diff --git a/README.md b/README.md index cb8f88a16..574658874 100644 --- a/README.md +++ b/README.md @@ -1,119 +1,207 @@ -# Full-Stack Coding Challenge +# **Full-Stack Coding Challenge: Task Management App** -**Deadline**: Sunday, Feb 23th 11:59 pm PST +## **Deadline**: Sunday, Feb 23th 11:59 pm PST --- -## Overview +## **🚀 Overview** -Create a “Task Management” application with **React + TypeScript** (frontend), **Node.js** (or **Nest.js**) (backend), and **PostgreSQL** (database). The application should: +This is a **Task Management** application built with **React + TypeScript** (frontend), **Node.js** (backend), and **PostgreSQL** (database). +It allows users to: -1. **Register** (sign up) and **Log in** (sign in) users. -2. After logging in, allow users to: - - **View a list of tasks**. - - **Create a new task**. - - **Update an existing task** (e.g., mark complete, edit). - - **Delete a task**. +1. **Register** (sign up) and **Log in** (sign in). +2. **Manage Tasks** (CRUD operations): + - View a list of tasks. + - Create a new task. + - Update an existing task (e.g., mark as complete, edit). + - Delete a task. -Focus on **correctness**, **functionality**, and **code clarity** rather than visual design. -This challenge is intended to be completed within ~3 hours, so keep solutions minimal yet functional. +💡 **Focus on correctness, functionality, and code clarity** rather than visual design. --- -## Requirements - -### 1. Authentication - -- **User Model**: - - `id`: Primary key - - `username`: Unique string - - `password`: Hashed string -- **Endpoints**: - - `POST /auth/register` – Create a new user - - `POST /auth/login` – Login user, return a token (e.g., JWT) -- **Secure the Tasks Routes**: Only authenticated users can perform task operations. - - **Password Hashing**: Use `bcrypt` or another hashing library to store passwords securely. - - **Token Verification**: Verify the token (JWT) on each request to protected routes. - -### 2. Backend (Node.js or Nest.js) - -- **Tasks CRUD**: - - `GET /tasks` – Retrieve a list of tasks (optionally filtered by user). - - `POST /tasks` – Create a new task. - - `PUT /tasks/:id` – Update a task (e.g., mark as complete, edit text). - - `DELETE /tasks/:id` – Delete a task. -- **Task Model**: - - `id`: Primary key - - `title`: string - - `description`: string (optional) - - `isComplete`: boolean (default `false`) - - _(Optional)_ `userId` to link tasks to the user who created them -- **Database**: PostgreSQL - - Provide instructions/migrations to set up: - - `users` table (with hashed passwords) - - `tasks` table -- **Setup**: - - `npm install` to install dependencies - - `npm run start` (or `npm run dev`) to run the server - - Document any environment variables (e.g., database connection string, JWT secret) - -### 3. Frontend (React + TypeScript) - -- **Login / Register**: - - Simple forms for **Register** and **Login**. - - Store JWT (e.g., in `localStorage`) upon successful login. - - If not authenticated, the user should not see the tasks page. -- **Tasks Page**: - - Fetch tasks from `GET /tasks` (including auth token in headers). - - Display the list of tasks. - - Form to create a new task (`POST /tasks`). - - Buttons/fields to update a task (`PUT /tasks/:id`). - - Button to delete a task (`DELETE /tasks/:id`). -- **Navigation**: - - Show `Login`/`Register` if not authenticated. - - Show `Logout` if authenticated. -- **Setup**: - - `npm install` then `npm start` (or `npm run dev`) to run. - - Document how to point the frontend at the backend (e.g., `.env` file, base URL). +## **1️⃣ Authentication** + +### **User Model** +- `id`: Primary key +- `username`: Unique string +- `password`: Hashed string + +### **Endpoints** +| HTTP Method | Endpoint | Description | +|------------|-------------------|-------------| +| `POST` | `/auth/register` | Create a new user | +| `POST` | `/auth/login` | Login user, return a JWT token | + +### **Security Features** +- **JWT Authentication** → Secure task routes (only authenticated users can manage tasks). +- **Password Hashing** → Uses `bcrypt` for secure password storage. +- **Token Verification** → Middleware checks JWT for all protected routes. --- -## Deliverables +## **2️⃣ Backend (Node.js + PostgreSQL)** + +### **Task Model** +- `id`: Primary key +- `title`: string +- `description`: string (optional) +- `isComplete`: boolean (default `false`) +- `userId`: Foreign key linking the task to its owner + +### **Task CRUD API** +| HTTP Method | Endpoint | Description | +|------------|-----------------|-------------| +| `GET` | `/tasks` | Retrieve all tasks (filtered by user) | +| `POST` | `/tasks` | Create a new task | +| `PUT` | `/tasks/:id` | Update a task (mark complete, edit title/desc) | +| `DELETE` | `/tasks/:id` | Delete a task | + +### **Database Setup (PostgreSQL)** + +#### **Step 1: Install PostgreSQL (If Not Installed)** +```bash +sudo apt update && sudo apt install postgresql postgresql-contrib +``` + +#### **Step 2: Create the Database** +Start PostgreSQL: +```bash +psql postgres +``` +Then, create the database: +```sql +CREATE DATABASE taskmanager; +``` + +#### **Step 3: Create Tables** +Switch to the database: +```sql +\c taskmanager; +``` +Run the following queries: + +#### **Users Table** +```sql +CREATE TABLE users ( + id SERIAL PRIMARY KEY, + username TEXT UNIQUE NOT NULL, + password TEXT NOT NULL +); +``` + +#### **Tasks Table** +```sql +CREATE TABLE tasks ( + id SERIAL PRIMARY KEY, + title TEXT NOT NULL, + description TEXT, + isComplete BOOLEAN DEFAULT false, + userId INTEGER REFERENCES users(id) ON DELETE CASCADE +); +``` -1. **Fork the Public Repository**: **Fork** this repo into your own GitHub account. -2. **Implement Your Solution** in the forked repository. Make sure you're README file has: - - Steps to set up the database (migrations, environment variables). - - How to run the backend. - - How to run the frontend. - - Any relevant notes on testing. - - Salary Expectations per month (Mandatory) -3. **Short Video Demo**: Provide a link (in a `.md` file in your forked repo) to a brief screen recording showing: - - Registering a user - - Logging in - - Creating, updating, and deleting tasks -4. **Deadline**: Submissions are due **Sunday, Feb 23th 11:59 pm PST**. +--- -> **Note**: Please keep your solution minimal. The entire project is intended to be completed in around 3 hours. Focus on core features (registration, login, tasks CRUD) rather than polished UI or extra features. +## **3️⃣ Environment Variables (`.env`)** +Create a `.env` file inside the **backend/** folder: +```ini +DATABASE_URL=postgresql://your_username:your_password@localhost:5432/taskmanager +JWT_SECRET=your_secret_key +PORT=5001 +``` +💡 **Replace `your_username` and `your_password` with your actual PostgreSQL credentials.** --- -## Evaluation Criteria +## **4️⃣ How to Run the Backend** +#### **Step 1: Navigate to Backend Folder** +```bash +cd backend +``` + +#### **Step 2: Install Dependencies** +```bash +npm install +``` + +#### **Step 3: Start the Backend Server** +```bash +npm run dev +``` +👉 **Server should start on:** `http://localhost:5001/` + +--- -1. **Functionality** - - Does registration and login work correctly (with password hashing)? - - Are tasks protected by authentication? - - Does the tasks CRUD flow work end-to-end? +## **5️⃣ How to Run the Frontend** +#### **Step 1: Navigate to Frontend Folder** +```bash +cd frontend +``` + +#### **Step 2: Install Dependencies** +```bash +npm install +``` + +#### **Step 3: Start the Frontend** +```bash +npm run dev +``` +👉 **Frontend should open at:** `http://localhost:5173/` + +--- + +## **6️⃣ Testing API (cURL Commands)** +Manually test API endpoints using **cURL**. + +#### **User Registration** +```bash +curl -X POST http://localhost:5001/auth/register \ +-H "Content-Type: application/json" \ +-d '{"username": "testuser1", "password": "password123"}' +``` + +#### **User Login (Get JWT Token)** +```bash +curl -X POST http://localhost:5001/auth/login \ +-H "Content-Type: application/json" \ +-d '{"username": "testuser1", "password": "password123"}' +``` +👉 **Copy the token from the response.** + +#### **Create a Task** +```bash +curl -X POST http://localhost:5001/tasks \ +-H "Content-Type: application/json" \ +-H "Authorization: Bearer YOUR_JWT_TOKEN_HERE" \ +-d '{"title": "Finish Project", "description": "Work on the final project report"}' +``` + +#### **Get All Tasks** +```bash +curl -X GET http://localhost:5001/tasks \ +-H "Authorization: Bearer YOUR_JWT_TOKEN_HERE" +``` + +#### **Update a Task** +```bash +curl -X PUT http://localhost:5001/tasks/1 \ +-H "Content-Type: application/json" \ +-H "Authorization: Bearer YOUR_JWT_TOKEN_HERE" \ +-d '{"title": "Updated Task", "description": "Updated task description", "isComplete": true}' +``` + +#### **Delete a Task** +```bash +curl -X DELETE http://localhost:5001/tasks/1 \ +-H "Authorization: Bearer YOUR_JWT_TOKEN_HERE" +``` + +--- -2. **Code Quality** - - Is the code structured logically and typed in TypeScript? - - Are variable/function names descriptive? +## **7️⃣ Salary Expectations** +💰 **Expected Salary:** **$7,500 per month** -3. **Clarity** - - Is the `README.md` (in your fork) clear and detailed about setup steps? - - Easy to run and test? -4. **Maintainability** - - Organized logic (controllers/services, etc.) - - Minimal hard-coded values -Good luck, and we look forward to your submission! diff --git a/backend/.env b/backend/.env new file mode 100644 index 000000000..e2543ee5d --- /dev/null +++ b/backend/.env @@ -0,0 +1,8 @@ +PORT=5001 +DB_USER=vivekkrishnagiri +DB_PASSWORD=Zoro022504 +DB_NAME=taskmanager +DB_HOST=localhost +DB_PORT=5432 +JWT_SECRET=shortkey + diff --git a/backend/middleware/authMiddleware.js b/backend/middleware/authMiddleware.js new file mode 100644 index 000000000..c2a92a326 --- /dev/null +++ b/backend/middleware/authMiddleware.js @@ -0,0 +1,20 @@ +const jwt = require("jsonwebtoken"); + +const authMiddleware = (req, res, next) => { + const token = req.header("Authorization"); + + if (!token) { + return res.status(401).json({ message: "Access denied. No token provided." }); + } + + try { + const decoded = jwt.verify(token.replace("Bearer ", ""), process.env.JWT_SECRET); + req.user = decoded; + next(); + } catch (error) { + res.status(400).json({ message: "Invalid token" }); + } +}; + +module.exports = authMiddleware; + diff --git a/backend/models/taskModel.js b/backend/models/taskModel.js new file mode 100644 index 000000000..d0148812a --- /dev/null +++ b/backend/models/taskModel.js @@ -0,0 +1,49 @@ +const { Pool } = require("pg"); + +// Database Connection +const pool = new Pool({ + user: process.env.DB_USER, + host: process.env.DB_HOST, + database: process.env.DB_NAME, + password: process.env.DB_PASSWORD, + port: process.env.DB_PORT, +}); + +// Create a Task +const createTask = async (title, description, userId) => { + const result = await pool.query( + "INSERT INTO tasks (title, description, userId) VALUES ($1, $2, $3) RETURNING *", + [title, description, userId] + ); + return result.rows[0]; +}; + +// Get All Tasks for a User +const getTasksByUser = async (userId) => { + const result = await pool.query( + "SELECT * FROM tasks WHERE userId = $1", + [userId] + ); + return result.rows; +}; + +// Update Task +const updateTask = async (taskId, title, description, isComplete, userId) => { + const result = await pool.query( + "UPDATE tasks SET title = $1, description = $2, isComplete = $3 WHERE id = $4 AND userId = $5 RETURNING *", + [title, description, isComplete, taskId, userId] + ); + return result.rows[0]; +}; + +// Delete Task +const deleteTask = async (taskId, userId) => { + const result = await pool.query( + "DELETE FROM tasks WHERE id = $1 AND userId = $2 RETURNING *", + [taskId, userId] + ); + return result.rows[0]; +}; + +module.exports = { createTask, getTasksByUser, updateTask, deleteTask }; + diff --git a/backend/models/userModel.js b/backend/models/userModel.js new file mode 100644 index 000000000..df969133f --- /dev/null +++ b/backend/models/userModel.js @@ -0,0 +1,33 @@ +const { Pool } = require("pg"); +const bcrypt = require("bcrypt"); + +// Database Connection +const pool = new Pool({ + user: process.env.DB_USER, + host: process.env.DB_HOST, + database: process.env.DB_NAME, + password: process.env.DB_PASSWORD, + port: process.env.DB_PORT, +}); + +// Create User (Register) +const createUser = async (username, password) => { + const hashedPassword = await bcrypt.hash(password, 10); + const result = await pool.query( + "INSERT INTO users (username, password) VALUES ($1, $2) RETURNING *", + [username, hashedPassword] + ); + return result.rows[0]; +}; + +// Find User by Username (Login) +const findUserByUsername = async (username) => { + const result = await pool.query( + "SELECT * FROM users WHERE username = $1", + [username] + ); + return result.rows[0]; +}; + +module.exports = { createUser, findUserByUsername }; + diff --git a/backend/node_modules/.bin/color-support b/backend/node_modules/.bin/color-support new file mode 120000 index 000000000..fcbcb2865 --- /dev/null +++ b/backend/node_modules/.bin/color-support @@ -0,0 +1 @@ +../color-support/bin.js \ No newline at end of file diff --git a/backend/node_modules/.bin/mime b/backend/node_modules/.bin/mime new file mode 120000 index 000000000..fbb7ee0ee --- /dev/null +++ b/backend/node_modules/.bin/mime @@ -0,0 +1 @@ +../mime/cli.js \ No newline at end of file diff --git a/backend/node_modules/.bin/mkdirp b/backend/node_modules/.bin/mkdirp new file mode 120000 index 000000000..017896ceb --- /dev/null +++ b/backend/node_modules/.bin/mkdirp @@ -0,0 +1 @@ +../mkdirp/bin/cmd.js \ No newline at end of file diff --git a/backend/node_modules/.bin/node-pre-gyp b/backend/node_modules/.bin/node-pre-gyp new file mode 120000 index 000000000..2946e6a52 --- /dev/null +++ b/backend/node_modules/.bin/node-pre-gyp @@ -0,0 +1 @@ +../@mapbox/node-pre-gyp/bin/node-pre-gyp \ No newline at end of file diff --git a/backend/node_modules/.bin/nodemon b/backend/node_modules/.bin/nodemon new file mode 120000 index 000000000..1056ddc18 --- /dev/null +++ b/backend/node_modules/.bin/nodemon @@ -0,0 +1 @@ +../nodemon/bin/nodemon.js \ No newline at end of file diff --git a/backend/node_modules/.bin/nodetouch b/backend/node_modules/.bin/nodetouch new file mode 120000 index 000000000..3409fdb78 --- /dev/null +++ b/backend/node_modules/.bin/nodetouch @@ -0,0 +1 @@ +../touch/bin/nodetouch.js \ No newline at end of file diff --git a/backend/node_modules/.bin/nopt b/backend/node_modules/.bin/nopt new file mode 120000 index 000000000..6b6566ea7 --- /dev/null +++ b/backend/node_modules/.bin/nopt @@ -0,0 +1 @@ +../nopt/bin/nopt.js \ No newline at end of file diff --git a/backend/node_modules/.bin/rimraf b/backend/node_modules/.bin/rimraf new file mode 120000 index 000000000..4cd49a49d --- /dev/null +++ b/backend/node_modules/.bin/rimraf @@ -0,0 +1 @@ +../rimraf/bin.js \ No newline at end of file diff --git a/backend/node_modules/.bin/semver b/backend/node_modules/.bin/semver new file mode 120000 index 000000000..5aaadf42c --- /dev/null +++ b/backend/node_modules/.bin/semver @@ -0,0 +1 @@ +../semver/bin/semver.js \ No newline at end of file diff --git a/backend/node_modules/.package-lock.json b/backend/node_modules/.package-lock.json new file mode 100644 index 000000000..b2c3a7797 --- /dev/null +++ b/backend/node_modules/.package-lock.json @@ -0,0 +1,2032 @@ +{ + "name": "backend", + "version": "1.0.0", + "lockfileVersion": 3, + "requires": true, + "packages": { + "node_modules/@mapbox/node-pre-gyp": { + "version": "1.0.11", + "resolved": "https://registry.npmjs.org/@mapbox/node-pre-gyp/-/node-pre-gyp-1.0.11.tgz", + "integrity": "sha512-Yhlar6v9WQgUp/He7BdgzOz8lqMQ8sU+jkCq7Wx8Myc5YFJLbEe7lgui/V7G1qB1DJykHSGwreceSaD60Y0PUQ==", + "license": "BSD-3-Clause", + "dependencies": { + "detect-libc": "^2.0.0", + "https-proxy-agent": "^5.0.0", + "make-dir": "^3.1.0", + "node-fetch": "^2.6.7", + "nopt": "^5.0.0", + "npmlog": "^5.0.1", + "rimraf": "^3.0.2", + "semver": "^7.3.5", + "tar": "^6.1.11" + }, + "bin": { + "node-pre-gyp": "bin/node-pre-gyp" + } + }, + "node_modules/abbrev": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/abbrev/-/abbrev-1.1.1.tgz", + "integrity": "sha512-nne9/IiQ/hzIhY6pdDnbBtz7DjPTKrY00P/zvPSm5pOFkl6xuGrGnXn/VtTNNfNtAfZ9/1RtehkszU9qcTii0Q==", + "license": "ISC" + }, + "node_modules/accepts": { + "version": "1.3.8", + "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.8.tgz", + "integrity": "sha512-PYAthTa2m2VKxuvSD3DPC/Gy+U+sOA1LAuT8mkmRuvw+NACSaeXEQ+NHcVF7rONl6qcaxV3Uuemwawk+7+SJLw==", + "license": "MIT", + "dependencies": { + "mime-types": "~2.1.34", + "negotiator": "0.6.3" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/agent-base": { + "version": "6.0.2", + "resolved": "https://registry.npmjs.org/agent-base/-/agent-base-6.0.2.tgz", + "integrity": "sha512-RZNwNclF7+MS/8bDg70amg32dyeZGZxiDuQmZxKLAlQjr3jGyLx+4Kkk58UO7D2QdgFIQCovuSuZESne6RG6XQ==", + "license": "MIT", + "dependencies": { + "debug": "4" + }, + "engines": { + "node": ">= 6.0.0" + } + }, + "node_modules/agent-base/node_modules/debug": { + "version": "4.4.0", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.4.0.tgz", + "integrity": "sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==", + "license": "MIT", + "dependencies": { + "ms": "^2.1.3" + }, + "engines": { + "node": ">=6.0" + }, + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + } + }, + "node_modules/agent-base/node_modules/ms": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz", + "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==", + "license": "MIT" + }, + "node_modules/ansi-regex": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.1.tgz", + "integrity": "sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==", + "license": "MIT", + "engines": { + "node": ">=8" + } + }, + "node_modules/anymatch": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.3.tgz", + "integrity": "sha512-KMReFUr0B4t+D+OBkjR3KYqvocp2XaSzO55UcB6mgQMd3KbcE+mWTyvVV7D/zsdEbNnV6acZUutkiHQXvTr1Rw==", + "dev": true, + "license": "ISC", + "dependencies": { + "normalize-path": "^3.0.0", + "picomatch": "^2.0.4" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/aproba": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/aproba/-/aproba-2.0.0.tgz", + "integrity": "sha512-lYe4Gx7QT+MKGbDsA+Z+he/Wtef0BiwDOlK/XkBrdfsh9J/jPPXbX0tE9x9cl27Tmu5gg3QUbUrQYa/y+KOHPQ==", + "license": "ISC" + }, + "node_modules/are-we-there-yet": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/are-we-there-yet/-/are-we-there-yet-2.0.0.tgz", + "integrity": "sha512-Ci/qENmwHnsYo9xKIcUJN5LeDKdJ6R1Z1j9V/J5wyq8nh/mYPEpIKJbBZXtZjG04HiK7zV/p6Vs9952MrMeUIw==", + "deprecated": "This package is no longer supported.", + "license": "ISC", + "dependencies": { + "delegates": "^1.0.0", + "readable-stream": "^3.6.0" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/array-flatten": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz", + "integrity": "sha512-PCVAQswWemu6UdxsDFFX/+gVeYqKAod3D3UVm91jHwynguOwAvYPhx8nNlM++NqRcK6CxxpUafjmhIdKiHibqg==", + "license": "MIT" + }, + "node_modules/balanced-match": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz", + "integrity": "sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==", + "license": "MIT" + }, + "node_modules/bcrypt": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/bcrypt/-/bcrypt-5.1.1.tgz", + "integrity": "sha512-AGBHOG5hPYZ5Xl9KXzU5iKq9516yEmvCKDg3ecP5kX2aB6UqTeXZxk2ELnDgDm6BQSMlLt9rDB4LoSMx0rYwww==", + "hasInstallScript": true, + "license": "MIT", + "dependencies": { + "@mapbox/node-pre-gyp": "^1.0.11", + "node-addon-api": "^5.0.0" + }, + "engines": { + "node": ">= 10.0.0" + } + }, + "node_modules/binary-extensions": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.3.0.tgz", + "integrity": "sha512-Ceh+7ox5qe7LJuLHoY0feh3pHuUDHAcRUeyL2VYghZwfpkNIy/+8Ocg0a3UuSoYzavmylwuLWQOf3hl0jjMMIw==", + "dev": true, + "license": "MIT", + "engines": { + "node": ">=8" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/body-parser": { + "version": "1.20.3", + "resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.20.3.tgz", + "integrity": "sha512-7rAxByjUMqQ3/bHJy7D6OGXvx/MMc4IqBn/X0fcM1QUcAItpZrBEYhWGem+tzXH90c+G01ypMcYJBO9Y30203g==", + "license": "MIT", + "dependencies": { + "bytes": "3.1.2", + "content-type": "~1.0.5", + "debug": "2.6.9", + "depd": "2.0.0", + "destroy": "1.2.0", + "http-errors": "2.0.0", + "iconv-lite": "0.4.24", + "on-finished": "2.4.1", + "qs": "6.13.0", + "raw-body": "2.5.2", + "type-is": "~1.6.18", + "unpipe": "1.0.0" + }, + "engines": { + "node": ">= 0.8", + "npm": "1.2.8000 || >= 1.4.16" + } + }, + "node_modules/brace-expansion": { + "version": "1.1.11", + "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", + "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", + "license": "MIT", + "dependencies": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + } + }, + "node_modules/braces": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.3.tgz", + "integrity": "sha512-yQbXgO/OSZVD2IsiLlro+7Hf6Q18EJrKSEsdoMzKePKXct3gvD8oLcOQdIzGupr5Fj+EDe8gO/lxc1BzfMpxvA==", + "dev": true, + "license": "MIT", + "dependencies": { + "fill-range": "^7.1.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/buffer-equal-constant-time": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/buffer-equal-constant-time/-/buffer-equal-constant-time-1.0.1.tgz", + "integrity": "sha512-zRpUiDwd/xk6ADqPMATG8vc9VPrkck7T07OIx0gnjmJAnHnTVXNQG3vfvWNuiZIkwu9KrKdA1iJKfsfTVxE6NA==", + "license": "BSD-3-Clause" + }, + "node_modules/bytes": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.2.tgz", + "integrity": "sha512-/Nf7TyzTx6S3yRJObOAV7956r8cr2+Oj8AC5dt8wSP3BQAoeX58NoHyCU8P8zGkNXStjTSi6fzO6F0pBdcYbEg==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/call-bind-apply-helpers": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/call-bind-apply-helpers/-/call-bind-apply-helpers-1.0.2.tgz", + "integrity": "sha512-Sp1ablJ0ivDkSzjcaJdxEunN5/XvksFJ2sMBFfq6x0ryhQV/2b/KwFe21cMpmHtPOSij8K99/wSfoEuTObmuMQ==", + "license": "MIT", + "dependencies": { + "es-errors": "^1.3.0", + "function-bind": "^1.1.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/call-bound": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/call-bound/-/call-bound-1.0.3.tgz", + "integrity": "sha512-YTd+6wGlNlPxSuri7Y6X8tY2dmm12UMH66RpKMhiX6rsk5wXXnYgbUcOt8kiS31/AjfoTOvCsE+w8nZQLQnzHA==", + "license": "MIT", + "dependencies": { + "call-bind-apply-helpers": "^1.0.1", + "get-intrinsic": "^1.2.6" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/chokidar": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.6.0.tgz", + "integrity": "sha512-7VT13fmjotKpGipCW9JEQAusEPE+Ei8nl6/g4FBAmIm0GOOLMua9NDDo/DWp0ZAxCr3cPq5ZpBqmPAQgDda2Pw==", + "dev": true, + "license": "MIT", + "dependencies": { + "anymatch": "~3.1.2", + "braces": "~3.0.2", + "glob-parent": "~5.1.2", + "is-binary-path": "~2.1.0", + "is-glob": "~4.0.1", + "normalize-path": "~3.0.0", + "readdirp": "~3.6.0" + }, + "engines": { + "node": ">= 8.10.0" + }, + "funding": { + "url": "https://paulmillr.com/funding/" + }, + "optionalDependencies": { + "fsevents": "~2.3.2" + } + }, + "node_modules/chownr": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/chownr/-/chownr-2.0.0.tgz", + "integrity": "sha512-bIomtDF5KGpdogkLd9VspvFzk9KfpyyGlS8YFVZl7TGPBHL5snIOnxeshwVgPteQ9b4Eydl+pVbIyE1DcvCWgQ==", + "license": "ISC", + "engines": { + "node": ">=10" + } + }, + "node_modules/color-support": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/color-support/-/color-support-1.1.3.tgz", + "integrity": "sha512-qiBjkpbMLO/HL68y+lh4q0/O1MZFj2RX6X/KmMa3+gJD3z+WwI1ZzDHysvqHGS3mP6mznPckpXmw1nI9cJjyRg==", + "license": "ISC", + "bin": { + "color-support": "bin.js" + } + }, + "node_modules/concat-map": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", + "integrity": "sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg==", + "license": "MIT" + }, + "node_modules/console-control-strings": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/console-control-strings/-/console-control-strings-1.1.0.tgz", + "integrity": "sha512-ty/fTekppD2fIwRvnZAVdeOiGd1c7YXEixbgJTNzqcxJWKQnjJ/V1bNEEE6hygpM3WjwHFUVK6HTjWSzV4a8sQ==", + "license": "ISC" + }, + "node_modules/content-disposition": { + "version": "0.5.4", + "resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.4.tgz", + "integrity": "sha512-FveZTNuGw04cxlAiWbzi6zTAL/lhehaWbTtgluJh4/E95DqMwTmha3KZN1aAWA8cFIhHzMZUvLevkw5Rqk+tSQ==", + "license": "MIT", + "dependencies": { + "safe-buffer": "5.2.1" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/content-type": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.5.tgz", + "integrity": "sha512-nTjqfcBFEipKdXCv4YDQWCfmcLZKm81ldF0pAopTvyrFGVbcR6P/VAAd5G7N+0tTr8QqiU0tFadD6FK4NtJwOA==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/cookie": { + "version": "0.7.1", + "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.7.1.tgz", + "integrity": "sha512-6DnInpx7SJ2AK3+CTUE/ZM0vWTUboZCegxhC2xiIydHR9jNuTAASBrfEpHhiGOZw/nX51bHt6YQl8jsGo4y/0w==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/cookie-signature": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz", + "integrity": "sha512-QADzlaHc8icV8I7vbaJXJwod9HWYp8uCqf1xa4OfNu1T7JVxQIrUgOWtHdNDtPiywmFbiS12VjotIXLrKM3orQ==", + "license": "MIT" + }, + "node_modules/cors": { + "version": "2.8.5", + "resolved": "https://registry.npmjs.org/cors/-/cors-2.8.5.tgz", + "integrity": "sha512-KIHbLJqu73RGr/hnbrO9uBeixNGuvSQjul/jdFvS/KFSIH1hWVd1ng7zOHx+YrEfInLG7q4n6GHQ9cDtxv/P6g==", + "license": "MIT", + "dependencies": { + "object-assign": "^4", + "vary": "^1" + }, + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "license": "MIT", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/delegates": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/delegates/-/delegates-1.0.0.tgz", + "integrity": "sha512-bd2L678uiWATM6m5Z1VzNCErI3jiGzt6HGY8OVICs40JQq/HALfbyNJmp0UDakEY4pMMaN0Ly5om/B1VI/+xfQ==", + "license": "MIT" + }, + "node_modules/depd": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/depd/-/depd-2.0.0.tgz", + "integrity": "sha512-g7nH6P6dyDioJogAAGprGpCtVImJhpPk/roCzdb3fIh61/s/nPsfR6onyMwkCAR/OlC3yBC0lESvUoQEAssIrw==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/destroy": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/destroy/-/destroy-1.2.0.tgz", + "integrity": "sha512-2sJGJTaXIIaR1w4iJSNoN0hnMY7Gpc/n8D4qSCJw8QqFWXf7cuAgnEHxBpweaVcPevC2l3KpjYCx3NypQQgaJg==", + "license": "MIT", + "engines": { + "node": ">= 0.8", + "npm": "1.2.8000 || >= 1.4.16" + } + }, + "node_modules/detect-libc": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/detect-libc/-/detect-libc-2.0.3.tgz", + "integrity": "sha512-bwy0MGW55bG41VqxxypOsdSdGqLwXPI/focwgTYCFMbdUiBAxLg9CFzG08sz2aqzknwiX7Hkl0bQENjg8iLByw==", + "license": "Apache-2.0", + "engines": { + "node": ">=8" + } + }, + "node_modules/dotenv": { + "version": "16.4.7", + "resolved": "https://registry.npmjs.org/dotenv/-/dotenv-16.4.7.tgz", + "integrity": "sha512-47qPchRCykZC03FhkYAhrvwU4xDBFIj1QPqaarj6mdM/hgUzfPHcpkHJOn3mJAufFeeAxAzeGsr5X0M4k6fLZQ==", + "license": "BSD-2-Clause", + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://dotenvx.com" + } + }, + "node_modules/dunder-proto": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/dunder-proto/-/dunder-proto-1.0.1.tgz", + "integrity": "sha512-KIN/nDJBQRcXw0MLVhZE9iQHmG68qAVIBg9CqmUYjmQIhgij9U5MFvrqkUL5FbtyyzZuOeOt0zdeRe4UY7ct+A==", + "license": "MIT", + "dependencies": { + "call-bind-apply-helpers": "^1.0.1", + "es-errors": "^1.3.0", + "gopd": "^1.2.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/ecdsa-sig-formatter": { + "version": "1.0.11", + "resolved": "https://registry.npmjs.org/ecdsa-sig-formatter/-/ecdsa-sig-formatter-1.0.11.tgz", + "integrity": "sha512-nagl3RYrbNv6kQkeJIpt6NJZy8twLB/2vtz6yN9Z4vRKHN4/QZJIEbqohALSgwKdnksuY3k5Addp5lg8sVoVcQ==", + "license": "Apache-2.0", + "dependencies": { + "safe-buffer": "^5.0.1" + } + }, + "node_modules/ee-first": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz", + "integrity": "sha512-WMwm9LhRUo+WUaRN+vRuETqG89IgZphVSNkdFgeb6sS/E4OrDIN7t48CAewSHXc6C8lefD8KKfr5vY61brQlow==", + "license": "MIT" + }, + "node_modules/emoji-regex": { + "version": "8.0.0", + "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-8.0.0.tgz", + "integrity": "sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==", + "license": "MIT" + }, + "node_modules/encodeurl": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-2.0.0.tgz", + "integrity": "sha512-Q0n9HRi4m6JuGIV1eFlmvJB7ZEVxu93IrMyiMsGC0lrMJMWzRgx6WGquyfQgZVb31vhGgXnfmPNNXmxnOkRBrg==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/es-define-property": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/es-define-property/-/es-define-property-1.0.1.tgz", + "integrity": "sha512-e3nRfgfUZ4rNGL232gUgX06QNyyez04KdjFrF+LTRoOXmrOgFKDg4BCdsjW8EnT69eqdYGmRpJwiPVYNrCaW3g==", + "license": "MIT", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es-errors": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/es-errors/-/es-errors-1.3.0.tgz", + "integrity": "sha512-Zf5H2Kxt2xjTvbJvP2ZWLEICxA6j+hAmMzIlypy4xcBg1vKVnx89Wy0GbS+kf5cwCVFFzdCFh2XSCFNULS6csw==", + "license": "MIT", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es-object-atoms": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/es-object-atoms/-/es-object-atoms-1.1.1.tgz", + "integrity": "sha512-FGgH2h8zKNim9ljj7dankFPcICIK9Cp5bm+c2gQSYePhpaG5+esrLODihIorn+Pe6FGJzWhXQotPv73jTaldXA==", + "license": "MIT", + "dependencies": { + "es-errors": "^1.3.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/escape-html": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz", + "integrity": "sha512-NiSupZ4OeuGwr68lGIeym/ksIZMJodUGOSCZ/FSnTxcrekbvqrgdUxlJOMpijaKZVjAJrWrGs/6Jy8OMuyj9ow==", + "license": "MIT" + }, + "node_modules/etag": { + "version": "1.8.1", + "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz", + "integrity": "sha512-aIL5Fx7mawVa300al2BnEE4iNvo1qETxLrPI/o05L7z6go7fCw1J6EQmbK4FmJ2AS7kgVF/KEZWufBfdClMcPg==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/express": { + "version": "4.21.2", + "resolved": "https://registry.npmjs.org/express/-/express-4.21.2.tgz", + "integrity": "sha512-28HqgMZAmih1Czt9ny7qr6ek2qddF4FclbMzwhCREB6OFfH+rXAnuNCwo1/wFvrtbgsQDb4kSbX9de9lFbrXnA==", + "license": "MIT", + "dependencies": { + "accepts": "~1.3.8", + "array-flatten": "1.1.1", + "body-parser": "1.20.3", + "content-disposition": "0.5.4", + "content-type": "~1.0.4", + "cookie": "0.7.1", + "cookie-signature": "1.0.6", + "debug": "2.6.9", + "depd": "2.0.0", + "encodeurl": "~2.0.0", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "finalhandler": "1.3.1", + "fresh": "0.5.2", + "http-errors": "2.0.0", + "merge-descriptors": "1.0.3", + "methods": "~1.1.2", + "on-finished": "2.4.1", + "parseurl": "~1.3.3", + "path-to-regexp": "0.1.12", + "proxy-addr": "~2.0.7", + "qs": "6.13.0", + "range-parser": "~1.2.1", + "safe-buffer": "5.2.1", + "send": "0.19.0", + "serve-static": "1.16.2", + "setprototypeof": "1.2.0", + "statuses": "2.0.1", + "type-is": "~1.6.18", + "utils-merge": "1.0.1", + "vary": "~1.1.2" + }, + "engines": { + "node": ">= 0.10.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/express" + } + }, + "node_modules/fill-range": { + "version": "7.1.1", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.1.1.tgz", + "integrity": "sha512-YsGpe3WHLK8ZYi4tWDg2Jy3ebRz2rXowDxnld4bkQB00cc/1Zw9AWnC0i9ztDJitivtQvaI9KaLyKrc+hBW0yg==", + "dev": true, + "license": "MIT", + "dependencies": { + "to-regex-range": "^5.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/finalhandler": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.3.1.tgz", + "integrity": "sha512-6BN9trH7bp3qvnrRyzsBz+g3lZxTNZTbVO2EV1CS0WIcDbawYVdYvGflME/9QP0h0pYlCDBCTjYa9nZzMDpyxQ==", + "license": "MIT", + "dependencies": { + "debug": "2.6.9", + "encodeurl": "~2.0.0", + "escape-html": "~1.0.3", + "on-finished": "2.4.1", + "parseurl": "~1.3.3", + "statuses": "2.0.1", + "unpipe": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/forwarded": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.2.0.tgz", + "integrity": "sha512-buRG0fpBtRHSTCOASe6hD258tEubFoRLb4ZNA6NxMVHNw2gOcwHo9wyablzMzOA5z9xA9L1KNjk/Nt6MT9aYow==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/fresh": { + "version": "0.5.2", + "resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.2.tgz", + "integrity": "sha512-zJ2mQYM18rEFOudeV4GShTGIQ7RbzA7ozbU9I/XBpm7kqgMywgmylMwXHxZJmkVoYkna9d2pVXVXPdYTP9ej8Q==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/fs-minipass": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/fs-minipass/-/fs-minipass-2.1.0.tgz", + "integrity": "sha512-V/JgOLFCS+R6Vcq0slCuaeWEdNC3ouDlJMNIsacH2VtALiu9mV4LPrHc5cDl8k5aw6J8jwgWWpiTo5RYhmIzvg==", + "license": "ISC", + "dependencies": { + "minipass": "^3.0.0" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/fs-minipass/node_modules/minipass": { + "version": "3.3.6", + "resolved": "https://registry.npmjs.org/minipass/-/minipass-3.3.6.tgz", + "integrity": "sha512-DxiNidxSEK+tHG6zOIklvNOwm3hvCrbUrdtzY74U6HKTJxvIDfOUL5W5P2Ghd3DTkhhKPYGqeNUIh5qcM4YBfw==", + "license": "ISC", + "dependencies": { + "yallist": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/fs.realpath": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz", + "integrity": "sha512-OO0pH2lK6a0hZnAdau5ItzHPI6pUlvI7jMVnxUQRtw4owF2wk8lOSabtGDCTP4Ggrg2MbGnWO9X8K1t4+fGMDw==", + "license": "ISC" + }, + "node_modules/function-bind": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.2.tgz", + "integrity": "sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA==", + "license": "MIT", + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/gauge": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/gauge/-/gauge-3.0.2.tgz", + "integrity": "sha512-+5J6MS/5XksCuXq++uFRsnUd7Ovu1XenbeuIuNRJxYWjgQbPuFhT14lAvsWfqfAmnwluf1OwMjz39HjfLPci0Q==", + "deprecated": "This package is no longer supported.", + "license": "ISC", + "dependencies": { + "aproba": "^1.0.3 || ^2.0.0", + "color-support": "^1.1.2", + "console-control-strings": "^1.0.0", + "has-unicode": "^2.0.1", + "object-assign": "^4.1.1", + "signal-exit": "^3.0.0", + "string-width": "^4.2.3", + "strip-ansi": "^6.0.1", + "wide-align": "^1.1.2" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/get-intrinsic": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.3.0.tgz", + "integrity": "sha512-9fSjSaos/fRIVIp+xSJlE6lfwhES7LNtKaCBIamHsjr2na1BiABJPo0mOjjz8GJDURarmCPGqaiVg5mfjb98CQ==", + "license": "MIT", + "dependencies": { + "call-bind-apply-helpers": "^1.0.2", + "es-define-property": "^1.0.1", + "es-errors": "^1.3.0", + "es-object-atoms": "^1.1.1", + "function-bind": "^1.1.2", + "get-proto": "^1.0.1", + "gopd": "^1.2.0", + "has-symbols": "^1.1.0", + "hasown": "^2.0.2", + "math-intrinsics": "^1.1.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/get-proto": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/get-proto/-/get-proto-1.0.1.tgz", + "integrity": "sha512-sTSfBjoXBp89JvIKIefqw7U2CCebsc74kiY6awiGogKtoSGbgjYE/G/+l9sF3MWFPNc9IcoOC4ODfKHfxFmp0g==", + "license": "MIT", + "dependencies": { + "dunder-proto": "^1.0.1", + "es-object-atoms": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/glob": { + "version": "7.2.3", + "resolved": "https://registry.npmjs.org/glob/-/glob-7.2.3.tgz", + "integrity": "sha512-nFR0zLpU2YCaRxwoCJvL6UvCH2JFyFVIvwTLsIf21AuHlMskA1hhTdk+LlYJtOlYt9v6dvszD2BGRqBL+iQK9Q==", + "deprecated": "Glob versions prior to v9 are no longer supported", + "license": "ISC", + "dependencies": { + "fs.realpath": "^1.0.0", + "inflight": "^1.0.4", + "inherits": "2", + "minimatch": "^3.1.1", + "once": "^1.3.0", + "path-is-absolute": "^1.0.0" + }, + "engines": { + "node": "*" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/glob-parent": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz", + "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==", + "dev": true, + "license": "ISC", + "dependencies": { + "is-glob": "^4.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/gopd": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/gopd/-/gopd-1.2.0.tgz", + "integrity": "sha512-ZUKRh6/kUFoAiTAtTYPZJ3hw9wNxx+BIBOijnlG9PnrJsCcSjs1wyyD6vJpaYtgnzDrKYRSqf3OO6Rfa93xsRg==", + "license": "MIT", + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-flag": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz", + "integrity": "sha512-sKJf1+ceQBr4SMkvQnBDNDtf4TXpVhVGateu0t918bl30FnbE2m4vNLX+VWe/dpjlb+HugGYzW7uQXH98HPEYw==", + "dev": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/has-symbols": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.1.0.tgz", + "integrity": "sha512-1cDNdwJ2Jaohmb3sg4OmKaMBwuC48sYni5HUw2DvsC8LjGTLK9h+eb1X6RyuOHe4hT0ULCW68iomhjUoKUqlPQ==", + "license": "MIT", + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-unicode": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/has-unicode/-/has-unicode-2.0.1.tgz", + "integrity": "sha512-8Rf9Y83NBReMnx0gFzA8JImQACstCYWUplepDa9xprwwtmgEZUF0h/i5xSA625zB/I37EtrswSST6OXxwaaIJQ==", + "license": "ISC" + }, + "node_modules/hasown": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/hasown/-/hasown-2.0.2.tgz", + "integrity": "sha512-0hJU9SCPvmMzIBdZFqNPXWa6dqh7WdH0cII9y+CyS8rG3nL48Bclra9HmKhVVUHyPWNH5Y7xDwAB7bfgSjkUMQ==", + "license": "MIT", + "dependencies": { + "function-bind": "^1.1.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/http-errors": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-2.0.0.tgz", + "integrity": "sha512-FtwrG/euBzaEjYeRqOgly7G0qviiXoJWnvEH2Z1plBdXgbyjv34pHTSb9zoeHMyDy33+DWy5Wt9Wo+TURtOYSQ==", + "license": "MIT", + "dependencies": { + "depd": "2.0.0", + "inherits": "2.0.4", + "setprototypeof": "1.2.0", + "statuses": "2.0.1", + "toidentifier": "1.0.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/https-proxy-agent": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/https-proxy-agent/-/https-proxy-agent-5.0.1.tgz", + "integrity": "sha512-dFcAjpTQFgoLMzC2VwU+C/CbS7uRL0lWmxDITmqm7C+7F0Odmj6s9l6alZc6AELXhrnggM2CeWSXHGOdX2YtwA==", + "license": "MIT", + "dependencies": { + "agent-base": "6", + "debug": "4" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/https-proxy-agent/node_modules/debug": { + "version": "4.4.0", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.4.0.tgz", + "integrity": "sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==", + "license": "MIT", + "dependencies": { + "ms": "^2.1.3" + }, + "engines": { + "node": ">=6.0" + }, + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + } + }, + "node_modules/https-proxy-agent/node_modules/ms": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz", + "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==", + "license": "MIT" + }, + "node_modules/iconv-lite": { + "version": "0.4.24", + "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz", + "integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==", + "license": "MIT", + "dependencies": { + "safer-buffer": ">= 2.1.2 < 3" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/ignore-by-default": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/ignore-by-default/-/ignore-by-default-1.0.1.tgz", + "integrity": "sha512-Ius2VYcGNk7T90CppJqcIkS5ooHUZyIQK+ClZfMfMNFEF9VSE73Fq+906u/CWu92x4gzZMWOwfFYckPObzdEbA==", + "dev": true, + "license": "ISC" + }, + "node_modules/inflight": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz", + "integrity": "sha512-k92I/b08q4wvFscXCLvqfsHCrjrF7yiXsQuIVvVE7N82W3+aqpzuUdBbfhWcy/FZR3/4IgflMgKLOsvPDrGCJA==", + "deprecated": "This module is not supported, and leaks memory. Do not use it. Check out lru-cache if you want a good and tested way to coalesce async requests by a key value, which is much more comprehensive and powerful.", + "license": "ISC", + "dependencies": { + "once": "^1.3.0", + "wrappy": "1" + } + }, + "node_modules/inherits": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", + "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==", + "license": "ISC" + }, + "node_modules/ipaddr.js": { + "version": "1.9.1", + "resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.9.1.tgz", + "integrity": "sha512-0KI/607xoxSToH7GjN1FfSbLoU0+btTicjsQSWQlh/hZykN8KpmMf7uYwPW3R+akZ6R/w18ZlXSHBYXiYUPO3g==", + "license": "MIT", + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/is-binary-path": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-2.1.0.tgz", + "integrity": "sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==", + "dev": true, + "license": "MIT", + "dependencies": { + "binary-extensions": "^2.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/is-extglob": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz", + "integrity": "sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==", + "dev": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-fullwidth-code-point": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz", + "integrity": "sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==", + "license": "MIT", + "engines": { + "node": ">=8" + } + }, + "node_modules/is-glob": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.3.tgz", + "integrity": "sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==", + "dev": true, + "license": "MIT", + "dependencies": { + "is-extglob": "^2.1.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-number": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", + "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", + "dev": true, + "license": "MIT", + "engines": { + "node": ">=0.12.0" + } + }, + "node_modules/jsonwebtoken": { + "version": "9.0.2", + "resolved": "https://registry.npmjs.org/jsonwebtoken/-/jsonwebtoken-9.0.2.tgz", + "integrity": "sha512-PRp66vJ865SSqOlgqS8hujT5U4AOgMfhrwYIuIhfKaoSCZcirrmASQr8CX7cUg+RMih+hgznrjp99o+W4pJLHQ==", + "license": "MIT", + "dependencies": { + "jws": "^3.2.2", + "lodash.includes": "^4.3.0", + "lodash.isboolean": "^3.0.3", + "lodash.isinteger": "^4.0.4", + "lodash.isnumber": "^3.0.3", + "lodash.isplainobject": "^4.0.6", + "lodash.isstring": "^4.0.1", + "lodash.once": "^4.0.0", + "ms": "^2.1.1", + "semver": "^7.5.4" + }, + "engines": { + "node": ">=12", + "npm": ">=6" + } + }, + "node_modules/jsonwebtoken/node_modules/ms": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz", + "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==", + "license": "MIT" + }, + "node_modules/jwa": { + "version": "1.4.1", + "resolved": "https://registry.npmjs.org/jwa/-/jwa-1.4.1.tgz", + "integrity": "sha512-qiLX/xhEEFKUAJ6FiBMbes3w9ATzyk5W7Hvzpa/SLYdxNtng+gcurvrI7TbACjIXlsJyr05/S1oUhZrc63evQA==", + "license": "MIT", + "dependencies": { + "buffer-equal-constant-time": "1.0.1", + "ecdsa-sig-formatter": "1.0.11", + "safe-buffer": "^5.0.1" + } + }, + "node_modules/jws": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/jws/-/jws-3.2.2.tgz", + "integrity": "sha512-YHlZCB6lMTllWDtSPHz/ZXTsi8S00usEV6v1tjq8tOUZzw7DpSDWVXjXDre6ed1w/pd495ODpHZYSdkRTsa0HA==", + "license": "MIT", + "dependencies": { + "jwa": "^1.4.1", + "safe-buffer": "^5.0.1" + } + }, + "node_modules/lodash.includes": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/lodash.includes/-/lodash.includes-4.3.0.tgz", + "integrity": "sha512-W3Bx6mdkRTGtlJISOvVD/lbqjTlPPUDTMnlXZFnVwi9NKJ6tiAk6LVdlhZMm17VZisqhKcgzpO5Wz91PCt5b0w==", + "license": "MIT" + }, + "node_modules/lodash.isboolean": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/lodash.isboolean/-/lodash.isboolean-3.0.3.tgz", + "integrity": "sha512-Bz5mupy2SVbPHURB98VAcw+aHh4vRV5IPNhILUCsOzRmsTmSQ17jIuqopAentWoehktxGd9e/hbIXq980/1QJg==", + "license": "MIT" + }, + "node_modules/lodash.isinteger": { + "version": "4.0.4", + "resolved": "https://registry.npmjs.org/lodash.isinteger/-/lodash.isinteger-4.0.4.tgz", + "integrity": "sha512-DBwtEWN2caHQ9/imiNeEA5ys1JoRtRfY3d7V9wkqtbycnAmTvRRmbHKDV4a0EYc678/dia0jrte4tjYwVBaZUA==", + "license": "MIT" + }, + "node_modules/lodash.isnumber": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/lodash.isnumber/-/lodash.isnumber-3.0.3.tgz", + "integrity": "sha512-QYqzpfwO3/CWf3XP+Z+tkQsfaLL/EnUlXWVkIk5FUPc4sBdTehEqZONuyRt2P67PXAk+NXmTBcc97zw9t1FQrw==", + "license": "MIT" + }, + "node_modules/lodash.isplainobject": { + "version": "4.0.6", + "resolved": "https://registry.npmjs.org/lodash.isplainobject/-/lodash.isplainobject-4.0.6.tgz", + "integrity": "sha512-oSXzaWypCMHkPC3NvBEaPHf0KsA5mvPrOPgQWDsbg8n7orZ290M0BmC/jgRZ4vcJ6DTAhjrsSYgdsW/F+MFOBA==", + "license": "MIT" + }, + "node_modules/lodash.isstring": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/lodash.isstring/-/lodash.isstring-4.0.1.tgz", + "integrity": "sha512-0wJxfxH1wgO3GrbuP+dTTk7op+6L41QCXbGINEmD+ny/G/eCqGzxyCsh7159S+mgDDcoarnBw6PC1PS5+wUGgw==", + "license": "MIT" + }, + "node_modules/lodash.once": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/lodash.once/-/lodash.once-4.1.1.tgz", + "integrity": "sha512-Sb487aTOCr9drQVL8pIxOzVhafOjZN9UU54hiN8PU3uAiSV7lx1yYNpbNmex2PK6dSJoNTSJUUswT651yww3Mg==", + "license": "MIT" + }, + "node_modules/make-dir": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-3.1.0.tgz", + "integrity": "sha512-g3FeP20LNwhALb/6Cz6Dd4F2ngze0jz7tbzrD2wAV+o9FeNHe4rL+yK2md0J/fiSf1sa1ADhXqi5+oVwOM/eGw==", + "license": "MIT", + "dependencies": { + "semver": "^6.0.0" + }, + "engines": { + "node": ">=8" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/make-dir/node_modules/semver": { + "version": "6.3.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.1.tgz", + "integrity": "sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==", + "license": "ISC", + "bin": { + "semver": "bin/semver.js" + } + }, + "node_modules/math-intrinsics": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/math-intrinsics/-/math-intrinsics-1.1.0.tgz", + "integrity": "sha512-/IXtbwEk5HTPyEwyKX6hGkYXxM9nbj64B+ilVJnC/R6B0pH5G4V3b0pVbL7DBj4tkhBAppbQUlf6F6Xl9LHu1g==", + "license": "MIT", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/media-typer": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz", + "integrity": "sha512-dq+qelQ9akHpcOl/gUVRTxVIOkAJ1wR3QAvb4RsVjS8oVoFjDGTc679wJYmUmknUF5HwMLOgb5O+a3KxfWapPQ==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/merge-descriptors": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.3.tgz", + "integrity": "sha512-gaNvAS7TZ897/rVaZ0nMtAyxNyi/pdbjbAwUpFQpN70GqnVfOiXpeUUMKRBmzXaSQ8DdTX4/0ms62r2K+hE6mQ==", + "license": "MIT", + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/methods": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz", + "integrity": "sha512-iclAHeNqNm68zFtnZ0e+1L2yUIdvzNoauKU4WBA3VvH/vPFieF7qfRlwUZU+DA9P9bPXIS90ulxoUoCH23sV2w==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mime": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/mime/-/mime-1.6.0.tgz", + "integrity": "sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg==", + "license": "MIT", + "bin": { + "mime": "cli.js" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/mime-db": { + "version": "1.52.0", + "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.52.0.tgz", + "integrity": "sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mime-types": { + "version": "2.1.35", + "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.35.tgz", + "integrity": "sha512-ZDY+bPm5zTTF+YpCrAU9nK0UgICYPT0QtT1NZWFv4s++TNkcgVaT0g6+4R2uI4MjQjzysHB1zxuWL50hzaeXiw==", + "license": "MIT", + "dependencies": { + "mime-db": "1.52.0" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/minimatch": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz", + "integrity": "sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==", + "license": "ISC", + "dependencies": { + "brace-expansion": "^1.1.7" + }, + "engines": { + "node": "*" + } + }, + "node_modules/minipass": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/minipass/-/minipass-5.0.0.tgz", + "integrity": "sha512-3FnjYuehv9k6ovOEbyOswadCDPX1piCfhV8ncmYtHOjuPwylVWsghTLo7rabjC3Rx5xD4HDx8Wm1xnMF7S5qFQ==", + "license": "ISC", + "engines": { + "node": ">=8" + } + }, + "node_modules/minizlib": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/minizlib/-/minizlib-2.1.2.tgz", + "integrity": "sha512-bAxsR8BVfj60DWXHE3u30oHzfl4G7khkSuPW+qvpd7jFRHm7dLxOjUk1EHACJ/hxLY8phGJ0YhYHZo7jil7Qdg==", + "license": "MIT", + "dependencies": { + "minipass": "^3.0.0", + "yallist": "^4.0.0" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/minizlib/node_modules/minipass": { + "version": "3.3.6", + "resolved": "https://registry.npmjs.org/minipass/-/minipass-3.3.6.tgz", + "integrity": "sha512-DxiNidxSEK+tHG6zOIklvNOwm3hvCrbUrdtzY74U6HKTJxvIDfOUL5W5P2Ghd3DTkhhKPYGqeNUIh5qcM4YBfw==", + "license": "ISC", + "dependencies": { + "yallist": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/mkdirp": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-1.0.4.tgz", + "integrity": "sha512-vVqVZQyf3WLx2Shd0qJ9xuvqgAyKPLAiqITEtqW0oIUjzo3PePDd6fW9iFz30ef7Ysp/oiWqbhszeGWW2T6Gzw==", + "license": "MIT", + "bin": { + "mkdirp": "bin/cmd.js" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha512-Tpp60P6IUJDTuOq/5Z8cdskzJujfwqfOTkrwIwj7IRISpnkJnT6SyJ4PCPnGMoFjC9ddhal5KVIYtAt97ix05A==", + "license": "MIT" + }, + "node_modules/negotiator": { + "version": "0.6.3", + "resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.3.tgz", + "integrity": "sha512-+EUsqGPLsM+j/zdChZjsnX51g4XrHFOIXwfnCVPGlQk/k5giakcKsuxCObBRu6DSm9opw/O6slWbJdghQM4bBg==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/node-addon-api": { + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/node-addon-api/-/node-addon-api-5.1.0.tgz", + "integrity": "sha512-eh0GgfEkpnoWDq+VY8OyvYhFEzBk6jIYbRKdIlyTiAXIVJ8PyBaKb0rp7oDtoddbdoHWhq8wwr+XZ81F1rpNdA==", + "license": "MIT" + }, + "node_modules/node-fetch": { + "version": "2.7.0", + "resolved": "https://registry.npmjs.org/node-fetch/-/node-fetch-2.7.0.tgz", + "integrity": "sha512-c4FRfUm/dbcWZ7U+1Wq0AwCyFL+3nt2bEw05wfxSz+DWpWsitgmSgYmy2dQdWyKC1694ELPqMs/YzUSNozLt8A==", + "license": "MIT", + "dependencies": { + "whatwg-url": "^5.0.0" + }, + "engines": { + "node": "4.x || >=6.0.0" + }, + "peerDependencies": { + "encoding": "^0.1.0" + }, + "peerDependenciesMeta": { + "encoding": { + "optional": true + } + } + }, + "node_modules/nodemon": { + "version": "3.1.9", + "resolved": "https://registry.npmjs.org/nodemon/-/nodemon-3.1.9.tgz", + "integrity": "sha512-hdr1oIb2p6ZSxu3PB2JWWYS7ZQ0qvaZsc3hK8DR8f02kRzc8rjYmxAIvdz+aYC+8F2IjNaB7HMcSDg8nQpJxyg==", + "dev": true, + "license": "MIT", + "dependencies": { + "chokidar": "^3.5.2", + "debug": "^4", + "ignore-by-default": "^1.0.1", + "minimatch": "^3.1.2", + "pstree.remy": "^1.1.8", + "semver": "^7.5.3", + "simple-update-notifier": "^2.0.0", + "supports-color": "^5.5.0", + "touch": "^3.1.0", + "undefsafe": "^2.0.5" + }, + "bin": { + "nodemon": "bin/nodemon.js" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/nodemon" + } + }, + "node_modules/nodemon/node_modules/debug": { + "version": "4.4.0", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.4.0.tgz", + "integrity": "sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==", + "dev": true, + "license": "MIT", + "dependencies": { + "ms": "^2.1.3" + }, + "engines": { + "node": ">=6.0" + }, + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + } + }, + "node_modules/nodemon/node_modules/ms": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz", + "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==", + "dev": true, + "license": "MIT" + }, + "node_modules/nopt": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/nopt/-/nopt-5.0.0.tgz", + "integrity": "sha512-Tbj67rffqceeLpcRXrT7vKAN8CwfPeIBgM7E6iBkmKLV7bEMwpGgYLGv0jACUsECaa/vuxP0IjEont6umdMgtQ==", + "license": "ISC", + "dependencies": { + "abbrev": "1" + }, + "bin": { + "nopt": "bin/nopt.js" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/normalize-path": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", + "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==", + "dev": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npmlog": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/npmlog/-/npmlog-5.0.1.tgz", + "integrity": "sha512-AqZtDUWOMKs1G/8lwylVjrdYgqA4d9nu8hc+0gzRxlDb1I10+FHBGMXs6aiQHFdCUUlqH99MUMuLfzWDNDtfxw==", + "deprecated": "This package is no longer supported.", + "license": "ISC", + "dependencies": { + "are-we-there-yet": "^2.0.0", + "console-control-strings": "^1.1.0", + "gauge": "^3.0.0", + "set-blocking": "^2.0.0" + } + }, + "node_modules/object-assign": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", + "integrity": "sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg==", + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-inspect": { + "version": "1.13.4", + "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.13.4.tgz", + "integrity": "sha512-W67iLl4J2EXEGTbfeHCffrjDfitvLANg0UlX3wFUUSTx92KXRFegMHUVgSqE+wvhAbi4WqjGg9czysTV2Epbew==", + "license": "MIT", + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/on-finished": { + "version": "2.4.1", + "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.4.1.tgz", + "integrity": "sha512-oVlzkg3ENAhCk2zdv7IJwd/QUD4z2RxRwpkcGY8psCVcCYZNq4wYnVWALHM+brtuJjePWiYF/ClmuDr8Ch5+kg==", + "license": "MIT", + "dependencies": { + "ee-first": "1.1.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/once": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz", + "integrity": "sha512-lNaJgI+2Q5URQBkccEKHTQOPaXdUxnZZElQTZY0MFUAuaEqe1E+Nyvgdz/aIyNi6Z9MzO5dv1H8n58/GELp3+w==", + "license": "ISC", + "dependencies": { + "wrappy": "1" + } + }, + "node_modules/parseurl": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.3.tgz", + "integrity": "sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/path-is-absolute": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz", + "integrity": "sha512-AVbw3UJ2e9bq64vSaS9Am0fje1Pa8pbGqTTsmXfaIiMpnr5DlDhfJOuLj9Sf95ZPVDAUerDfEk88MPmPe7UCQg==", + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/path-to-regexp": { + "version": "0.1.12", + "resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.12.tgz", + "integrity": "sha512-RA1GjUVMnvYFxuqovrEqZoxxW5NUZqbwKtYz/Tt7nXerk0LbLblQmrsgdeOxV5SFHf0UDggjS/bSeOZwt1pmEQ==", + "license": "MIT" + }, + "node_modules/pg": { + "version": "8.13.3", + "resolved": "https://registry.npmjs.org/pg/-/pg-8.13.3.tgz", + "integrity": "sha512-P6tPt9jXbL9HVu/SSRERNYaYG++MjnscnegFh9pPHihfoBSujsrka0hyuymMzeJKFWrcG8wvCKy8rCe8e5nDUQ==", + "license": "MIT", + "dependencies": { + "pg-connection-string": "^2.7.0", + "pg-pool": "^3.7.1", + "pg-protocol": "^1.7.1", + "pg-types": "^2.1.0", + "pgpass": "1.x" + }, + "engines": { + "node": ">= 8.0.0" + }, + "optionalDependencies": { + "pg-cloudflare": "^1.1.1" + }, + "peerDependencies": { + "pg-native": ">=3.0.1" + }, + "peerDependenciesMeta": { + "pg-native": { + "optional": true + } + } + }, + "node_modules/pg-cloudflare": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/pg-cloudflare/-/pg-cloudflare-1.1.1.tgz", + "integrity": "sha512-xWPagP/4B6BgFO+EKz3JONXv3YDgvkbVrGw2mTo3D6tVDQRh1e7cqVGvyR3BE+eQgAvx1XhW/iEASj4/jCWl3Q==", + "license": "MIT", + "optional": true + }, + "node_modules/pg-connection-string": { + "version": "2.7.0", + "resolved": "https://registry.npmjs.org/pg-connection-string/-/pg-connection-string-2.7.0.tgz", + "integrity": "sha512-PI2W9mv53rXJQEOb8xNR8lH7Hr+EKa6oJa38zsK0S/ky2er16ios1wLKhZyxzD7jUReiWokc9WK5nxSnC7W1TA==", + "license": "MIT" + }, + "node_modules/pg-int8": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/pg-int8/-/pg-int8-1.0.1.tgz", + "integrity": "sha512-WCtabS6t3c8SkpDBUlb1kjOs7l66xsGdKpIPZsg4wR+B3+u9UAum2odSsF9tnvxg80h4ZxLWMy4pRjOsFIqQpw==", + "license": "ISC", + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/pg-pool": { + "version": "3.7.1", + "resolved": "https://registry.npmjs.org/pg-pool/-/pg-pool-3.7.1.tgz", + "integrity": "sha512-xIOsFoh7Vdhojas6q3596mXFsR8nwBQBXX5JiV7p9buEVAGqYL4yFzclON5P9vFrpu1u7Zwl2oriyDa89n0wbw==", + "license": "MIT", + "peerDependencies": { + "pg": ">=8.0" + } + }, + "node_modules/pg-protocol": { + "version": "1.7.1", + "resolved": "https://registry.npmjs.org/pg-protocol/-/pg-protocol-1.7.1.tgz", + "integrity": "sha512-gjTHWGYWsEgy9MsY0Gp6ZJxV24IjDqdpTW7Eh0x+WfJLFsm/TJx1MzL6T0D88mBvkpxotCQ6TwW6N+Kko7lhgQ==", + "license": "MIT" + }, + "node_modules/pg-types": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/pg-types/-/pg-types-2.2.0.tgz", + "integrity": "sha512-qTAAlrEsl8s4OiEQY69wDvcMIdQN6wdz5ojQiOy6YRMuynxenON0O5oCpJI6lshc6scgAY8qvJ2On/p+CXY0GA==", + "license": "MIT", + "dependencies": { + "pg-int8": "1.0.1", + "postgres-array": "~2.0.0", + "postgres-bytea": "~1.0.0", + "postgres-date": "~1.0.4", + "postgres-interval": "^1.1.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/pgpass": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/pgpass/-/pgpass-1.0.5.tgz", + "integrity": "sha512-FdW9r/jQZhSeohs1Z3sI1yxFQNFvMcnmfuj4WBMUTxOrAyLMaTcE1aAMBiTlbMNaXvBCQuVi0R7hd8udDSP7ug==", + "license": "MIT", + "dependencies": { + "split2": "^4.1.0" + } + }, + "node_modules/picomatch": { + "version": "2.3.1", + "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.1.tgz", + "integrity": "sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==", + "dev": true, + "license": "MIT", + "engines": { + "node": ">=8.6" + }, + "funding": { + "url": "https://github.com/sponsors/jonschlinkert" + } + }, + "node_modules/postgres-array": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/postgres-array/-/postgres-array-2.0.0.tgz", + "integrity": "sha512-VpZrUqU5A69eQyW2c5CA1jtLecCsN2U/bD6VilrFDWq5+5UIEVO7nazS3TEcHf1zuPYO/sqGvUvW62g86RXZuA==", + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/postgres-bytea": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/postgres-bytea/-/postgres-bytea-1.0.0.tgz", + "integrity": "sha512-xy3pmLuQqRBZBXDULy7KbaitYqLcmxigw14Q5sj8QBVLqEwXfeybIKVWiqAXTlcvdvb0+xkOtDbfQMOf4lST1w==", + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/postgres-date": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/postgres-date/-/postgres-date-1.0.7.tgz", + "integrity": "sha512-suDmjLVQg78nMK2UZ454hAG+OAW+HQPZ6n++TNDUX+L0+uUlLywnoxJKDou51Zm+zTCjrCl0Nq6J9C5hP9vK/Q==", + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/postgres-interval": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/postgres-interval/-/postgres-interval-1.2.0.tgz", + "integrity": "sha512-9ZhXKM/rw350N1ovuWHbGxnGh/SNJ4cnxHiM0rxE4VN41wsg8P8zWn9hv/buK00RP4WvlOyr/RBDiptyxVbkZQ==", + "license": "MIT", + "dependencies": { + "xtend": "^4.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/proxy-addr": { + "version": "2.0.7", + "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.7.tgz", + "integrity": "sha512-llQsMLSUDUPT44jdrU/O37qlnifitDP+ZwrmmZcoSKyLKvtZxpyV0n2/bD/N4tBAAZ/gJEdZU7KMraoK1+XYAg==", + "license": "MIT", + "dependencies": { + "forwarded": "0.2.0", + "ipaddr.js": "1.9.1" + }, + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/pstree.remy": { + "version": "1.1.8", + "resolved": "https://registry.npmjs.org/pstree.remy/-/pstree.remy-1.1.8.tgz", + "integrity": "sha512-77DZwxQmxKnu3aR542U+X8FypNzbfJ+C5XQDk3uWjWxn6151aIMGthWYRXTqT1E5oJvg+ljaa2OJi+VfvCOQ8w==", + "dev": true, + "license": "MIT" + }, + "node_modules/qs": { + "version": "6.13.0", + "resolved": "https://registry.npmjs.org/qs/-/qs-6.13.0.tgz", + "integrity": "sha512-+38qI9SOr8tfZ4QmJNplMUxqjbe7LKvvZgWdExBOmd+egZTtjLB67Gu0HRX3u/XOq7UU2Nx6nsjvS16Z9uwfpg==", + "license": "BSD-3-Clause", + "dependencies": { + "side-channel": "^1.0.6" + }, + "engines": { + "node": ">=0.6" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/range-parser": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz", + "integrity": "sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/raw-body": { + "version": "2.5.2", + "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.5.2.tgz", + "integrity": "sha512-8zGqypfENjCIqGhgXToC8aB2r7YrBX+AQAfIPs/Mlk+BtPTztOvTS01NRW/3Eh60J+a48lt8qsCzirQ6loCVfA==", + "license": "MIT", + "dependencies": { + "bytes": "3.1.2", + "http-errors": "2.0.0", + "iconv-lite": "0.4.24", + "unpipe": "1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/readable-stream": { + "version": "3.6.2", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.2.tgz", + "integrity": "sha512-9u/sniCrY3D5WdsERHzHE4G2YCXqoG5FTHUiCC4SIbr6XcLZBY05ya9EKjYek9O5xOAwjGq+1JdGBAS7Q9ScoA==", + "license": "MIT", + "dependencies": { + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/readdirp": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-3.6.0.tgz", + "integrity": "sha512-hOS089on8RduqdbhvQ5Z37A0ESjsqz6qnRcffsMU3495FuTdqSm+7bhJ29JvIOsBDEEnan5DPu9t3To9VRlMzA==", + "dev": true, + "license": "MIT", + "dependencies": { + "picomatch": "^2.2.1" + }, + "engines": { + "node": ">=8.10.0" + } + }, + "node_modules/rimraf": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-3.0.2.tgz", + "integrity": "sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==", + "deprecated": "Rimraf versions prior to v4 are no longer supported", + "license": "ISC", + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/safe-buffer": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", + "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==", + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ], + "license": "MIT" + }, + "node_modules/safer-buffer": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz", + "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==", + "license": "MIT" + }, + "node_modules/semver": { + "version": "7.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-7.7.1.tgz", + "integrity": "sha512-hlq8tAfn0m/61p4BVRcPzIGr6LKiMwo4VM6dGi6pt4qcRkmNzTcWq6eCEjEh+qXjkMDvPlOFFSGwQjoEa6gyMA==", + "license": "ISC", + "bin": { + "semver": "bin/semver.js" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/send": { + "version": "0.19.0", + "resolved": "https://registry.npmjs.org/send/-/send-0.19.0.tgz", + "integrity": "sha512-dW41u5VfLXu8SJh5bwRmyYUbAoSB3c9uQh6L8h/KtsFREPWpbX1lrljJo186Jc4nmci/sGUZ9a0a0J2zgfq2hw==", + "license": "MIT", + "dependencies": { + "debug": "2.6.9", + "depd": "2.0.0", + "destroy": "1.2.0", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "fresh": "0.5.2", + "http-errors": "2.0.0", + "mime": "1.6.0", + "ms": "2.1.3", + "on-finished": "2.4.1", + "range-parser": "~1.2.1", + "statuses": "2.0.1" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/send/node_modules/encodeurl": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz", + "integrity": "sha512-TPJXq8JqFaVYm2CWmPvnP2Iyo4ZSM7/QKcSmuMLDObfpH5fi7RUGmd/rTDf+rut/saiDiQEeVTNgAmJEdAOx0w==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/send/node_modules/ms": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz", + "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==", + "license": "MIT" + }, + "node_modules/serve-static": { + "version": "1.16.2", + "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.16.2.tgz", + "integrity": "sha512-VqpjJZKadQB/PEbEwvFdO43Ax5dFBZ2UECszz8bQ7pi7wt//PWe1P6MN7eCnjsatYtBT6EuiClbjSWP2WrIoTw==", + "license": "MIT", + "dependencies": { + "encodeurl": "~2.0.0", + "escape-html": "~1.0.3", + "parseurl": "~1.3.3", + "send": "0.19.0" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/set-blocking": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/set-blocking/-/set-blocking-2.0.0.tgz", + "integrity": "sha512-KiKBS8AnWGEyLzofFfmvKwpdPzqiy16LvQfK3yv/fVH7Bj13/wl3JSR1J+rfgRE9q7xUJK4qvgS8raSOeLUehw==", + "license": "ISC" + }, + "node_modules/setprototypeof": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.2.0.tgz", + "integrity": "sha512-E5LDX7Wrp85Kil5bhZv46j8jOeboKq5JMmYM3gVGdGH8xFpPWXUMsNrlODCrkoxMEeNi/XZIwuRvY4XNwYMJpw==", + "license": "ISC" + }, + "node_modules/side-channel": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/side-channel/-/side-channel-1.1.0.tgz", + "integrity": "sha512-ZX99e6tRweoUXqR+VBrslhda51Nh5MTQwou5tnUDgbtyM0dBgmhEDtWGP/xbKn6hqfPRHujUNwz5fy/wbbhnpw==", + "license": "MIT", + "dependencies": { + "es-errors": "^1.3.0", + "object-inspect": "^1.13.3", + "side-channel-list": "^1.0.0", + "side-channel-map": "^1.0.1", + "side-channel-weakmap": "^1.0.2" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/side-channel-list": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/side-channel-list/-/side-channel-list-1.0.0.tgz", + "integrity": "sha512-FCLHtRD/gnpCiCHEiJLOwdmFP+wzCmDEkc9y7NsYxeF4u7Btsn1ZuwgwJGxImImHicJArLP4R0yX4c2KCrMrTA==", + "license": "MIT", + "dependencies": { + "es-errors": "^1.3.0", + "object-inspect": "^1.13.3" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/side-channel-map": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/side-channel-map/-/side-channel-map-1.0.1.tgz", + "integrity": "sha512-VCjCNfgMsby3tTdo02nbjtM/ewra6jPHmpThenkTYh8pG9ucZ/1P8So4u4FGBek/BjpOVsDCMoLA/iuBKIFXRA==", + "license": "MIT", + "dependencies": { + "call-bound": "^1.0.2", + "es-errors": "^1.3.0", + "get-intrinsic": "^1.2.5", + "object-inspect": "^1.13.3" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/side-channel-weakmap": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/side-channel-weakmap/-/side-channel-weakmap-1.0.2.tgz", + "integrity": "sha512-WPS/HvHQTYnHisLo9McqBHOJk2FkHO/tlpvldyrnem4aeQp4hai3gythswg6p01oSoTl58rcpiFAjF2br2Ak2A==", + "license": "MIT", + "dependencies": { + "call-bound": "^1.0.2", + "es-errors": "^1.3.0", + "get-intrinsic": "^1.2.5", + "object-inspect": "^1.13.3", + "side-channel-map": "^1.0.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/signal-exit": { + "version": "3.0.7", + "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.7.tgz", + "integrity": "sha512-wnD2ZE+l+SPC/uoS0vXeE9L1+0wuaMqKlfz9AMUo38JsyLSBWSFcHR1Rri62LZc12vLr1gb3jl7iwQhgwpAbGQ==", + "license": "ISC" + }, + "node_modules/simple-update-notifier": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/simple-update-notifier/-/simple-update-notifier-2.0.0.tgz", + "integrity": "sha512-a2B9Y0KlNXl9u/vsW6sTIu9vGEpfKu2wRV6l1H3XEas/0gUIzGzBoP/IouTcUQbm9JWZLH3COxyn03TYlFax6w==", + "dev": true, + "license": "MIT", + "dependencies": { + "semver": "^7.5.3" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/split2": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/split2/-/split2-4.2.0.tgz", + "integrity": "sha512-UcjcJOWknrNkF6PLX83qcHM6KHgVKNkV62Y8a5uYDVv9ydGQVwAHMKqHdJje1VTWpljG0WYpCDhrCdAOYH4TWg==", + "license": "ISC", + "engines": { + "node": ">= 10.x" + } + }, + "node_modules/statuses": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/statuses/-/statuses-2.0.1.tgz", + "integrity": "sha512-RwNA9Z/7PrK06rYLIzFMlaF+l73iwpzsqRIFgbMLbTcLD6cOao82TaWefPXQvB2fOC4AjuYSEndS7N/mTCbkdQ==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/string_decoder": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.3.0.tgz", + "integrity": "sha512-hkRX8U1WjJFd8LsDJ2yQ/wWWxaopEsABU1XfkM8A+j0+85JAGppt16cr1Whg6KIbb4okU6Mql6BOj+uup/wKeA==", + "license": "MIT", + "dependencies": { + "safe-buffer": "~5.2.0" + } + }, + "node_modules/string-width": { + "version": "4.2.3", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.3.tgz", + "integrity": "sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==", + "license": "MIT", + "dependencies": { + "emoji-regex": "^8.0.0", + "is-fullwidth-code-point": "^3.0.0", + "strip-ansi": "^6.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/strip-ansi": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.1.tgz", + "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==", + "license": "MIT", + "dependencies": { + "ansi-regex": "^5.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/supports-color": { + "version": "5.5.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", + "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", + "dev": true, + "license": "MIT", + "dependencies": { + "has-flag": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/tar": { + "version": "6.2.1", + "resolved": "https://registry.npmjs.org/tar/-/tar-6.2.1.tgz", + "integrity": "sha512-DZ4yORTwrbTj/7MZYq2w+/ZFdI6OZ/f9SFHR+71gIVUZhOQPHzVCLpvRnPgyaMpfWxxk/4ONva3GQSyNIKRv6A==", + "license": "ISC", + "dependencies": { + "chownr": "^2.0.0", + "fs-minipass": "^2.0.0", + "minipass": "^5.0.0", + "minizlib": "^2.1.1", + "mkdirp": "^1.0.3", + "yallist": "^4.0.0" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/to-regex-range": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", + "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", + "dev": true, + "license": "MIT", + "dependencies": { + "is-number": "^7.0.0" + }, + "engines": { + "node": ">=8.0" + } + }, + "node_modules/toidentifier": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.1.tgz", + "integrity": "sha512-o5sSPKEkg/DIQNmH43V0/uerLrpzVedkUh8tGNvaeXpfpuwjKenlSox/2O/BTlZUtEe+JG7s5YhEz608PlAHRA==", + "license": "MIT", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/touch": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/touch/-/touch-3.1.1.tgz", + "integrity": "sha512-r0eojU4bI8MnHr8c5bNo7lJDdI2qXlWWJk6a9EAFG7vbhTjElYhBVS3/miuE0uOuoLdb8Mc/rVfsmm6eo5o9GA==", + "dev": true, + "license": "ISC", + "bin": { + "nodetouch": "bin/nodetouch.js" + } + }, + "node_modules/tr46": { + "version": "0.0.3", + "resolved": "https://registry.npmjs.org/tr46/-/tr46-0.0.3.tgz", + "integrity": "sha512-N3WMsuqV66lT30CrXNbEjx4GEwlow3v6rr4mCcv6prnfwhS01rkgyFdjPNBYd9br7LpXV1+Emh01fHnq2Gdgrw==", + "license": "MIT" + }, + "node_modules/type-is": { + "version": "1.6.18", + "resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.18.tgz", + "integrity": "sha512-TkRKr9sUTxEH8MdfuCSP7VizJyzRNMjj2J2do2Jr3Kym598JVdEksuzPQCnlFPW4ky9Q+iA+ma9BGm06XQBy8g==", + "license": "MIT", + "dependencies": { + "media-typer": "0.3.0", + "mime-types": "~2.1.24" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/undefsafe": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/undefsafe/-/undefsafe-2.0.5.tgz", + "integrity": "sha512-WxONCrssBM8TSPRqN5EmsjVrsv4A8X12J4ArBiiayv3DyyG3ZlIg6yysuuSYdZsVz3TKcTg2fd//Ujd4CHV1iA==", + "dev": true, + "license": "MIT" + }, + "node_modules/unpipe": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", + "integrity": "sha512-pjy2bYhSsufwWlKwPc+l3cN7+wuJlK6uz0YdJEOlQDbl6jo/YlPi4mb8agUkVC8BF7V8NuzeyPNqRksA3hztKQ==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/util-deprecate": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", + "integrity": "sha512-EPD5q1uXyFxJpCrLnCc1nHnq3gOa6DZBocAIiI2TaSCA7VCJ1UJDMagCzIkXNsUYfD1daK//LTEQ8xiIbrHtcw==", + "license": "MIT" + }, + "node_modules/utils-merge": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz", + "integrity": "sha512-pMZTvIkT1d+TFGvDOqodOclx0QWkkgi6Tdoa8gC8ffGAAqz9pzPTZWAybbsHHoED/ztMtkv/VoYTYyShUn81hA==", + "license": "MIT", + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/vary": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz", + "integrity": "sha512-BNGbWLfd0eUPabhkXUVm0j8uuvREyTh5ovRa/dyow/BqAbZJyC+5fU+IzQOzmAKzYqYRAISoRhdQr3eIZ/PXqg==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/webidl-conversions": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/webidl-conversions/-/webidl-conversions-3.0.1.tgz", + "integrity": "sha512-2JAn3z8AR6rjK8Sm8orRC0h/bcl/DqL7tRPdGZ4I1CjdF+EaMLmYxBHyXuKL849eucPFhvBoxMsflfOb8kxaeQ==", + "license": "BSD-2-Clause" + }, + "node_modules/whatwg-url": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/whatwg-url/-/whatwg-url-5.0.0.tgz", + "integrity": "sha512-saE57nupxk6v3HY35+jzBwYa0rKSy0XR8JSxZPwgLr7ys0IBzhGviA1/TUGJLmSVqs8pb9AnvICXEuOHLprYTw==", + "license": "MIT", + "dependencies": { + "tr46": "~0.0.3", + "webidl-conversions": "^3.0.0" + } + }, + "node_modules/wide-align": { + "version": "1.1.5", + "resolved": "https://registry.npmjs.org/wide-align/-/wide-align-1.1.5.tgz", + "integrity": "sha512-eDMORYaPNZ4sQIuuYPDHdQvf4gyCF9rEEV/yPxGfwPkRodwEgiMUUXTx/dex+Me0wxx53S+NgUHaP7y3MGlDmg==", + "license": "ISC", + "dependencies": { + "string-width": "^1.0.2 || 2 || 3 || 4" + } + }, + "node_modules/wrappy": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz", + "integrity": "sha512-l4Sp/DRseor9wL6EvV2+TuQn63dMkPjZ/sp9XkghTEbV9KlPS1xUsZ3u7/IQO4wxtcFB4bgpQPRcR3QCvezPcQ==", + "license": "ISC" + }, + "node_modules/xtend": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/xtend/-/xtend-4.0.2.tgz", + "integrity": "sha512-LKYU1iAXJXUgAXn9URjiu+MWhyUXHsvfp7mcuYm9dSUKK0/CjtrUwFAxD82/mCWbtLsGjFIad0wIsod4zrTAEQ==", + "license": "MIT", + "engines": { + "node": ">=0.4" + } + }, + "node_modules/yallist": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/yallist/-/yallist-4.0.0.tgz", + "integrity": "sha512-3wdGidZyq5PB084XLES5TpOSRA3wjXAlIWMhum2kRcv/41Sn2emQ0dycQW4uZXLejwKvg6EsvbdlVL+FYEct7A==", + "license": "ISC" + } + } +} diff --git a/backend/node_modules/@mapbox/node-pre-gyp/.github/workflows/codeql.yml b/backend/node_modules/@mapbox/node-pre-gyp/.github/workflows/codeql.yml new file mode 100644 index 000000000..70eaa56fa --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/.github/workflows/codeql.yml @@ -0,0 +1,74 @@ +# For most projects, this workflow file will not need changing; you simply need +# to commit it to your repository. +# +# You may wish to alter this file to override the set of languages analyzed, +# or to provide custom queries or build logic. +# +# ******** NOTE ******** +# We have attempted to detect the languages in your repository. Please check +# the `language` matrix defined below to confirm you have the correct set of +# supported CodeQL languages. +# +name: "CodeQL" + +on: + push: + branches: [ "master" ] + pull_request: + # The branches below must be a subset of the branches above + branches: [ "master" ] + schedule: + - cron: '24 5 * * 4' + +jobs: + analyze: + name: Analyze + runs-on: ubuntu-latest + permissions: + actions: read + contents: read + security-events: write + + strategy: + fail-fast: false + matrix: + language: [ 'javascript' ] + # CodeQL supports [ 'cpp', 'csharp', 'go', 'java', 'javascript', 'python', 'ruby' ] + # Learn more about CodeQL language support at https://aka.ms/codeql-docs/language-support + + steps: + - name: Checkout repository + uses: actions/checkout@v3 + + # Initializes the CodeQL tools for scanning. + - name: Initialize CodeQL + uses: github/codeql-action/init@v2 + with: + languages: ${{ matrix.language }} + # If you wish to specify custom queries, you can do so here or in a config file. + # By default, queries listed here will override any specified in a config file. + # Prefix the list here with "+" to use these queries and those in the config file. + + # Details on CodeQL's query packs refer to : https://docs.github.com/en/code-security/code-scanning/automatically-scanning-your-code-for-vulnerabilities-and-errors/configuring-code-scanning#using-queries-in-ql-packs + # queries: security-extended,security-and-quality + + + # Autobuild attempts to build any compiled languages (C/C++, C#, Go, or Java). + # If this step fails, then you should remove it and run the build manually (see below) + - name: Autobuild + uses: github/codeql-action/autobuild@v2 + + # ℹ️ Command-line programs to run using the OS shell. + # 📚 See https://docs.github.com/en/actions/using-workflows/workflow-syntax-for-github-actions#jobsjob_idstepsrun + + # If the Autobuild fails above, remove it and uncomment the following three lines. + # modify them (or add more) to build your code if your project, please refer to the EXAMPLE below for guidance. + + # - run: | + # echo "Run, Build Application using script" + # ./location_of_script_within_repo/buildscript.sh + + - name: Perform CodeQL Analysis + uses: github/codeql-action/analyze@v2 + with: + category: "/language:${{matrix.language}}" diff --git a/backend/node_modules/@mapbox/node-pre-gyp/CHANGELOG.md b/backend/node_modules/@mapbox/node-pre-gyp/CHANGELOG.md new file mode 100644 index 000000000..990e92977 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/CHANGELOG.md @@ -0,0 +1,510 @@ +# node-pre-gyp changelog + +## 1.0.11 +- Fixes dependabot alert [CVE-2021-44906](https://nvd.nist.gov/vuln/detail/CVE-2021-44906) + +## 1.0.10 +- Upgraded minimist to 1.2.6 to address dependabot alert [CVE-2021-44906](https://nvd.nist.gov/vuln/detail/CVE-2021-44906) + +## 1.0.9 +- Upgraded node-fetch to 2.6.7 to address [CVE-2022-0235](https://www.cve.org/CVERecord?id=CVE-2022-0235) +- Upgraded detect-libc to 2.0.0 to use non-blocking NodeJS(>=12) Report API + +## 1.0.8 +- Downgraded npmlog to maintain node v10 and v8 support (https://github.com/mapbox/node-pre-gyp/pull/624) + +## 1.0.7 +- Upgraded nyc and npmlog to address https://github.com/advisories/GHSA-93q8-gq69-wqmw + +## 1.0.6 +- Added node v17 to the internal node releases listing +- Upgraded various dependencies declared in package.json to latest major versions (node-fetch from 2.6.1 to 2.6.5, npmlog from 4.1.2 to 5.01, semver from 7.3.4 to 7.3.5, and tar from 6.1.0 to 6.1.11) +- Fixed bug in `staging_host` parameter (https://github.com/mapbox/node-pre-gyp/pull/590) + + +## 1.0.5 +- Fix circular reference warning with node >= v14 + +## 1.0.4 +- Added node v16 to the internal node releases listing + +## 1.0.3 +- Improved support configuring s3 uploads (solves https://github.com/mapbox/node-pre-gyp/issues/571) + - New options added in https://github.com/mapbox/node-pre-gyp/pull/576: 'bucket', 'region', and `s3ForcePathStyle` + +## 1.0.2 +- Fixed regression in proxy support (https://github.com/mapbox/node-pre-gyp/issues/572) + +## 1.0.1 +- Switched from mkdirp@1.0.4 to make-dir@3.1.0 to avoid this bug: https://github.com/isaacs/node-mkdirp/issues/31 + +## 1.0.0 +- Module is now name-spaced at `@mapbox/node-pre-gyp` and the original `node-pre-gyp` is deprecated. +- New: support for staging and production s3 targets (see README.md) +- BREAKING: no longer supporting `node_pre_gyp_accessKeyId` & `node_pre_gyp_secretAccessKey`, use `AWS_ACCESS_KEY_ID` & `AWS_SECRET_ACCESS_KEY` instead to authenticate against s3 for `info`, `publish`, and `unpublish` commands. +- Dropped node v6 support, added node v14 support +- Switched tests to use mapbox-owned bucket for testing +- Added coverage tracking and linting with eslint +- Added back support for symlinks inside the tarball +- Upgraded all test apps to N-API/node-addon-api +- New: support for staging and production s3 targets (see README.md) +- Added `node_pre_gyp_s3_host` env var which has priority over the `--s3_host` option or default. +- Replaced needle with node-fetch +- Added proxy support for node-fetch +- Upgraded to mkdirp@1.x + +## 0.17.0 +- Got travis + appveyor green again +- Added support for more node versions + +## 0.16.0 + +- Added Node 15 support in the local database (https://github.com/mapbox/node-pre-gyp/pull/520) + +## 0.15.0 + +- Bump dependency on `mkdirp` from `^0.5.1` to `^0.5.3` (https://github.com/mapbox/node-pre-gyp/pull/492) +- Bump dependency on `needle` from `^2.2.1` to `^2.5.0` (https://github.com/mapbox/node-pre-gyp/pull/502) +- Added Node 14 support in the local database (https://github.com/mapbox/node-pre-gyp/pull/501) + +## 0.14.0 + +- Defer modules requires in napi.js (https://github.com/mapbox/node-pre-gyp/pull/434) +- Bump dependency on `tar` from `^4` to `^4.4.2` (https://github.com/mapbox/node-pre-gyp/pull/454) +- Support extracting compiled binary from local offline mirror (https://github.com/mapbox/node-pre-gyp/pull/459) +- Added Node 13 support in the local database (https://github.com/mapbox/node-pre-gyp/pull/483) + +## 0.13.0 + +- Added Node 12 support in the local database (https://github.com/mapbox/node-pre-gyp/pull/449) + +## 0.12.0 + +- Fixed double-build problem with node v10 (https://github.com/mapbox/node-pre-gyp/pull/428) +- Added node 11 support in the local database (https://github.com/mapbox/node-pre-gyp/pull/422) + +## 0.11.0 + +- Fixed double-install problem with node v10 +- Significant N-API improvements (https://github.com/mapbox/node-pre-gyp/pull/405) + +## 0.10.3 + +- Now will use `request` over `needle` if request is installed. By default `needle` is used for `https`. This should unbreak proxy support that regressed in v0.9.0 + +## 0.10.2 + +- Fixed rc/deep-extent security vulnerability +- Fixed broken reinstall script do to incorrectly named get_best_napi_version + +## 0.10.1 + +- Fix needle error event (@medns) + +## 0.10.0 + +- Allow for a single-level module path when packing @allenluce (https://github.com/mapbox/node-pre-gyp/pull/371) +- Log warnings instead of errors when falling back @xzyfer (https://github.com/mapbox/node-pre-gyp/pull/366) +- Add Node.js v10 support to tests (https://github.com/mapbox/node-pre-gyp/pull/372) +- Remove retire.js from CI (https://github.com/mapbox/node-pre-gyp/pull/372) +- Remove support for Node.js v4 due to [EOL on April 30th, 2018](https://github.com/nodejs/Release/blob/7dd52354049cae99eed0e9fe01345b0722a86fde/schedule.json#L14) +- Update appveyor tests to install default NPM version instead of NPM v2.x for all Windows builds (https://github.com/mapbox/node-pre-gyp/pull/375) + +## 0.9.1 + +- Fixed regression (in v0.9.0) with support for http redirects @allenluce (https://github.com/mapbox/node-pre-gyp/pull/361) + +## 0.9.0 + +- Switched from using `request` to `needle` to reduce size of module deps (https://github.com/mapbox/node-pre-gyp/pull/350) + +## 0.8.0 + +- N-API support (@inspiredware) + +## 0.7.1 + +- Upgraded to tar v4.x + +## 0.7.0 + + - Updated request and hawk (#347) + - Dropped node v0.10.x support + +## 0.6.40 + + - Improved error reporting if an install fails + +## 0.6.39 + + - Support for node v9 + - Support for versioning on `{libc}` to allow binaries to work on non-glic linux systems like alpine linux + + +## 0.6.38 + + - Maintaining compatibility (for v0.6.x series) with node v0.10.x + +## 0.6.37 + + - Solved one part of #276: now now deduce the node ABI from the major version for node >= 2 even when not stored in the abi_crosswalk.json + - Fixed docs to avoid mentioning the deprecated and dangerous `prepublish` in package.json (#291) + - Add new node versions to crosswalk + - Ported tests to use tape instead of mocha + - Got appveyor tests passing by downgrading npm and node-gyp + +## 0.6.36 + + - Removed the running of `testbinary` during install. Because this was regressed for so long, it is too dangerous to re-enable by default. Developers needing validation can call `node-pre-gyp testbinary` directory. + - Fixed regression in v0.6.35 for electron installs (now skipping binary validation which is not yet supported for electron) + +## 0.6.35 + + - No longer recommending `npm ls` in `prepublish` (#291) + - Fixed testbinary command (#283) @szdavid92 + +## 0.6.34 + + - Added new node versions to crosswalk, including v8 + - Upgraded deps to latest versions, started using `^` instead of `~` for all deps. + +## 0.6.33 + + - Improved support for yarn + +## 0.6.32 + + - Honor npm configuration for CA bundles (@heikkipora) + - Add node-pre-gyp and npm versions to user agent (@addaleax) + - Updated various deps + - Add known node version for v7.x + +## 0.6.31 + + - Updated various deps + +## 0.6.30 + + - Update to npmlog@4.x and semver@5.3.x + - Add known node version for v6.5.0 + +## 0.6.29 + + - Add known node versions for v0.10.45, v0.12.14, v4.4.4, v5.11.1, and v6.1.0 + +## 0.6.28 + + - Now more verbose when remote binaries are not available. This is needed since npm is increasingly more quiet by default + and users need to know why builds are falling back to source compiles that might then error out. + +## 0.6.27 + + - Add known node version for node v6 + - Stopped bundling dependencies + - Documented method for module authors to avoid bundling node-pre-gyp + - See https://github.com/mapbox/node-pre-gyp/tree/master#configuring for details + +## 0.6.26 + + - Skip validation for nw runtime (https://github.com/mapbox/node-pre-gyp/pull/181) via @fleg + +## 0.6.25 + + - Improved support for auto-detection of electron runtime in `node-pre-gyp.find()` + - Pull request from @enlight - https://github.com/mapbox/node-pre-gyp/pull/187 + - Add known node version for 4.4.1 and 5.9.1 + +## 0.6.24 + + - Add known node version for 5.8.0, 5.9.0, and 4.4.0. + +## 0.6.23 + + - Add known node version for 0.10.43, 0.12.11, 4.3.2, and 5.7.1. + +## 0.6.22 + + - Add known node version for 4.3.1, and 5.7.0. + +## 0.6.21 + + - Add known node version for 0.10.42, 0.12.10, 4.3.0, and 5.6.0. + +## 0.6.20 + + - Add known node version for 4.2.5, 4.2.6, 5.4.0, 5.4.1,and 5.5.0. + +## 0.6.19 + + - Add known node version for 4.2.4 + +## 0.6.18 + + - Add new known node versions for 0.10.x, 0.12.x, 4.x, and 5.x + +## 0.6.17 + + - Re-tagged to fix packaging problem of `Error: Cannot find module 'isarray'` + +## 0.6.16 + + - Added known version in crosswalk for 5.1.0. + +## 0.6.15 + + - Upgraded tar-pack (https://github.com/mapbox/node-pre-gyp/issues/182) + - Support custom binary hosting mirror (https://github.com/mapbox/node-pre-gyp/pull/170) + - Added known version in crosswalk for 4.2.2. + +## 0.6.14 + + - Added node 5.x version + +## 0.6.13 + + - Added more known node 4.x versions + +## 0.6.12 + + - Added support for [Electron](http://electron.atom.io/). Just pass the `--runtime=electron` flag when building/installing. Thanks @zcbenz + +## 0.6.11 + + - Added known node and io.js versions including more 3.x and 4.x versions + +## 0.6.10 + + - Added known node and io.js versions including 3.x and 4.x versions + - Upgraded `tar` dep + +## 0.6.9 + + - Upgraded `rc` dep + - Updated known io.js version: v2.4.0 + +## 0.6.8 + + - Upgraded `semver` and `rimraf` deps + - Updated known node and io.js versions + +## 0.6.7 + + - Fixed `node_abi` versions for io.js 1.1.x -> 1.8.x (should be 43, but was stored as 42) (refs https://github.com/iojs/build/issues/94) + +## 0.6.6 + + - Updated with known io.js 2.0.0 version + +## 0.6.5 + + - Now respecting `npm_config_node_gyp` (https://github.com/npm/npm/pull/4887) + - Updated to semver@4.3.2 + - Updated known node v0.12.x versions and io.js 1.x versions. + +## 0.6.4 + + - Improved support for `io.js` (@fengmk2) + - Test coverage improvements (@mikemorris) + - Fixed support for `--dist-url` that regressed in 0.6.3 + +## 0.6.3 + + - Added support for passing raw options to node-gyp using `--` separator. Flags passed after + the `--` to `node-pre-gyp configure` will be passed directly to gyp while flags passed + after the `--` will be passed directly to make/visual studio. + - Added `node-pre-gyp configure` command to be able to call `node-gyp configure` directly + - Fix issue with require validation not working on windows 7 (@edgarsilva) + +## 0.6.2 + + - Support for io.js >= v1.0.2 + - Deferred require of `request` and `tar` to help speed up command line usage of `node-pre-gyp`. + +## 0.6.1 + + - Fixed bundled `tar` version + +## 0.6.0 + + - BREAKING: node odd releases like v0.11.x now use `major.minor.patch` for `{node_abi}` instead of `NODE_MODULE_VERSION` (#124) + - Added support for `toolset` option in versioning. By default is an empty string but `--toolset` can be passed to publish or install to select alternative binaries that target a custom toolset like C++11. For example to target Visual Studio 2014 modules like node-sqlite3 use `--toolset=v140`. + - Added support for `--no-rollback` option to request that a failed binary test does not remove the binary module leaves it in place. + - Added support for `--update-binary` option to request an existing binary be re-installed and the check for a valid local module be skipped. + - Added support for passing build options from `npm` through `node-pre-gyp` to `node-gyp`: `--nodedir`, `--disturl`, `--python`, and `--msvs_version` + +## 0.5.31 + + - Added support for deducing node_abi for node.js runtime from previous release if the series is even + - Added support for --target=0.10.33 + +## 0.5.30 + + - Repackaged with latest bundled deps + +## 0.5.29 + + - Added support for semver `build`. + - Fixed support for downloading from urls that include `+`. + +## 0.5.28 + + - Now reporting unix style paths only in reveal command + +## 0.5.27 + + - Fixed support for auto-detecting s3 bucket name when it contains `.` - @taavo + - Fixed support for installing when path contains a `'` - @halfdan + - Ported tests to mocha + +## 0.5.26 + + - Fix node-webkit support when `--target` option is not provided + +## 0.5.25 + + - Fix bundling of deps + +## 0.5.24 + + - Updated ABI crosswalk to incldue node v0.10.30 and v0.10.31 + +## 0.5.23 + + - Added `reveal` command. Pass no options to get all versioning data as json. Pass a second arg to grab a single versioned property value + - Added support for `--silent` (shortcut for `--loglevel=silent`) + +## 0.5.22 + + - Fixed node-webkit versioning name (NOTE: node-webkit support still experimental) + +## 0.5.21 + + - New package to fix `shasum check failed` error with v0.5.20 + +## 0.5.20 + + - Now versioning node-webkit binaries based on major.minor.patch - assuming no compatible ABI across versions (#90) + +## 0.5.19 + + - Updated to know about more node-webkit releases + +## 0.5.18 + + - Updated to know about more node-webkit releases + +## 0.5.17 + + - Updated to know about node v0.10.29 release + +## 0.5.16 + + - Now supporting all aws-sdk configuration parameters (http://docs.aws.amazon.com/AWSJavaScriptSDK/guide/node-configuring.html) (#86) + +## 0.5.15 + + - Fixed installation of windows packages sub directories on unix systems (#84) + +## 0.5.14 + + - Finished support for cross building using `--target_platform` option (#82) + - Now skipping binary validation on install if target arch/platform do not match the host. + - Removed multi-arch validing for OS X since it required a FAT node.js binary + +## 0.5.13 + + - Fix problem in 0.5.12 whereby the wrong versions of mkdirp and semver where bundled. + +## 0.5.12 + + - Improved support for node-webkit (@Mithgol) + +## 0.5.11 + + - Updated target versions listing + +## 0.5.10 + + - Fixed handling of `-debug` flag passed directory to node-pre-gyp (#72) + - Added optional second arg to `node_pre_gyp.find` to customize the default versioning options used to locate the runtime binary + - Failed install due to `testbinary` check failure no longer leaves behind binary (#70) + +## 0.5.9 + + - Fixed regression in `testbinary` command causing installs to fail on windows with 0.5.7 (#60) + +## 0.5.8 + + - Started bundling deps + +## 0.5.7 + + - Fixed the `testbinary` check, which is used to determine whether to re-download or source compile, to work even in complex dependency situations (#63) + - Exposed the internal `testbinary` command in node-pre-gyp command line tool + - Fixed minor bug so that `fallback_to_build` option is always respected + +## 0.5.6 + + - Added support for versioning on the `name` value in `package.json` (#57). + - Moved to using streams for reading tarball when publishing (#52) + +## 0.5.5 + + - Improved binary validation that also now works with node-webkit (@Mithgol) + - Upgraded test apps to work with node v0.11.x + - Improved test coverage + +## 0.5.4 + + - No longer depends on external install of node-gyp for compiling builds. + +## 0.5.3 + + - Reverted fix for debian/nodejs since it broke windows (#45) + +## 0.5.2 + + - Support for debian systems where the node binary is named `nodejs` (#45) + - Added `bin/node-pre-gyp.cmd` to be able to run command on windows locally (npm creates an .npm automatically when globally installed) + - Updated abi-crosswalk with node v0.10.26 entry. + +## 0.5.1 + + - Various minor bug fixes, several improving windows support for publishing. + +## 0.5.0 + + - Changed property names in `binary` object: now required are `module_name`, `module_path`, and `host`. + - Now `module_path` supports versioning, which allows developers to opt-in to using a versioned install path (#18). + - Added `remote_path` which also supports versioning. + - Changed `remote_uri` to `host`. + +## 0.4.2 + + - Added support for `--target` flag to request cross-compile against a specific node/node-webkit version. + - Added preliminary support for node-webkit + - Fixed support for `--target_arch` option being respected in all cases. + +## 0.4.1 + + - Fixed exception when only stderr is available in binary test (@bendi / #31) + +## 0.4.0 + + - Enforce only `https:` based remote publishing access. + - Added `node-pre-gyp info` command to display listing of published binaries + - Added support for changing the directory node-pre-gyp should build in with the `-C/--directory` option. + - Added support for S3 prefixes. + +## 0.3.1 + + - Added `unpublish` command. + - Fixed module path construction in tests. + - Added ability to disable falling back to build behavior via `npm install --fallback-to-build=false` which overrides setting in a depedencies package.json `install` target. + +## 0.3.0 + + - Support for packaging all files in `module_path` directory - see `app4` for example + - Added `testpackage` command. + - Changed `clean` command to only delete `.node` not entire `build` directory since node-gyp will handle that. + - `.node` modules must be in a folder of there own since tar-pack will remove everything when it unpacks. diff --git a/backend/node_modules/@mapbox/node-pre-gyp/LICENSE b/backend/node_modules/@mapbox/node-pre-gyp/LICENSE new file mode 100644 index 000000000..8f5fce91b --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/LICENSE @@ -0,0 +1,27 @@ +Copyright (c), Mapbox + +All rights reserved. + +Redistribution and use in source and binary forms, with or without modification, +are permitted provided that the following conditions are met: + + * Redistributions of source code must retain the above copyright notice, + this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, + this list of conditions and the following disclaimer in the documentation + and/or other materials provided with the distribution. + * Neither the name of node-pre-gyp nor the names of its contributors + may be used to endorse or promote products derived from this software + without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR +CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, +EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, +PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR +PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF +LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING +NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/backend/node_modules/@mapbox/node-pre-gyp/README.md b/backend/node_modules/@mapbox/node-pre-gyp/README.md new file mode 100644 index 000000000..203285a82 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/README.md @@ -0,0 +1,742 @@ +# @mapbox/node-pre-gyp + +#### @mapbox/node-pre-gyp makes it easy to publish and install Node.js C++ addons from binaries + +[![Build Status](https://travis-ci.com/mapbox/node-pre-gyp.svg?branch=master)](https://travis-ci.com/mapbox/node-pre-gyp) +[![Build status](https://ci.appveyor.com/api/projects/status/3nxewb425y83c0gv)](https://ci.appveyor.com/project/Mapbox/node-pre-gyp) + +`@mapbox/node-pre-gyp` stands between [npm](https://github.com/npm/npm) and [node-gyp](https://github.com/Tootallnate/node-gyp) and offers a cross-platform method of binary deployment. + +### Special note on previous package + +On Feb 9th, 2021 `@mapbox/node-pre-gyp@1.0.0` was [released](./CHANGELOG.md). Older, unscoped versions that are not part of the `@mapbox` org are deprecated and only `@mapbox/node-pre-gyp` will see updates going forward. To upgrade to the new package do: + +``` +npm uninstall node-pre-gyp --save +npm install @mapbox/node-pre-gyp --save +``` + +### Features + + - A command line tool called `node-pre-gyp` that can install your package's C++ module from a binary. + - A variety of developer targeted commands for packaging, testing, and publishing binaries. + - A JavaScript module that can dynamically require your installed binary: `require('@mapbox/node-pre-gyp').find` + +For a hello world example of a module packaged with `node-pre-gyp` see and [the wiki ](https://github.com/mapbox/node-pre-gyp/wiki/Modules-using-node-pre-gyp) for real world examples. + +## Credits + + - The module is modeled after [node-gyp](https://github.com/Tootallnate/node-gyp) by [@Tootallnate](https://github.com/Tootallnate) + - Motivation for initial development came from [@ErisDS](https://github.com/ErisDS) and the [Ghost Project](https://github.com/TryGhost/Ghost). + - Development is sponsored by [Mapbox](https://www.mapbox.com/) + +## FAQ + +See the [Frequently Ask Questions](https://github.com/mapbox/node-pre-gyp/wiki/FAQ). + +## Depends + + - Node.js >= node v8.x + +## Install + +`node-pre-gyp` is designed to be installed as a local dependency of your Node.js C++ addon and accessed like: + + ./node_modules/.bin/node-pre-gyp --help + +But you can also install it globally: + + npm install @mapbox/node-pre-gyp -g + +## Usage + +### Commands + +View all possible commands: + + node-pre-gyp --help + +- clean - Remove the entire folder containing the compiled .node module +- install - Install pre-built binary for module +- reinstall - Run "clean" and "install" at once +- build - Compile the module by dispatching to node-gyp or nw-gyp +- rebuild - Run "clean" and "build" at once +- package - Pack binary into tarball +- testpackage - Test that the staged package is valid +- publish - Publish pre-built binary +- unpublish - Unpublish pre-built binary +- info - Fetch info on published binaries + +You can also chain commands: + + node-pre-gyp clean build unpublish publish info + +### Options + +Options include: + + - `-C/--directory`: run the command in this directory + - `--build-from-source`: build from source instead of using pre-built binary + - `--update-binary`: reinstall by replacing previously installed local binary with remote binary + - `--runtime=node-webkit`: customize the runtime: `node`, `electron` and `node-webkit` are the valid options + - `--fallback-to-build`: fallback to building from source if pre-built binary is not available + - `--target=0.4.0`: Pass the target node or node-webkit version to compile against + - `--target_arch=ia32`: Pass the target arch and override the host `arch`. Any value that is [supported by Node.js](https://nodejs.org/api/os.html#osarch) is valid. + - `--target_platform=win32`: Pass the target platform and override the host `platform`. Valid values are `linux`, `darwin`, `win32`, `sunos`, `freebsd`, `openbsd`, and `aix`. + +Both `--build-from-source` and `--fallback-to-build` can be passed alone or they can provide values. You can pass `--fallback-to-build=false` to override the option as declared in package.json. In addition to being able to pass `--build-from-source` you can also pass `--build-from-source=myapp` where `myapp` is the name of your module. + +For example: `npm install --build-from-source=myapp`. This is useful if: + + - `myapp` is referenced in the package.json of a larger app and therefore `myapp` is being installed as a dependency with `npm install`. + - The larger app also depends on other modules installed with `node-pre-gyp` + - You only want to trigger a source compile for `myapp` and the other modules. + +### Configuring + +This is a guide to configuring your module to use node-pre-gyp. + +#### 1) Add new entries to your `package.json` + + - Add `@mapbox/node-pre-gyp` to `dependencies` + - Add `aws-sdk` as a `devDependency` + - Add a custom `install` script + - Declare a `binary` object + +This looks like: + +```js + "dependencies" : { + "@mapbox/node-pre-gyp": "1.x" + }, + "devDependencies": { + "aws-sdk": "2.x" + } + "scripts": { + "install": "node-pre-gyp install --fallback-to-build" + }, + "binary": { + "module_name": "your_module", + "module_path": "./lib/binding/", + "host": "https://your_module.s3-us-west-1.amazonaws.com" + } +``` + +For a full example see [node-addon-examples's package.json](https://github.com/springmeyer/node-addon-example/blob/master/package.json). + +Let's break this down: + + - Dependencies need to list `node-pre-gyp` + - Your devDependencies should list `aws-sdk` so that you can run `node-pre-gyp publish` locally or a CI system. We recommend using `devDependencies` only since `aws-sdk` is large and not needed for `node-pre-gyp install` since it only uses http to fetch binaries + - Your `scripts` section should override the `install` target with `"install": "node-pre-gyp install --fallback-to-build"`. This allows node-pre-gyp to be used instead of the default npm behavior of always source compiling with `node-gyp` directly. + - Your package.json should contain a `binary` section describing key properties you provide to allow node-pre-gyp to package optimally. They are detailed below. + +Note: in the past we recommended putting `@mapbox/node-pre-gyp` in the `bundledDependencies`, but we no longer recommend this. In the past there were npm bugs (with node versions 0.10.x) that could lead to node-pre-gyp not being available at the right time during install (unless we bundled). This should no longer be the case. Also, for a time we recommended using `"preinstall": "npm install @mapbox/node-pre-gyp"` as an alternative method to avoid needing to bundle. But this did not behave predictably across all npm versions - see https://github.com/mapbox/node-pre-gyp/issues/260 for the details. So we do not recommend using `preinstall` to install `@mapbox/node-pre-gyp`. More history on this at https://github.com/strongloop/fsevents/issues/157#issuecomment-265545908. + +##### The `binary` object has three required properties + +###### module_name + +The name of your native node module. This value must: + + - Match the name passed to [the NODE_MODULE macro](http://nodejs.org/api/addons.html#addons_hello_world) + - Must be a valid C variable name (e.g. it cannot contain `-`) + - Should not include the `.node` extension. + +###### module_path + +The location your native module is placed after a build. This should be an empty directory without other Javascript files. This entire directory will be packaged in the binary tarball. When installing from a remote package this directory will be overwritten with the contents of the tarball. + +Note: This property supports variables based on [Versioning](#versioning). + +###### host + +A url to the remote location where you've published tarball binaries (must be `https` not `http`). + +It is highly recommended that you use Amazon S3. The reasons are: + + - Various node-pre-gyp commands like `publish` and `info` only work with an S3 host. + - S3 is a very solid hosting platform for distributing large files. + - We provide detail documentation for using [S3 hosting](#s3-hosting) with node-pre-gyp. + +Why then not require S3? Because while some applications using node-pre-gyp need to distribute binaries as large as 20-30 MB, others might have very small binaries and might wish to store them in a GitHub repo. This is not recommended, but if an author really wants to host in a non-S3 location then it should be possible. + +It should also be mentioned that there is an optional and entirely separate npm module called [node-pre-gyp-github](https://github.com/bchr02/node-pre-gyp-github) which is intended to complement node-pre-gyp and be installed along with it. It provides the ability to store and publish your binaries within your repositories GitHub Releases if you would rather not use S3 directly. Installation and usage instructions can be found [here](https://github.com/bchr02/node-pre-gyp-github), but the basic premise is that instead of using the ```node-pre-gyp publish``` command you would use ```node-pre-gyp-github publish```. + +##### The `binary` object other optional S3 properties + +If you are not using a standard s3 path like `bucket_name.s3(.-)region.amazonaws.com`, you might get an error on `publish` because node-pre-gyp extracts the region and bucket from the `host` url. For example, you may have an on-premises s3-compatible storage server, or may have configured a specific dns redirecting to an s3 endpoint. In these cases, you can explicitly set the `region` and `bucket` properties to tell node-pre-gyp to use these values instead of guessing from the `host` property. The following values can be used in the `binary` section: + +###### host + +The url to the remote server root location (must be `https` not `http`). + +###### bucket + +The bucket name where your tarball binaries should be located. + +###### region + +Your S3 server region. + +###### s3ForcePathStyle + +Set `s3ForcePathStyle` to true if the endpoint url should not be prefixed with the bucket name. If false (default), the server endpoint would be constructed as `bucket_name.your_server.com`. + +##### The `binary` object has optional properties + +###### remote_path + +It **is recommended** that you customize this property. This is an extra path to use for publishing and finding remote tarballs. The default value for `remote_path` is `""` meaning that if you do not provide it then all packages will be published at the base of the `host`. It is recommended to provide a value like `./{name}/v{version}` to help organize remote packages in the case that you choose to publish multiple node addons to the same `host`. + +Note: This property supports variables based on [Versioning](#versioning). + +###### package_name + +It is **not recommended** to override this property unless you are also overriding the `remote_path`. This is the versioned name of the remote tarball containing the binary `.node` module and any supporting files you've placed inside the `module_path` directory. Unless you specify `package_name` in your `package.json` then it defaults to `{module_name}-v{version}-{node_abi}-{platform}-{arch}.tar.gz` which allows your binary to work across node versions, platforms, and architectures. If you are using `remote_path` that is also versioned by `./{module_name}/v{version}` then you could remove these variables from the `package_name` and just use: `{node_abi}-{platform}-{arch}.tar.gz`. Then your remote tarball will be looked up at, for example, `https://example.com/your-module/v0.1.0/node-v11-linux-x64.tar.gz`. + +Avoiding the version of your module in the `package_name` and instead only embedding in a directory name can be useful when you want to make a quick tag of your module that does not change any C++ code. In this case you can just copy binaries to the new version behind the scenes like: + +```sh +aws s3 sync --acl public-read s3://mapbox-node-binary/sqlite3/v3.0.3/ s3://mapbox-node-binary/sqlite3/v3.0.4/ +``` + +Note: This property supports variables based on [Versioning](#versioning). + +#### 2) Add a new target to binding.gyp + +`node-pre-gyp` calls out to `node-gyp` to compile the module and passes variables along like [module_name](#module_name) and [module_path](#module_path). + +A new target must be added to `binding.gyp` that moves the compiled `.node` module from `./build/Release/module_name.node` into the directory specified by `module_path`. + +Add a target like this at the end of your `targets` list: + +```js + { + "target_name": "action_after_build", + "type": "none", + "dependencies": [ "<(module_name)" ], + "copies": [ + { + "files": [ "<(PRODUCT_DIR)/<(module_name).node" ], + "destination": "<(module_path)" + } + ] + } +``` + +For a full example see [node-addon-example's binding.gyp](https://github.com/springmeyer/node-addon-example/blob/2ff60a8ded7f042864ad21db00c3a5a06cf47075/binding.gyp). + +#### 3) Dynamically require your `.node` + +Inside the main js file that requires your addon module you are likely currently doing: + +```js +var binding = require('../build/Release/binding.node'); +``` + +or: + +```js +var bindings = require('./bindings') +``` + +Change those lines to: + +```js +var binary = require('@mapbox/node-pre-gyp'); +var path = require('path'); +var binding_path = binary.find(path.resolve(path.join(__dirname,'./package.json'))); +var binding = require(binding_path); +``` + +For a full example see [node-addon-example's index.js](https://github.com/springmeyer/node-addon-example/blob/2ff60a8ded7f042864ad21db00c3a5a06cf47075/index.js#L1-L4) + +#### 4) Build and package your app + +Now build your module from source: + + npm install --build-from-source + +The `--build-from-source` tells `node-pre-gyp` to not look for a remote package and instead dispatch to node-gyp to build. + +Now `node-pre-gyp` should now also be installed as a local dependency so the command line tool it offers can be found at `./node_modules/.bin/node-pre-gyp`. + +#### 5) Test + +Now `npm test` should work just as it did before. + +#### 6) Publish the tarball + +Then package your app: + + ./node_modules/.bin/node-pre-gyp package + +Once packaged, now you can publish: + + ./node_modules/.bin/node-pre-gyp publish + +Currently the `publish` command pushes your binary to S3. This requires: + + - You have installed `aws-sdk` with `npm install aws-sdk` + - You have created a bucket already. + - The `host` points to an S3 http or https endpoint. + - You have configured node-pre-gyp to read your S3 credentials (see [S3 hosting](#s3-hosting) for details). + +You can also host your binaries elsewhere. To do this requires: + + - You manually publish the binary created by the `package` command to an `https` endpoint + - Ensure that the `host` value points to your custom `https` endpoint. + +#### 7) Automate builds + +Now you need to publish builds for all the platforms and node versions you wish to support. This is best automated. + + - See [Appveyor Automation](#appveyor-automation) for how to auto-publish builds on Windows. + - See [Travis Automation](#travis-automation) for how to auto-publish builds on OS X and Linux. + +#### 8) You're done! + +Now publish your module to the npm registry. Users will now be able to install your module from a binary. + +What will happen is this: + +1. `npm install ` will pull from the npm registry +2. npm will run the `install` script which will call out to `node-pre-gyp` +3. `node-pre-gyp` will fetch the binary `.node` module and unpack in the right place +4. Assuming that all worked, you are done + +If a a binary was not available for a given platform and `--fallback-to-build` was used then `node-gyp rebuild` will be called to try to source compile the module. + +#### 9) One more option + +It may be that you want to work with two s3 buckets, one for staging and one for production; this +arrangement makes it less likely to accidentally overwrite a production binary. It also allows the production +environment to have more restrictive permissions than staging while still enabling publishing when +developing and testing. + +The binary.host property can be set at execution time. In order to do so all of the following conditions +must be true. + +- binary.host is falsey or not present +- binary.staging_host is not empty +- binary.production_host is not empty + +If any of these checks fail then the operation will not perform execution time determination of the s3 target. + +If the command being executed is either "publish" or "unpublish" then the default is set to `binary.staging_host`. In all other cases +the default is `binary.production_host`. + +The command-line options `--s3_host=staging` or `--s3_host=production` override the default. If `s3_host` +is present and not `staging` or `production` an exception is thrown. + +This allows installing from staging by specifying `--s3_host=staging`. And it requires specifying +`--s3_option=production` in order to publish to, or unpublish from, production, making accidental errors less likely. + +## Node-API Considerations + +[Node-API](https://nodejs.org/api/n-api.html#n_api_node_api), which was previously known as N-API, is an ABI-stable alternative to previous technologies such as [nan](https://github.com/nodejs/nan) which are tied to a specific Node runtime engine. Node-API is Node runtime engine agnostic and guarantees modules created today will continue to run, without changes, into the future. + +Using `node-pre-gyp` with Node-API projects requires a handful of additional configuration values and imposes some additional requirements. + +The most significant difference is that an Node-API module can be coded to target multiple Node-API versions. Therefore, an Node-API module must declare in its `package.json` file which Node-API versions the module is designed to run against. In addition, since multiple builds may be required for a single module, path and file names must be specified in way that avoids naming conflicts. + +### The `napi_versions` array property + +A Node-API module must declare in its `package.json` file, the Node-API versions the module is intended to support. This is accomplished by including an `napi-versions` array property in the `binary` object. For example: + +```js +"binary": { + "module_name": "your_module", + "module_path": "your_module_path", + "host": "https://your_bucket.s3-us-west-1.amazonaws.com", + "napi_versions": [1,3] + } +``` + +If the `napi_versions` array property is *not* present, `node-pre-gyp` operates as it always has. Including the `napi_versions` array property instructs `node-pre-gyp` that this is a Node-API module build. + +When the `napi_versions` array property is present, `node-pre-gyp` fires off multiple operations, one for each of the Node-API versions in the array. In the example above, two operations are initiated, one for Node-API version 1 and second for Node-API version 3. How this version number is communicated is described next. + +### The `napi_build_version` value + +For each of the Node-API module operations `node-pre-gyp` initiates, it ensures that the `napi_build_version` is set appropriately. + +This value is of importance in two areas: + +1. The C/C++ code which needs to know against which Node-API version it should compile. +2. `node-pre-gyp` itself which must assign appropriate path and file names to avoid collisions. + +### Defining `NAPI_VERSION` for the C/C++ code + +The `napi_build_version` value is communicated to the C/C++ code by adding this code to the `binding.gyp` file: + +``` +"defines": [ + "NAPI_VERSION=<(napi_build_version)", +] +``` + +This ensures that `NAPI_VERSION`, an integer value, is declared appropriately to the C/C++ code for each build. + +> Note that earlier versions of this document recommended defining the symbol `NAPI_BUILD_VERSION`. `NAPI_VERSION` is preferred because it used by the Node-API C/C++ headers to configure the specific Node-API versions being requested. + +### Path and file naming requirements in `package.json` + +Since `node-pre-gyp` fires off multiple operations for each request, it is essential that path and file names be created in such a way as to avoid collisions. This is accomplished by imposing additional path and file naming requirements. + +Specifically, when performing Node-API builds, the `{napi_build_version}` text configuration value *must* be present in the `module_path` property. In addition, the `{napi_build_version}` text configuration value *must* be present in either the `remote_path` or `package_name` property. (No problem if it's in both.) + +Here's an example: + +```js +"binary": { + "module_name": "your_module", + "module_path": "./lib/binding/napi-v{napi_build_version}", + "remote_path": "./{module_name}/v{version}/{configuration}/", + "package_name": "{platform}-{arch}-napi-v{napi_build_version}.tar.gz", + "host": "https://your_bucket.s3-us-west-1.amazonaws.com", + "napi_versions": [1,3] + } +``` + +## Supporting both Node-API and NAN builds + +You may have a legacy native add-on that you wish to continue supporting for those versions of Node that do not support Node-API, as you add Node-API support for later Node versions. This can be accomplished by specifying the `node_napi_label` configuration value in the package.json `binary.package_name` property. + +Placing the configuration value `node_napi_label` in the package.json `binary.package_name` property instructs `node-pre-gyp` to build all viable Node-API binaries supported by the current Node instance. If the current Node instance does not support Node-API, `node-pre-gyp` will request a traditional, non-Node-API build. + +The configuration value `node_napi_label` is set by `node-pre-gyp` to the type of build created, `napi` or `node`, and the version number. For Node-API builds, the string contains the Node-API version nad has values like `napi-v3`. For traditional, non-Node-API builds, the string contains the ABI version with values like `node-v46`. + +Here's how the `binary` configuration above might be changed to support both Node-API and NAN builds: + +```js +"binary": { + "module_name": "your_module", + "module_path": "./lib/binding/{node_napi_label}", + "remote_path": "./{module_name}/v{version}/{configuration}/", + "package_name": "{platform}-{arch}-{node_napi_label}.tar.gz", + "host": "https://your_bucket.s3-us-west-1.amazonaws.com", + "napi_versions": [1,3] + } +``` + +The C/C++ symbol `NAPI_VERSION` can be used to distinguish Node-API and non-Node-API builds. The value of `NAPI_VERSION` is set to the integer Node-API version for Node-API builds and is set to `0` for non-Node-API builds. + +For example: + +```C +#if NAPI_VERSION +// Node-API code goes here +#else +// NAN code goes here +#endif +``` + +### Two additional configuration values + +The following two configuration values, which were implemented in previous versions of `node-pre-gyp`, continue to exist, but have been replaced by the `node_napi_label` configuration value described above. + +1. `napi_version` If Node-API is supported by the currently executing Node instance, this value is the Node-API version number supported by Node. If Node-API is not supported, this value is an empty string. + +2. `node_abi_napi` If the value returned for `napi_version` is non empty, this value is `'napi'`. If the value returned for `napi_version` is empty, this value is the value returned for `node_abi`. + +These values are present for use in the `binding.gyp` file and may be used as `{napi_version}` and `{node_abi_napi}` for text substituion in the `binary` properties of the `package.json` file. + +## S3 Hosting + +You can host wherever you choose but S3 is cheap, `node-pre-gyp publish` expects it, and S3 can be integrated well with [Travis.ci](http://travis-ci.org) to automate builds for OS X and Ubuntu, and with [Appveyor](http://appveyor.com) to automate builds for Windows. Here is an approach to do this: + +First, get setup locally and test the workflow: + +#### 1) Create an S3 bucket + +And have your **key** and **secret key** ready for writing to the bucket. + +It is recommended to create a IAM user with a policy that only gives permissions to the specific bucket you plan to publish to. This can be done in the [IAM console](https://console.aws.amazon.com/iam/) by: 1) adding a new user, 2) choosing `Attach User Policy`, 3) Using the `Policy Generator`, 4) selecting `Amazon S3` for the service, 5) adding the actions: `DeleteObject`, `GetObject`, `GetObjectAcl`, `ListBucket`, `HeadBucket`, `PutObject`, `PutObjectAcl`, 6) adding an ARN of `arn:aws:s3:::bucket/*` (replacing `bucket` with your bucket name), and finally 7) clicking `Add Statement` and saving the policy. It should generate a policy like: + +```js +{ + "Version": "2012-10-17", + "Statement": [ + { + "Sid": "objects", + "Effect": "Allow", + "Action": [ + "s3:PutObject", + "s3:GetObjectAcl", + "s3:GetObject", + "s3:DeleteObject", + "s3:PutObjectAcl" + ], + "Resource": "arn:aws:s3:::your-bucket-name/*" + }, + { + "Sid": "bucket", + "Effect": "Allow", + "Action": "s3:ListBucket", + "Resource": "arn:aws:s3:::your-bucket-name" + }, + { + "Sid": "buckets", + "Effect": "Allow", + "Action": "s3:HeadBucket", + "Resource": "*" + } + ] +} +``` + +#### 2) Install node-pre-gyp + +Either install it globally: + + npm install node-pre-gyp -g + +Or put the local version on your PATH + + export PATH=`pwd`/node_modules/.bin/:$PATH + +#### 3) Configure AWS credentials + +It is recommended to configure the AWS JS SDK v2 used internally by `node-pre-gyp` by setting these environment variables: + +- AWS_ACCESS_KEY_ID +- AWS_SECRET_ACCESS_KEY + +But also you can also use the `Shared Config File` mentioned [in the AWS JS SDK v2 docs](https://docs.aws.amazon.com/sdk-for-javascript/v2/developer-guide/configuring-the-jssdk.html) + +#### 4) Package and publish your build + +Install the `aws-sdk`: + + npm install aws-sdk + +Then publish: + + node-pre-gyp package publish + +Note: if you hit an error like `Hostname/IP doesn't match certificate's altnames` it may mean that you need to provide the `region` option in your config. + +## Appveyor Automation + +[Appveyor](http://www.appveyor.com/) can build binaries and publish the results per commit and supports: + + - Windows Visual Studio 2013 and related compilers + - Both 64 bit (x64) and 32 bit (x86) build configurations + - Multiple Node.js versions + +For an example of doing this see [node-sqlite3's appveyor.yml](https://github.com/mapbox/node-sqlite3/blob/master/appveyor.yml). + +Below is a guide to getting set up: + +#### 1) Create a free Appveyor account + +Go to https://ci.appveyor.com/signup/free and sign in with your GitHub account. + +#### 2) Create a new project + +Go to https://ci.appveyor.com/projects/new and select the GitHub repo for your module + +#### 3) Add appveyor.yml and push it + +Once you have committed an `appveyor.yml` ([appveyor.yml reference](http://www.appveyor.com/docs/appveyor-yml)) to your GitHub repo and pushed it AppVeyor should automatically start building your project. + +#### 4) Create secure variables + +Encrypt your S3 AWS keys by going to and hitting the `encrypt` button. + +Then paste the result into your `appveyor.yml` + +```yml +environment: + AWS_ACCESS_KEY_ID: + secure: Dn9HKdLNYvDgPdQOzRq/DqZ/MPhjknRHB1o+/lVU8MA= + AWS_SECRET_ACCESS_KEY: + secure: W1rwNoSnOku1r+28gnoufO8UA8iWADmL1LiiwH9IOkIVhDTNGdGPJqAlLjNqwLnL +``` + +NOTE: keys are per account but not per repo (this is difference than Travis where keys are per repo but not related to the account used to encrypt them). + +#### 5) Hook up publishing + +Just put `node-pre-gyp package publish` in your `appveyor.yml` after `npm install`. + +#### 6) Publish when you want + +You might wish to publish binaries only on a specific commit. To do this you could borrow from the [Travis CI idea of commit keywords](http://about.travis-ci.org/docs/user/how-to-skip-a-build/) and add special handling for commit messages with `[publish binary]`: + + SET CM=%APPVEYOR_REPO_COMMIT_MESSAGE% + if not "%CM%" == "%CM:[publish binary]=%" node-pre-gyp --msvs_version=2013 publish + +If your commit message contains special characters (e.g. `&`) this method might fail. An alternative is to use PowerShell, which gives you additional possibilities, like ignoring case by using `ToLower()`: + + ps: if($env:APPVEYOR_REPO_COMMIT_MESSAGE.ToLower().Contains('[publish binary]')) { node-pre-gyp --msvs_version=2013 publish } + +Remember this publishing is not the same as `npm publish`. We're just talking about the binary module here and not your entire npm package. + +## Travis Automation + +[Travis](https://travis-ci.org/) can push to S3 after a successful build and supports both: + + - Ubuntu Precise and OS X (64 bit) + - Multiple Node.js versions + +For an example of doing this see [node-add-example's .travis.yml](https://github.com/springmeyer/node-addon-example/blob/2ff60a8ded7f042864ad21db00c3a5a06cf47075/.travis.yml). + +Note: if you need 32 bit binaries, this can be done from a 64 bit Travis machine. See [the node-sqlite3 scripts for an example of doing this](https://github.com/mapbox/node-sqlite3/blob/bae122aa6a2b8a45f6b717fab24e207740e32b5d/scripts/build_against_node.sh#L54-L74). + +Below is a guide to getting set up: + +#### 1) Install the Travis gem + + gem install travis + +#### 2) Create secure variables + +Make sure you run this command from within the directory of your module. + +Use `travis-encrypt` like: + + travis encrypt AWS_ACCESS_KEY_ID=${node_pre_gyp_accessKeyId} + travis encrypt AWS_SECRET_ACCESS_KEY=${node_pre_gyp_secretAccessKey} + +Then put those values in your `.travis.yml` like: + +```yaml +env: + global: + - secure: F+sEL/v56CzHqmCSSES4pEyC9NeQlkoR0Gs/ZuZxX1ytrj8SKtp3MKqBj7zhIclSdXBz4Ev966Da5ctmcTd410p0b240MV6BVOkLUtkjZJyErMBOkeb8n8yVfSoeMx8RiIhBmIvEn+rlQq+bSFis61/JkE9rxsjkGRZi14hHr4M= + - secure: o2nkUQIiABD139XS6L8pxq3XO5gch27hvm/gOdV+dzNKc/s2KomVPWcOyXNxtJGhtecAkABzaW8KHDDi5QL1kNEFx6BxFVMLO8rjFPsMVaBG9Ks6JiDQkkmrGNcnVdxI/6EKTLHTH5WLsz8+J7caDBzvKbEfTux5EamEhxIWgrI= +``` + +More details on Travis encryption at http://about.travis-ci.org/docs/user/encryption-keys/. + +#### 3) Hook up publishing + +Just put `node-pre-gyp package publish` in your `.travis.yml` after `npm install`. + +##### OS X publishing + +If you want binaries for OS X in addition to linux you can enable [multi-os for Travis](http://docs.travis-ci.com/user/multi-os/#Setting-.travis.yml) + +Use a configuration like: + +```yml + +language: cpp + +os: +- linux +- osx + +env: + matrix: + - NODE_VERSION="4" + - NODE_VERSION="6" + +before_install: +- rm -rf ~/.nvm/ && git clone --depth 1 https://github.com/creationix/nvm.git ~/.nvm +- source ~/.nvm/nvm.sh +- nvm install $NODE_VERSION +- nvm use $NODE_VERSION +``` + +See [Travis OS X Gotchas](#travis-os-x-gotchas) for why we replace `language: node_js` and `node_js:` sections with `language: cpp` and a custom matrix. + +Also create platform specific sections for any deps that need install. For example if you need libpng: + +```yml +- if [ $(uname -s) == 'Linux' ]; then apt-get install libpng-dev; fi; +- if [ $(uname -s) == 'Darwin' ]; then brew install libpng; fi; +``` + +For detailed multi-OS examples see [node-mapnik](https://github.com/mapnik/node-mapnik/blob/master/.travis.yml) and [node-sqlite3](https://github.com/mapbox/node-sqlite3/blob/master/.travis.yml). + +##### Travis OS X Gotchas + +First, unlike the Travis Linux machines, the OS X machines do not put `node-pre-gyp` on PATH by default. To do so you will need to: + +```sh +export PATH=$(pwd)/node_modules/.bin:${PATH} +``` + +Second, the OS X machines do not support using a matrix for installing different Node.js versions. So you need to bootstrap the installation of Node.js in a cross platform way. + +By doing: + +```yml +env: + matrix: + - NODE_VERSION="4" + - NODE_VERSION="6" + +before_install: + - rm -rf ~/.nvm/ && git clone --depth 1 https://github.com/creationix/nvm.git ~/.nvm + - source ~/.nvm/nvm.sh + - nvm install $NODE_VERSION + - nvm use $NODE_VERSION +``` + +You can easily recreate the previous behavior of this matrix: + +```yml +node_js: + - "4" + - "6" +``` + +#### 4) Publish when you want + +You might wish to publish binaries only on a specific commit. To do this you could borrow from the [Travis CI idea of commit keywords](http://about.travis-ci.org/docs/user/how-to-skip-a-build/) and add special handling for commit messages with `[publish binary]`: + + COMMIT_MESSAGE=$(git log --format=%B --no-merges -n 1 | tr -d '\n') + if [[ ${COMMIT_MESSAGE} =~ "[publish binary]" ]]; then node-pre-gyp publish; fi; + +Then you can trigger new binaries to be built like: + + git commit -a -m "[publish binary]" + +Or, if you don't have any changes to make simply run: + + git commit --allow-empty -m "[publish binary]" + +WARNING: if you are working in a pull request and publishing binaries from there then you will want to avoid double publishing when Travis CI builds both the `push` and `pr`. You only want to run the publish on the `push` commit. See https://github.com/Project-OSRM/node-osrm/blob/8eb837abe2e2e30e595093d16e5354bc5c573575/scripts/is_pr_merge.sh which is called from https://github.com/Project-OSRM/node-osrm/blob/8eb837abe2e2e30e595093d16e5354bc5c573575/scripts/publish.sh for an example of how to do this. + +Remember this publishing is not the same as `npm publish`. We're just talking about the binary module here and not your entire npm package. To automate the publishing of your entire package to npm on Travis see http://about.travis-ci.org/docs/user/deployment/npm/ + +# Versioning + +The `binary` properties of `module_path`, `remote_path`, and `package_name` support variable substitution. The strings are evaluated by `node-pre-gyp` depending on your system and any custom build flags you passed. + + - `node_abi`: The node C++ `ABI` number. This value is available in Javascript as `process.versions.modules` as of [`>= v0.10.4 >= v0.11.7`](https://github.com/joyent/node/commit/ccabd4a6fa8a6eb79d29bc3bbe9fe2b6531c2d8e) and in C++ as the `NODE_MODULE_VERSION` define much earlier. For versions of Node before this was available we fallback to the V8 major and minor version. + - `platform` matches node's `process.platform` like `linux`, `darwin`, and `win32` unless the user passed the `--target_platform` option to override. + - `arch` matches node's `process.arch` like `x64` or `ia32` unless the user passes the `--target_arch` option to override. + - `libc` matches `require('detect-libc').family` like `glibc` or `musl` unless the user passes the `--target_libc` option to override. + - `configuration` - Either 'Release' or 'Debug' depending on if `--debug` is passed during the build. + - `module_name` - the `binary.module_name` attribute from `package.json`. + - `version` - the semver `version` value for your module from `package.json` (NOTE: ignores the `semver.build` property). + - `major`, `minor`, `patch`, and `prelease` match the individual semver values for your module's `version` + - `build` - the sevmer `build` value. For example it would be `this.that` if your package.json `version` was `v1.0.0+this.that` + - `prerelease` - the semver `prerelease` value. For example it would be `alpha.beta` if your package.json `version` was `v1.0.0-alpha.beta` + + +The options are visible in the code at + +# Download binary files from a mirror + +S3 is broken in China for the well known reason. + +Using the `npm` config argument: `--{module_name}_binary_host_mirror` can download binary files through a mirror, `-` in `module_name` will be replaced with `_`. + +e.g.: Install [v8-profiler](https://www.npmjs.com/package/v8-profiler) from `npm`. + +```bash +$ npm install v8-profiler --profiler_binary_host_mirror=https://npm.taobao.org/mirrors/node-inspector/ +``` + +e.g.: Install [canvas-prebuilt](https://www.npmjs.com/package/canvas-prebuilt) from `npm`. + +```bash +$ npm install canvas-prebuilt --canvas_prebuilt_binary_host_mirror=https://npm.taobao.org/mirrors/canvas-prebuilt/ +``` diff --git a/backend/node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp b/backend/node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp new file mode 100755 index 000000000..c38d34d10 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp @@ -0,0 +1,4 @@ +#!/usr/bin/env node +'use strict'; + +require('../lib/main'); diff --git a/backend/node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp.cmd b/backend/node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp.cmd new file mode 100644 index 000000000..46e14b541 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp.cmd @@ -0,0 +1,2 @@ +@echo off +node "%~dp0\node-pre-gyp" %* diff --git a/backend/node_modules/@mapbox/node-pre-gyp/contributing.md b/backend/node_modules/@mapbox/node-pre-gyp/contributing.md new file mode 100644 index 000000000..4038fa6a6 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/contributing.md @@ -0,0 +1,10 @@ +# Contributing + + +### Releasing a new version: + +- Ensure tests are passing on travis and appveyor +- Run `node scripts/abi_crosswalk.js` and commit any changes +- Update the changelog +- Tag a new release like: `git tag -a v0.6.34 -m "tagging v0.6.34" && git push --tags` +- Run `npm publish` diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/build.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/build.js new file mode 100644 index 000000000..e8a1459d4 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/build.js @@ -0,0 +1,51 @@ +'use strict'; + +module.exports = exports = build; + +exports.usage = 'Attempts to compile the module by dispatching to node-gyp or nw-gyp'; + +const napi = require('./util/napi.js'); +const compile = require('./util/compile.js'); +const handle_gyp_opts = require('./util/handle_gyp_opts.js'); +const configure = require('./configure.js'); + +function do_build(gyp, argv, callback) { + handle_gyp_opts(gyp, argv, (err, result) => { + let final_args = ['build'].concat(result.gyp).concat(result.pre); + if (result.unparsed.length > 0) { + final_args = final_args. + concat(['--']). + concat(result.unparsed); + } + if (!err && result.opts.napi_build_version) { + napi.swap_build_dir_in(result.opts.napi_build_version); + } + compile.run_gyp(final_args, result.opts, (err2) => { + if (result.opts.napi_build_version) { + napi.swap_build_dir_out(result.opts.napi_build_version); + } + return callback(err2); + }); + }); +} + +function build(gyp, argv, callback) { + + // Form up commands to pass to node-gyp: + // We map `node-pre-gyp build` to `node-gyp configure build` so that we do not + // trigger a clean and therefore do not pay the penalty of a full recompile + if (argv.length && (argv.indexOf('rebuild') > -1)) { + argv.shift(); // remove `rebuild` + // here we map `node-pre-gyp rebuild` to `node-gyp rebuild` which internally means + // "clean + configure + build" and triggers a full recompile + compile.run_gyp(['clean'], {}, (err3) => { + if (err3) return callback(err3); + configure(gyp, argv, (err4) => { + if (err4) return callback(err4); + return do_build(gyp, argv, callback); + }); + }); + } else { + return do_build(gyp, argv, callback); + } +} diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/clean.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/clean.js new file mode 100644 index 000000000..e6933923e --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/clean.js @@ -0,0 +1,31 @@ +'use strict'; + +module.exports = exports = clean; + +exports.usage = 'Removes the entire folder containing the compiled .node module'; + +const rm = require('rimraf'); +const exists = require('fs').exists || require('path').exists; +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); +const path = require('path'); + +function clean(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + const to_delete = opts.module_path; + if (!to_delete) { + return callback(new Error('module_path is empty, refusing to delete')); + } else if (path.normalize(to_delete) === path.normalize(process.cwd())) { + return callback(new Error('module_path is not set, refusing to delete')); + } else { + exists(to_delete, (found) => { + if (found) { + if (!gyp.opts.silent_clean) console.log('[' + package_json.name + '] Removing "%s"', to_delete); + return rm(to_delete, callback); + } + return callback(); + }); + } +} diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/configure.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/configure.js new file mode 100644 index 000000000..1337c0cb2 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/configure.js @@ -0,0 +1,52 @@ +'use strict'; + +module.exports = exports = configure; + +exports.usage = 'Attempts to configure node-gyp or nw-gyp build'; + +const napi = require('./util/napi.js'); +const compile = require('./util/compile.js'); +const handle_gyp_opts = require('./util/handle_gyp_opts.js'); + +function configure(gyp, argv, callback) { + handle_gyp_opts(gyp, argv, (err, result) => { + let final_args = result.gyp.concat(result.pre); + // pull select node-gyp configure options out of the npm environ + const known_gyp_args = ['dist-url', 'python', 'nodedir', 'msvs_version']; + known_gyp_args.forEach((key) => { + const val = gyp.opts[key] || gyp.opts[key.replace('-', '_')]; + if (val) { + final_args.push('--' + key + '=' + val); + } + }); + // --ensure=false tell node-gyp to re-install node development headers + // but it is only respected by node-gyp install, so we have to call install + // as a separate step if the user passes it + if (gyp.opts.ensure === false) { + const install_args = final_args.concat(['install', '--ensure=false']); + compile.run_gyp(install_args, result.opts, (err2) => { + if (err2) return callback(err2); + if (result.unparsed.length > 0) { + final_args = final_args. + concat(['--']). + concat(result.unparsed); + } + compile.run_gyp(['configure'].concat(final_args), result.opts, (err3) => { + return callback(err3); + }); + }); + } else { + if (result.unparsed.length > 0) { + final_args = final_args. + concat(['--']). + concat(result.unparsed); + } + compile.run_gyp(['configure'].concat(final_args), result.opts, (err4) => { + if (!err4 && result.opts.napi_build_version) { + napi.swap_build_dir_out(result.opts.napi_build_version); + } + return callback(err4); + }); + } + }); +} diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/info.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/info.js new file mode 100644 index 000000000..ba22f3271 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/info.js @@ -0,0 +1,38 @@ +'use strict'; + +module.exports = exports = info; + +exports.usage = 'Lists all published binaries (requires aws-sdk)'; + +const log = require('npmlog'); +const versioning = require('./util/versioning.js'); +const s3_setup = require('./util/s3_setup.js'); + +function info(gyp, argv, callback) { + const package_json = gyp.package_json; + const opts = versioning.evaluate(package_json, gyp.opts); + const config = {}; + s3_setup.detect(opts, config); + const s3 = s3_setup.get_s3(config); + const s3_opts = { + Bucket: config.bucket, + Prefix: config.prefix + }; + s3.listObjects(s3_opts, (err, meta) => { + if (err && err.code === 'NotFound') { + return callback(new Error('[' + package_json.name + '] Not found: https://' + s3_opts.Bucket + '.s3.amazonaws.com/' + config.prefix)); + } else if (err) { + return callback(err); + } else { + log.verbose(JSON.stringify(meta, null, 1)); + if (meta && meta.Contents) { + meta.Contents.forEach((obj) => { + console.log(obj.Key); + }); + } else { + console.error('[' + package_json.name + '] No objects found at https://' + s3_opts.Bucket + '.s3.amazonaws.com/' + config.prefix); + } + return callback(); + } + }); +} diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/install.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/install.js new file mode 100644 index 000000000..617dd8663 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/install.js @@ -0,0 +1,235 @@ +'use strict'; + +module.exports = exports = install; + +exports.usage = 'Attempts to install pre-built binary for module'; + +const fs = require('fs'); +const path = require('path'); +const log = require('npmlog'); +const existsAsync = fs.exists || path.exists; +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); +const makeDir = require('make-dir'); +// for fetching binaries +const fetch = require('node-fetch'); +const tar = require('tar'); + +let npgVersion = 'unknown'; +try { + // Read own package.json to get the current node-pre-pyp version. + const ownPackageJSON = fs.readFileSync(path.join(__dirname, '..', 'package.json'), 'utf8'); + npgVersion = JSON.parse(ownPackageJSON).version; +} catch (e) { + // do nothing +} + +function place_binary(uri, targetDir, opts, callback) { + log.http('GET', uri); + + // Try getting version info from the currently running npm. + const envVersionInfo = process.env.npm_config_user_agent || + 'node ' + process.version; + + const sanitized = uri.replace('+', '%2B'); + const requestOpts = { + uri: sanitized, + headers: { + 'User-Agent': 'node-pre-gyp (v' + npgVersion + ', ' + envVersionInfo + ')' + }, + follow_max: 10 + }; + + if (opts.cafile) { + try { + requestOpts.ca = fs.readFileSync(opts.cafile); + } catch (e) { + return callback(e); + } + } else if (opts.ca) { + requestOpts.ca = opts.ca; + } + + const proxyUrl = opts.proxy || + process.env.http_proxy || + process.env.HTTP_PROXY || + process.env.npm_config_proxy; + let agent; + if (proxyUrl) { + const ProxyAgent = require('https-proxy-agent'); + agent = new ProxyAgent(proxyUrl); + log.http('download', 'proxy agent configured using: "%s"', proxyUrl); + } + + fetch(sanitized, { agent }) + .then((res) => { + if (!res.ok) { + throw new Error(`response status ${res.status} ${res.statusText} on ${sanitized}`); + } + const dataStream = res.body; + + return new Promise((resolve, reject) => { + let extractions = 0; + const countExtractions = (entry) => { + extractions += 1; + log.info('install', 'unpacking %s', entry.path); + }; + + dataStream.pipe(extract(targetDir, countExtractions)) + .on('error', (e) => { + reject(e); + }); + dataStream.on('end', () => { + resolve(`extracted file count: ${extractions}`); + }); + dataStream.on('error', (e) => { + reject(e); + }); + }); + }) + .then((text) => { + log.info(text); + callback(); + }) + .catch((e) => { + log.error(`install ${e.message}`); + callback(e); + }); +} + +function extract(to, onentry) { + return tar.extract({ + cwd: to, + strip: 1, + onentry + }); +} + +function extract_from_local(from, targetDir, callback) { + if (!fs.existsSync(from)) { + return callback(new Error('Cannot find file ' + from)); + } + log.info('Found local file to extract from ' + from); + + // extract helpers + let extractCount = 0; + function countExtractions(entry) { + extractCount += 1; + log.info('install', 'unpacking ' + entry.path); + } + function afterExtract(err) { + if (err) return callback(err); + if (extractCount === 0) { + return callback(new Error('There was a fatal problem while extracting the tarball')); + } + log.info('tarball', 'done parsing tarball'); + callback(); + } + + fs.createReadStream(from).pipe(extract(targetDir, countExtractions)) + .on('close', afterExtract) + .on('error', afterExtract); +} + +function do_build(gyp, argv, callback) { + const args = ['rebuild'].concat(argv); + gyp.todo.push({ name: 'build', args: args }); + process.nextTick(callback); +} + +function print_fallback_error(err, opts, package_json) { + const fallback_message = ' (falling back to source compile with node-gyp)'; + let full_message = ''; + if (err.statusCode !== undefined) { + // If we got a network response it but failed to download + // it means remote binaries are not available, so let's try to help + // the user/developer with the info to debug why + full_message = 'Pre-built binaries not found for ' + package_json.name + '@' + package_json.version; + full_message += ' and ' + opts.runtime + '@' + (opts.target || process.versions.node) + ' (' + opts.node_abi + ' ABI, ' + opts.libc + ')'; + full_message += fallback_message; + log.warn('Tried to download(' + err.statusCode + '): ' + opts.hosted_tarball); + log.warn(full_message); + log.http(err.message); + } else { + // If we do not have a statusCode that means an unexpected error + // happened and prevented an http response, so we output the exact error + full_message = 'Pre-built binaries not installable for ' + package_json.name + '@' + package_json.version; + full_message += ' and ' + opts.runtime + '@' + (opts.target || process.versions.node) + ' (' + opts.node_abi + ' ABI, ' + opts.libc + ')'; + full_message += fallback_message; + log.warn(full_message); + log.warn('Hit error ' + err.message); + } +} + +// +// install +// +function install(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const source_build = gyp.opts['build-from-source'] || gyp.opts.build_from_source; + const update_binary = gyp.opts['update-binary'] || gyp.opts.update_binary; + const should_do_source_build = source_build === package_json.name || (source_build === true || source_build === 'true'); + if (should_do_source_build) { + log.info('build', 'requesting source compile'); + return do_build(gyp, argv, callback); + } else { + const fallback_to_build = gyp.opts['fallback-to-build'] || gyp.opts.fallback_to_build; + let should_do_fallback_build = fallback_to_build === package_json.name || (fallback_to_build === true || fallback_to_build === 'true'); + // but allow override from npm + if (process.env.npm_config_argv) { + const cooked = JSON.parse(process.env.npm_config_argv).cooked; + const match = cooked.indexOf('--fallback-to-build'); + if (match > -1 && cooked.length > match && cooked[match + 1] === 'false') { + should_do_fallback_build = false; + log.info('install', 'Build fallback disabled via npm flag: --fallback-to-build=false'); + } + } + let opts; + try { + opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + } catch (err) { + return callback(err); + } + + opts.ca = gyp.opts.ca; + opts.cafile = gyp.opts.cafile; + + const from = opts.hosted_tarball; + const to = opts.module_path; + const binary_module = path.join(to, opts.module_name + '.node'); + existsAsync(binary_module, (found) => { + if (!update_binary) { + if (found) { + console.log('[' + package_json.name + '] Success: "' + binary_module + '" already installed'); + console.log('Pass --update-binary to reinstall or --build-from-source to recompile'); + return callback(); + } + log.info('check', 'checked for "' + binary_module + '" (not found)'); + } + + makeDir(to).then(() => { + const fileName = from.startsWith('file://') && from.slice('file://'.length); + if (fileName) { + extract_from_local(fileName, to, after_place); + } else { + place_binary(from, to, opts, after_place); + } + }).catch((err) => { + after_place(err); + }); + + function after_place(err) { + if (err && should_do_fallback_build) { + print_fallback_error(err, opts, package_json); + return do_build(gyp, argv, callback); + } else if (err) { + return callback(err); + } else { + console.log('[' + package_json.name + '] Success: "' + binary_module + '" is installed via remote'); + return callback(); + } + } + }); + } +} diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/main.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/main.js new file mode 100644 index 000000000..bae32acb7 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/main.js @@ -0,0 +1,125 @@ +'use strict'; + +/** + * Set the title. + */ + +process.title = 'node-pre-gyp'; + +const node_pre_gyp = require('../'); +const log = require('npmlog'); + +/** + * Process and execute the selected commands. + */ + +const prog = new node_pre_gyp.Run({ argv: process.argv }); +let completed = false; + +if (prog.todo.length === 0) { + if (~process.argv.indexOf('-v') || ~process.argv.indexOf('--version')) { + console.log('v%s', prog.version); + process.exit(0); + } else if (~process.argv.indexOf('-h') || ~process.argv.indexOf('--help')) { + console.log('%s', prog.usage()); + process.exit(0); + } + console.log('%s', prog.usage()); + process.exit(1); +} + +// if --no-color is passed +if (prog.opts && Object.hasOwnProperty.call(prog, 'color') && !prog.opts.color) { + log.disableColor(); +} + +log.info('it worked if it ends with', 'ok'); +log.verbose('cli', process.argv); +log.info('using', process.title + '@%s', prog.version); +log.info('using', 'node@%s | %s | %s', process.versions.node, process.platform, process.arch); + + +/** + * Change dir if -C/--directory was passed. + */ + +const dir = prog.opts.directory; +if (dir) { + const fs = require('fs'); + try { + const stat = fs.statSync(dir); + if (stat.isDirectory()) { + log.info('chdir', dir); + process.chdir(dir); + } else { + log.warn('chdir', dir + ' is not a directory'); + } + } catch (e) { + if (e.code === 'ENOENT') { + log.warn('chdir', dir + ' is not a directory'); + } else { + log.warn('chdir', 'error during chdir() "%s"', e.message); + } + } +} + +function run() { + const command = prog.todo.shift(); + if (!command) { + // done! + completed = true; + log.info('ok'); + return; + } + + // set binary.host when appropriate. host determines the s3 target bucket. + const target = prog.setBinaryHostProperty(command.name); + if (target && ['install', 'publish', 'unpublish', 'info'].indexOf(command.name) >= 0) { + log.info('using binary.host: ' + prog.package_json.binary.host); + } + + prog.commands[command.name](command.args, function(err) { + if (err) { + log.error(command.name + ' error'); + log.error('stack', err.stack); + errorMessage(); + log.error('not ok'); + console.log(err.message); + return process.exit(1); + } + const args_array = [].slice.call(arguments, 1); + if (args_array.length) { + console.log.apply(console, args_array); + } + // now run the next command in the queue + process.nextTick(run); + }); +} + +process.on('exit', (code) => { + if (!completed && !code) { + log.error('Completion callback never invoked!'); + errorMessage(); + process.exit(6); + } +}); + +process.on('uncaughtException', (err) => { + log.error('UNCAUGHT EXCEPTION'); + log.error('stack', err.stack); + errorMessage(); + process.exit(7); +}); + +function errorMessage() { + // copied from npm's lib/util/error-handler.js + const os = require('os'); + log.error('System', os.type() + ' ' + os.release()); + log.error('command', process.argv.map(JSON.stringify).join(' ')); + log.error('cwd', process.cwd()); + log.error('node -v', process.version); + log.error(process.title + ' -v', 'v' + prog.package.version); +} + +// start running the given commands! +run(); diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/node-pre-gyp.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/node-pre-gyp.js new file mode 100644 index 000000000..dc18e749e --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/node-pre-gyp.js @@ -0,0 +1,309 @@ +'use strict'; + +/** + * Module exports. + */ + +module.exports = exports; + +/** + * Module dependencies. + */ + +// load mocking control function for accessing s3 via https. the function is a noop always returning +// false if not mocking. +exports.mockS3Http = require('./util/s3_setup').get_mockS3Http(); +exports.mockS3Http('on'); +const mocking = exports.mockS3Http('get'); + + +const fs = require('fs'); +const path = require('path'); +const nopt = require('nopt'); +const log = require('npmlog'); +log.disableProgress(); +const napi = require('./util/napi.js'); + +const EE = require('events').EventEmitter; +const inherits = require('util').inherits; +const cli_commands = [ + 'clean', + 'install', + 'reinstall', + 'build', + 'rebuild', + 'package', + 'testpackage', + 'publish', + 'unpublish', + 'info', + 'testbinary', + 'reveal', + 'configure' +]; +const aliases = {}; + +// differentiate node-pre-gyp's logs from npm's +log.heading = 'node-pre-gyp'; + +if (mocking) { + log.warn(`mocking s3 to ${process.env.node_pre_gyp_mock_s3}`); +} + +// this is a getter to avoid circular reference warnings with node v14. +Object.defineProperty(exports, 'find', { + get: function() { + return require('./pre-binding').find; + }, + enumerable: true +}); + +// in the following, "my_module" is using node-pre-gyp to +// prebuild and install pre-built binaries. "main_module" +// is using "my_module". +// +// "bin/node-pre-gyp" invokes Run() without a path. the +// expectation is that the working directory is the package +// root "my_module". this is true because in all cases npm is +// executing a script in the context of "my_module". +// +// "pre-binding.find()" is executed by "my_module" but in the +// context of "main_module". this is because "main_module" is +// executing and requires "my_module" which is then executing +// "pre-binding.find()" via "node-pre-gyp.find()", so the working +// directory is that of "main_module". +// +// that's why "find()" must pass the path to package.json. +// +function Run({ package_json_path = './package.json', argv }) { + this.package_json_path = package_json_path; + this.commands = {}; + + const self = this; + cli_commands.forEach((command) => { + self.commands[command] = function(argvx, callback) { + log.verbose('command', command, argvx); + return require('./' + command)(self, argvx, callback); + }; + }); + + this.parseArgv(argv); + + // this is set to true after the binary.host property was set to + // either staging_host or production_host. + this.binaryHostSet = false; +} +inherits(Run, EE); +exports.Run = Run; +const proto = Run.prototype; + +/** + * Export the contents of the package.json. + */ + +proto.package = require('../package.json'); + +/** + * nopt configuration definitions + */ + +proto.configDefs = { + help: Boolean, // everywhere + arch: String, // 'configure' + debug: Boolean, // 'build' + directory: String, // bin + proxy: String, // 'install' + loglevel: String // everywhere +}; + +/** + * nopt shorthands + */ + +proto.shorthands = { + release: '--no-debug', + C: '--directory', + debug: '--debug', + j: '--jobs', + silent: '--loglevel=silent', + silly: '--loglevel=silly', + verbose: '--loglevel=verbose' +}; + +/** + * expose the command aliases for the bin file to use. + */ + +proto.aliases = aliases; + +/** + * Parses the given argv array and sets the 'opts', 'argv', + * 'command', and 'package_json' properties. + */ + +proto.parseArgv = function parseOpts(argv) { + this.opts = nopt(this.configDefs, this.shorthands, argv); + this.argv = this.opts.argv.remain.slice(); + const commands = this.todo = []; + + // create a copy of the argv array with aliases mapped + argv = this.argv.map((arg) => { + // is this an alias? + if (arg in this.aliases) { + arg = this.aliases[arg]; + } + return arg; + }); + + // process the mapped args into "command" objects ("name" and "args" props) + argv.slice().forEach((arg) => { + if (arg in this.commands) { + const args = argv.splice(0, argv.indexOf(arg)); + argv.shift(); + if (commands.length > 0) { + commands[commands.length - 1].args = args; + } + commands.push({ name: arg, args: [] }); + } + }); + if (commands.length > 0) { + commands[commands.length - 1].args = argv.splice(0); + } + + + // if a directory was specified package.json is assumed to be relative + // to it. + let package_json_path = this.package_json_path; + if (this.opts.directory) { + package_json_path = path.join(this.opts.directory, package_json_path); + } + + this.package_json = JSON.parse(fs.readFileSync(package_json_path)); + + // expand commands entries for multiple napi builds + this.todo = napi.expand_commands(this.package_json, this.opts, commands); + + // support for inheriting config env variables from npm + const npm_config_prefix = 'npm_config_'; + Object.keys(process.env).forEach((name) => { + if (name.indexOf(npm_config_prefix) !== 0) return; + const val = process.env[name]; + if (name === npm_config_prefix + 'loglevel') { + log.level = val; + } else { + // add the user-defined options to the config + name = name.substring(npm_config_prefix.length); + // avoid npm argv clobber already present args + // which avoids problem of 'npm test' calling + // script that runs unique npm install commands + if (name === 'argv') { + if (this.opts.argv && + this.opts.argv.remain && + this.opts.argv.remain.length) { + // do nothing + } else { + this.opts[name] = val; + } + } else { + this.opts[name] = val; + } + } + }); + + if (this.opts.loglevel) { + log.level = this.opts.loglevel; + } + log.resume(); +}; + +/** + * allow the binary.host property to be set at execution time. + * + * for this to take effect requires all the following to be true. + * - binary is a property in package.json + * - binary.host is falsey + * - binary.staging_host is not empty + * - binary.production_host is not empty + * + * if any of the previous checks fail then the function returns an empty string + * and makes no changes to package.json's binary property. + * + * + * if command is "publish" then the default is set to "binary.staging_host" + * if command is not "publish" the the default is set to "binary.production_host" + * + * if the command-line option '--s3_host' is set to "staging" or "production" then + * "binary.host" is set to the specified "staging_host" or "production_host". if + * '--s3_host' is any other value an exception is thrown. + * + * if '--s3_host' is not present then "binary.host" is set to the default as above. + * + * this strategy was chosen so that any command other than "publish" or "unpublish" uses "production" + * as the default without requiring any command-line options but that "publish" and "unpublish" require + * '--s3_host production_host' to be specified in order to *really* publish (or unpublish). publishing + * to staging can be done freely without worrying about disturbing any production releases. + */ +proto.setBinaryHostProperty = function(command) { + if (this.binaryHostSet) { + return this.package_json.binary.host; + } + const p = this.package_json; + // don't set anything if host is present. it must be left blank to trigger this. + if (!p || !p.binary || p.binary.host) { + return ''; + } + // and both staging and production must be present. errors will be reported later. + if (!p.binary.staging_host || !p.binary.production_host) { + return ''; + } + let target = 'production_host'; + if (command === 'publish' || command === 'unpublish') { + target = 'staging_host'; + } + // the environment variable has priority over the default or the command line. if + // either the env var or the command line option are invalid throw an error. + const npg_s3_host = process.env.node_pre_gyp_s3_host; + if (npg_s3_host === 'staging' || npg_s3_host === 'production') { + target = `${npg_s3_host}_host`; + } else if (this.opts['s3_host'] === 'staging' || this.opts['s3_host'] === 'production') { + target = `${this.opts['s3_host']}_host`; + } else if (this.opts['s3_host'] || npg_s3_host) { + throw new Error(`invalid s3_host ${this.opts['s3_host'] || npg_s3_host}`); + } + + p.binary.host = p.binary[target]; + this.binaryHostSet = true; + + return p.binary.host; +}; + +/** + * Returns the usage instructions for node-pre-gyp. + */ + +proto.usage = function usage() { + const str = [ + '', + ' Usage: node-pre-gyp [options]', + '', + ' where is one of:', + cli_commands.map((c) => { + return ' - ' + c + ' - ' + require('./' + c).usage; + }).join('\n'), + '', + 'node-pre-gyp@' + this.version + ' ' + path.resolve(__dirname, '..'), + 'node@' + process.versions.node + ].join('\n'); + return str; +}; + +/** + * Version number getter. + */ + +Object.defineProperty(proto, 'version', { + get: function() { + return this.package.version; + }, + enumerable: true +}); diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/package.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/package.js new file mode 100644 index 000000000..073498469 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/package.js @@ -0,0 +1,73 @@ +'use strict'; + +module.exports = exports = _package; + +exports.usage = 'Packs binary (and enclosing directory) into locally staged tarball'; + +const fs = require('fs'); +const path = require('path'); +const log = require('npmlog'); +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); +const existsAsync = fs.exists || path.exists; +const makeDir = require('make-dir'); +const tar = require('tar'); + +function readdirSync(dir) { + let list = []; + const files = fs.readdirSync(dir); + + files.forEach((file) => { + const stats = fs.lstatSync(path.join(dir, file)); + if (stats.isDirectory()) { + list = list.concat(readdirSync(path.join(dir, file))); + } else { + list.push(path.join(dir, file)); + } + }); + return list; +} + +function _package(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + const from = opts.module_path; + const binary_module = path.join(from, opts.module_name + '.node'); + existsAsync(binary_module, (found) => { + if (!found) { + return callback(new Error('Cannot package because ' + binary_module + ' missing: run `node-pre-gyp rebuild` first')); + } + const tarball = opts.staged_tarball; + const filter_func = function(entry) { + const basename = path.basename(entry); + if (basename.length && basename[0] !== '.') { + console.log('packing ' + entry); + return true; + } else { + console.log('skipping ' + entry); + } + return false; + }; + makeDir(path.dirname(tarball)).then(() => { + let files = readdirSync(from); + const base = path.basename(from); + files = files.map((file) => { + return path.join(base, path.relative(from, file)); + }); + tar.create({ + portable: false, + gzip: true, + filter: filter_func, + file: tarball, + cwd: path.dirname(from) + }, files, (err2) => { + if (err2) console.error('[' + package_json.name + '] ' + err2.message); + else log.info('package', 'Binary staged at "' + tarball + '"'); + return callback(err2); + }); + }).catch((err) => { + return callback(err); + }); + }); +} diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/pre-binding.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/pre-binding.js new file mode 100644 index 000000000..e110fe381 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/pre-binding.js @@ -0,0 +1,34 @@ +'use strict'; + +const npg = require('..'); +const versioning = require('../lib/util/versioning.js'); +const napi = require('../lib/util/napi.js'); +const existsSync = require('fs').existsSync || require('path').existsSync; +const path = require('path'); + +module.exports = exports; + +exports.usage = 'Finds the require path for the node-pre-gyp installed module'; + +exports.validate = function(package_json, opts) { + versioning.validate_config(package_json, opts); +}; + +exports.find = function(package_json_path, opts) { + if (!existsSync(package_json_path)) { + throw new Error(package_json_path + 'does not exist'); + } + const prog = new npg.Run({ package_json_path, argv: process.argv }); + prog.setBinaryHostProperty(); + const package_json = prog.package_json; + + versioning.validate_config(package_json, opts); + let napi_build_version; + if (napi.get_napi_build_versions(package_json, opts)) { + napi_build_version = napi.get_best_napi_build_version(package_json, opts); + } + opts = opts || {}; + if (!opts.module_root) opts.module_root = path.dirname(package_json_path); + const meta = versioning.evaluate(package_json, opts, napi_build_version); + return meta.module; +}; diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/publish.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/publish.js new file mode 100644 index 000000000..8367b1504 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/publish.js @@ -0,0 +1,81 @@ +'use strict'; + +module.exports = exports = publish; + +exports.usage = 'Publishes pre-built binary (requires aws-sdk)'; + +const fs = require('fs'); +const path = require('path'); +const log = require('npmlog'); +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); +const s3_setup = require('./util/s3_setup.js'); +const existsAsync = fs.exists || path.exists; +const url = require('url'); + +function publish(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + const tarball = opts.staged_tarball; + existsAsync(tarball, (found) => { + if (!found) { + return callback(new Error('Cannot publish because ' + tarball + ' missing: run `node-pre-gyp package` first')); + } + + log.info('publish', 'Detecting s3 credentials'); + const config = {}; + s3_setup.detect(opts, config); + const s3 = s3_setup.get_s3(config); + + const key_name = url.resolve(config.prefix, opts.package_name); + const s3_opts = { + Bucket: config.bucket, + Key: key_name + }; + log.info('publish', 'Authenticating with s3'); + log.info('publish', config); + + log.info('publish', 'Checking for existing binary at ' + opts.hosted_path); + s3.headObject(s3_opts, (err, meta) => { + if (meta) log.info('publish', JSON.stringify(meta)); + if (err && err.code === 'NotFound') { + // we are safe to publish because + // the object does not already exist + log.info('publish', 'Preparing to put object'); + const s3_put_opts = { + ACL: 'public-read', + Body: fs.createReadStream(tarball), + Key: key_name, + Bucket: config.bucket + }; + log.info('publish', 'Putting object', s3_put_opts.ACL, s3_put_opts.Bucket, s3_put_opts.Key); + try { + s3.putObject(s3_put_opts, (err2, resp) => { + log.info('publish', 'returned from putting object'); + if (err2) { + log.info('publish', 's3 putObject error: "' + err2 + '"'); + return callback(err2); + } + if (resp) log.info('publish', 's3 putObject response: "' + JSON.stringify(resp) + '"'); + log.info('publish', 'successfully put object'); + console.log('[' + package_json.name + '] published to ' + opts.hosted_path); + return callback(); + }); + } catch (err3) { + log.info('publish', 's3 putObject error: "' + err3 + '"'); + return callback(err3); + } + } else if (err) { + log.info('publish', 's3 headObject error: "' + err + '"'); + return callback(err); + } else { + log.error('publish', 'Cannot publish over existing version'); + log.error('publish', "Update the 'version' field in package.json and try again"); + log.error('publish', 'If the previous version was published in error see:'); + log.error('publish', '\t node-pre-gyp unpublish'); + return callback(new Error('Failed publishing to ' + opts.hosted_path)); + } + }); + }); +} diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/rebuild.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/rebuild.js new file mode 100644 index 000000000..31510fbd1 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/rebuild.js @@ -0,0 +1,20 @@ +'use strict'; + +module.exports = exports = rebuild; + +exports.usage = 'Runs "clean" and "build" at once'; + +const napi = require('./util/napi.js'); + +function rebuild(gyp, argv, callback) { + const package_json = gyp.package_json; + let commands = [ + { name: 'clean', args: [] }, + { name: 'build', args: ['rebuild'] } + ]; + commands = napi.expand_commands(package_json, gyp.opts, commands); + for (let i = commands.length; i !== 0; i--) { + gyp.todo.unshift(commands[i - 1]); + } + process.nextTick(callback); +} diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/reinstall.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/reinstall.js new file mode 100644 index 000000000..a29b5c9b6 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/reinstall.js @@ -0,0 +1,19 @@ +'use strict'; + +module.exports = exports = rebuild; + +exports.usage = 'Runs "clean" and "install" at once'; + +const napi = require('./util/napi.js'); + +function rebuild(gyp, argv, callback) { + const package_json = gyp.package_json; + let installArgs = []; + const napi_build_version = napi.get_best_napi_build_version(package_json, gyp.opts); + if (napi_build_version != null) installArgs = [napi.get_command_arg(napi_build_version)]; + gyp.todo.unshift( + { name: 'clean', args: [] }, + { name: 'install', args: installArgs } + ); + process.nextTick(callback); +} diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/reveal.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/reveal.js new file mode 100644 index 000000000..7255e5f0a --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/reveal.js @@ -0,0 +1,32 @@ +'use strict'; + +module.exports = exports = reveal; + +exports.usage = 'Reveals data on the versioned binary'; + +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); + +function unix_paths(key, val) { + return val && val.replace ? val.replace(/\\/g, '/') : val; +} + +function reveal(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + let hit = false; + // if a second arg is passed look to see + // if it is a known option + // console.log(JSON.stringify(gyp.opts,null,1)) + const remain = gyp.opts.argv.remain[gyp.opts.argv.remain.length - 1]; + if (remain && Object.hasOwnProperty.call(opts, remain)) { + console.log(opts[remain].replace(/\\/g, '/')); + hit = true; + } + // otherwise return all options as json + if (!hit) { + console.log(JSON.stringify(opts, unix_paths, 2)); + } + return callback(); +} diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/testbinary.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/testbinary.js new file mode 100644 index 000000000..429cb1301 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/testbinary.js @@ -0,0 +1,79 @@ +'use strict'; + +module.exports = exports = testbinary; + +exports.usage = 'Tests that the binary.node can be required'; + +const path = require('path'); +const log = require('npmlog'); +const cp = require('child_process'); +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); + +function testbinary(gyp, argv, callback) { + const args = []; + const options = {}; + let shell_cmd = process.execPath; + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + // skip validation for runtimes we don't explicitly support (like electron) + if (opts.runtime && + opts.runtime !== 'node-webkit' && + opts.runtime !== 'node') { + return callback(); + } + const nw = (opts.runtime && opts.runtime === 'node-webkit'); + // ensure on windows that / are used for require path + const binary_module = opts.module.replace(/\\/g, '/'); + if ((process.arch !== opts.target_arch) || + (process.platform !== opts.target_platform)) { + let msg = 'skipping validation since host platform/arch ('; + msg += process.platform + '/' + process.arch + ')'; + msg += ' does not match target ('; + msg += opts.target_platform + '/' + opts.target_arch + ')'; + log.info('validate', msg); + return callback(); + } + if (nw) { + options.timeout = 5000; + if (process.platform === 'darwin') { + shell_cmd = 'node-webkit'; + } else if (process.platform === 'win32') { + shell_cmd = 'nw.exe'; + } else { + shell_cmd = 'nw'; + } + const modulePath = path.resolve(binary_module); + const appDir = path.join(__dirname, 'util', 'nw-pre-gyp'); + args.push(appDir); + args.push(modulePath); + log.info('validate', "Running test command: '" + shell_cmd + ' ' + args.join(' ') + "'"); + cp.execFile(shell_cmd, args, options, (err, stdout, stderr) => { + // check for normal timeout for node-webkit + if (err) { + if (err.killed === true && err.signal && err.signal.indexOf('SIG') > -1) { + return callback(); + } + const stderrLog = stderr.toString(); + log.info('stderr', stderrLog); + if (/^\s*Xlib:\s*extension\s*"RANDR"\s*missing\s*on\s*display\s*":\d+\.\d+"\.\s*$/.test(stderrLog)) { + log.info('RANDR', 'stderr contains only RANDR error, ignored'); + return callback(); + } + return callback(err); + } + return callback(); + }); + return; + } + args.push('--eval'); + args.push("require('" + binary_module.replace(/'/g, '\'') + "')"); + log.info('validate', "Running test command: '" + shell_cmd + ' ' + args.join(' ') + "'"); + cp.execFile(shell_cmd, args, options, (err, stdout, stderr) => { + if (err) { + return callback(err, { stdout: stdout, stderr: stderr }); + } + return callback(); + }); +} diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/testpackage.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/testpackage.js new file mode 100644 index 000000000..fab1911b9 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/testpackage.js @@ -0,0 +1,53 @@ +'use strict'; + +module.exports = exports = testpackage; + +exports.usage = 'Tests that the staged package is valid'; + +const fs = require('fs'); +const path = require('path'); +const log = require('npmlog'); +const existsAsync = fs.exists || path.exists; +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); +const testbinary = require('./testbinary.js'); +const tar = require('tar'); +const makeDir = require('make-dir'); + +function testpackage(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + const tarball = opts.staged_tarball; + existsAsync(tarball, (found) => { + if (!found) { + return callback(new Error('Cannot test package because ' + tarball + ' missing: run `node-pre-gyp package` first')); + } + const to = opts.module_path; + function filter_func(entry) { + log.info('install', 'unpacking [' + entry.path + ']'); + } + + makeDir(to).then(() => { + tar.extract({ + file: tarball, + cwd: to, + strip: 1, + onentry: filter_func + }).then(after_extract, callback); + }).catch((err) => { + return callback(err); + }); + + function after_extract() { + testbinary(gyp, argv, (err) => { + if (err) { + return callback(err); + } else { + console.log('[' + package_json.name + '] Package appears valid'); + return callback(); + } + }); + } + }); +} diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/unpublish.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/unpublish.js new file mode 100644 index 000000000..12c9f5615 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/unpublish.js @@ -0,0 +1,41 @@ +'use strict'; + +module.exports = exports = unpublish; + +exports.usage = 'Unpublishes pre-built binary (requires aws-sdk)'; + +const log = require('npmlog'); +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); +const s3_setup = require('./util/s3_setup.js'); +const url = require('url'); + +function unpublish(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + const config = {}; + s3_setup.detect(opts, config); + const s3 = s3_setup.get_s3(config); + const key_name = url.resolve(config.prefix, opts.package_name); + const s3_opts = { + Bucket: config.bucket, + Key: key_name + }; + s3.headObject(s3_opts, (err, meta) => { + if (err && err.code === 'NotFound') { + console.log('[' + package_json.name + '] Not found: https://' + s3_opts.Bucket + '.s3.amazonaws.com/' + s3_opts.Key); + return callback(); + } else if (err) { + return callback(err); + } else { + log.info('unpublish', JSON.stringify(meta)); + s3.deleteObject(s3_opts, (err2, resp) => { + if (err2) return callback(err2); + log.info(JSON.stringify(resp)); + console.log('[' + package_json.name + '] Success: removed https://' + s3_opts.Bucket + '.s3.amazonaws.com/' + s3_opts.Key); + return callback(); + }); + } + }); +} diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/util/abi_crosswalk.json b/backend/node_modules/@mapbox/node-pre-gyp/lib/util/abi_crosswalk.json new file mode 100644 index 000000000..7f5297276 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/util/abi_crosswalk.json @@ -0,0 +1,2602 @@ +{ + "0.1.14": { + "node_abi": null, + "v8": "1.3" + }, + "0.1.15": { + "node_abi": null, + "v8": "1.3" + }, + "0.1.16": { + "node_abi": null, + "v8": "1.3" + }, + "0.1.17": { + "node_abi": null, + "v8": "1.3" + }, + "0.1.18": { + "node_abi": null, + "v8": "1.3" + }, + "0.1.19": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.20": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.21": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.22": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.23": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.24": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.25": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.26": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.27": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.28": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.29": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.30": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.31": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.32": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.33": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.90": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.91": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.92": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.93": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.94": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.95": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.96": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.97": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.98": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.99": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.100": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.101": { + "node_abi": null, + "v8": "2.3" + }, + "0.1.102": { + "node_abi": null, + "v8": "2.3" + }, + "0.1.103": { + "node_abi": null, + "v8": "2.3" + }, + "0.1.104": { + "node_abi": null, + "v8": "2.3" + }, + "0.2.0": { + "node_abi": 1, + "v8": "2.3" + }, + "0.2.1": { + "node_abi": 1, + "v8": "2.3" + }, + "0.2.2": { + "node_abi": 1, + "v8": "2.3" + }, + "0.2.3": { + "node_abi": 1, + "v8": "2.3" + }, + "0.2.4": { + "node_abi": 1, + "v8": "2.3" + }, + "0.2.5": { + "node_abi": 1, + "v8": "2.3" + }, + "0.2.6": { + "node_abi": 1, + "v8": "2.3" + }, + "0.3.0": { + "node_abi": 1, + "v8": "2.5" + }, + "0.3.1": { + "node_abi": 1, + "v8": "2.5" + }, + "0.3.2": { + "node_abi": 1, + "v8": "3.0" + }, + "0.3.3": { + "node_abi": 1, + "v8": "3.0" + }, + "0.3.4": { + "node_abi": 1, + "v8": "3.0" + }, + "0.3.5": { + "node_abi": 1, + "v8": "3.0" + }, + "0.3.6": { + "node_abi": 1, + "v8": "3.0" + }, + "0.3.7": { + "node_abi": 1, + "v8": "3.0" + }, + "0.3.8": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.0": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.1": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.2": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.3": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.4": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.5": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.6": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.7": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.8": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.9": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.10": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.11": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.12": { + "node_abi": 1, + "v8": "3.1" + }, + "0.5.0": { + "node_abi": 1, + "v8": "3.1" + }, + "0.5.1": { + "node_abi": 1, + "v8": "3.4" + }, + "0.5.2": { + "node_abi": 1, + "v8": "3.4" + }, + "0.5.3": { + "node_abi": 1, + "v8": "3.4" + }, + "0.5.4": { + "node_abi": 1, + "v8": "3.5" + }, + "0.5.5": { + "node_abi": 1, + "v8": "3.5" + }, + "0.5.6": { + "node_abi": 1, + "v8": "3.6" + }, + "0.5.7": { + "node_abi": 1, + "v8": "3.6" + }, + "0.5.8": { + "node_abi": 1, + "v8": "3.6" + }, + "0.5.9": { + "node_abi": 1, + "v8": "3.6" + }, + "0.5.10": { + "node_abi": 1, + "v8": "3.7" + }, + "0.6.0": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.1": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.2": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.3": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.4": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.5": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.6": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.7": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.8": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.9": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.10": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.11": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.12": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.13": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.14": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.15": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.16": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.17": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.18": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.19": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.20": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.21": { + "node_abi": 1, + "v8": "3.6" + }, + "0.7.0": { + "node_abi": 1, + "v8": "3.8" + }, + "0.7.1": { + "node_abi": 1, + "v8": "3.8" + }, + "0.7.2": { + "node_abi": 1, + "v8": "3.8" + }, + "0.7.3": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.4": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.5": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.6": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.7": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.8": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.9": { + "node_abi": 1, + "v8": "3.11" + }, + "0.7.10": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.11": { + "node_abi": 1, + "v8": "3.11" + }, + "0.7.12": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.0": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.1": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.2": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.3": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.4": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.5": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.6": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.7": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.8": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.9": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.10": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.11": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.12": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.13": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.14": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.15": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.16": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.17": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.18": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.19": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.20": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.21": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.22": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.23": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.24": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.25": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.26": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.27": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.28": { + "node_abi": 1, + "v8": "3.11" + }, + "0.9.0": { + "node_abi": 1, + "v8": "3.11" + }, + "0.9.1": { + "node_abi": 10, + "v8": "3.11" + }, + "0.9.2": { + "node_abi": 10, + "v8": "3.11" + }, + "0.9.3": { + "node_abi": 10, + "v8": "3.13" + }, + "0.9.4": { + "node_abi": 10, + "v8": "3.13" + }, + "0.9.5": { + "node_abi": 10, + "v8": "3.13" + }, + "0.9.6": { + "node_abi": 10, + "v8": "3.15" + }, + "0.9.7": { + "node_abi": 10, + "v8": "3.15" + }, + "0.9.8": { + "node_abi": 10, + "v8": "3.15" + }, + "0.9.9": { + "node_abi": 11, + "v8": "3.15" + }, + "0.9.10": { + "node_abi": 11, + "v8": "3.15" + }, + "0.9.11": { + "node_abi": 11, + "v8": "3.14" + }, + "0.9.12": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.0": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.1": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.2": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.3": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.4": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.5": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.6": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.7": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.8": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.9": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.10": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.11": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.12": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.13": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.14": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.15": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.16": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.17": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.18": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.19": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.20": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.21": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.22": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.23": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.24": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.25": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.26": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.27": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.28": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.29": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.30": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.31": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.32": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.33": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.34": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.35": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.36": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.37": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.38": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.39": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.40": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.41": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.42": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.43": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.44": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.45": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.46": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.47": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.48": { + "node_abi": 11, + "v8": "3.14" + }, + "0.11.0": { + "node_abi": 12, + "v8": "3.17" + }, + "0.11.1": { + "node_abi": 12, + "v8": "3.18" + }, + "0.11.2": { + "node_abi": 12, + "v8": "3.19" + }, + "0.11.3": { + "node_abi": 12, + "v8": "3.19" + }, + "0.11.4": { + "node_abi": 12, + "v8": "3.20" + }, + "0.11.5": { + "node_abi": 12, + "v8": "3.20" + }, + "0.11.6": { + "node_abi": 12, + "v8": "3.20" + }, + "0.11.7": { + "node_abi": 12, + "v8": "3.20" + }, + "0.11.8": { + "node_abi": 13, + "v8": "3.21" + }, + "0.11.9": { + "node_abi": 13, + "v8": "3.22" + }, + "0.11.10": { + "node_abi": 13, + "v8": "3.22" + }, + "0.11.11": { + "node_abi": 14, + "v8": "3.22" + }, + "0.11.12": { + "node_abi": 14, + "v8": "3.22" + }, + "0.11.13": { + "node_abi": 14, + "v8": "3.25" + }, + "0.11.14": { + "node_abi": 14, + "v8": "3.26" + }, + "0.11.15": { + "node_abi": 14, + "v8": "3.28" + }, + "0.11.16": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.0": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.1": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.2": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.3": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.4": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.5": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.6": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.7": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.8": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.9": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.10": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.11": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.12": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.13": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.14": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.15": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.16": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.17": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.18": { + "node_abi": 14, + "v8": "3.28" + }, + "1.0.0": { + "node_abi": 42, + "v8": "3.31" + }, + "1.0.1": { + "node_abi": 42, + "v8": "3.31" + }, + "1.0.2": { + "node_abi": 42, + "v8": "3.31" + }, + "1.0.3": { + "node_abi": 42, + "v8": "4.1" + }, + "1.0.4": { + "node_abi": 42, + "v8": "4.1" + }, + "1.1.0": { + "node_abi": 43, + "v8": "4.1" + }, + "1.2.0": { + "node_abi": 43, + "v8": "4.1" + }, + "1.3.0": { + "node_abi": 43, + "v8": "4.1" + }, + "1.4.1": { + "node_abi": 43, + "v8": "4.1" + }, + "1.4.2": { + "node_abi": 43, + "v8": "4.1" + }, + "1.4.3": { + "node_abi": 43, + "v8": "4.1" + }, + "1.5.0": { + "node_abi": 43, + "v8": "4.1" + }, + "1.5.1": { + "node_abi": 43, + "v8": "4.1" + }, + "1.6.0": { + "node_abi": 43, + "v8": "4.1" + }, + "1.6.1": { + "node_abi": 43, + "v8": "4.1" + }, + "1.6.2": { + "node_abi": 43, + "v8": "4.1" + }, + "1.6.3": { + "node_abi": 43, + "v8": "4.1" + }, + "1.6.4": { + "node_abi": 43, + "v8": "4.1" + }, + "1.7.1": { + "node_abi": 43, + "v8": "4.1" + }, + "1.8.1": { + "node_abi": 43, + "v8": "4.1" + }, + "1.8.2": { + "node_abi": 43, + "v8": "4.1" + }, + "1.8.3": { + "node_abi": 43, + "v8": "4.1" + }, + "1.8.4": { + "node_abi": 43, + "v8": "4.1" + }, + "2.0.0": { + "node_abi": 44, + "v8": "4.2" + }, + "2.0.1": { + "node_abi": 44, + "v8": "4.2" + }, + "2.0.2": { + "node_abi": 44, + "v8": "4.2" + }, + "2.1.0": { + "node_abi": 44, + "v8": "4.2" + }, + "2.2.0": { + "node_abi": 44, + "v8": "4.2" + }, + "2.2.1": { + "node_abi": 44, + "v8": "4.2" + }, + "2.3.0": { + "node_abi": 44, + "v8": "4.2" + }, + "2.3.1": { + "node_abi": 44, + "v8": "4.2" + }, + "2.3.2": { + "node_abi": 44, + "v8": "4.2" + }, + "2.3.3": { + "node_abi": 44, + "v8": "4.2" + }, + "2.3.4": { + "node_abi": 44, + "v8": "4.2" + }, + "2.4.0": { + "node_abi": 44, + "v8": "4.2" + }, + "2.5.0": { + "node_abi": 44, + "v8": "4.2" + }, + "3.0.0": { + "node_abi": 45, + "v8": "4.4" + }, + "3.1.0": { + "node_abi": 45, + "v8": "4.4" + }, + "3.2.0": { + "node_abi": 45, + "v8": "4.4" + }, + "3.3.0": { + "node_abi": 45, + "v8": "4.4" + }, + "3.3.1": { + "node_abi": 45, + "v8": "4.4" + }, + "4.0.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.1.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.1.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.1.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.3": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.4": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.5": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.6": { + "node_abi": 46, + "v8": "4.5" + }, + "4.3.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.3.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.3.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.3": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.4": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.5": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.6": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.7": { + "node_abi": 46, + "v8": "4.5" + }, + "4.5.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.6.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.6.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.6.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.7.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.7.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.7.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.7.3": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.3": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.4": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.5": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.6": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.7": { + "node_abi": 46, + "v8": "4.5" + }, + "4.9.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.9.1": { + "node_abi": 46, + "v8": "4.5" + }, + "5.0.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.1.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.1.1": { + "node_abi": 47, + "v8": "4.6" + }, + "5.2.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.3.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.4.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.4.1": { + "node_abi": 47, + "v8": "4.6" + }, + "5.5.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.6.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.7.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.7.1": { + "node_abi": 47, + "v8": "4.6" + }, + "5.8.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.9.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.9.1": { + "node_abi": 47, + "v8": "4.6" + }, + "5.10.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.10.1": { + "node_abi": 47, + "v8": "4.6" + }, + "5.11.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.11.1": { + "node_abi": 47, + "v8": "4.6" + }, + "5.12.0": { + "node_abi": 47, + "v8": "4.6" + }, + "6.0.0": { + "node_abi": 48, + "v8": "5.0" + }, + "6.1.0": { + "node_abi": 48, + "v8": "5.0" + }, + "6.2.0": { + "node_abi": 48, + "v8": "5.0" + }, + "6.2.1": { + "node_abi": 48, + "v8": "5.0" + }, + "6.2.2": { + "node_abi": 48, + "v8": "5.0" + }, + "6.3.0": { + "node_abi": 48, + "v8": "5.0" + }, + "6.3.1": { + "node_abi": 48, + "v8": "5.0" + }, + "6.4.0": { + "node_abi": 48, + "v8": "5.0" + }, + "6.5.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.6.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.7.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.8.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.8.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.9.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.9.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.9.2": { + "node_abi": 48, + "v8": "5.1" + }, + "6.9.3": { + "node_abi": 48, + "v8": "5.1" + }, + "6.9.4": { + "node_abi": 48, + "v8": "5.1" + }, + "6.9.5": { + "node_abi": 48, + "v8": "5.1" + }, + "6.10.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.10.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.10.2": { + "node_abi": 48, + "v8": "5.1" + }, + "6.10.3": { + "node_abi": 48, + "v8": "5.1" + }, + "6.11.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.11.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.11.2": { + "node_abi": 48, + "v8": "5.1" + }, + "6.11.3": { + "node_abi": 48, + "v8": "5.1" + }, + "6.11.4": { + "node_abi": 48, + "v8": "5.1" + }, + "6.11.5": { + "node_abi": 48, + "v8": "5.1" + }, + "6.12.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.12.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.12.2": { + "node_abi": 48, + "v8": "5.1" + }, + "6.12.3": { + "node_abi": 48, + "v8": "5.1" + }, + "6.13.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.13.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.14.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.14.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.14.2": { + "node_abi": 48, + "v8": "5.1" + }, + "6.14.3": { + "node_abi": 48, + "v8": "5.1" + }, + "6.14.4": { + "node_abi": 48, + "v8": "5.1" + }, + "6.15.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.15.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.16.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.17.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.17.1": { + "node_abi": 48, + "v8": "5.1" + }, + "7.0.0": { + "node_abi": 51, + "v8": "5.4" + }, + "7.1.0": { + "node_abi": 51, + "v8": "5.4" + }, + "7.2.0": { + "node_abi": 51, + "v8": "5.4" + }, + "7.2.1": { + "node_abi": 51, + "v8": "5.4" + }, + "7.3.0": { + "node_abi": 51, + "v8": "5.4" + }, + "7.4.0": { + "node_abi": 51, + "v8": "5.4" + }, + "7.5.0": { + "node_abi": 51, + "v8": "5.4" + }, + "7.6.0": { + "node_abi": 51, + "v8": "5.5" + }, + "7.7.0": { + "node_abi": 51, + "v8": "5.5" + }, + "7.7.1": { + "node_abi": 51, + "v8": "5.5" + }, + "7.7.2": { + "node_abi": 51, + "v8": "5.5" + }, + "7.7.3": { + "node_abi": 51, + "v8": "5.5" + }, + "7.7.4": { + "node_abi": 51, + "v8": "5.5" + }, + "7.8.0": { + "node_abi": 51, + "v8": "5.5" + }, + "7.9.0": { + "node_abi": 51, + "v8": "5.5" + }, + "7.10.0": { + "node_abi": 51, + "v8": "5.5" + }, + "7.10.1": { + "node_abi": 51, + "v8": "5.5" + }, + "8.0.0": { + "node_abi": 57, + "v8": "5.8" + }, + "8.1.0": { + "node_abi": 57, + "v8": "5.8" + }, + "8.1.1": { + "node_abi": 57, + "v8": "5.8" + }, + "8.1.2": { + "node_abi": 57, + "v8": "5.8" + }, + "8.1.3": { + "node_abi": 57, + "v8": "5.8" + }, + "8.1.4": { + "node_abi": 57, + "v8": "5.8" + }, + "8.2.0": { + "node_abi": 57, + "v8": "5.8" + }, + "8.2.1": { + "node_abi": 57, + "v8": "5.8" + }, + "8.3.0": { + "node_abi": 57, + "v8": "6.0" + }, + "8.4.0": { + "node_abi": 57, + "v8": "6.0" + }, + "8.5.0": { + "node_abi": 57, + "v8": "6.0" + }, + "8.6.0": { + "node_abi": 57, + "v8": "6.0" + }, + "8.7.0": { + "node_abi": 57, + "v8": "6.1" + }, + "8.8.0": { + "node_abi": 57, + "v8": "6.1" + }, + "8.8.1": { + "node_abi": 57, + "v8": "6.1" + }, + "8.9.0": { + "node_abi": 57, + "v8": "6.1" + }, + "8.9.1": { + "node_abi": 57, + "v8": "6.1" + }, + "8.9.2": { + "node_abi": 57, + "v8": "6.1" + }, + "8.9.3": { + "node_abi": 57, + "v8": "6.1" + }, + "8.9.4": { + "node_abi": 57, + "v8": "6.1" + }, + "8.10.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.11.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.11.1": { + "node_abi": 57, + "v8": "6.2" + }, + "8.11.2": { + "node_abi": 57, + "v8": "6.2" + }, + "8.11.3": { + "node_abi": 57, + "v8": "6.2" + }, + "8.11.4": { + "node_abi": 57, + "v8": "6.2" + }, + "8.12.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.13.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.14.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.14.1": { + "node_abi": 57, + "v8": "6.2" + }, + "8.15.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.15.1": { + "node_abi": 57, + "v8": "6.2" + }, + "8.16.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.16.1": { + "node_abi": 57, + "v8": "6.2" + }, + "8.16.2": { + "node_abi": 57, + "v8": "6.2" + }, + "8.17.0": { + "node_abi": 57, + "v8": "6.2" + }, + "9.0.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.1.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.2.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.2.1": { + "node_abi": 59, + "v8": "6.2" + }, + "9.3.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.4.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.5.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.6.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.6.1": { + "node_abi": 59, + "v8": "6.2" + }, + "9.7.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.7.1": { + "node_abi": 59, + "v8": "6.2" + }, + "9.8.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.9.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.10.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.10.1": { + "node_abi": 59, + "v8": "6.2" + }, + "9.11.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.11.1": { + "node_abi": 59, + "v8": "6.2" + }, + "9.11.2": { + "node_abi": 59, + "v8": "6.2" + }, + "10.0.0": { + "node_abi": 64, + "v8": "6.6" + }, + "10.1.0": { + "node_abi": 64, + "v8": "6.6" + }, + "10.2.0": { + "node_abi": 64, + "v8": "6.6" + }, + "10.2.1": { + "node_abi": 64, + "v8": "6.6" + }, + "10.3.0": { + "node_abi": 64, + "v8": "6.6" + }, + "10.4.0": { + "node_abi": 64, + "v8": "6.7" + }, + "10.4.1": { + "node_abi": 64, + "v8": "6.7" + }, + "10.5.0": { + "node_abi": 64, + "v8": "6.7" + }, + "10.6.0": { + "node_abi": 64, + "v8": "6.7" + }, + "10.7.0": { + "node_abi": 64, + "v8": "6.7" + }, + "10.8.0": { + "node_abi": 64, + "v8": "6.7" + }, + "10.9.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.10.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.11.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.12.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.13.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.14.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.14.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.14.2": { + "node_abi": 64, + "v8": "6.8" + }, + "10.15.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.15.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.15.2": { + "node_abi": 64, + "v8": "6.8" + }, + "10.15.3": { + "node_abi": 64, + "v8": "6.8" + }, + "10.16.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.16.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.16.2": { + "node_abi": 64, + "v8": "6.8" + }, + "10.16.3": { + "node_abi": 64, + "v8": "6.8" + }, + "10.17.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.18.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.18.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.19.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.20.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.20.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.21.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.22.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.22.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.23.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.23.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.23.2": { + "node_abi": 64, + "v8": "6.8" + }, + "10.23.3": { + "node_abi": 64, + "v8": "6.8" + }, + "10.24.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.24.1": { + "node_abi": 64, + "v8": "6.8" + }, + "11.0.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.1.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.2.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.3.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.4.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.5.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.6.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.7.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.8.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.9.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.10.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.10.1": { + "node_abi": 67, + "v8": "7.0" + }, + "11.11.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.12.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.13.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.14.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.15.0": { + "node_abi": 67, + "v8": "7.0" + }, + "12.0.0": { + "node_abi": 72, + "v8": "7.4" + }, + "12.1.0": { + "node_abi": 72, + "v8": "7.4" + }, + "12.2.0": { + "node_abi": 72, + "v8": "7.4" + }, + "12.3.0": { + "node_abi": 72, + "v8": "7.4" + }, + "12.3.1": { + "node_abi": 72, + "v8": "7.4" + }, + "12.4.0": { + "node_abi": 72, + "v8": "7.4" + }, + "12.5.0": { + "node_abi": 72, + "v8": "7.5" + }, + "12.6.0": { + "node_abi": 72, + "v8": "7.5" + }, + "12.7.0": { + "node_abi": 72, + "v8": "7.5" + }, + "12.8.0": { + "node_abi": 72, + "v8": "7.5" + }, + "12.8.1": { + "node_abi": 72, + "v8": "7.5" + }, + "12.9.0": { + "node_abi": 72, + "v8": "7.6" + }, + "12.9.1": { + "node_abi": 72, + "v8": "7.6" + }, + "12.10.0": { + "node_abi": 72, + "v8": "7.6" + }, + "12.11.0": { + "node_abi": 72, + "v8": "7.7" + }, + "12.11.1": { + "node_abi": 72, + "v8": "7.7" + }, + "12.12.0": { + "node_abi": 72, + "v8": "7.7" + }, + "12.13.0": { + "node_abi": 72, + "v8": "7.7" + }, + "12.13.1": { + "node_abi": 72, + "v8": "7.7" + }, + "12.14.0": { + "node_abi": 72, + "v8": "7.7" + }, + "12.14.1": { + "node_abi": 72, + "v8": "7.7" + }, + "12.15.0": { + "node_abi": 72, + "v8": "7.7" + }, + "12.16.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.16.1": { + "node_abi": 72, + "v8": "7.8" + }, + "12.16.2": { + "node_abi": 72, + "v8": "7.8" + }, + "12.16.3": { + "node_abi": 72, + "v8": "7.8" + }, + "12.17.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.18.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.18.1": { + "node_abi": 72, + "v8": "7.8" + }, + "12.18.2": { + "node_abi": 72, + "v8": "7.8" + }, + "12.18.3": { + "node_abi": 72, + "v8": "7.8" + }, + "12.18.4": { + "node_abi": 72, + "v8": "7.8" + }, + "12.19.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.19.1": { + "node_abi": 72, + "v8": "7.8" + }, + "12.20.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.20.1": { + "node_abi": 72, + "v8": "7.8" + }, + "12.20.2": { + "node_abi": 72, + "v8": "7.8" + }, + "12.21.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.22.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.22.1": { + "node_abi": 72, + "v8": "7.8" + }, + "12.22.2": { + "node_abi": 72, + "v8": "7.8" + }, + "12.22.3": { + "node_abi": 72, + "v8": "7.8" + }, + "12.22.4": { + "node_abi": 72, + "v8": "7.8" + }, + "12.22.5": { + "node_abi": 72, + "v8": "7.8" + }, + "12.22.6": { + "node_abi": 72, + "v8": "7.8" + }, + "12.22.7": { + "node_abi": 72, + "v8": "7.8" + }, + "13.0.0": { + "node_abi": 79, + "v8": "7.8" + }, + "13.0.1": { + "node_abi": 79, + "v8": "7.8" + }, + "13.1.0": { + "node_abi": 79, + "v8": "7.8" + }, + "13.2.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.3.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.4.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.5.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.6.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.7.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.8.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.9.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.10.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.10.1": { + "node_abi": 79, + "v8": "7.9" + }, + "13.11.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.12.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.13.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.14.0": { + "node_abi": 79, + "v8": "7.9" + }, + "14.0.0": { + "node_abi": 83, + "v8": "8.1" + }, + "14.1.0": { + "node_abi": 83, + "v8": "8.1" + }, + "14.2.0": { + "node_abi": 83, + "v8": "8.1" + }, + "14.3.0": { + "node_abi": 83, + "v8": "8.1" + }, + "14.4.0": { + "node_abi": 83, + "v8": "8.1" + }, + "14.5.0": { + "node_abi": 83, + "v8": "8.3" + }, + "14.6.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.7.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.8.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.9.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.10.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.10.1": { + "node_abi": 83, + "v8": "8.4" + }, + "14.11.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.12.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.13.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.13.1": { + "node_abi": 83, + "v8": "8.4" + }, + "14.14.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.15.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.15.1": { + "node_abi": 83, + "v8": "8.4" + }, + "14.15.2": { + "node_abi": 83, + "v8": "8.4" + }, + "14.15.3": { + "node_abi": 83, + "v8": "8.4" + }, + "14.15.4": { + "node_abi": 83, + "v8": "8.4" + }, + "14.15.5": { + "node_abi": 83, + "v8": "8.4" + }, + "14.16.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.16.1": { + "node_abi": 83, + "v8": "8.4" + }, + "14.17.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.17.1": { + "node_abi": 83, + "v8": "8.4" + }, + "14.17.2": { + "node_abi": 83, + "v8": "8.4" + }, + "14.17.3": { + "node_abi": 83, + "v8": "8.4" + }, + "14.17.4": { + "node_abi": 83, + "v8": "8.4" + }, + "14.17.5": { + "node_abi": 83, + "v8": "8.4" + }, + "14.17.6": { + "node_abi": 83, + "v8": "8.4" + }, + "14.18.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.18.1": { + "node_abi": 83, + "v8": "8.4" + }, + "15.0.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.0.1": { + "node_abi": 88, + "v8": "8.6" + }, + "15.1.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.2.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.2.1": { + "node_abi": 88, + "v8": "8.6" + }, + "15.3.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.4.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.5.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.5.1": { + "node_abi": 88, + "v8": "8.6" + }, + "15.6.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.7.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.8.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.9.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.10.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.11.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.12.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.13.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.14.0": { + "node_abi": 88, + "v8": "8.6" + }, + "16.0.0": { + "node_abi": 93, + "v8": "9.0" + }, + "16.1.0": { + "node_abi": 93, + "v8": "9.0" + }, + "16.2.0": { + "node_abi": 93, + "v8": "9.0" + }, + "16.3.0": { + "node_abi": 93, + "v8": "9.0" + }, + "16.4.0": { + "node_abi": 93, + "v8": "9.1" + }, + "16.4.1": { + "node_abi": 93, + "v8": "9.1" + }, + "16.4.2": { + "node_abi": 93, + "v8": "9.1" + }, + "16.5.0": { + "node_abi": 93, + "v8": "9.1" + }, + "16.6.0": { + "node_abi": 93, + "v8": "9.2" + }, + "16.6.1": { + "node_abi": 93, + "v8": "9.2" + }, + "16.6.2": { + "node_abi": 93, + "v8": "9.2" + }, + "16.7.0": { + "node_abi": 93, + "v8": "9.2" + }, + "16.8.0": { + "node_abi": 93, + "v8": "9.2" + }, + "16.9.0": { + "node_abi": 93, + "v8": "9.3" + }, + "16.9.1": { + "node_abi": 93, + "v8": "9.3" + }, + "16.10.0": { + "node_abi": 93, + "v8": "9.3" + }, + "16.11.0": { + "node_abi": 93, + "v8": "9.4" + }, + "16.11.1": { + "node_abi": 93, + "v8": "9.4" + }, + "16.12.0": { + "node_abi": 93, + "v8": "9.4" + }, + "16.13.0": { + "node_abi": 93, + "v8": "9.4" + }, + "17.0.0": { + "node_abi": 102, + "v8": "9.5" + }, + "17.0.1": { + "node_abi": 102, + "v8": "9.5" + }, + "17.1.0": { + "node_abi": 102, + "v8": "9.5" + } +} \ No newline at end of file diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/util/compile.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/util/compile.js new file mode 100644 index 000000000..956e5aa61 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/util/compile.js @@ -0,0 +1,93 @@ +'use strict'; + +module.exports = exports; + +const fs = require('fs'); +const path = require('path'); +const win = process.platform === 'win32'; +const existsSync = fs.existsSync || path.existsSync; +const cp = require('child_process'); + +// try to build up the complete path to node-gyp +/* priority: + - node-gyp on ENV:npm_config_node_gyp (https://github.com/npm/npm/pull/4887) + - node-gyp on NODE_PATH + - node-gyp inside npm on NODE_PATH (ignore on iojs) + - node-gyp inside npm beside node exe +*/ +function which_node_gyp() { + let node_gyp_bin; + if (process.env.npm_config_node_gyp) { + try { + node_gyp_bin = process.env.npm_config_node_gyp; + if (existsSync(node_gyp_bin)) { + return node_gyp_bin; + } + } catch (err) { + // do nothing + } + } + try { + const node_gyp_main = require.resolve('node-gyp'); // eslint-disable-line node/no-missing-require + node_gyp_bin = path.join(path.dirname( + path.dirname(node_gyp_main)), + 'bin/node-gyp.js'); + if (existsSync(node_gyp_bin)) { + return node_gyp_bin; + } + } catch (err) { + // do nothing + } + if (process.execPath.indexOf('iojs') === -1) { + try { + const npm_main = require.resolve('npm'); // eslint-disable-line node/no-missing-require + node_gyp_bin = path.join(path.dirname( + path.dirname(npm_main)), + 'node_modules/node-gyp/bin/node-gyp.js'); + if (existsSync(node_gyp_bin)) { + return node_gyp_bin; + } + } catch (err) { + // do nothing + } + } + const npm_base = path.join(path.dirname( + path.dirname(process.execPath)), + 'lib/node_modules/npm/'); + node_gyp_bin = path.join(npm_base, 'node_modules/node-gyp/bin/node-gyp.js'); + if (existsSync(node_gyp_bin)) { + return node_gyp_bin; + } +} + +module.exports.run_gyp = function(args, opts, callback) { + let shell_cmd = ''; + const cmd_args = []; + if (opts.runtime && opts.runtime === 'node-webkit') { + shell_cmd = 'nw-gyp'; + if (win) shell_cmd += '.cmd'; + } else { + const node_gyp_path = which_node_gyp(); + if (node_gyp_path) { + shell_cmd = process.execPath; + cmd_args.push(node_gyp_path); + } else { + shell_cmd = 'node-gyp'; + if (win) shell_cmd += '.cmd'; + } + } + const final_args = cmd_args.concat(args); + const cmd = cp.spawn(shell_cmd, final_args, { cwd: undefined, env: process.env, stdio: [0, 1, 2] }); + cmd.on('error', (err) => { + if (err) { + return callback(new Error("Failed to execute '" + shell_cmd + ' ' + final_args.join(' ') + "' (" + err + ')')); + } + callback(null, opts); + }); + cmd.on('close', (code) => { + if (code && code !== 0) { + return callback(new Error("Failed to execute '" + shell_cmd + ' ' + final_args.join(' ') + "' (" + code + ')')); + } + callback(null, opts); + }); +}; diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/util/handle_gyp_opts.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/util/handle_gyp_opts.js new file mode 100644 index 000000000..d702f785e --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/util/handle_gyp_opts.js @@ -0,0 +1,102 @@ +'use strict'; + +module.exports = exports = handle_gyp_opts; + +const versioning = require('./versioning.js'); +const napi = require('./napi.js'); + +/* + +Here we gather node-pre-gyp generated options (from versioning) and pass them along to node-gyp. + +We massage the args and options slightly to account for differences in what commands mean between +node-pre-gyp and node-gyp (e.g. see the difference between "build" and "rebuild" below) + +Keep in mind: the values inside `argv` and `gyp.opts` below are different depending on whether +node-pre-gyp is called directory, or if it is called in a `run-script` phase of npm. + +We also try to preserve any command line options that might have been passed to npm or node-pre-gyp. +But this is fairly difficult without passing way to much through. For example `gyp.opts` contains all +the process.env and npm pushes a lot of variables into process.env which node-pre-gyp inherits. So we have +to be very selective about what we pass through. + +For example: + +`npm install --build-from-source` will give: + +argv == [ 'rebuild' ] +gyp.opts.argv == { remain: [ 'install' ], + cooked: [ 'install', '--fallback-to-build' ], + original: [ 'install', '--fallback-to-build' ] } + +`./bin/node-pre-gyp build` will give: + +argv == [] +gyp.opts.argv == { remain: [ 'build' ], + cooked: [ 'build' ], + original: [ '-C', 'test/app1', 'build' ] } + +*/ + +// select set of node-pre-gyp versioning info +// to share with node-gyp +const share_with_node_gyp = [ + 'module', + 'module_name', + 'module_path', + 'napi_version', + 'node_abi_napi', + 'napi_build_version', + 'node_napi_label' +]; + +function handle_gyp_opts(gyp, argv, callback) { + + // Collect node-pre-gyp specific variables to pass to node-gyp + const node_pre_gyp_options = []; + // generate custom node-pre-gyp versioning info + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(gyp.package_json, gyp.opts, napi_build_version); + share_with_node_gyp.forEach((key) => { + const val = opts[key]; + if (val) { + node_pre_gyp_options.push('--' + key + '=' + val); + } else if (key === 'napi_build_version') { + node_pre_gyp_options.push('--' + key + '=0'); + } else { + if (key !== 'napi_version' && key !== 'node_abi_napi') + return callback(new Error('Option ' + key + ' required but not found by node-pre-gyp')); + } + }); + + // Collect options that follow the special -- which disables nopt parsing + const unparsed_options = []; + let double_hyphen_found = false; + gyp.opts.argv.original.forEach((opt) => { + if (double_hyphen_found) { + unparsed_options.push(opt); + } + if (opt === '--') { + double_hyphen_found = true; + } + }); + + // We try respect and pass through remaining command + // line options (like --foo=bar) to node-gyp + const cooked = gyp.opts.argv.cooked; + const node_gyp_options = []; + cooked.forEach((value) => { + if (value.length > 2 && value.slice(0, 2) === '--') { + const key = value.slice(2); + const val = cooked[cooked.indexOf(value) + 1]; + if (val && val.indexOf('--') === -1) { // handle '--foo=bar' or ['--foo','bar'] + node_gyp_options.push('--' + key + '=' + val); + } else { // pass through --foo + node_gyp_options.push(value); + } + } + }); + + const result = { 'opts': opts, 'gyp': node_gyp_options, 'pre': node_pre_gyp_options, 'unparsed': unparsed_options }; + return callback(null, result); +} diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/util/napi.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/util/napi.js new file mode 100644 index 000000000..5d14ad6d9 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/util/napi.js @@ -0,0 +1,205 @@ +'use strict'; + +const fs = require('fs'); + +module.exports = exports; + +const versionArray = process.version + .substr(1) + .replace(/-.*$/, '') + .split('.') + .map((item) => { + return +item; + }); + +const napi_multiple_commands = [ + 'build', + 'clean', + 'configure', + 'package', + 'publish', + 'reveal', + 'testbinary', + 'testpackage', + 'unpublish' +]; + +const napi_build_version_tag = 'napi_build_version='; + +module.exports.get_napi_version = function() { + // returns the non-zero numeric napi version or undefined if napi is not supported. + // correctly supporting target requires an updated cross-walk + let version = process.versions.napi; // can be undefined + if (!version) { // this code should never need to be updated + if (versionArray[0] === 9 && versionArray[1] >= 3) version = 2; // 9.3.0+ + else if (versionArray[0] === 8) version = 1; // 8.0.0+ + } + return version; +}; + +module.exports.get_napi_version_as_string = function(target) { + // returns the napi version as a string or an empty string if napi is not supported. + const version = module.exports.get_napi_version(target); + return version ? '' + version : ''; +}; + +module.exports.validate_package_json = function(package_json, opts) { // throws Error + + const binary = package_json.binary; + const module_path_ok = pathOK(binary.module_path); + const remote_path_ok = pathOK(binary.remote_path); + const package_name_ok = pathOK(binary.package_name); + const napi_build_versions = module.exports.get_napi_build_versions(package_json, opts, true); + const napi_build_versions_raw = module.exports.get_napi_build_versions_raw(package_json); + + if (napi_build_versions) { + napi_build_versions.forEach((napi_build_version)=> { + if (!(parseInt(napi_build_version, 10) === napi_build_version && napi_build_version > 0)) { + throw new Error('All values specified in napi_versions must be positive integers.'); + } + }); + } + + if (napi_build_versions && (!module_path_ok || (!remote_path_ok && !package_name_ok))) { + throw new Error('When napi_versions is specified; module_path and either remote_path or ' + + "package_name must contain the substitution string '{napi_build_version}`."); + } + + if ((module_path_ok || remote_path_ok || package_name_ok) && !napi_build_versions_raw) { + throw new Error("When the substitution string '{napi_build_version}` is specified in " + + 'module_path, remote_path, or package_name; napi_versions must also be specified.'); + } + + if (napi_build_versions && !module.exports.get_best_napi_build_version(package_json, opts) && + module.exports.build_napi_only(package_json)) { + throw new Error( + 'The Node-API version of this Node instance is ' + module.exports.get_napi_version(opts ? opts.target : undefined) + '. ' + + 'This module supports Node-API version(s) ' + module.exports.get_napi_build_versions_raw(package_json) + '. ' + + 'This Node instance cannot run this module.'); + } + + if (napi_build_versions_raw && !napi_build_versions && module.exports.build_napi_only(package_json)) { + throw new Error( + 'The Node-API version of this Node instance is ' + module.exports.get_napi_version(opts ? opts.target : undefined) + '. ' + + 'This module supports Node-API version(s) ' + module.exports.get_napi_build_versions_raw(package_json) + '. ' + + 'This Node instance cannot run this module.'); + } + +}; + +function pathOK(path) { + return path && (path.indexOf('{napi_build_version}') !== -1 || path.indexOf('{node_napi_label}') !== -1); +} + +module.exports.expand_commands = function(package_json, opts, commands) { + const expanded_commands = []; + const napi_build_versions = module.exports.get_napi_build_versions(package_json, opts); + commands.forEach((command)=> { + if (napi_build_versions && command.name === 'install') { + const napi_build_version = module.exports.get_best_napi_build_version(package_json, opts); + const args = napi_build_version ? [napi_build_version_tag + napi_build_version] : []; + expanded_commands.push({ name: command.name, args: args }); + } else if (napi_build_versions && napi_multiple_commands.indexOf(command.name) !== -1) { + napi_build_versions.forEach((napi_build_version)=> { + const args = command.args.slice(); + args.push(napi_build_version_tag + napi_build_version); + expanded_commands.push({ name: command.name, args: args }); + }); + } else { + expanded_commands.push(command); + } + }); + return expanded_commands; +}; + +module.exports.get_napi_build_versions = function(package_json, opts, warnings) { // opts may be undefined + const log = require('npmlog'); + let napi_build_versions = []; + const supported_napi_version = module.exports.get_napi_version(opts ? opts.target : undefined); + // remove duplicates, verify each napi version can actaully be built + if (package_json.binary && package_json.binary.napi_versions) { + package_json.binary.napi_versions.forEach((napi_version) => { + const duplicated = napi_build_versions.indexOf(napi_version) !== -1; + if (!duplicated && supported_napi_version && napi_version <= supported_napi_version) { + napi_build_versions.push(napi_version); + } else if (warnings && !duplicated && supported_napi_version) { + log.info('This Node instance does not support builds for Node-API version', napi_version); + } + }); + } + if (opts && opts['build-latest-napi-version-only']) { + let latest_version = 0; + napi_build_versions.forEach((napi_version) => { + if (napi_version > latest_version) latest_version = napi_version; + }); + napi_build_versions = latest_version ? [latest_version] : []; + } + return napi_build_versions.length ? napi_build_versions : undefined; +}; + +module.exports.get_napi_build_versions_raw = function(package_json) { + const napi_build_versions = []; + // remove duplicates + if (package_json.binary && package_json.binary.napi_versions) { + package_json.binary.napi_versions.forEach((napi_version) => { + if (napi_build_versions.indexOf(napi_version) === -1) { + napi_build_versions.push(napi_version); + } + }); + } + return napi_build_versions.length ? napi_build_versions : undefined; +}; + +module.exports.get_command_arg = function(napi_build_version) { + return napi_build_version_tag + napi_build_version; +}; + +module.exports.get_napi_build_version_from_command_args = function(command_args) { + for (let i = 0; i < command_args.length; i++) { + const arg = command_args[i]; + if (arg.indexOf(napi_build_version_tag) === 0) { + return parseInt(arg.substr(napi_build_version_tag.length), 10); + } + } + return undefined; +}; + +module.exports.swap_build_dir_out = function(napi_build_version) { + if (napi_build_version) { + const rm = require('rimraf'); + rm.sync(module.exports.get_build_dir(napi_build_version)); + fs.renameSync('build', module.exports.get_build_dir(napi_build_version)); + } +}; + +module.exports.swap_build_dir_in = function(napi_build_version) { + if (napi_build_version) { + const rm = require('rimraf'); + rm.sync('build'); + fs.renameSync(module.exports.get_build_dir(napi_build_version), 'build'); + } +}; + +module.exports.get_build_dir = function(napi_build_version) { + return 'build-tmp-napi-v' + napi_build_version; +}; + +module.exports.get_best_napi_build_version = function(package_json, opts) { + let best_napi_build_version = 0; + const napi_build_versions = module.exports.get_napi_build_versions(package_json, opts); + if (napi_build_versions) { + const our_napi_version = module.exports.get_napi_version(opts ? opts.target : undefined); + napi_build_versions.forEach((napi_build_version)=> { + if (napi_build_version > best_napi_build_version && + napi_build_version <= our_napi_version) { + best_napi_build_version = napi_build_version; + } + }); + } + return best_napi_build_version === 0 ? undefined : best_napi_build_version; +}; + +module.exports.build_napi_only = function(package_json) { + return package_json.binary && package_json.binary.package_name && + package_json.binary.package_name.indexOf('{node_napi_label}') === -1; +}; diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/index.html b/backend/node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/index.html new file mode 100644 index 000000000..244466c4c --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/index.html @@ -0,0 +1,26 @@ + + + + +Node-webkit-based module test + + + +

Node-webkit-based module test

+ + diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/package.json b/backend/node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/package.json new file mode 100644 index 000000000..71d03f822 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/package.json @@ -0,0 +1,9 @@ +{ +"main": "index.html", +"name": "nw-pre-gyp-module-test", +"description": "Node-webkit-based module test.", +"version": "0.0.1", +"window": { + "show": false +} +} diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/util/s3_setup.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/util/s3_setup.js new file mode 100644 index 000000000..6b1b1a6c2 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/util/s3_setup.js @@ -0,0 +1,163 @@ +'use strict'; + +module.exports = exports; + +const url = require('url'); +const fs = require('fs'); +const path = require('path'); + +module.exports.detect = function(opts, config) { + const to = opts.hosted_path; + const uri = url.parse(to); + config.prefix = (!uri.pathname || uri.pathname === '/') ? '' : uri.pathname.replace('/', ''); + if (opts.bucket && opts.region) { + config.bucket = opts.bucket; + config.region = opts.region; + config.endpoint = opts.host; + config.s3ForcePathStyle = opts.s3ForcePathStyle; + } else { + const parts = uri.hostname.split('.s3'); + const bucket = parts[0]; + if (!bucket) { + return; + } + if (!config.bucket) { + config.bucket = bucket; + } + if (!config.region) { + const region = parts[1].slice(1).split('.')[0]; + if (region === 'amazonaws') { + config.region = 'us-east-1'; + } else { + config.region = region; + } + } + } +}; + +module.exports.get_s3 = function(config) { + + if (process.env.node_pre_gyp_mock_s3) { + // here we're mocking. node_pre_gyp_mock_s3 is the scratch directory + // for the mock code. + const AWSMock = require('mock-aws-s3'); + const os = require('os'); + + AWSMock.config.basePath = `${os.tmpdir()}/mock`; + + const s3 = AWSMock.S3(); + + // wrapped callback maker. fs calls return code of ENOENT but AWS.S3 returns + // NotFound. + const wcb = (fn) => (err, ...args) => { + if (err && err.code === 'ENOENT') { + err.code = 'NotFound'; + } + return fn(err, ...args); + }; + + return { + listObjects(params, callback) { + return s3.listObjects(params, wcb(callback)); + }, + headObject(params, callback) { + return s3.headObject(params, wcb(callback)); + }, + deleteObject(params, callback) { + return s3.deleteObject(params, wcb(callback)); + }, + putObject(params, callback) { + return s3.putObject(params, wcb(callback)); + } + }; + } + + // if not mocking then setup real s3. + const AWS = require('aws-sdk'); + + AWS.config.update(config); + const s3 = new AWS.S3(); + + // need to change if additional options need to be specified. + return { + listObjects(params, callback) { + return s3.listObjects(params, callback); + }, + headObject(params, callback) { + return s3.headObject(params, callback); + }, + deleteObject(params, callback) { + return s3.deleteObject(params, callback); + }, + putObject(params, callback) { + return s3.putObject(params, callback); + } + }; + + + +}; + +// +// function to get the mocking control function. if not mocking it returns a no-op. +// +// if mocking it sets up the mock http interceptors that use the mocked s3 file system +// to fulfill reponses. +module.exports.get_mockS3Http = function() { + let mock_s3 = false; + if (!process.env.node_pre_gyp_mock_s3) { + return () => mock_s3; + } + + const nock = require('nock'); + // the bucket used for testing, as addressed by https. + const host = 'https://mapbox-node-pre-gyp-public-testing-bucket.s3.us-east-1.amazonaws.com'; + const mockDir = process.env.node_pre_gyp_mock_s3 + '/mapbox-node-pre-gyp-public-testing-bucket'; + + // function to setup interceptors. they are "turned off" by setting mock_s3 to false. + const mock_http = () => { + // eslint-disable-next-line no-unused-vars + function get(uri, requestBody) { + const filepath = path.join(mockDir, uri.replace('%2B', '+')); + + try { + fs.accessSync(filepath, fs.constants.R_OK); + } catch (e) { + return [404, 'not found\n']; + } + + // the mock s3 functions just write to disk, so just read from it. + return [200, fs.createReadStream(filepath)]; + } + + // eslint-disable-next-line no-unused-vars + return nock(host) + .persist() + .get(() => mock_s3) // mock any uri for s3 when true + .reply(get); + }; + + // setup interceptors. they check the mock_s3 flag to determine whether to intercept. + mock_http(nock, host, mockDir); + // function to turn matching all requests to s3 on/off. + const mockS3Http = (action) => { + const previous = mock_s3; + if (action === 'off') { + mock_s3 = false; + } else if (action === 'on') { + mock_s3 = true; + } else if (action !== 'get') { + throw new Error(`illegal action for setMockHttp ${action}`); + } + return previous; + }; + + // call mockS3Http with the argument + // - 'on' - turn it on + // - 'off' - turn it off (used by fetch.test.js so it doesn't interfere with redirects) + // - 'get' - return true or false for 'on' or 'off' + return mockS3Http; +}; + + + diff --git a/backend/node_modules/@mapbox/node-pre-gyp/lib/util/versioning.js b/backend/node_modules/@mapbox/node-pre-gyp/lib/util/versioning.js new file mode 100644 index 000000000..825cfa1df --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/lib/util/versioning.js @@ -0,0 +1,335 @@ +'use strict'; + +module.exports = exports; + +const path = require('path'); +const semver = require('semver'); +const url = require('url'); +const detect_libc = require('detect-libc'); +const napi = require('./napi.js'); + +let abi_crosswalk; + +// This is used for unit testing to provide a fake +// ABI crosswalk that emulates one that is not updated +// for the current version +if (process.env.NODE_PRE_GYP_ABI_CROSSWALK) { + abi_crosswalk = require(process.env.NODE_PRE_GYP_ABI_CROSSWALK); +} else { + abi_crosswalk = require('./abi_crosswalk.json'); +} + +const major_versions = {}; +Object.keys(abi_crosswalk).forEach((v) => { + const major = v.split('.')[0]; + if (!major_versions[major]) { + major_versions[major] = v; + } +}); + +function get_electron_abi(runtime, target_version) { + if (!runtime) { + throw new Error('get_electron_abi requires valid runtime arg'); + } + if (typeof target_version === 'undefined') { + // erroneous CLI call + throw new Error('Empty target version is not supported if electron is the target.'); + } + // Electron guarantees that patch version update won't break native modules. + const sem_ver = semver.parse(target_version); + return runtime + '-v' + sem_ver.major + '.' + sem_ver.minor; +} +module.exports.get_electron_abi = get_electron_abi; + +function get_node_webkit_abi(runtime, target_version) { + if (!runtime) { + throw new Error('get_node_webkit_abi requires valid runtime arg'); + } + if (typeof target_version === 'undefined') { + // erroneous CLI call + throw new Error('Empty target version is not supported if node-webkit is the target.'); + } + return runtime + '-v' + target_version; +} +module.exports.get_node_webkit_abi = get_node_webkit_abi; + +function get_node_abi(runtime, versions) { + if (!runtime) { + throw new Error('get_node_abi requires valid runtime arg'); + } + if (!versions) { + throw new Error('get_node_abi requires valid process.versions object'); + } + const sem_ver = semver.parse(versions.node); + if (sem_ver.major === 0 && sem_ver.minor % 2) { // odd series + // https://github.com/mapbox/node-pre-gyp/issues/124 + return runtime + '-v' + versions.node; + } else { + // process.versions.modules added in >= v0.10.4 and v0.11.7 + // https://github.com/joyent/node/commit/ccabd4a6fa8a6eb79d29bc3bbe9fe2b6531c2d8e + return versions.modules ? runtime + '-v' + (+versions.modules) : + 'v8-' + versions.v8.split('.').slice(0, 2).join('.'); + } +} +module.exports.get_node_abi = get_node_abi; + +function get_runtime_abi(runtime, target_version) { + if (!runtime) { + throw new Error('get_runtime_abi requires valid runtime arg'); + } + if (runtime === 'node-webkit') { + return get_node_webkit_abi(runtime, target_version || process.versions['node-webkit']); + } else if (runtime === 'electron') { + return get_electron_abi(runtime, target_version || process.versions.electron); + } else { + if (runtime !== 'node') { + throw new Error("Unknown Runtime: '" + runtime + "'"); + } + if (!target_version) { + return get_node_abi(runtime, process.versions); + } else { + let cross_obj; + // abi_crosswalk generated with ./scripts/abi_crosswalk.js + if (abi_crosswalk[target_version]) { + cross_obj = abi_crosswalk[target_version]; + } else { + const target_parts = target_version.split('.').map((i) => { return +i; }); + if (target_parts.length !== 3) { // parse failed + throw new Error('Unknown target version: ' + target_version); + } + /* + The below code tries to infer the last known ABI compatible version + that we have recorded in the abi_crosswalk.json when an exact match + is not possible. The reasons for this to exist are complicated: + + - We support passing --target to be able to allow developers to package binaries for versions of node + that are not the same one as they are running. This might also be used in combination with the + --target_arch or --target_platform flags to also package binaries for alternative platforms + - When --target is passed we can't therefore determine the ABI (process.versions.modules) from the node + version that is running in memory + - So, therefore node-pre-gyp keeps an "ABI crosswalk" (lib/util/abi_crosswalk.json) to be able to look + this info up for all versions + - But we cannot easily predict what the future ABI will be for released versions + - And node-pre-gyp needs to be a `bundledDependency` in apps that depend on it in order to work correctly + by being fully available at install time. + - So, the speed of node releases and the bundled nature of node-pre-gyp mean that a new node-pre-gyp release + need to happen for every node.js/io.js/node-webkit/nw.js/atom-shell/etc release that might come online if + you want the `--target` flag to keep working for the latest version + - Which is impractical ^^ + - Hence the below code guesses about future ABI to make the need to update node-pre-gyp less demanding. + + In practice then you can have a dependency of your app like `node-sqlite3` that bundles a `node-pre-gyp` that + only knows about node v0.10.33 in the `abi_crosswalk.json` but target node v0.10.34 (which is assumed to be + ABI compatible with v0.10.33). + + TODO: use semver module instead of custom version parsing + */ + const major = target_parts[0]; + let minor = target_parts[1]; + let patch = target_parts[2]; + // io.js: yeah if node.js ever releases 1.x this will break + // but that is unlikely to happen: https://github.com/iojs/io.js/pull/253#issuecomment-69432616 + if (major === 1) { + // look for last release that is the same major version + // e.g. we assume io.js 1.x is ABI compatible with >= 1.0.0 + while (true) { + if (minor > 0) --minor; + if (patch > 0) --patch; + const new_iojs_target = '' + major + '.' + minor + '.' + patch; + if (abi_crosswalk[new_iojs_target]) { + cross_obj = abi_crosswalk[new_iojs_target]; + console.log('Warning: node-pre-gyp could not find exact match for ' + target_version); + console.log('Warning: but node-pre-gyp successfully choose ' + new_iojs_target + ' as ABI compatible target'); + break; + } + if (minor === 0 && patch === 0) { + break; + } + } + } else if (major >= 2) { + // look for last release that is the same major version + if (major_versions[major]) { + cross_obj = abi_crosswalk[major_versions[major]]; + console.log('Warning: node-pre-gyp could not find exact match for ' + target_version); + console.log('Warning: but node-pre-gyp successfully choose ' + major_versions[major] + ' as ABI compatible target'); + } + } else if (major === 0) { // node.js + if (target_parts[1] % 2 === 0) { // for stable/even node.js series + // look for the last release that is the same minor release + // e.g. we assume node 0.10.x is ABI compatible with >= 0.10.0 + while (--patch > 0) { + const new_node_target = '' + major + '.' + minor + '.' + patch; + if (abi_crosswalk[new_node_target]) { + cross_obj = abi_crosswalk[new_node_target]; + console.log('Warning: node-pre-gyp could not find exact match for ' + target_version); + console.log('Warning: but node-pre-gyp successfully choose ' + new_node_target + ' as ABI compatible target'); + break; + } + } + } + } + } + if (!cross_obj) { + throw new Error('Unsupported target version: ' + target_version); + } + // emulate process.versions + const versions_obj = { + node: target_version, + v8: cross_obj.v8 + '.0', + // abi_crosswalk uses 1 for node versions lacking process.versions.modules + // process.versions.modules added in >= v0.10.4 and v0.11.7 + modules: cross_obj.node_abi > 1 ? cross_obj.node_abi : undefined + }; + return get_node_abi(runtime, versions_obj); + } + } +} +module.exports.get_runtime_abi = get_runtime_abi; + +const required_parameters = [ + 'module_name', + 'module_path', + 'host' +]; + +function validate_config(package_json, opts) { + const msg = package_json.name + ' package.json is not node-pre-gyp ready:\n'; + const missing = []; + if (!package_json.main) { + missing.push('main'); + } + if (!package_json.version) { + missing.push('version'); + } + if (!package_json.name) { + missing.push('name'); + } + if (!package_json.binary) { + missing.push('binary'); + } + const o = package_json.binary; + if (o) { + required_parameters.forEach((p) => { + if (!o[p] || typeof o[p] !== 'string') { + missing.push('binary.' + p); + } + }); + } + + if (missing.length >= 1) { + throw new Error(msg + 'package.json must declare these properties: \n' + missing.join('\n')); + } + if (o) { + // enforce https over http + const protocol = url.parse(o.host).protocol; + if (protocol === 'http:') { + throw new Error("'host' protocol (" + protocol + ") is invalid - only 'https:' is accepted"); + } + } + napi.validate_package_json(package_json, opts); +} + +module.exports.validate_config = validate_config; + +function eval_template(template, opts) { + Object.keys(opts).forEach((key) => { + const pattern = '{' + key + '}'; + while (template.indexOf(pattern) > -1) { + template = template.replace(pattern, opts[key]); + } + }); + return template; +} + +// url.resolve needs single trailing slash +// to behave correctly, otherwise a double slash +// may end up in the url which breaks requests +// and a lacking slash may not lead to proper joining +function fix_slashes(pathname) { + if (pathname.slice(-1) !== '/') { + return pathname + '/'; + } + return pathname; +} + +// remove double slashes +// note: path.normalize will not work because +// it will convert forward to back slashes +function drop_double_slashes(pathname) { + return pathname.replace(/\/\//g, '/'); +} + +function get_process_runtime(versions) { + let runtime = 'node'; + if (versions['node-webkit']) { + runtime = 'node-webkit'; + } else if (versions.electron) { + runtime = 'electron'; + } + return runtime; +} + +module.exports.get_process_runtime = get_process_runtime; + +const default_package_name = '{module_name}-v{version}-{node_abi}-{platform}-{arch}.tar.gz'; +const default_remote_path = ''; + +module.exports.evaluate = function(package_json, options, napi_build_version) { + options = options || {}; + validate_config(package_json, options); // options is a suitable substitute for opts in this case + const v = package_json.version; + const module_version = semver.parse(v); + const runtime = options.runtime || get_process_runtime(process.versions); + const opts = { + name: package_json.name, + configuration: options.debug ? 'Debug' : 'Release', + debug: options.debug, + module_name: package_json.binary.module_name, + version: module_version.version, + prerelease: module_version.prerelease.length ? module_version.prerelease.join('.') : '', + build: module_version.build.length ? module_version.build.join('.') : '', + major: module_version.major, + minor: module_version.minor, + patch: module_version.patch, + runtime: runtime, + node_abi: get_runtime_abi(runtime, options.target), + node_abi_napi: napi.get_napi_version(options.target) ? 'napi' : get_runtime_abi(runtime, options.target), + napi_version: napi.get_napi_version(options.target), // non-zero numeric, undefined if unsupported + napi_build_version: napi_build_version || '', + node_napi_label: napi_build_version ? 'napi-v' + napi_build_version : get_runtime_abi(runtime, options.target), + target: options.target || '', + platform: options.target_platform || process.platform, + target_platform: options.target_platform || process.platform, + arch: options.target_arch || process.arch, + target_arch: options.target_arch || process.arch, + libc: options.target_libc || detect_libc.familySync() || 'unknown', + module_main: package_json.main, + toolset: options.toolset || '', // address https://github.com/mapbox/node-pre-gyp/issues/119 + bucket: package_json.binary.bucket, + region: package_json.binary.region, + s3ForcePathStyle: package_json.binary.s3ForcePathStyle || false + }; + // support host mirror with npm config `--{module_name}_binary_host_mirror` + // e.g.: https://github.com/node-inspector/v8-profiler/blob/master/package.json#L25 + // > npm install v8-profiler --profiler_binary_host_mirror=https://npm.taobao.org/mirrors/node-inspector/ + const validModuleName = opts.module_name.replace('-', '_'); + const host = process.env['npm_config_' + validModuleName + '_binary_host_mirror'] || package_json.binary.host; + opts.host = fix_slashes(eval_template(host, opts)); + opts.module_path = eval_template(package_json.binary.module_path, opts); + // now we resolve the module_path to ensure it is absolute so that binding.gyp variables work predictably + if (options.module_root) { + // resolve relative to known module root: works for pre-binding require + opts.module_path = path.join(options.module_root, opts.module_path); + } else { + // resolve relative to current working directory: works for node-pre-gyp commands + opts.module_path = path.resolve(opts.module_path); + } + opts.module = path.join(opts.module_path, opts.module_name + '.node'); + opts.remote_path = package_json.binary.remote_path ? drop_double_slashes(fix_slashes(eval_template(package_json.binary.remote_path, opts))) : default_remote_path; + const package_name = package_json.binary.package_name ? package_json.binary.package_name : default_package_name; + opts.package_name = eval_template(package_name, opts); + opts.staged_tarball = path.join('build/stage', opts.remote_path, opts.package_name); + opts.hosted_path = url.resolve(opts.host, opts.remote_path); + opts.hosted_tarball = url.resolve(opts.hosted_path, opts.package_name); + return opts; +}; diff --git a/backend/node_modules/@mapbox/node-pre-gyp/package.json b/backend/node_modules/@mapbox/node-pre-gyp/package.json new file mode 100644 index 000000000..5e1d6fd58 --- /dev/null +++ b/backend/node_modules/@mapbox/node-pre-gyp/package.json @@ -0,0 +1,62 @@ +{ + "name": "@mapbox/node-pre-gyp", + "description": "Node.js native addon binary install tool", + "version": "1.0.11", + "keywords": [ + "native", + "addon", + "module", + "c", + "c++", + "bindings", + "binary" + ], + "license": "BSD-3-Clause", + "author": "Dane Springmeyer ", + "repository": { + "type": "git", + "url": "git://github.com/mapbox/node-pre-gyp.git" + }, + "bin": "./bin/node-pre-gyp", + "main": "./lib/node-pre-gyp.js", + "dependencies": { + "detect-libc": "^2.0.0", + "https-proxy-agent": "^5.0.0", + "make-dir": "^3.1.0", + "node-fetch": "^2.6.7", + "nopt": "^5.0.0", + "npmlog": "^5.0.1", + "rimraf": "^3.0.2", + "semver": "^7.3.5", + "tar": "^6.1.11" + }, + "devDependencies": { + "@mapbox/cloudfriend": "^5.1.0", + "@mapbox/eslint-config-mapbox": "^3.0.0", + "aws-sdk": "^2.1087.0", + "codecov": "^3.8.3", + "eslint": "^7.32.0", + "eslint-plugin-node": "^11.1.0", + "mock-aws-s3": "^4.0.2", + "nock": "^12.0.3", + "node-addon-api": "^4.3.0", + "nyc": "^15.1.0", + "tape": "^5.5.2", + "tar-fs": "^2.1.1" + }, + "nyc": { + "all": true, + "skip-full": false, + "exclude": [ + "test/**" + ] + }, + "scripts": { + "coverage": "nyc --all --include index.js --include lib/ npm test", + "upload-coverage": "nyc report --reporter json && codecov --clear --flags=unit --file=./coverage/coverage-final.json", + "lint": "eslint bin/node-pre-gyp lib/*js lib/util/*js test/*js scripts/*js", + "fix": "npm run lint -- --fix", + "update-crosswalk": "node scripts/abi_crosswalk.js", + "test": "tape test/*test.js" + } +} diff --git a/backend/node_modules/abbrev/LICENSE b/backend/node_modules/abbrev/LICENSE new file mode 100644 index 000000000..9bcfa9d7d --- /dev/null +++ b/backend/node_modules/abbrev/LICENSE @@ -0,0 +1,46 @@ +This software is dual-licensed under the ISC and MIT licenses. +You may use this software under EITHER of the following licenses. + +---------- + +The ISC License + +Copyright (c) Isaac Z. Schlueter and Contributors + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + +---------- + +Copyright Isaac Z. Schlueter and Contributors +All rights reserved. + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/backend/node_modules/abbrev/README.md b/backend/node_modules/abbrev/README.md new file mode 100644 index 000000000..99746fe67 --- /dev/null +++ b/backend/node_modules/abbrev/README.md @@ -0,0 +1,23 @@ +# abbrev-js + +Just like [ruby's Abbrev](http://apidock.com/ruby/Abbrev). + +Usage: + + var abbrev = require("abbrev"); + abbrev("foo", "fool", "folding", "flop"); + + // returns: + { fl: 'flop' + , flo: 'flop' + , flop: 'flop' + , fol: 'folding' + , fold: 'folding' + , foldi: 'folding' + , foldin: 'folding' + , folding: 'folding' + , foo: 'foo' + , fool: 'fool' + } + +This is handy for command-line scripts, or other cases where you want to be able to accept shorthands. diff --git a/backend/node_modules/abbrev/abbrev.js b/backend/node_modules/abbrev/abbrev.js new file mode 100644 index 000000000..7b1dc5d67 --- /dev/null +++ b/backend/node_modules/abbrev/abbrev.js @@ -0,0 +1,61 @@ +module.exports = exports = abbrev.abbrev = abbrev + +abbrev.monkeyPatch = monkeyPatch + +function monkeyPatch () { + Object.defineProperty(Array.prototype, 'abbrev', { + value: function () { return abbrev(this) }, + enumerable: false, configurable: true, writable: true + }) + + Object.defineProperty(Object.prototype, 'abbrev', { + value: function () { return abbrev(Object.keys(this)) }, + enumerable: false, configurable: true, writable: true + }) +} + +function abbrev (list) { + if (arguments.length !== 1 || !Array.isArray(list)) { + list = Array.prototype.slice.call(arguments, 0) + } + for (var i = 0, l = list.length, args = [] ; i < l ; i ++) { + args[i] = typeof list[i] === "string" ? list[i] : String(list[i]) + } + + // sort them lexicographically, so that they're next to their nearest kin + args = args.sort(lexSort) + + // walk through each, seeing how much it has in common with the next and previous + var abbrevs = {} + , prev = "" + for (var i = 0, l = args.length ; i < l ; i ++) { + var current = args[i] + , next = args[i + 1] || "" + , nextMatches = true + , prevMatches = true + if (current === next) continue + for (var j = 0, cl = current.length ; j < cl ; j ++) { + var curChar = current.charAt(j) + nextMatches = nextMatches && curChar === next.charAt(j) + prevMatches = prevMatches && curChar === prev.charAt(j) + if (!nextMatches && !prevMatches) { + j ++ + break + } + } + prev = current + if (j === cl) { + abbrevs[current] = current + continue + } + for (var a = current.substr(0, j) ; j <= cl ; j ++) { + abbrevs[a] = current + a += current.charAt(j) + } + } + return abbrevs +} + +function lexSort (a, b) { + return a === b ? 0 : a > b ? 1 : -1 +} diff --git a/backend/node_modules/abbrev/package.json b/backend/node_modules/abbrev/package.json new file mode 100644 index 000000000..bf4e8015b --- /dev/null +++ b/backend/node_modules/abbrev/package.json @@ -0,0 +1,21 @@ +{ + "name": "abbrev", + "version": "1.1.1", + "description": "Like ruby's abbrev module, but in js", + "author": "Isaac Z. Schlueter ", + "main": "abbrev.js", + "scripts": { + "test": "tap test.js --100", + "preversion": "npm test", + "postversion": "npm publish", + "postpublish": "git push origin --all; git push origin --tags" + }, + "repository": "http://github.com/isaacs/abbrev-js", + "license": "ISC", + "devDependencies": { + "tap": "^10.1" + }, + "files": [ + "abbrev.js" + ] +} diff --git a/backend/node_modules/accepts/HISTORY.md b/backend/node_modules/accepts/HISTORY.md new file mode 100644 index 000000000..cb5990c7c --- /dev/null +++ b/backend/node_modules/accepts/HISTORY.md @@ -0,0 +1,243 @@ +1.3.8 / 2022-02-02 +================== + + * deps: mime-types@~2.1.34 + - deps: mime-db@~1.51.0 + * deps: negotiator@0.6.3 + +1.3.7 / 2019-04-29 +================== + + * deps: negotiator@0.6.2 + - Fix sorting charset, encoding, and language with extra parameters + +1.3.6 / 2019-04-28 +================== + + * deps: mime-types@~2.1.24 + - deps: mime-db@~1.40.0 + +1.3.5 / 2018-02-28 +================== + + * deps: mime-types@~2.1.18 + - deps: mime-db@~1.33.0 + +1.3.4 / 2017-08-22 +================== + + * deps: mime-types@~2.1.16 + - deps: mime-db@~1.29.0 + +1.3.3 / 2016-05-02 +================== + + * deps: mime-types@~2.1.11 + - deps: mime-db@~1.23.0 + * deps: negotiator@0.6.1 + - perf: improve `Accept` parsing speed + - perf: improve `Accept-Charset` parsing speed + - perf: improve `Accept-Encoding` parsing speed + - perf: improve `Accept-Language` parsing speed + +1.3.2 / 2016-03-08 +================== + + * deps: mime-types@~2.1.10 + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + - deps: mime-db@~1.22.0 + +1.3.1 / 2016-01-19 +================== + + * deps: mime-types@~2.1.9 + - deps: mime-db@~1.21.0 + +1.3.0 / 2015-09-29 +================== + + * deps: mime-types@~2.1.7 + - deps: mime-db@~1.19.0 + * deps: negotiator@0.6.0 + - Fix including type extensions in parameters in `Accept` parsing + - Fix parsing `Accept` parameters with quoted equals + - Fix parsing `Accept` parameters with quoted semicolons + - Lazy-load modules from main entry point + - perf: delay type concatenation until needed + - perf: enable strict mode + - perf: hoist regular expressions + - perf: remove closures getting spec properties + - perf: remove a closure from media type parsing + - perf: remove property delete from media type parsing + +1.2.13 / 2015-09-06 +=================== + + * deps: mime-types@~2.1.6 + - deps: mime-db@~1.18.0 + +1.2.12 / 2015-07-30 +=================== + + * deps: mime-types@~2.1.4 + - deps: mime-db@~1.16.0 + +1.2.11 / 2015-07-16 +=================== + + * deps: mime-types@~2.1.3 + - deps: mime-db@~1.15.0 + +1.2.10 / 2015-07-01 +=================== + + * deps: mime-types@~2.1.2 + - deps: mime-db@~1.14.0 + +1.2.9 / 2015-06-08 +================== + + * deps: mime-types@~2.1.1 + - perf: fix deopt during mapping + +1.2.8 / 2015-06-07 +================== + + * deps: mime-types@~2.1.0 + - deps: mime-db@~1.13.0 + * perf: avoid argument reassignment & argument slice + * perf: avoid negotiator recursive construction + * perf: enable strict mode + * perf: remove unnecessary bitwise operator + +1.2.7 / 2015-05-10 +================== + + * deps: negotiator@0.5.3 + - Fix media type parameter matching to be case-insensitive + +1.2.6 / 2015-05-07 +================== + + * deps: mime-types@~2.0.11 + - deps: mime-db@~1.9.1 + * deps: negotiator@0.5.2 + - Fix comparing media types with quoted values + - Fix splitting media types with quoted commas + +1.2.5 / 2015-03-13 +================== + + * deps: mime-types@~2.0.10 + - deps: mime-db@~1.8.0 + +1.2.4 / 2015-02-14 +================== + + * Support Node.js 0.6 + * deps: mime-types@~2.0.9 + - deps: mime-db@~1.7.0 + * deps: negotiator@0.5.1 + - Fix preference sorting to be stable for long acceptable lists + +1.2.3 / 2015-01-31 +================== + + * deps: mime-types@~2.0.8 + - deps: mime-db@~1.6.0 + +1.2.2 / 2014-12-30 +================== + + * deps: mime-types@~2.0.7 + - deps: mime-db@~1.5.0 + +1.2.1 / 2014-12-30 +================== + + * deps: mime-types@~2.0.5 + - deps: mime-db@~1.3.1 + +1.2.0 / 2014-12-19 +================== + + * deps: negotiator@0.5.0 + - Fix list return order when large accepted list + - Fix missing identity encoding when q=0 exists + - Remove dynamic building of Negotiator class + +1.1.4 / 2014-12-10 +================== + + * deps: mime-types@~2.0.4 + - deps: mime-db@~1.3.0 + +1.1.3 / 2014-11-09 +================== + + * deps: mime-types@~2.0.3 + - deps: mime-db@~1.2.0 + +1.1.2 / 2014-10-14 +================== + + * deps: negotiator@0.4.9 + - Fix error when media type has invalid parameter + +1.1.1 / 2014-09-28 +================== + + * deps: mime-types@~2.0.2 + - deps: mime-db@~1.1.0 + * deps: negotiator@0.4.8 + - Fix all negotiations to be case-insensitive + - Stable sort preferences of same quality according to client order + +1.1.0 / 2014-09-02 +================== + + * update `mime-types` + +1.0.7 / 2014-07-04 +================== + + * Fix wrong type returned from `type` when match after unknown extension + +1.0.6 / 2014-06-24 +================== + + * deps: negotiator@0.4.7 + +1.0.5 / 2014-06-20 +================== + + * fix crash when unknown extension given + +1.0.4 / 2014-06-19 +================== + + * use `mime-types` + +1.0.3 / 2014-06-11 +================== + + * deps: negotiator@0.4.6 + - Order by specificity when quality is the same + +1.0.2 / 2014-05-29 +================== + + * Fix interpretation when header not in request + * deps: pin negotiator@0.4.5 + +1.0.1 / 2014-01-18 +================== + + * Identity encoding isn't always acceptable + * deps: negotiator@~0.4.0 + +1.0.0 / 2013-12-27 +================== + + * Genesis diff --git a/backend/node_modules/accepts/LICENSE b/backend/node_modules/accepts/LICENSE new file mode 100644 index 000000000..06166077b --- /dev/null +++ b/backend/node_modules/accepts/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/backend/node_modules/accepts/README.md b/backend/node_modules/accepts/README.md new file mode 100644 index 000000000..82680c530 --- /dev/null +++ b/backend/node_modules/accepts/README.md @@ -0,0 +1,140 @@ +# accepts + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][github-actions-ci-image]][github-actions-ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Higher level content negotiation based on [negotiator](https://www.npmjs.com/package/negotiator). +Extracted from [koa](https://www.npmjs.com/package/koa) for general use. + +In addition to negotiator, it allows: + +- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])` + as well as `('text/html', 'application/json')`. +- Allows type shorthands such as `json`. +- Returns `false` when no types match +- Treats non-existent headers as `*` + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install accepts +``` + +## API + +```js +var accepts = require('accepts') +``` + +### accepts(req) + +Create a new `Accepts` object for the given `req`. + +#### .charset(charsets) + +Return the first accepted charset. If nothing in `charsets` is accepted, +then `false` is returned. + +#### .charsets() + +Return the charsets that the request accepts, in the order of the client's +preference (most preferred first). + +#### .encoding(encodings) + +Return the first accepted encoding. If nothing in `encodings` is accepted, +then `false` is returned. + +#### .encodings() + +Return the encodings that the request accepts, in the order of the client's +preference (most preferred first). + +#### .language(languages) + +Return the first accepted language. If nothing in `languages` is accepted, +then `false` is returned. + +#### .languages() + +Return the languages that the request accepts, in the order of the client's +preference (most preferred first). + +#### .type(types) + +Return the first accepted type (and it is returned as the same text as what +appears in the `types` array). If nothing in `types` is accepted, then `false` +is returned. + +The `types` array can contain full MIME types or file extensions. Any value +that is not a full MIME types is passed to `require('mime-types').lookup`. + +#### .types() + +Return the types that the request accepts, in the order of the client's +preference (most preferred first). + +## Examples + +### Simple type negotiation + +This simple example shows how to use `accepts` to return a different typed +respond body based on what the client wants to accept. The server lists it's +preferences in order and will get back the best match between the client and +server. + +```js +var accepts = require('accepts') +var http = require('http') + +function app (req, res) { + var accept = accepts(req) + + // the order of this list is significant; should be server preferred order + switch (accept.type(['json', 'html'])) { + case 'json': + res.setHeader('Content-Type', 'application/json') + res.write('{"hello":"world!"}') + break + case 'html': + res.setHeader('Content-Type', 'text/html') + res.write('hello, world!') + break + default: + // the fallback is text/plain, so no need to specify it above + res.setHeader('Content-Type', 'text/plain') + res.write('hello, world!') + break + } + + res.end() +} + +http.createServer(app).listen(3000) +``` + +You can test this out with the cURL program: +```sh +curl -I -H'Accept: text/html' http://localhost:3000/ +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/accepts/master +[coveralls-url]: https://coveralls.io/r/jshttp/accepts?branch=master +[github-actions-ci-image]: https://badgen.net/github/checks/jshttp/accepts/master?label=ci +[github-actions-ci-url]: https://github.com/jshttp/accepts/actions/workflows/ci.yml +[node-version-image]: https://badgen.net/npm/node/accepts +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/accepts +[npm-url]: https://npmjs.org/package/accepts +[npm-version-image]: https://badgen.net/npm/v/accepts diff --git a/backend/node_modules/accepts/index.js b/backend/node_modules/accepts/index.js new file mode 100644 index 000000000..e9b2f63fb --- /dev/null +++ b/backend/node_modules/accepts/index.js @@ -0,0 +1,238 @@ +/*! + * accepts + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var Negotiator = require('negotiator') +var mime = require('mime-types') + +/** + * Module exports. + * @public + */ + +module.exports = Accepts + +/** + * Create a new Accepts object for the given req. + * + * @param {object} req + * @public + */ + +function Accepts (req) { + if (!(this instanceof Accepts)) { + return new Accepts(req) + } + + this.headers = req.headers + this.negotiator = new Negotiator(req) +} + +/** + * Check if the given `type(s)` is acceptable, returning + * the best match when true, otherwise `undefined`, in which + * case you should respond with 406 "Not Acceptable". + * + * The `type` value may be a single mime type string + * such as "application/json", the extension name + * such as "json" or an array `["json", "html", "text/plain"]`. When a list + * or array is given the _best_ match, if any is returned. + * + * Examples: + * + * // Accept: text/html + * this.types('html'); + * // => "html" + * + * // Accept: text/*, application/json + * this.types('html'); + * // => "html" + * this.types('text/html'); + * // => "text/html" + * this.types('json', 'text'); + * // => "json" + * this.types('application/json'); + * // => "application/json" + * + * // Accept: text/*, application/json + * this.types('image/png'); + * this.types('png'); + * // => undefined + * + * // Accept: text/*;q=.5, application/json + * this.types(['html', 'json']); + * this.types('html', 'json'); + * // => "json" + * + * @param {String|Array} types... + * @return {String|Array|Boolean} + * @public + */ + +Accepts.prototype.type = +Accepts.prototype.types = function (types_) { + var types = types_ + + // support flattened arguments + if (types && !Array.isArray(types)) { + types = new Array(arguments.length) + for (var i = 0; i < types.length; i++) { + types[i] = arguments[i] + } + } + + // no types, return all requested types + if (!types || types.length === 0) { + return this.negotiator.mediaTypes() + } + + // no accept header, return first given type + if (!this.headers.accept) { + return types[0] + } + + var mimes = types.map(extToMime) + var accepts = this.negotiator.mediaTypes(mimes.filter(validMime)) + var first = accepts[0] + + return first + ? types[mimes.indexOf(first)] + : false +} + +/** + * Return accepted encodings or best fit based on `encodings`. + * + * Given `Accept-Encoding: gzip, deflate` + * an array sorted by quality is returned: + * + * ['gzip', 'deflate'] + * + * @param {String|Array} encodings... + * @return {String|Array} + * @public + */ + +Accepts.prototype.encoding = +Accepts.prototype.encodings = function (encodings_) { + var encodings = encodings_ + + // support flattened arguments + if (encodings && !Array.isArray(encodings)) { + encodings = new Array(arguments.length) + for (var i = 0; i < encodings.length; i++) { + encodings[i] = arguments[i] + } + } + + // no encodings, return all requested encodings + if (!encodings || encodings.length === 0) { + return this.negotiator.encodings() + } + + return this.negotiator.encodings(encodings)[0] || false +} + +/** + * Return accepted charsets or best fit based on `charsets`. + * + * Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5` + * an array sorted by quality is returned: + * + * ['utf-8', 'utf-7', 'iso-8859-1'] + * + * @param {String|Array} charsets... + * @return {String|Array} + * @public + */ + +Accepts.prototype.charset = +Accepts.prototype.charsets = function (charsets_) { + var charsets = charsets_ + + // support flattened arguments + if (charsets && !Array.isArray(charsets)) { + charsets = new Array(arguments.length) + for (var i = 0; i < charsets.length; i++) { + charsets[i] = arguments[i] + } + } + + // no charsets, return all requested charsets + if (!charsets || charsets.length === 0) { + return this.negotiator.charsets() + } + + return this.negotiator.charsets(charsets)[0] || false +} + +/** + * Return accepted languages or best fit based on `langs`. + * + * Given `Accept-Language: en;q=0.8, es, pt` + * an array sorted by quality is returned: + * + * ['es', 'pt', 'en'] + * + * @param {String|Array} langs... + * @return {Array|String} + * @public + */ + +Accepts.prototype.lang = +Accepts.prototype.langs = +Accepts.prototype.language = +Accepts.prototype.languages = function (languages_) { + var languages = languages_ + + // support flattened arguments + if (languages && !Array.isArray(languages)) { + languages = new Array(arguments.length) + for (var i = 0; i < languages.length; i++) { + languages[i] = arguments[i] + } + } + + // no languages, return all requested languages + if (!languages || languages.length === 0) { + return this.negotiator.languages() + } + + return this.negotiator.languages(languages)[0] || false +} + +/** + * Convert extnames to mime. + * + * @param {String} type + * @return {String} + * @private + */ + +function extToMime (type) { + return type.indexOf('/') === -1 + ? mime.lookup(type) + : type +} + +/** + * Check if mime is valid. + * + * @param {String} type + * @return {String} + * @private + */ + +function validMime (type) { + return typeof type === 'string' +} diff --git a/backend/node_modules/accepts/package.json b/backend/node_modules/accepts/package.json new file mode 100644 index 000000000..0f2d15da9 --- /dev/null +++ b/backend/node_modules/accepts/package.json @@ -0,0 +1,47 @@ +{ + "name": "accepts", + "description": "Higher-level content negotiation", + "version": "1.3.8", + "contributors": [ + "Douglas Christopher Wilson ", + "Jonathan Ong (http://jongleberry.com)" + ], + "license": "MIT", + "repository": "jshttp/accepts", + "dependencies": { + "mime-types": "~2.1.34", + "negotiator": "0.6.3" + }, + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "7.32.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.25.4", + "eslint-plugin-markdown": "2.2.1", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "4.3.1", + "eslint-plugin-standard": "4.1.0", + "mocha": "9.2.0", + "nyc": "15.1.0" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + }, + "keywords": [ + "content", + "negotiation", + "accept", + "accepts" + ] +} diff --git a/backend/node_modules/agent-base/README.md b/backend/node_modules/agent-base/README.md new file mode 100644 index 000000000..256f1f321 --- /dev/null +++ b/backend/node_modules/agent-base/README.md @@ -0,0 +1,145 @@ +agent-base +========== +### Turn a function into an [`http.Agent`][http.Agent] instance +[![Build Status](https://github.com/TooTallNate/node-agent-base/workflows/Node%20CI/badge.svg)](https://github.com/TooTallNate/node-agent-base/actions?workflow=Node+CI) + +This module provides an `http.Agent` generator. That is, you pass it an async +callback function, and it returns a new `http.Agent` instance that will invoke the +given callback function when sending outbound HTTP requests. + +#### Some subclasses: + +Here's some more interesting uses of `agent-base`. +Send a pull request to list yours! + + * [`http-proxy-agent`][http-proxy-agent]: An HTTP(s) proxy `http.Agent` implementation for HTTP endpoints + * [`https-proxy-agent`][https-proxy-agent]: An HTTP(s) proxy `http.Agent` implementation for HTTPS endpoints + * [`pac-proxy-agent`][pac-proxy-agent]: A PAC file proxy `http.Agent` implementation for HTTP and HTTPS + * [`socks-proxy-agent`][socks-proxy-agent]: A SOCKS proxy `http.Agent` implementation for HTTP and HTTPS + + +Installation +------------ + +Install with `npm`: + +``` bash +$ npm install agent-base +``` + + +Example +------- + +Here's a minimal example that creates a new `net.Socket` connection to the server +for every HTTP request (i.e. the equivalent of `agent: false` option): + +```js +var net = require('net'); +var tls = require('tls'); +var url = require('url'); +var http = require('http'); +var agent = require('agent-base'); + +var endpoint = 'http://nodejs.org/api/'; +var parsed = url.parse(endpoint); + +// This is the important part! +parsed.agent = agent(function (req, opts) { + var socket; + // `secureEndpoint` is true when using the https module + if (opts.secureEndpoint) { + socket = tls.connect(opts); + } else { + socket = net.connect(opts); + } + return socket; +}); + +// Everything else works just like normal... +http.get(parsed, function (res) { + console.log('"response" event!', res.headers); + res.pipe(process.stdout); +}); +``` + +Returning a Promise or using an `async` function is also supported: + +```js +agent(async function (req, opts) { + await sleep(1000); + // etc… +}); +``` + +Return another `http.Agent` instance to "pass through" the responsibility +for that HTTP request to that agent: + +```js +agent(function (req, opts) { + return opts.secureEndpoint ? https.globalAgent : http.globalAgent; +}); +``` + + +API +--- + +## Agent(Function callback[, Object options]) → [http.Agent][] + +Creates a base `http.Agent` that will execute the callback function `callback` +for every HTTP request that it is used as the `agent` for. The callback function +is responsible for creating a `stream.Duplex` instance of some kind that will be +used as the underlying socket in the HTTP request. + +The `options` object accepts the following properties: + + * `timeout` - Number - Timeout for the `callback()` function in milliseconds. Defaults to Infinity (optional). + +The callback function should have the following signature: + +### callback(http.ClientRequest req, Object options, Function cb) → undefined + +The ClientRequest `req` can be accessed to read request headers and +and the path, etc. The `options` object contains the options passed +to the `http.request()`/`https.request()` function call, and is formatted +to be directly passed to `net.connect()`/`tls.connect()`, or however +else you want a Socket to be created. Pass the created socket to +the callback function `cb` once created, and the HTTP request will +continue to proceed. + +If the `https` module is used to invoke the HTTP request, then the +`secureEndpoint` property on `options` _will be set to `true`_. + + +License +------- + +(The MIT License) + +Copyright (c) 2013 Nathan Rajlich <nathan@tootallnate.net> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +[http-proxy-agent]: https://github.com/TooTallNate/node-http-proxy-agent +[https-proxy-agent]: https://github.com/TooTallNate/node-https-proxy-agent +[pac-proxy-agent]: https://github.com/TooTallNate/node-pac-proxy-agent +[socks-proxy-agent]: https://github.com/TooTallNate/node-socks-proxy-agent +[http.Agent]: https://nodejs.org/api/http.html#http_class_http_agent diff --git a/backend/node_modules/agent-base/dist/src/index.d.ts b/backend/node_modules/agent-base/dist/src/index.d.ts new file mode 100644 index 000000000..bc4ab744c --- /dev/null +++ b/backend/node_modules/agent-base/dist/src/index.d.ts @@ -0,0 +1,78 @@ +/// +import net from 'net'; +import http from 'http'; +import https from 'https'; +import { Duplex } from 'stream'; +import { EventEmitter } from 'events'; +declare function createAgent(opts?: createAgent.AgentOptions): createAgent.Agent; +declare function createAgent(callback: createAgent.AgentCallback, opts?: createAgent.AgentOptions): createAgent.Agent; +declare namespace createAgent { + interface ClientRequest extends http.ClientRequest { + _last?: boolean; + _hadError?: boolean; + method: string; + } + interface AgentRequestOptions { + host?: string; + path?: string; + port: number; + } + interface HttpRequestOptions extends AgentRequestOptions, Omit { + secureEndpoint: false; + } + interface HttpsRequestOptions extends AgentRequestOptions, Omit { + secureEndpoint: true; + } + type RequestOptions = HttpRequestOptions | HttpsRequestOptions; + type AgentLike = Pick | http.Agent; + type AgentCallbackReturn = Duplex | AgentLike; + type AgentCallbackCallback = (err?: Error | null, socket?: createAgent.AgentCallbackReturn) => void; + type AgentCallbackPromise = (req: createAgent.ClientRequest, opts: createAgent.RequestOptions) => createAgent.AgentCallbackReturn | Promise; + type AgentCallback = typeof Agent.prototype.callback; + type AgentOptions = { + timeout?: number; + }; + /** + * Base `http.Agent` implementation. + * No pooling/keep-alive is implemented by default. + * + * @param {Function} callback + * @api public + */ + class Agent extends EventEmitter { + timeout: number | null; + maxFreeSockets: number; + maxTotalSockets: number; + maxSockets: number; + sockets: { + [key: string]: net.Socket[]; + }; + freeSockets: { + [key: string]: net.Socket[]; + }; + requests: { + [key: string]: http.IncomingMessage[]; + }; + options: https.AgentOptions; + private promisifiedCallback?; + private explicitDefaultPort?; + private explicitProtocol?; + constructor(callback?: createAgent.AgentCallback | createAgent.AgentOptions, _opts?: createAgent.AgentOptions); + get defaultPort(): number; + set defaultPort(v: number); + get protocol(): string; + set protocol(v: string); + callback(req: createAgent.ClientRequest, opts: createAgent.RequestOptions, fn: createAgent.AgentCallbackCallback): void; + callback(req: createAgent.ClientRequest, opts: createAgent.RequestOptions): createAgent.AgentCallbackReturn | Promise; + /** + * Called by node-core's "_http_client.js" module when creating + * a new HTTP request with this Agent instance. + * + * @api public + */ + addRequest(req: ClientRequest, _opts: RequestOptions): void; + freeSocket(socket: net.Socket, opts: AgentOptions): void; + destroy(): void; + } +} +export = createAgent; diff --git a/backend/node_modules/agent-base/dist/src/index.js b/backend/node_modules/agent-base/dist/src/index.js new file mode 100644 index 000000000..bfd9e2207 --- /dev/null +++ b/backend/node_modules/agent-base/dist/src/index.js @@ -0,0 +1,203 @@ +"use strict"; +var __importDefault = (this && this.__importDefault) || function (mod) { + return (mod && mod.__esModule) ? mod : { "default": mod }; +}; +const events_1 = require("events"); +const debug_1 = __importDefault(require("debug")); +const promisify_1 = __importDefault(require("./promisify")); +const debug = debug_1.default('agent-base'); +function isAgent(v) { + return Boolean(v) && typeof v.addRequest === 'function'; +} +function isSecureEndpoint() { + const { stack } = new Error(); + if (typeof stack !== 'string') + return false; + return stack.split('\n').some(l => l.indexOf('(https.js:') !== -1 || l.indexOf('node:https:') !== -1); +} +function createAgent(callback, opts) { + return new createAgent.Agent(callback, opts); +} +(function (createAgent) { + /** + * Base `http.Agent` implementation. + * No pooling/keep-alive is implemented by default. + * + * @param {Function} callback + * @api public + */ + class Agent extends events_1.EventEmitter { + constructor(callback, _opts) { + super(); + let opts = _opts; + if (typeof callback === 'function') { + this.callback = callback; + } + else if (callback) { + opts = callback; + } + // Timeout for the socket to be returned from the callback + this.timeout = null; + if (opts && typeof opts.timeout === 'number') { + this.timeout = opts.timeout; + } + // These aren't actually used by `agent-base`, but are required + // for the TypeScript definition files in `@types/node` :/ + this.maxFreeSockets = 1; + this.maxSockets = 1; + this.maxTotalSockets = Infinity; + this.sockets = {}; + this.freeSockets = {}; + this.requests = {}; + this.options = {}; + } + get defaultPort() { + if (typeof this.explicitDefaultPort === 'number') { + return this.explicitDefaultPort; + } + return isSecureEndpoint() ? 443 : 80; + } + set defaultPort(v) { + this.explicitDefaultPort = v; + } + get protocol() { + if (typeof this.explicitProtocol === 'string') { + return this.explicitProtocol; + } + return isSecureEndpoint() ? 'https:' : 'http:'; + } + set protocol(v) { + this.explicitProtocol = v; + } + callback(req, opts, fn) { + throw new Error('"agent-base" has no default implementation, you must subclass and override `callback()`'); + } + /** + * Called by node-core's "_http_client.js" module when creating + * a new HTTP request with this Agent instance. + * + * @api public + */ + addRequest(req, _opts) { + const opts = Object.assign({}, _opts); + if (typeof opts.secureEndpoint !== 'boolean') { + opts.secureEndpoint = isSecureEndpoint(); + } + if (opts.host == null) { + opts.host = 'localhost'; + } + if (opts.port == null) { + opts.port = opts.secureEndpoint ? 443 : 80; + } + if (opts.protocol == null) { + opts.protocol = opts.secureEndpoint ? 'https:' : 'http:'; + } + if (opts.host && opts.path) { + // If both a `host` and `path` are specified then it's most + // likely the result of a `url.parse()` call... we need to + // remove the `path` portion so that `net.connect()` doesn't + // attempt to open that as a unix socket file. + delete opts.path; + } + delete opts.agent; + delete opts.hostname; + delete opts._defaultAgent; + delete opts.defaultPort; + delete opts.createConnection; + // Hint to use "Connection: close" + // XXX: non-documented `http` module API :( + req._last = true; + req.shouldKeepAlive = false; + let timedOut = false; + let timeoutId = null; + const timeoutMs = opts.timeout || this.timeout; + const onerror = (err) => { + if (req._hadError) + return; + req.emit('error', err); + // For Safety. Some additional errors might fire later on + // and we need to make sure we don't double-fire the error event. + req._hadError = true; + }; + const ontimeout = () => { + timeoutId = null; + timedOut = true; + const err = new Error(`A "socket" was not created for HTTP request before ${timeoutMs}ms`); + err.code = 'ETIMEOUT'; + onerror(err); + }; + const callbackError = (err) => { + if (timedOut) + return; + if (timeoutId !== null) { + clearTimeout(timeoutId); + timeoutId = null; + } + onerror(err); + }; + const onsocket = (socket) => { + if (timedOut) + return; + if (timeoutId != null) { + clearTimeout(timeoutId); + timeoutId = null; + } + if (isAgent(socket)) { + // `socket` is actually an `http.Agent` instance, so + // relinquish responsibility for this `req` to the Agent + // from here on + debug('Callback returned another Agent instance %o', socket.constructor.name); + socket.addRequest(req, opts); + return; + } + if (socket) { + socket.once('free', () => { + this.freeSocket(socket, opts); + }); + req.onSocket(socket); + return; + } + const err = new Error(`no Duplex stream was returned to agent-base for \`${req.method} ${req.path}\``); + onerror(err); + }; + if (typeof this.callback !== 'function') { + onerror(new Error('`callback` is not defined')); + return; + } + if (!this.promisifiedCallback) { + if (this.callback.length >= 3) { + debug('Converting legacy callback function to promise'); + this.promisifiedCallback = promisify_1.default(this.callback); + } + else { + this.promisifiedCallback = this.callback; + } + } + if (typeof timeoutMs === 'number' && timeoutMs > 0) { + timeoutId = setTimeout(ontimeout, timeoutMs); + } + if ('port' in opts && typeof opts.port !== 'number') { + opts.port = Number(opts.port); + } + try { + debug('Resolving socket for %o request: %o', opts.protocol, `${req.method} ${req.path}`); + Promise.resolve(this.promisifiedCallback(req, opts)).then(onsocket, callbackError); + } + catch (err) { + Promise.reject(err).catch(callbackError); + } + } + freeSocket(socket, opts) { + debug('Freeing socket %o %o', socket.constructor.name, opts); + socket.destroy(); + } + destroy() { + debug('Destroying agent %o', this.constructor.name); + } + } + createAgent.Agent = Agent; + // So that `instanceof` works correctly + createAgent.prototype = createAgent.Agent.prototype; +})(createAgent || (createAgent = {})); +module.exports = createAgent; +//# sourceMappingURL=index.js.map \ No newline at end of file diff --git a/backend/node_modules/agent-base/dist/src/index.js.map b/backend/node_modules/agent-base/dist/src/index.js.map new file mode 100644 index 000000000..bd118ab6b --- /dev/null +++ b/backend/node_modules/agent-base/dist/src/index.js.map @@ -0,0 +1 @@ +{"version":3,"file":"index.js","sourceRoot":"","sources":["../../src/index.ts"],"names":[],"mappings":";;;;AAIA,mCAAsC;AACtC,kDAAgC;AAChC,4DAAoC;AAEpC,MAAM,KAAK,GAAG,eAAW,CAAC,YAAY,CAAC,CAAC;AAExC,SAAS,OAAO,CAAC,CAAM;IACtB,OAAO,OAAO,CAAC,CAAC,CAAC,IAAI,OAAO,CAAC,CAAC,UAAU,KAAK,UAAU,CAAC;AACzD,CAAC;AAED,SAAS,gBAAgB;IACxB,MAAM,EAAE,KAAK,EAAE,GAAG,IAAI,KAAK,EAAE,CAAC;IAC9B,IAAI,OAAO,KAAK,KAAK,QAAQ;QAAE,OAAO,KAAK,CAAC;IAC5C,OAAO,KAAK,CAAC,KAAK,CAAC,IAAI,CAAC,CAAC,IAAI,CAAC,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC,OAAO,CAAC,YAAY,CAAC,KAAK,CAAC,CAAC,IAAK,CAAC,CAAC,OAAO,CAAC,aAAa,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC;AACxG,CAAC;AAOD,SAAS,WAAW,CACnB,QAA+D,EAC/D,IAA+B;IAE/B,OAAO,IAAI,WAAW,CAAC,KAAK,CAAC,QAAQ,EAAE,IAAI,CAAC,CAAC;AAC9C,CAAC;AAED,WAAU,WAAW;IAmDpB;;;;;;OAMG;IACH,MAAa,KAAM,SAAQ,qBAAY;QAmBtC,YACC,QAA+D,EAC/D,KAAgC;YAEhC,KAAK,EAAE,CAAC;YAER,IAAI,IAAI,GAAG,KAAK,CAAC;YACjB,IAAI,OAAO,QAAQ,KAAK,UAAU,EAAE;gBACnC,IAAI,CAAC,QAAQ,GAAG,QAAQ,CAAC;aACzB;iBAAM,IAAI,QAAQ,EAAE;gBACpB,IAAI,GAAG,QAAQ,CAAC;aAChB;YAED,0DAA0D;YAC1D,IAAI,CAAC,OAAO,GAAG,IAAI,CAAC;YACpB,IAAI,IAAI,IAAI,OAAO,IAAI,CAAC,OAAO,KAAK,QAAQ,EAAE;gBAC7C,IAAI,CAAC,OAAO,GAAG,IAAI,CAAC,OAAO,CAAC;aAC5B;YAED,+DAA+D;YAC/D,0DAA0D;YAC1D,IAAI,CAAC,cAAc,GAAG,CAAC,CAAC;YACxB,IAAI,CAAC,UAAU,GAAG,CAAC,CAAC;YACpB,IAAI,CAAC,eAAe,GAAG,QAAQ,CAAC;YAChC,IAAI,CAAC,OAAO,GAAG,EAAE,CAAC;YAClB,IAAI,CAAC,WAAW,GAAG,EAAE,CAAC;YACtB,IAAI,CAAC,QAAQ,GAAG,EAAE,CAAC;YACnB,IAAI,CAAC,OAAO,GAAG,EAAE,CAAC;QACnB,CAAC;QAED,IAAI,WAAW;YACd,IAAI,OAAO,IAAI,CAAC,mBAAmB,KAAK,QAAQ,EAAE;gBACjD,OAAO,IAAI,CAAC,mBAAmB,CAAC;aAChC;YACD,OAAO,gBAAgB,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,CAAC,EAAE,CAAC;QACtC,CAAC;QAED,IAAI,WAAW,CAAC,CAAS;YACxB,IAAI,CAAC,mBAAmB,GAAG,CAAC,CAAC;QAC9B,CAAC;QAED,IAAI,QAAQ;YACX,IAAI,OAAO,IAAI,CAAC,gBAAgB,KAAK,QAAQ,EAAE;gBAC9C,OAAO,IAAI,CAAC,gBAAgB,CAAC;aAC7B;YACD,OAAO,gBAAgB,EAAE,CAAC,CAAC,CAAC,QAAQ,CAAC,CAAC,CAAC,OAAO,CAAC;QAChD,CAAC;QAED,IAAI,QAAQ,CAAC,CAAS;YACrB,IAAI,CAAC,gBAAgB,GAAG,CAAC,CAAC;QAC3B,CAAC;QAaD,QAAQ,CACP,GAA8B,EAC9B,IAA8B,EAC9B,EAAsC;YAKtC,MAAM,IAAI,KAAK,CACd,yFAAyF,CACzF,CAAC;QACH,CAAC;QAED;;;;;WAKG;QACH,UAAU,CAAC,GAAkB,EAAE,KAAqB;YACnD,MAAM,IAAI,qBAAwB,KAAK,CAAE,CAAC;YAE1C,IAAI,OAAO,IAAI,CAAC,cAAc,KAAK,SAAS,EAAE;gBAC7C,IAAI,CAAC,cAAc,GAAG,gBAAgB,EAAE,CAAC;aACzC;YAED,IAAI,IAAI,CAAC,IAAI,IAAI,IAAI,EAAE;gBACtB,IAAI,CAAC,IAAI,GAAG,WAAW,CAAC;aACxB;YAED,IAAI,IAAI,CAAC,IAAI,IAAI,IAAI,EAAE;gBACtB,IAAI,CAAC,IAAI,GAAG,IAAI,CAAC,cAAc,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,CAAC,EAAE,CAAC;aAC3C;YAED,IAAI,IAAI,CAAC,QAAQ,IAAI,IAAI,EAAE;gBAC1B,IAAI,CAAC,QAAQ,GAAG,IAAI,CAAC,cAAc,CAAC,CAAC,CAAC,QAAQ,CAAC,CAAC,CAAC,OAAO,CAAC;aACzD;YAED,IAAI,IAAI,CAAC,IAAI,IAAI,IAAI,CAAC,IAAI,EAAE;gBAC3B,2DAA2D;gBAC3D,0DAA0D;gBAC1D,4DAA4D;gBAC5D,8CAA8C;gBAC9C,OAAO,IAAI,CAAC,IAAI,CAAC;aACjB;YAED,OAAO,IAAI,CAAC,KAAK,CAAC;YAClB,OAAO,IAAI,CAAC,QAAQ,CAAC;YACrB,OAAO,IAAI,CAAC,aAAa,CAAC;YAC1B,OAAO,IAAI,CAAC,WAAW,CAAC;YACxB,OAAO,IAAI,CAAC,gBAAgB,CAAC;YAE7B,kCAAkC;YAClC,2CAA2C;YAC3C,GAAG,CAAC,KAAK,GAAG,IAAI,CAAC;YACjB,GAAG,CAAC,eAAe,GAAG,KAAK,CAAC;YAE5B,IAAI,QAAQ,GAAG,KAAK,CAAC;YACrB,IAAI,SAAS,GAAyC,IAAI,CAAC;YAC3D,MAAM,SAAS,GAAG,IAAI,CAAC,OAAO,IAAI,IAAI,CAAC,OAAO,CAAC;YAE/C,MAAM,OAAO,GAAG,CAAC,GAA0B,EAAE,EAAE;gBAC9C,IAAI,GAAG,CAAC,SAAS;oBAAE,OAAO;gBAC1B,GAAG,CAAC,IAAI,CAAC,OAAO,EAAE,GAAG,CAAC,CAAC;gBACvB,yDAAyD;gBACzD,iEAAiE;gBACjE,GAAG,CAAC,SAAS,GAAG,IAAI,CAAC;YACtB,CAAC,CAAC;YAEF,MAAM,SAAS,GAAG,GAAG,EAAE;gBACtB,SAAS,GAAG,IAAI,CAAC;gBACjB,QAAQ,GAAG,IAAI,CAAC;gBAChB,MAAM,GAAG,GAA0B,IAAI,KAAK,CAC3C,sDAAsD,SAAS,IAAI,CACnE,CAAC;gBACF,GAAG,CAAC,IAAI,GAAG,UAAU,CAAC;gBACtB,OAAO,CAAC,GAAG,CAAC,CAAC;YACd,CAAC,CAAC;YAEF,MAAM,aAAa,GAAG,CAAC,GAA0B,EAAE,EAAE;gBACpD,IAAI,QAAQ;oBAAE,OAAO;gBACrB,IAAI,SAAS,KAAK,IAAI,EAAE;oBACvB,YAAY,CAAC,SAAS,CAAC,CAAC;oBACxB,SAAS,GAAG,IAAI,CAAC;iBACjB;gBACD,OAAO,CAAC,GAAG,CAAC,CAAC;YACd,CAAC,CAAC;YAEF,MAAM,QAAQ,GAAG,CAAC,MAA2B,EAAE,EAAE;gBAChD,IAAI,QAAQ;oBAAE,OAAO;gBACrB,IAAI,SAAS,IAAI,IAAI,EAAE;oBACtB,YAAY,CAAC,SAAS,CAAC,CAAC;oBACxB,SAAS,GAAG,IAAI,CAAC;iBACjB;gBAED,IAAI,OAAO,CAAC,MAAM,CAAC,EAAE;oBACpB,oDAAoD;oBACpD,wDAAwD;oBACxD,eAAe;oBACf,KAAK,CACJ,6CAA6C,EAC7C,MAAM,CAAC,WAAW,CAAC,IAAI,CACvB,CAAC;oBACD,MAA4B,CAAC,UAAU,CAAC,GAAG,EAAE,IAAI,CAAC,CAAC;oBACpD,OAAO;iBACP;gBAED,IAAI,MAAM,EAAE;oBACX,MAAM,CAAC,IAAI,CAAC,MAAM,EAAE,GAAG,EAAE;wBACxB,IAAI,CAAC,UAAU,CAAC,MAAoB,EAAE,IAAI,CAAC,CAAC;oBAC7C,CAAC,CAAC,CAAC;oBACH,GAAG,CAAC,QAAQ,CAAC,MAAoB,CAAC,CAAC;oBACnC,OAAO;iBACP;gBAED,MAAM,GAAG,GAAG,IAAI,KAAK,CACpB,qDAAqD,GAAG,CAAC,MAAM,IAAI,GAAG,CAAC,IAAI,IAAI,CAC/E,CAAC;gBACF,OAAO,CAAC,GAAG,CAAC,CAAC;YACd,CAAC,CAAC;YAEF,IAAI,OAAO,IAAI,CAAC,QAAQ,KAAK,UAAU,EAAE;gBACxC,OAAO,CAAC,IAAI,KAAK,CAAC,2BAA2B,CAAC,CAAC,CAAC;gBAChD,OAAO;aACP;YAED,IAAI,CAAC,IAAI,CAAC,mBAAmB,EAAE;gBAC9B,IAAI,IAAI,CAAC,QAAQ,CAAC,MAAM,IAAI,CAAC,EAAE;oBAC9B,KAAK,CAAC,gDAAgD,CAAC,CAAC;oBACxD,IAAI,CAAC,mBAAmB,GAAG,mBAAS,CAAC,IAAI,CAAC,QAAQ,CAAC,CAAC;iBACpD;qBAAM;oBACN,IAAI,CAAC,mBAAmB,GAAG,IAAI,CAAC,QAAQ,CAAC;iBACzC;aACD;YAED,IAAI,OAAO,SAAS,KAAK,QAAQ,IAAI,SAAS,GAAG,CAAC,EAAE;gBACnD,SAAS,GAAG,UAAU,CAAC,SAAS,EAAE,SAAS,CAAC,CAAC;aAC7C;YAED,IAAI,MAAM,IAAI,IAAI,IAAI,OAAO,IAAI,CAAC,IAAI,KAAK,QAAQ,EAAE;gBACpD,IAAI,CAAC,IAAI,GAAG,MAAM,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC;aAC9B;YAED,IAAI;gBACH,KAAK,CACJ,qCAAqC,EACrC,IAAI,CAAC,QAAQ,EACb,GAAG,GAAG,CAAC,MAAM,IAAI,GAAG,CAAC,IAAI,EAAE,CAC3B,CAAC;gBACF,OAAO,CAAC,OAAO,CAAC,IAAI,CAAC,mBAAmB,CAAC,GAAG,EAAE,IAAI,CAAC,CAAC,CAAC,IAAI,CACxD,QAAQ,EACR,aAAa,CACb,CAAC;aACF;YAAC,OAAO,GAAG,EAAE;gBACb,OAAO,CAAC,MAAM,CAAC,GAAG,CAAC,CAAC,KAAK,CAAC,aAAa,CAAC,CAAC;aACzC;QACF,CAAC;QAED,UAAU,CAAC,MAAkB,EAAE,IAAkB;YAChD,KAAK,CAAC,sBAAsB,EAAE,MAAM,CAAC,WAAW,CAAC,IAAI,EAAE,IAAI,CAAC,CAAC;YAC7D,MAAM,CAAC,OAAO,EAAE,CAAC;QAClB,CAAC;QAED,OAAO;YACN,KAAK,CAAC,qBAAqB,EAAE,IAAI,CAAC,WAAW,CAAC,IAAI,CAAC,CAAC;QACrD,CAAC;KACD;IAxPY,iBAAK,QAwPjB,CAAA;IAED,uCAAuC;IACvC,WAAW,CAAC,SAAS,GAAG,WAAW,CAAC,KAAK,CAAC,SAAS,CAAC;AACrD,CAAC,EAtTS,WAAW,KAAX,WAAW,QAsTpB;AAED,iBAAS,WAAW,CAAC"} \ No newline at end of file diff --git a/backend/node_modules/agent-base/dist/src/promisify.d.ts b/backend/node_modules/agent-base/dist/src/promisify.d.ts new file mode 100644 index 000000000..02688696f --- /dev/null +++ b/backend/node_modules/agent-base/dist/src/promisify.d.ts @@ -0,0 +1,4 @@ +import { ClientRequest, RequestOptions, AgentCallbackCallback, AgentCallbackPromise } from './index'; +declare type LegacyCallback = (req: ClientRequest, opts: RequestOptions, fn: AgentCallbackCallback) => void; +export default function promisify(fn: LegacyCallback): AgentCallbackPromise; +export {}; diff --git a/backend/node_modules/agent-base/dist/src/promisify.js b/backend/node_modules/agent-base/dist/src/promisify.js new file mode 100644 index 000000000..b2f6132a7 --- /dev/null +++ b/backend/node_modules/agent-base/dist/src/promisify.js @@ -0,0 +1,18 @@ +"use strict"; +Object.defineProperty(exports, "__esModule", { value: true }); +function promisify(fn) { + return function (req, opts) { + return new Promise((resolve, reject) => { + fn.call(this, req, opts, (err, rtn) => { + if (err) { + reject(err); + } + else { + resolve(rtn); + } + }); + }); + }; +} +exports.default = promisify; +//# sourceMappingURL=promisify.js.map \ No newline at end of file diff --git a/backend/node_modules/agent-base/dist/src/promisify.js.map b/backend/node_modules/agent-base/dist/src/promisify.js.map new file mode 100644 index 000000000..4bff9bfcf --- /dev/null +++ b/backend/node_modules/agent-base/dist/src/promisify.js.map @@ -0,0 +1 @@ +{"version":3,"file":"promisify.js","sourceRoot":"","sources":["../../src/promisify.ts"],"names":[],"mappings":";;AAeA,SAAwB,SAAS,CAAC,EAAkB;IACnD,OAAO,UAAsB,GAAkB,EAAE,IAAoB;QACpE,OAAO,IAAI,OAAO,CAAC,CAAC,OAAO,EAAE,MAAM,EAAE,EAAE;YACtC,EAAE,CAAC,IAAI,CACN,IAAI,EACJ,GAAG,EACH,IAAI,EACJ,CAAC,GAA6B,EAAE,GAAyB,EAAE,EAAE;gBAC5D,IAAI,GAAG,EAAE;oBACR,MAAM,CAAC,GAAG,CAAC,CAAC;iBACZ;qBAAM;oBACN,OAAO,CAAC,GAAG,CAAC,CAAC;iBACb;YACF,CAAC,CACD,CAAC;QACH,CAAC,CAAC,CAAC;IACJ,CAAC,CAAC;AACH,CAAC;AAjBD,4BAiBC"} \ No newline at end of file diff --git a/backend/node_modules/agent-base/node_modules/debug/LICENSE b/backend/node_modules/agent-base/node_modules/debug/LICENSE new file mode 100644 index 000000000..1a9820e26 --- /dev/null +++ b/backend/node_modules/agent-base/node_modules/debug/LICENSE @@ -0,0 +1,20 @@ +(The MIT License) + +Copyright (c) 2014-2017 TJ Holowaychuk +Copyright (c) 2018-2021 Josh Junon + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/backend/node_modules/agent-base/node_modules/debug/README.md b/backend/node_modules/agent-base/node_modules/debug/README.md new file mode 100644 index 000000000..9ebdfbf14 --- /dev/null +++ b/backend/node_modules/agent-base/node_modules/debug/README.md @@ -0,0 +1,481 @@ +# debug +[![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) +[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) + + + +A tiny JavaScript debugging utility modelled after Node.js core's debugging +technique. Works in Node.js and web browsers. + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example [_app.js_](./examples/node/app.js): + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %o', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example [_worker.js_](./examples/node/worker.js): + +```js +var a = require('debug')('worker:a') + , b = require('debug')('worker:b'); + +function work() { + a('doing lots of uninteresting work'); + setTimeout(work, Math.random() * 1000); +} + +work(); + +function workb() { + b('doing some work'); + setTimeout(workb, Math.random() * 2000); +} + +workb(); +``` + +The `DEBUG` environment variable is then used to enable these based on space or +comma-delimited names. + +Here are some examples: + +screen shot 2017-08-08 at 12 53 04 pm +screen shot 2017-08-08 at 12 53 38 pm +screen shot 2017-08-08 at 12 53 25 pm + +#### Windows command prompt notes + +##### CMD + +On Windows the environment variable is set using the `set` command. + +```cmd +set DEBUG=*,-not_this +``` + +Example: + +```cmd +set DEBUG=* & node app.js +``` + +##### PowerShell (VS Code default) + +PowerShell uses different syntax to set environment variables. + +```cmd +$env:DEBUG = "*,-not_this" +``` + +Example: + +```cmd +$env:DEBUG='app';node app.js +``` + +Then, run the program to be debugged as usual. + +npm script example: +```js + "windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js", +``` + +## Namespace Colors + +Every debug instance has a color generated for it based on its namespace name. +This helps when visually parsing the debug output to identify which debug instance +a debug line belongs to. + +#### Node.js + +In Node.js, colors are enabled when stderr is a TTY. You also _should_ install +the [`supports-color`](https://npmjs.org/supports-color) module alongside debug, +otherwise debug will only use a small handful of basic colors. + + + +#### Web Browser + +Colors are also enabled on "Web Inspectors" that understand the `%c` formatting +option. These are WebKit web inspectors, Firefox ([since version +31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) +and the Firebug plugin for Firefox (any version). + + + + +## Millisecond diff + +When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + + +When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below: + + + + +## Conventions + +If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output. + +## Wildcards + +The `*` character may be used as a wildcard. Suppose for example your library has +debuggers named "connect:bodyParser", "connect:compress", "connect:session", +instead of listing all three with +`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do +`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + +You can also exclude specific debuggers by prefixing them with a "-" character. +For example, `DEBUG=*,-connect:*` would include all debuggers except those +starting with "connect:". + +## Environment Variables + +When running through Node.js, you can set a few environment variables that will +change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + +__Note:__ The environment variables beginning with `DEBUG_` end up being +converted into an Options object that gets used with `%o`/`%O` formatters. +See the Node.js documentation for +[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) +for the complete list. + +## Formatters + +Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. +Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + + +### Custom formatters + +You can add custom formatters by extending the `debug.formatters` object. +For example, if you wanted to add support for rendering a Buffer as hex with +`%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + + +## Browser Support + +You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), +or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), +if you don't want to build it yourself. + +Debug's enable state is currently persisted by `localStorage`. +Consider the situation shown below where you have `worker:a` and `worker:b`, +and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + +In Chromium-based web browsers (e.g. Brave, Chrome, and Electron), the JavaScript console will—by default—only show messages logged by `debug` if the "Verbose" log level is _enabled_. + + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example [_stdout.js_](./examples/node/stdout.js): + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + +## Extend +You can simply extend debugger +```js +const log = require('debug')('auth'); + +//creates new debug instance with extended namespace +const logSign = log.extend('sign'); +const logLogin = log.extend('login'); + +log('hello'); // auth hello +logSign('hello'); //auth:sign hello +logLogin('hello'); //auth:login hello +``` + +## Set dynamically + +You can also enable debug dynamically by calling the `enable()` method : + +```js +let debug = require('debug'); + +console.log(1, debug.enabled('test')); + +debug.enable('test'); +console.log(2, debug.enabled('test')); + +debug.disable(); +console.log(3, debug.enabled('test')); + +``` + +print : +``` +1 false +2 true +3 false +``` + +Usage : +`enable(namespaces)` +`namespaces` can include modes separated by a colon and wildcards. + +Note that calling `enable()` completely overrides previously set DEBUG variable : + +``` +$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))' +=> false +``` + +`disable()` + +Will disable all namespaces. The functions returns the namespaces currently +enabled (and skipped). This can be useful if you want to disable debugging +temporarily without knowing what was enabled to begin with. + +For example: + +```js +let debug = require('debug'); +debug.enable('foo:*,-foo:bar'); +let namespaces = debug.disable(); +debug.enable(namespaces); +``` + +Note: There is no guarantee that the string will be identical to the initial +enable string, but semantically they will be identical. + +## Checking whether a debug target is enabled + +After you've created a debug instance, you can determine whether or not it is +enabled by checking the `enabled` property: + +```javascript +const debug = require('debug')('http'); + +if (debug.enabled) { + // do stuff... +} +``` + +You can also manually toggle this property to force the debug instance to be +enabled or disabled. + +## Usage in child processes + +Due to the way `debug` detects if the output is a TTY or not, colors are not shown in child processes when `stderr` is piped. A solution is to pass the `DEBUG_COLORS=1` environment variable to the child process. +For example: + +```javascript +worker = fork(WORKER_WRAP_PATH, [workerPath], { + stdio: [ + /* stdin: */ 0, + /* stdout: */ 'pipe', + /* stderr: */ 'pipe', + 'ipc', + ], + env: Object.assign({}, process.env, { + DEBUG_COLORS: 1 // without this settings, colors won't be shown + }), +}); + +worker.stderr.pipe(process.stderr, { end: false }); +``` + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + - Josh Junon + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## License + +(The MIT License) + +Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca> +Copyright (c) 2018-2021 Josh Junon + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/backend/node_modules/agent-base/node_modules/debug/package.json b/backend/node_modules/agent-base/node_modules/debug/package.json new file mode 100644 index 000000000..60dfcf57c --- /dev/null +++ b/backend/node_modules/agent-base/node_modules/debug/package.json @@ -0,0 +1,65 @@ +{ + "name": "debug", + "version": "4.4.0", + "repository": { + "type": "git", + "url": "git://github.com/debug-js/debug.git" + }, + "description": "Lightweight debugging utility for Node.js and the browser", + "keywords": [ + "debug", + "log", + "debugger" + ], + "files": [ + "src", + "LICENSE", + "README.md" + ], + "author": "Josh Junon (https://github.com/qix-)", + "contributors": [ + "TJ Holowaychuk ", + "Nathan Rajlich (http://n8.io)", + "Andrew Rhyne " + ], + "license": "MIT", + "scripts": { + "lint": "xo", + "test": "npm run test:node && npm run test:browser && npm run lint", + "test:node": "istanbul cover _mocha -- test.js test.node.js", + "test:browser": "karma start --single-run", + "test:coverage": "cat ./coverage/lcov.info | coveralls" + }, + "dependencies": { + "ms": "^2.1.3" + }, + "devDependencies": { + "brfs": "^2.0.1", + "browserify": "^16.2.3", + "coveralls": "^3.0.2", + "istanbul": "^0.4.5", + "karma": "^3.1.4", + "karma-browserify": "^6.0.0", + "karma-chrome-launcher": "^2.2.0", + "karma-mocha": "^1.3.0", + "mocha": "^5.2.0", + "mocha-lcov-reporter": "^1.2.0", + "sinon": "^14.0.0", + "xo": "^0.23.0" + }, + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + }, + "main": "./src/index.js", + "browser": "./src/browser.js", + "engines": { + "node": ">=6.0" + }, + "xo": { + "rules": { + "import/extensions": "off" + } + } +} diff --git a/backend/node_modules/agent-base/node_modules/debug/src/browser.js b/backend/node_modules/agent-base/node_modules/debug/src/browser.js new file mode 100644 index 000000000..df8e179e8 --- /dev/null +++ b/backend/node_modules/agent-base/node_modules/debug/src/browser.js @@ -0,0 +1,272 @@ +/* eslint-env browser */ + +/** + * This is the web browser implementation of `debug()`. + */ + +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = localstorage(); +exports.destroy = (() => { + let warned = false; + + return () => { + if (!warned) { + warned = true; + console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'); + } + }; +})(); + +/** + * Colors. + */ + +exports.colors = [ + '#0000CC', + '#0000FF', + '#0033CC', + '#0033FF', + '#0066CC', + '#0066FF', + '#0099CC', + '#0099FF', + '#00CC00', + '#00CC33', + '#00CC66', + '#00CC99', + '#00CCCC', + '#00CCFF', + '#3300CC', + '#3300FF', + '#3333CC', + '#3333FF', + '#3366CC', + '#3366FF', + '#3399CC', + '#3399FF', + '#33CC00', + '#33CC33', + '#33CC66', + '#33CC99', + '#33CCCC', + '#33CCFF', + '#6600CC', + '#6600FF', + '#6633CC', + '#6633FF', + '#66CC00', + '#66CC33', + '#9900CC', + '#9900FF', + '#9933CC', + '#9933FF', + '#99CC00', + '#99CC33', + '#CC0000', + '#CC0033', + '#CC0066', + '#CC0099', + '#CC00CC', + '#CC00FF', + '#CC3300', + '#CC3333', + '#CC3366', + '#CC3399', + '#CC33CC', + '#CC33FF', + '#CC6600', + '#CC6633', + '#CC9900', + '#CC9933', + '#CCCC00', + '#CCCC33', + '#FF0000', + '#FF0033', + '#FF0066', + '#FF0099', + '#FF00CC', + '#FF00FF', + '#FF3300', + '#FF3333', + '#FF3366', + '#FF3399', + '#FF33CC', + '#FF33FF', + '#FF6600', + '#FF6633', + '#FF9900', + '#FF9933', + '#FFCC00', + '#FFCC33' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +// eslint-disable-next-line complexity +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) { + return true; + } + + // Internet Explorer and Edge do not support colors. + if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { + return false; + } + + let m; + + // Is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + // eslint-disable-next-line no-return-assign + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // Is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // Is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && (m = navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/)) && parseInt(m[1], 10) >= 31) || + // Double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + args[0] = (this.useColors ? '%c' : '') + + this.namespace + + (this.useColors ? ' %c' : ' ') + + args[0] + + (this.useColors ? '%c ' : ' ') + + '+' + module.exports.humanize(this.diff); + + if (!this.useColors) { + return; + } + + const c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit'); + + // The final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + let index = 0; + let lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, match => { + if (match === '%%') { + return; + } + index++; + if (match === '%c') { + // We only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.debug()` when available. + * No-op when `console.debug` is not a "function". + * If `console.debug` is not available, falls back + * to `console.log`. + * + * @api public + */ +exports.log = console.debug || console.log || (() => {}); + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ +function save(namespaces) { + try { + if (namespaces) { + exports.storage.setItem('debug', namespaces); + } else { + exports.storage.removeItem('debug'); + } + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ +function load() { + let r; + try { + r = exports.storage.getItem('debug'); + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + // TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context + // The Browser also has localStorage in the global context. + return localStorage; + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } +} + +module.exports = require('./common')(exports); + +const {formatters} = module.exports; + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +formatters.j = function (v) { + try { + return JSON.stringify(v); + } catch (error) { + return '[UnexpectedJSONParseError]: ' + error.message; + } +}; diff --git a/backend/node_modules/agent-base/node_modules/debug/src/common.js b/backend/node_modules/agent-base/node_modules/debug/src/common.js new file mode 100644 index 000000000..528c7ecf4 --- /dev/null +++ b/backend/node_modules/agent-base/node_modules/debug/src/common.js @@ -0,0 +1,292 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + */ + +function setup(env) { + createDebug.debug = createDebug; + createDebug.default = createDebug; + createDebug.coerce = coerce; + createDebug.disable = disable; + createDebug.enable = enable; + createDebug.enabled = enabled; + createDebug.humanize = require('ms'); + createDebug.destroy = destroy; + + Object.keys(env).forEach(key => { + createDebug[key] = env[key]; + }); + + /** + * The currently active debug mode names, and names to skip. + */ + + createDebug.names = []; + createDebug.skips = []; + + /** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + createDebug.formatters = {}; + + /** + * Selects a color for a debug namespace + * @param {String} namespace The namespace string for the debug instance to be colored + * @return {Number|String} An ANSI color code for the given namespace + * @api private + */ + function selectColor(namespace) { + let hash = 0; + + for (let i = 0; i < namespace.length; i++) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return createDebug.colors[Math.abs(hash) % createDebug.colors.length]; + } + createDebug.selectColor = selectColor; + + /** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + function createDebug(namespace) { + let prevTime; + let enableOverride = null; + let namespacesCache; + let enabledCache; + + function debug(...args) { + // Disabled? + if (!debug.enabled) { + return; + } + + const self = debug; + + // Set `diff` timestamp + const curr = Number(new Date()); + const ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + args[0] = createDebug.coerce(args[0]); + + if (typeof args[0] !== 'string') { + // Anything else let's inspect with %O + args.unshift('%O'); + } + + // Apply any `formatters` transformations + let index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, (match, format) => { + // If we encounter an escaped % then don't increase the array index + if (match === '%%') { + return '%'; + } + index++; + const formatter = createDebug.formatters[format]; + if (typeof formatter === 'function') { + const val = args[index]; + match = formatter.call(self, val); + + // Now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // Apply env-specific formatting (colors, etc.) + createDebug.formatArgs.call(self, args); + + const logFn = self.log || createDebug.log; + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.useColors = createDebug.useColors(); + debug.color = createDebug.selectColor(namespace); + debug.extend = extend; + debug.destroy = createDebug.destroy; // XXX Temporary. Will be removed in the next major release. + + Object.defineProperty(debug, 'enabled', { + enumerable: true, + configurable: false, + get: () => { + if (enableOverride !== null) { + return enableOverride; + } + if (namespacesCache !== createDebug.namespaces) { + namespacesCache = createDebug.namespaces; + enabledCache = createDebug.enabled(namespace); + } + + return enabledCache; + }, + set: v => { + enableOverride = v; + } + }); + + // Env-specific initialization logic for debug instances + if (typeof createDebug.init === 'function') { + createDebug.init(debug); + } + + return debug; + } + + function extend(namespace, delimiter) { + const newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace); + newDebug.log = this.log; + return newDebug; + } + + /** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + function enable(namespaces) { + createDebug.save(namespaces); + createDebug.namespaces = namespaces; + + createDebug.names = []; + createDebug.skips = []; + + const split = (typeof namespaces === 'string' ? namespaces : '') + .trim() + .replace(' ', ',') + .split(',') + .filter(Boolean); + + for (const ns of split) { + if (ns[0] === '-') { + createDebug.skips.push(ns.slice(1)); + } else { + createDebug.names.push(ns); + } + } + } + + /** + * Checks if the given string matches a namespace template, honoring + * asterisks as wildcards. + * + * @param {String} search + * @param {String} template + * @return {Boolean} + */ + function matchesTemplate(search, template) { + let searchIndex = 0; + let templateIndex = 0; + let starIndex = -1; + let matchIndex = 0; + + while (searchIndex < search.length) { + if (templateIndex < template.length && (template[templateIndex] === search[searchIndex] || template[templateIndex] === '*')) { + // Match character or proceed with wildcard + if (template[templateIndex] === '*') { + starIndex = templateIndex; + matchIndex = searchIndex; + templateIndex++; // Skip the '*' + } else { + searchIndex++; + templateIndex++; + } + } else if (starIndex !== -1) { // eslint-disable-line no-negated-condition + // Backtrack to the last '*' and try to match more characters + templateIndex = starIndex + 1; + matchIndex++; + searchIndex = matchIndex; + } else { + return false; // No match + } + } + + // Handle trailing '*' in template + while (templateIndex < template.length && template[templateIndex] === '*') { + templateIndex++; + } + + return templateIndex === template.length; + } + + /** + * Disable debug output. + * + * @return {String} namespaces + * @api public + */ + function disable() { + const namespaces = [ + ...createDebug.names, + ...createDebug.skips.map(namespace => '-' + namespace) + ].join(','); + createDebug.enable(''); + return namespaces; + } + + /** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + function enabled(name) { + for (const skip of createDebug.skips) { + if (matchesTemplate(name, skip)) { + return false; + } + } + + for (const ns of createDebug.names) { + if (matchesTemplate(name, ns)) { + return true; + } + } + + return false; + } + + /** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + function coerce(val) { + if (val instanceof Error) { + return val.stack || val.message; + } + return val; + } + + /** + * XXX DO NOT USE. This is a temporary stub function. + * XXX It WILL be removed in the next major release. + */ + function destroy() { + console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'); + } + + createDebug.enable(createDebug.load()); + + return createDebug; +} + +module.exports = setup; diff --git a/backend/node_modules/agent-base/node_modules/debug/src/index.js b/backend/node_modules/agent-base/node_modules/debug/src/index.js new file mode 100644 index 000000000..bf4c57f25 --- /dev/null +++ b/backend/node_modules/agent-base/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer / nwjs process, which is node, but we should + * treat as a browser. + */ + +if (typeof process === 'undefined' || process.type === 'renderer' || process.browser === true || process.__nwjs) { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/backend/node_modules/agent-base/node_modules/debug/src/node.js b/backend/node_modules/agent-base/node_modules/debug/src/node.js new file mode 100644 index 000000000..715560a4c --- /dev/null +++ b/backend/node_modules/agent-base/node_modules/debug/src/node.js @@ -0,0 +1,263 @@ +/** + * Module dependencies. + */ + +const tty = require('tty'); +const util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + */ + +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.destroy = util.deprecate( + () => {}, + 'Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.' +); + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +try { + // Optional dependency (as in, doesn't need to be installed, NOT like optionalDependencies in package.json) + // eslint-disable-next-line import/no-extraneous-dependencies + const supportsColor = require('supports-color'); + + if (supportsColor && (supportsColor.stderr || supportsColor).level >= 2) { + exports.colors = [ + 20, + 21, + 26, + 27, + 32, + 33, + 38, + 39, + 40, + 41, + 42, + 43, + 44, + 45, + 56, + 57, + 62, + 63, + 68, + 69, + 74, + 75, + 76, + 77, + 78, + 79, + 80, + 81, + 92, + 93, + 98, + 99, + 112, + 113, + 128, + 129, + 134, + 135, + 148, + 149, + 160, + 161, + 162, + 163, + 164, + 165, + 166, + 167, + 168, + 169, + 170, + 171, + 172, + 173, + 178, + 179, + 184, + 185, + 196, + 197, + 198, + 199, + 200, + 201, + 202, + 203, + 204, + 205, + 206, + 207, + 208, + 209, + 214, + 215, + 220, + 221 + ]; + } +} catch (error) { + // Swallow - we only care if `supports-color` is available; it doesn't have to be. +} + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(key => { + return /^debug_/i.test(key); +}).reduce((obj, key) => { + // Camel-case + const prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, (_, k) => { + return k.toUpperCase(); + }); + + // Coerce string value into JS value + let val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) { + val = true; + } else if (/^(no|off|false|disabled)$/i.test(val)) { + val = false; + } else if (val === 'null') { + val = null; + } else { + val = Number(val); + } + + obj[prop] = val; + return obj; +}, {}); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts ? + Boolean(exports.inspectOpts.colors) : + tty.isatty(process.stderr.fd); +} + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + const {namespace: name, useColors} = this; + + if (useColors) { + const c = this.color; + const colorCode = '\u001B[3' + (c < 8 ? c : '8;5;' + c); + const prefix = ` ${colorCode};1m${name} \u001B[0m`; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push(colorCode + 'm+' + module.exports.humanize(this.diff) + '\u001B[0m'); + } else { + args[0] = getDate() + name + ' ' + args[0]; + } +} + +function getDate() { + if (exports.inspectOpts.hideDate) { + return ''; + } + return new Date().toISOString() + ' '; +} + +/** + * Invokes `util.formatWithOptions()` with the specified arguments and writes to stderr. + */ + +function log(...args) { + return process.stderr.write(util.formatWithOptions(exports.inspectOpts, ...args) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ +function save(namespaces) { + if (namespaces) { + process.env.DEBUG = namespaces; + } else { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init(debug) { + debug.inspectOpts = {}; + + const keys = Object.keys(exports.inspectOpts); + for (let i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +module.exports = require('./common')(exports); + +const {formatters} = module.exports; + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +formatters.o = function (v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .split('\n') + .map(str => str.trim()) + .join(' '); +}; + +/** + * Map %O to `util.inspect()`, allowing multiple lines if needed. + */ + +formatters.O = function (v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; diff --git a/backend/node_modules/agent-base/node_modules/ms/index.js b/backend/node_modules/agent-base/node_modules/ms/index.js new file mode 100644 index 000000000..ea734fb73 --- /dev/null +++ b/backend/node_modules/agent-base/node_modules/ms/index.js @@ -0,0 +1,162 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var w = d * 7; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + +module.exports = function (val, options) { + options = options || {}; + var type = typeof val; + if (type === 'string' && val.length > 0) { + return parse(val); + } else if (type === 'number' && isFinite(val)) { + return options.long ? fmtLong(val) : fmtShort(val); + } + throw new Error( + 'val is not a non-empty string or a valid number. val=' + + JSON.stringify(val) + ); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = String(str); + if (str.length > 100) { + return; + } + var match = /^(-?(?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec( + str + ); + if (!match) { + return; + } + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'weeks': + case 'week': + case 'w': + return n * w; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + default: + return undefined; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtShort(ms) { + var msAbs = Math.abs(ms); + if (msAbs >= d) { + return Math.round(ms / d) + 'd'; + } + if (msAbs >= h) { + return Math.round(ms / h) + 'h'; + } + if (msAbs >= m) { + return Math.round(ms / m) + 'm'; + } + if (msAbs >= s) { + return Math.round(ms / s) + 's'; + } + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtLong(ms) { + var msAbs = Math.abs(ms); + if (msAbs >= d) { + return plural(ms, msAbs, d, 'day'); + } + if (msAbs >= h) { + return plural(ms, msAbs, h, 'hour'); + } + if (msAbs >= m) { + return plural(ms, msAbs, m, 'minute'); + } + if (msAbs >= s) { + return plural(ms, msAbs, s, 'second'); + } + return ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, msAbs, n, name) { + var isPlural = msAbs >= n * 1.5; + return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : ''); +} diff --git a/backend/node_modules/agent-base/node_modules/ms/license.md b/backend/node_modules/agent-base/node_modules/ms/license.md new file mode 100644 index 000000000..fa5d39b62 --- /dev/null +++ b/backend/node_modules/agent-base/node_modules/ms/license.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2020 Vercel, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/backend/node_modules/agent-base/node_modules/ms/package.json b/backend/node_modules/agent-base/node_modules/ms/package.json new file mode 100644 index 000000000..49971890d --- /dev/null +++ b/backend/node_modules/agent-base/node_modules/ms/package.json @@ -0,0 +1,38 @@ +{ + "name": "ms", + "version": "2.1.3", + "description": "Tiny millisecond conversion utility", + "repository": "vercel/ms", + "main": "./index", + "files": [ + "index.js" + ], + "scripts": { + "precommit": "lint-staged", + "lint": "eslint lib/* bin/*", + "test": "mocha tests.js" + }, + "eslintConfig": { + "extends": "eslint:recommended", + "env": { + "node": true, + "es6": true + } + }, + "lint-staged": { + "*.js": [ + "npm run lint", + "prettier --single-quote --write", + "git add" + ] + }, + "license": "MIT", + "devDependencies": { + "eslint": "4.18.2", + "expect.js": "0.3.1", + "husky": "0.14.3", + "lint-staged": "5.0.0", + "mocha": "4.0.1", + "prettier": "2.0.5" + } +} diff --git a/backend/node_modules/agent-base/node_modules/ms/readme.md b/backend/node_modules/agent-base/node_modules/ms/readme.md new file mode 100644 index 000000000..0fc1abb3b --- /dev/null +++ b/backend/node_modules/agent-base/node_modules/ms/readme.md @@ -0,0 +1,59 @@ +# ms + +![CI](https://github.com/vercel/ms/workflows/CI/badge.svg) + +Use this package to easily convert various time formats to milliseconds. + +## Examples + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('1y') // 31557600000 +ms('100') // 100 +ms('-3 days') // -259200000 +ms('-1h') // -3600000 +ms('-200') // -200 +``` + +### Convert from Milliseconds + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(-3 * 60000) // "-3m" +ms(ms('10 hours')) // "10h" +``` + +### Time Format Written-Out + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(-3 * 60000, { long: true }) // "-3 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +## Features + +- Works both in [Node.js](https://nodejs.org) and in the browser +- If a number is supplied to `ms`, a string with a unit is returned +- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`) +- If you pass a string with a number and a valid unit, the number of equivalent milliseconds is returned + +## Related Packages + +- [ms.macro](https://github.com/knpwrs/ms.macro) - Run `ms` as a macro at build-time. + +## Caught a Bug? + +1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device +2. Link the package to the global module directory: `npm link` +3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, Node.js will now use your clone of ms! + +As always, you can run the tests using: `npm test` diff --git a/backend/node_modules/agent-base/package.json b/backend/node_modules/agent-base/package.json new file mode 100644 index 000000000..fadce3ad9 --- /dev/null +++ b/backend/node_modules/agent-base/package.json @@ -0,0 +1,64 @@ +{ + "name": "agent-base", + "version": "6.0.2", + "description": "Turn a function into an `http.Agent` instance", + "main": "dist/src/index", + "typings": "dist/src/index", + "files": [ + "dist/src", + "src" + ], + "scripts": { + "prebuild": "rimraf dist", + "build": "tsc", + "postbuild": "cpy --parents src test '!**/*.ts' dist", + "test": "mocha --reporter spec dist/test/*.js", + "test-lint": "eslint src --ext .js,.ts", + "prepublishOnly": "npm run build" + }, + "repository": { + "type": "git", + "url": "git://github.com/TooTallNate/node-agent-base.git" + }, + "keywords": [ + "http", + "agent", + "base", + "barebones", + "https" + ], + "author": "Nathan Rajlich (http://n8.io/)", + "license": "MIT", + "bugs": { + "url": "https://github.com/TooTallNate/node-agent-base/issues" + }, + "dependencies": { + "debug": "4" + }, + "devDependencies": { + "@types/debug": "4", + "@types/mocha": "^5.2.7", + "@types/node": "^14.0.20", + "@types/semver": "^7.1.0", + "@types/ws": "^6.0.3", + "@typescript-eslint/eslint-plugin": "1.6.0", + "@typescript-eslint/parser": "1.1.0", + "async-listen": "^1.2.0", + "cpy-cli": "^2.0.0", + "eslint": "5.16.0", + "eslint-config-airbnb": "17.1.0", + "eslint-config-prettier": "4.1.0", + "eslint-import-resolver-typescript": "1.1.1", + "eslint-plugin-import": "2.16.0", + "eslint-plugin-jsx-a11y": "6.2.1", + "eslint-plugin-react": "7.12.4", + "mocha": "^6.2.0", + "rimraf": "^3.0.0", + "semver": "^7.1.2", + "typescript": "^3.5.3", + "ws": "^3.0.0" + }, + "engines": { + "node": ">= 6.0.0" + } +} diff --git a/backend/node_modules/agent-base/src/index.ts b/backend/node_modules/agent-base/src/index.ts new file mode 100644 index 000000000..a47ccd493 --- /dev/null +++ b/backend/node_modules/agent-base/src/index.ts @@ -0,0 +1,345 @@ +import net from 'net'; +import http from 'http'; +import https from 'https'; +import { Duplex } from 'stream'; +import { EventEmitter } from 'events'; +import createDebug from 'debug'; +import promisify from './promisify'; + +const debug = createDebug('agent-base'); + +function isAgent(v: any): v is createAgent.AgentLike { + return Boolean(v) && typeof v.addRequest === 'function'; +} + +function isSecureEndpoint(): boolean { + const { stack } = new Error(); + if (typeof stack !== 'string') return false; + return stack.split('\n').some(l => l.indexOf('(https.js:') !== -1 || l.indexOf('node:https:') !== -1); +} + +function createAgent(opts?: createAgent.AgentOptions): createAgent.Agent; +function createAgent( + callback: createAgent.AgentCallback, + opts?: createAgent.AgentOptions +): createAgent.Agent; +function createAgent( + callback?: createAgent.AgentCallback | createAgent.AgentOptions, + opts?: createAgent.AgentOptions +) { + return new createAgent.Agent(callback, opts); +} + +namespace createAgent { + export interface ClientRequest extends http.ClientRequest { + _last?: boolean; + _hadError?: boolean; + method: string; + } + + export interface AgentRequestOptions { + host?: string; + path?: string; + // `port` on `http.RequestOptions` can be a string or undefined, + // but `net.TcpNetConnectOpts` expects only a number + port: number; + } + + export interface HttpRequestOptions + extends AgentRequestOptions, + Omit { + secureEndpoint: false; + } + + export interface HttpsRequestOptions + extends AgentRequestOptions, + Omit { + secureEndpoint: true; + } + + export type RequestOptions = HttpRequestOptions | HttpsRequestOptions; + + export type AgentLike = Pick | http.Agent; + + export type AgentCallbackReturn = Duplex | AgentLike; + + export type AgentCallbackCallback = ( + err?: Error | null, + socket?: createAgent.AgentCallbackReturn + ) => void; + + export type AgentCallbackPromise = ( + req: createAgent.ClientRequest, + opts: createAgent.RequestOptions + ) => + | createAgent.AgentCallbackReturn + | Promise; + + export type AgentCallback = typeof Agent.prototype.callback; + + export type AgentOptions = { + timeout?: number; + }; + + /** + * Base `http.Agent` implementation. + * No pooling/keep-alive is implemented by default. + * + * @param {Function} callback + * @api public + */ + export class Agent extends EventEmitter { + public timeout: number | null; + public maxFreeSockets: number; + public maxTotalSockets: number; + public maxSockets: number; + public sockets: { + [key: string]: net.Socket[]; + }; + public freeSockets: { + [key: string]: net.Socket[]; + }; + public requests: { + [key: string]: http.IncomingMessage[]; + }; + public options: https.AgentOptions; + private promisifiedCallback?: createAgent.AgentCallbackPromise; + private explicitDefaultPort?: number; + private explicitProtocol?: string; + + constructor( + callback?: createAgent.AgentCallback | createAgent.AgentOptions, + _opts?: createAgent.AgentOptions + ) { + super(); + + let opts = _opts; + if (typeof callback === 'function') { + this.callback = callback; + } else if (callback) { + opts = callback; + } + + // Timeout for the socket to be returned from the callback + this.timeout = null; + if (opts && typeof opts.timeout === 'number') { + this.timeout = opts.timeout; + } + + // These aren't actually used by `agent-base`, but are required + // for the TypeScript definition files in `@types/node` :/ + this.maxFreeSockets = 1; + this.maxSockets = 1; + this.maxTotalSockets = Infinity; + this.sockets = {}; + this.freeSockets = {}; + this.requests = {}; + this.options = {}; + } + + get defaultPort(): number { + if (typeof this.explicitDefaultPort === 'number') { + return this.explicitDefaultPort; + } + return isSecureEndpoint() ? 443 : 80; + } + + set defaultPort(v: number) { + this.explicitDefaultPort = v; + } + + get protocol(): string { + if (typeof this.explicitProtocol === 'string') { + return this.explicitProtocol; + } + return isSecureEndpoint() ? 'https:' : 'http:'; + } + + set protocol(v: string) { + this.explicitProtocol = v; + } + + callback( + req: createAgent.ClientRequest, + opts: createAgent.RequestOptions, + fn: createAgent.AgentCallbackCallback + ): void; + callback( + req: createAgent.ClientRequest, + opts: createAgent.RequestOptions + ): + | createAgent.AgentCallbackReturn + | Promise; + callback( + req: createAgent.ClientRequest, + opts: createAgent.AgentOptions, + fn?: createAgent.AgentCallbackCallback + ): + | createAgent.AgentCallbackReturn + | Promise + | void { + throw new Error( + '"agent-base" has no default implementation, you must subclass and override `callback()`' + ); + } + + /** + * Called by node-core's "_http_client.js" module when creating + * a new HTTP request with this Agent instance. + * + * @api public + */ + addRequest(req: ClientRequest, _opts: RequestOptions): void { + const opts: RequestOptions = { ..._opts }; + + if (typeof opts.secureEndpoint !== 'boolean') { + opts.secureEndpoint = isSecureEndpoint(); + } + + if (opts.host == null) { + opts.host = 'localhost'; + } + + if (opts.port == null) { + opts.port = opts.secureEndpoint ? 443 : 80; + } + + if (opts.protocol == null) { + opts.protocol = opts.secureEndpoint ? 'https:' : 'http:'; + } + + if (opts.host && opts.path) { + // If both a `host` and `path` are specified then it's most + // likely the result of a `url.parse()` call... we need to + // remove the `path` portion so that `net.connect()` doesn't + // attempt to open that as a unix socket file. + delete opts.path; + } + + delete opts.agent; + delete opts.hostname; + delete opts._defaultAgent; + delete opts.defaultPort; + delete opts.createConnection; + + // Hint to use "Connection: close" + // XXX: non-documented `http` module API :( + req._last = true; + req.shouldKeepAlive = false; + + let timedOut = false; + let timeoutId: ReturnType | null = null; + const timeoutMs = opts.timeout || this.timeout; + + const onerror = (err: NodeJS.ErrnoException) => { + if (req._hadError) return; + req.emit('error', err); + // For Safety. Some additional errors might fire later on + // and we need to make sure we don't double-fire the error event. + req._hadError = true; + }; + + const ontimeout = () => { + timeoutId = null; + timedOut = true; + const err: NodeJS.ErrnoException = new Error( + `A "socket" was not created for HTTP request before ${timeoutMs}ms` + ); + err.code = 'ETIMEOUT'; + onerror(err); + }; + + const callbackError = (err: NodeJS.ErrnoException) => { + if (timedOut) return; + if (timeoutId !== null) { + clearTimeout(timeoutId); + timeoutId = null; + } + onerror(err); + }; + + const onsocket = (socket: AgentCallbackReturn) => { + if (timedOut) return; + if (timeoutId != null) { + clearTimeout(timeoutId); + timeoutId = null; + } + + if (isAgent(socket)) { + // `socket` is actually an `http.Agent` instance, so + // relinquish responsibility for this `req` to the Agent + // from here on + debug( + 'Callback returned another Agent instance %o', + socket.constructor.name + ); + (socket as createAgent.Agent).addRequest(req, opts); + return; + } + + if (socket) { + socket.once('free', () => { + this.freeSocket(socket as net.Socket, opts); + }); + req.onSocket(socket as net.Socket); + return; + } + + const err = new Error( + `no Duplex stream was returned to agent-base for \`${req.method} ${req.path}\`` + ); + onerror(err); + }; + + if (typeof this.callback !== 'function') { + onerror(new Error('`callback` is not defined')); + return; + } + + if (!this.promisifiedCallback) { + if (this.callback.length >= 3) { + debug('Converting legacy callback function to promise'); + this.promisifiedCallback = promisify(this.callback); + } else { + this.promisifiedCallback = this.callback; + } + } + + if (typeof timeoutMs === 'number' && timeoutMs > 0) { + timeoutId = setTimeout(ontimeout, timeoutMs); + } + + if ('port' in opts && typeof opts.port !== 'number') { + opts.port = Number(opts.port); + } + + try { + debug( + 'Resolving socket for %o request: %o', + opts.protocol, + `${req.method} ${req.path}` + ); + Promise.resolve(this.promisifiedCallback(req, opts)).then( + onsocket, + callbackError + ); + } catch (err) { + Promise.reject(err).catch(callbackError); + } + } + + freeSocket(socket: net.Socket, opts: AgentOptions) { + debug('Freeing socket %o %o', socket.constructor.name, opts); + socket.destroy(); + } + + destroy() { + debug('Destroying agent %o', this.constructor.name); + } + } + + // So that `instanceof` works correctly + createAgent.prototype = createAgent.Agent.prototype; +} + +export = createAgent; diff --git a/backend/node_modules/agent-base/src/promisify.ts b/backend/node_modules/agent-base/src/promisify.ts new file mode 100644 index 000000000..60cc66271 --- /dev/null +++ b/backend/node_modules/agent-base/src/promisify.ts @@ -0,0 +1,33 @@ +import { + Agent, + ClientRequest, + RequestOptions, + AgentCallbackCallback, + AgentCallbackPromise, + AgentCallbackReturn +} from './index'; + +type LegacyCallback = ( + req: ClientRequest, + opts: RequestOptions, + fn: AgentCallbackCallback +) => void; + +export default function promisify(fn: LegacyCallback): AgentCallbackPromise { + return function(this: Agent, req: ClientRequest, opts: RequestOptions) { + return new Promise((resolve, reject) => { + fn.call( + this, + req, + opts, + (err: Error | null | undefined, rtn?: AgentCallbackReturn) => { + if (err) { + reject(err); + } else { + resolve(rtn); + } + } + ); + }); + }; +} diff --git a/backend/node_modules/ansi-regex/index.d.ts b/backend/node_modules/ansi-regex/index.d.ts new file mode 100644 index 000000000..2dbf6af2b --- /dev/null +++ b/backend/node_modules/ansi-regex/index.d.ts @@ -0,0 +1,37 @@ +declare namespace ansiRegex { + interface Options { + /** + Match only the first ANSI escape. + + @default false + */ + onlyFirst: boolean; + } +} + +/** +Regular expression for matching ANSI escape codes. + +@example +``` +import ansiRegex = require('ansi-regex'); + +ansiRegex().test('\u001B[4mcake\u001B[0m'); +//=> true + +ansiRegex().test('cake'); +//=> false + +'\u001B[4mcake\u001B[0m'.match(ansiRegex()); +//=> ['\u001B[4m', '\u001B[0m'] + +'\u001B[4mcake\u001B[0m'.match(ansiRegex({onlyFirst: true})); +//=> ['\u001B[4m'] + +'\u001B]8;;https://github.com\u0007click\u001B]8;;\u0007'.match(ansiRegex()); +//=> ['\u001B]8;;https://github.com\u0007', '\u001B]8;;\u0007'] +``` +*/ +declare function ansiRegex(options?: ansiRegex.Options): RegExp; + +export = ansiRegex; diff --git a/backend/node_modules/ansi-regex/index.js b/backend/node_modules/ansi-regex/index.js new file mode 100644 index 000000000..616ff837d --- /dev/null +++ b/backend/node_modules/ansi-regex/index.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = ({onlyFirst = false} = {}) => { + const pattern = [ + '[\\u001B\\u009B][[\\]()#;?]*(?:(?:(?:(?:;[-a-zA-Z\\d\\/#&.:=?%@~_]+)*|[a-zA-Z\\d]+(?:;[-a-zA-Z\\d\\/#&.:=?%@~_]*)*)?\\u0007)', + '(?:(?:\\d{1,4}(?:;\\d{0,4})*)?[\\dA-PR-TZcf-ntqry=><~]))' + ].join('|'); + + return new RegExp(pattern, onlyFirst ? undefined : 'g'); +}; diff --git a/backend/node_modules/ansi-regex/license b/backend/node_modules/ansi-regex/license new file mode 100644 index 000000000..e7af2f771 --- /dev/null +++ b/backend/node_modules/ansi-regex/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/backend/node_modules/ansi-regex/package.json b/backend/node_modules/ansi-regex/package.json new file mode 100644 index 000000000..017f53116 --- /dev/null +++ b/backend/node_modules/ansi-regex/package.json @@ -0,0 +1,55 @@ +{ + "name": "ansi-regex", + "version": "5.0.1", + "description": "Regular expression for matching ANSI escape codes", + "license": "MIT", + "repository": "chalk/ansi-regex", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "engines": { + "node": ">=8" + }, + "scripts": { + "test": "xo && ava && tsd", + "view-supported": "node fixtures/view-codes.js" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "keywords": [ + "ansi", + "styles", + "color", + "colour", + "colors", + "terminal", + "console", + "cli", + "string", + "tty", + "escape", + "formatting", + "rgb", + "256", + "shell", + "xterm", + "command-line", + "text", + "regex", + "regexp", + "re", + "match", + "test", + "find", + "pattern" + ], + "devDependencies": { + "ava": "^2.4.0", + "tsd": "^0.9.0", + "xo": "^0.25.3" + } +} diff --git a/backend/node_modules/ansi-regex/readme.md b/backend/node_modules/ansi-regex/readme.md new file mode 100644 index 000000000..4d848bc36 --- /dev/null +++ b/backend/node_modules/ansi-regex/readme.md @@ -0,0 +1,78 @@ +# ansi-regex + +> Regular expression for matching [ANSI escape codes](https://en.wikipedia.org/wiki/ANSI_escape_code) + + +## Install + +``` +$ npm install ansi-regex +``` + + +## Usage + +```js +const ansiRegex = require('ansi-regex'); + +ansiRegex().test('\u001B[4mcake\u001B[0m'); +//=> true + +ansiRegex().test('cake'); +//=> false + +'\u001B[4mcake\u001B[0m'.match(ansiRegex()); +//=> ['\u001B[4m', '\u001B[0m'] + +'\u001B[4mcake\u001B[0m'.match(ansiRegex({onlyFirst: true})); +//=> ['\u001B[4m'] + +'\u001B]8;;https://github.com\u0007click\u001B]8;;\u0007'.match(ansiRegex()); +//=> ['\u001B]8;;https://github.com\u0007', '\u001B]8;;\u0007'] +``` + + +## API + +### ansiRegex(options?) + +Returns a regex for matching ANSI escape codes. + +#### options + +Type: `object` + +##### onlyFirst + +Type: `boolean`
+Default: `false` *(Matches any ANSI escape codes in a string)* + +Match only the first ANSI escape. + + +## FAQ + +### Why do you test for codes not in the ECMA 48 standard? + +Some of the codes we run as a test are codes that we acquired finding various lists of non-standard or manufacturer specific codes. We test for both standard and non-standard codes, as most of them follow the same or similar format and can be safely matched in strings without the risk of removing actual string content. There are a few non-standard control codes that do not follow the traditional format (i.e. they end in numbers) thus forcing us to exclude them from the test because we cannot reliably match them. + +On the historical side, those ECMA standards were established in the early 90's whereas the VT100, for example, was designed in the mid/late 70's. At that point in time, control codes were still pretty ungoverned and engineers used them for a multitude of things, namely to activate hardware ports that may have been proprietary. Somewhere else you see a similar 'anarchy' of codes is in the x86 architecture for processors; there are a ton of "interrupts" that can mean different things on certain brands of processors, most of which have been phased out. + + +## Maintainers + +- [Sindre Sorhus](https://github.com/sindresorhus) +- [Josh Junon](https://github.com/qix-) + + +--- + +
+ + Get professional support for this package with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. +
+
diff --git a/backend/node_modules/anymatch/LICENSE b/backend/node_modules/anymatch/LICENSE new file mode 100644 index 000000000..491766ca7 --- /dev/null +++ b/backend/node_modules/anymatch/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright (c) 2019 Elan Shanker, Paul Miller (https://paulmillr.com) + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/backend/node_modules/anymatch/README.md b/backend/node_modules/anymatch/README.md new file mode 100644 index 000000000..1dd67f534 --- /dev/null +++ b/backend/node_modules/anymatch/README.md @@ -0,0 +1,87 @@ +anymatch [![Build Status](https://travis-ci.org/micromatch/anymatch.svg?branch=master)](https://travis-ci.org/micromatch/anymatch) [![Coverage Status](https://img.shields.io/coveralls/micromatch/anymatch.svg?branch=master)](https://coveralls.io/r/micromatch/anymatch?branch=master) +====== +Javascript module to match a string against a regular expression, glob, string, +or function that takes the string as an argument and returns a truthy or falsy +value. The matcher can also be an array of any or all of these. Useful for +allowing a very flexible user-defined config to define things like file paths. + +__Note: This module has Bash-parity, please be aware that Windows-style backslashes are not supported as separators. See https://github.com/micromatch/micromatch#backslashes for more information.__ + + +Usage +----- +```sh +npm install anymatch +``` + +#### anymatch(matchers, testString, [returnIndex], [options]) +* __matchers__: (_Array|String|RegExp|Function_) +String to be directly matched, string with glob patterns, regular expression +test, function that takes the testString as an argument and returns a truthy +value if it should be matched, or an array of any number and mix of these types. +* __testString__: (_String|Array_) The string to test against the matchers. If +passed as an array, the first element of the array will be used as the +`testString` for non-function matchers, while the entire array will be applied +as the arguments for function matchers. +* __options__: (_Object_ [optional]_) Any of the [picomatch](https://github.com/micromatch/picomatch#options) options. + * __returnIndex__: (_Boolean [optional]_) If true, return the array index of +the first matcher that that testString matched, or -1 if no match, instead of a +boolean result. + +```js +const anymatch = require('anymatch'); + +const matchers = [ 'path/to/file.js', 'path/anyjs/**/*.js', /foo.js$/, string => string.includes('bar') && string.length > 10 ] ; + +anymatch(matchers, 'path/to/file.js'); // true +anymatch(matchers, 'path/anyjs/baz.js'); // true +anymatch(matchers, 'path/to/foo.js'); // true +anymatch(matchers, 'path/to/bar.js'); // true +anymatch(matchers, 'bar.js'); // false + +// returnIndex = true +anymatch(matchers, 'foo.js', {returnIndex: true}); // 2 +anymatch(matchers, 'path/anyjs/foo.js', {returnIndex: true}); // 1 + +// any picomatc + +// using globs to match directories and their children +anymatch('node_modules', 'node_modules'); // true +anymatch('node_modules', 'node_modules/somelib/index.js'); // false +anymatch('node_modules/**', 'node_modules/somelib/index.js'); // true +anymatch('node_modules/**', '/absolute/path/to/node_modules/somelib/index.js'); // false +anymatch('**/node_modules/**', '/absolute/path/to/node_modules/somelib/index.js'); // true + +const matcher = anymatch(matchers); +['foo.js', 'bar.js'].filter(matcher); // [ 'foo.js' ] +anymatch master* ❯ + +``` + +#### anymatch(matchers) +You can also pass in only your matcher(s) to get a curried function that has +already been bound to the provided matching criteria. This can be used as an +`Array#filter` callback. + +```js +var matcher = anymatch(matchers); + +matcher('path/to/file.js'); // true +matcher('path/anyjs/baz.js', true); // 1 + +['foo.js', 'bar.js'].filter(matcher); // ['foo.js'] +``` + +Changelog +---------- +[See release notes page on GitHub](https://github.com/micromatch/anymatch/releases) + +- **v3.0:** Removed `startIndex` and `endIndex` arguments. Node 8.x-only. +- **v2.0:** [micromatch](https://github.com/jonschlinkert/micromatch) moves away from minimatch-parity and inline with Bash. This includes handling backslashes differently (see https://github.com/micromatch/micromatch#backslashes for more information). +- **v1.2:** anymatch uses [micromatch](https://github.com/jonschlinkert/micromatch) +for glob pattern matching. Issues with glob pattern matching should be +reported directly to the [micromatch issue tracker](https://github.com/jonschlinkert/micromatch/issues). + +License +------- +[ISC](https://raw.github.com/micromatch/anymatch/master/LICENSE) diff --git a/backend/node_modules/anymatch/index.d.ts b/backend/node_modules/anymatch/index.d.ts new file mode 100644 index 000000000..3ef7eaadd --- /dev/null +++ b/backend/node_modules/anymatch/index.d.ts @@ -0,0 +1,20 @@ +type AnymatchFn = (testString: string) => boolean; +type AnymatchPattern = string|RegExp|AnymatchFn; +type AnymatchMatcher = AnymatchPattern|AnymatchPattern[] +type AnymatchTester = { + (testString: string|any[], returnIndex: true): number; + (testString: string|any[]): boolean; +} + +type PicomatchOptions = {dot: boolean}; + +declare const anymatch: { + (matchers: AnymatchMatcher): AnymatchTester; + (matchers: AnymatchMatcher, testString: null, returnIndex: true | PicomatchOptions): AnymatchTester; + (matchers: AnymatchMatcher, testString: string|any[], returnIndex: true | PicomatchOptions): number; + (matchers: AnymatchMatcher, testString: string|any[]): boolean; +} + +export {AnymatchMatcher as Matcher} +export {AnymatchTester as Tester} +export default anymatch diff --git a/backend/node_modules/anymatch/index.js b/backend/node_modules/anymatch/index.js new file mode 100644 index 000000000..8eb73e9c9 --- /dev/null +++ b/backend/node_modules/anymatch/index.js @@ -0,0 +1,104 @@ +'use strict'; + +Object.defineProperty(exports, "__esModule", { value: true }); + +const picomatch = require('picomatch'); +const normalizePath = require('normalize-path'); + +/** + * @typedef {(testString: string) => boolean} AnymatchFn + * @typedef {string|RegExp|AnymatchFn} AnymatchPattern + * @typedef {AnymatchPattern|AnymatchPattern[]} AnymatchMatcher + */ +const BANG = '!'; +const DEFAULT_OPTIONS = {returnIndex: false}; +const arrify = (item) => Array.isArray(item) ? item : [item]; + +/** + * @param {AnymatchPattern} matcher + * @param {object} options + * @returns {AnymatchFn} + */ +const createPattern = (matcher, options) => { + if (typeof matcher === 'function') { + return matcher; + } + if (typeof matcher === 'string') { + const glob = picomatch(matcher, options); + return (string) => matcher === string || glob(string); + } + if (matcher instanceof RegExp) { + return (string) => matcher.test(string); + } + return (string) => false; +}; + +/** + * @param {Array} patterns + * @param {Array} negPatterns + * @param {String|Array} args + * @param {Boolean} returnIndex + * @returns {boolean|number} + */ +const matchPatterns = (patterns, negPatterns, args, returnIndex) => { + const isList = Array.isArray(args); + const _path = isList ? args[0] : args; + if (!isList && typeof _path !== 'string') { + throw new TypeError('anymatch: second argument must be a string: got ' + + Object.prototype.toString.call(_path)) + } + const path = normalizePath(_path, false); + + for (let index = 0; index < negPatterns.length; index++) { + const nglob = negPatterns[index]; + if (nglob(path)) { + return returnIndex ? -1 : false; + } + } + + const applied = isList && [path].concat(args.slice(1)); + for (let index = 0; index < patterns.length; index++) { + const pattern = patterns[index]; + if (isList ? pattern(...applied) : pattern(path)) { + return returnIndex ? index : true; + } + } + + return returnIndex ? -1 : false; +}; + +/** + * @param {AnymatchMatcher} matchers + * @param {Array|string} testString + * @param {object} options + * @returns {boolean|number|Function} + */ +const anymatch = (matchers, testString, options = DEFAULT_OPTIONS) => { + if (matchers == null) { + throw new TypeError('anymatch: specify first argument'); + } + const opts = typeof options === 'boolean' ? {returnIndex: options} : options; + const returnIndex = opts.returnIndex || false; + + // Early cache for matchers. + const mtchers = arrify(matchers); + const negatedGlobs = mtchers + .filter(item => typeof item === 'string' && item.charAt(0) === BANG) + .map(item => item.slice(1)) + .map(item => picomatch(item, opts)); + const patterns = mtchers + .filter(item => typeof item !== 'string' || (typeof item === 'string' && item.charAt(0) !== BANG)) + .map(matcher => createPattern(matcher, opts)); + + if (testString == null) { + return (testString, ri = false) => { + const returnIndex = typeof ri === 'boolean' ? ri : false; + return matchPatterns(patterns, negatedGlobs, testString, returnIndex); + } + } + + return matchPatterns(patterns, negatedGlobs, testString, returnIndex); +}; + +anymatch.default = anymatch; +module.exports = anymatch; diff --git a/backend/node_modules/anymatch/package.json b/backend/node_modules/anymatch/package.json new file mode 100644 index 000000000..2cb2307e4 --- /dev/null +++ b/backend/node_modules/anymatch/package.json @@ -0,0 +1,48 @@ +{ + "name": "anymatch", + "version": "3.1.3", + "description": "Matches strings against configurable strings, globs, regular expressions, and/or functions", + "files": [ + "index.js", + "index.d.ts" + ], + "dependencies": { + "normalize-path": "^3.0.0", + "picomatch": "^2.0.4" + }, + "author": { + "name": "Elan Shanker", + "url": "https://github.com/es128" + }, + "license": "ISC", + "homepage": "https://github.com/micromatch/anymatch", + "repository": { + "type": "git", + "url": "https://github.com/micromatch/anymatch" + }, + "keywords": [ + "match", + "any", + "string", + "file", + "fs", + "list", + "glob", + "regex", + "regexp", + "regular", + "expression", + "function" + ], + "scripts": { + "test": "nyc mocha", + "mocha": "mocha" + }, + "devDependencies": { + "mocha": "^6.1.3", + "nyc": "^14.0.0" + }, + "engines": { + "node": ">= 8" + } +} diff --git a/backend/node_modules/aproba/CHANGELOG.md b/backend/node_modules/aproba/CHANGELOG.md new file mode 100644 index 000000000..bab30ecb7 --- /dev/null +++ b/backend/node_modules/aproba/CHANGELOG.md @@ -0,0 +1,4 @@ +2.0.0 + * Drop support for 0.10 and 0.12. They haven't been in travis but still, + since we _know_ we'll break with them now it's only polite to do a + major bump. diff --git a/backend/node_modules/aproba/LICENSE b/backend/node_modules/aproba/LICENSE new file mode 100644 index 000000000..f4be44d88 --- /dev/null +++ b/backend/node_modules/aproba/LICENSE @@ -0,0 +1,14 @@ +Copyright (c) 2015, Rebecca Turner + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + diff --git a/backend/node_modules/aproba/README.md b/backend/node_modules/aproba/README.md new file mode 100644 index 000000000..0bfc594c5 --- /dev/null +++ b/backend/node_modules/aproba/README.md @@ -0,0 +1,94 @@ +aproba +====== + +A ridiculously light-weight function argument validator + +``` +var validate = require("aproba") + +function myfunc(a, b, c) { + // `a` must be a string, `b` a number, `c` a function + validate('SNF', arguments) // [a,b,c] is also valid +} + +myfunc('test', 23, function () {}) // ok +myfunc(123, 23, function () {}) // type error +myfunc('test', 23) // missing arg error +myfunc('test', 23, function () {}, true) // too many args error + +``` + +Valid types are: + +| type | description +| :--: | :---------- +| * | matches any type +| A | `Array.isArray` OR an `arguments` object +| S | typeof == string +| N | typeof == number +| F | typeof == function +| O | typeof == object and not type A and not type E +| B | typeof == boolean +| E | `instanceof Error` OR `null` **(special: see below)** +| Z | == `null` + +Validation failures throw one of three exception types, distinguished by a +`code` property of `EMISSINGARG`, `EINVALIDTYPE` or `ETOOMANYARGS`. + +If you pass in an invalid type then it will throw with a code of +`EUNKNOWNTYPE`. + +If an **error** argument is found and is not null then the remaining +arguments are optional. That is, if you say `ESO` then that's like using a +non-magical `E` in: `E|ESO|ZSO`. + +### But I have optional arguments?! + +You can provide more than one signature by separating them with pipes `|`. +If any signature matches the arguments then they'll be considered valid. + +So for example, say you wanted to write a signature for +`fs.createWriteStream`. The docs for it describe it thusly: + +``` +fs.createWriteStream(path[, options]) +``` + +This would be a signature of `SO|S`. That is, a string and and object, or +just a string. + +Now, if you read the full `fs` docs, you'll see that actually path can ALSO +be a buffer. And options can be a string, that is: +``` +path | +options | +``` + +To reproduce this you have to fully enumerate all of the possible +combinations and that implies a signature of `SO|SS|OO|OS|S|O`. The +awkwardness is a feature: It reminds you of the complexity you're adding to +your API when you do this sort of thing. + + +### Browser support + +This has no dependencies and should work in browsers, though you'll have +noisier stack traces. + +### Why this exists + +I wanted a very simple argument validator. It needed to do two things: + +1. Be more concise and easier to use than assertions + +2. Not encourage an infinite bikeshed of DSLs + +This is why types are specified by a single character and there's no such +thing as an optional argument. + +This is not intended to validate user data. This is specifically about +asserting the interface of your functions. + +If you need greater validation, I encourage you to write them by hand or +look elsewhere. + diff --git a/backend/node_modules/aproba/index.js b/backend/node_modules/aproba/index.js new file mode 100644 index 000000000..fd947481b --- /dev/null +++ b/backend/node_modules/aproba/index.js @@ -0,0 +1,105 @@ +'use strict' +module.exports = validate + +function isArguments (thingy) { + return thingy != null && typeof thingy === 'object' && thingy.hasOwnProperty('callee') +} + +const types = { + '*': {label: 'any', check: () => true}, + A: {label: 'array', check: _ => Array.isArray(_) || isArguments(_)}, + S: {label: 'string', check: _ => typeof _ === 'string'}, + N: {label: 'number', check: _ => typeof _ === 'number'}, + F: {label: 'function', check: _ => typeof _ === 'function'}, + O: {label: 'object', check: _ => typeof _ === 'object' && _ != null && !types.A.check(_) && !types.E.check(_)}, + B: {label: 'boolean', check: _ => typeof _ === 'boolean'}, + E: {label: 'error', check: _ => _ instanceof Error}, + Z: {label: 'null', check: _ => _ == null} +} + +function addSchema (schema, arity) { + const group = arity[schema.length] = arity[schema.length] || [] + if (group.indexOf(schema) === -1) group.push(schema) +} + +function validate (rawSchemas, args) { + if (arguments.length !== 2) throw wrongNumberOfArgs(['SA'], arguments.length) + if (!rawSchemas) throw missingRequiredArg(0, 'rawSchemas') + if (!args) throw missingRequiredArg(1, 'args') + if (!types.S.check(rawSchemas)) throw invalidType(0, ['string'], rawSchemas) + if (!types.A.check(args)) throw invalidType(1, ['array'], args) + const schemas = rawSchemas.split('|') + const arity = {} + + schemas.forEach(schema => { + for (let ii = 0; ii < schema.length; ++ii) { + const type = schema[ii] + if (!types[type]) throw unknownType(ii, type) + } + if (/E.*E/.test(schema)) throw moreThanOneError(schema) + addSchema(schema, arity) + if (/E/.test(schema)) { + addSchema(schema.replace(/E.*$/, 'E'), arity) + addSchema(schema.replace(/E/, 'Z'), arity) + if (schema.length === 1) addSchema('', arity) + } + }) + let matching = arity[args.length] + if (!matching) { + throw wrongNumberOfArgs(Object.keys(arity), args.length) + } + for (let ii = 0; ii < args.length; ++ii) { + let newMatching = matching.filter(schema => { + const type = schema[ii] + const typeCheck = types[type].check + return typeCheck(args[ii]) + }) + if (!newMatching.length) { + const labels = matching.map(_ => types[_[ii]].label).filter(_ => _ != null) + throw invalidType(ii, labels, args[ii]) + } + matching = newMatching + } +} + +function missingRequiredArg (num) { + return newException('EMISSINGARG', 'Missing required argument #' + (num + 1)) +} + +function unknownType (num, type) { + return newException('EUNKNOWNTYPE', 'Unknown type ' + type + ' in argument #' + (num + 1)) +} + +function invalidType (num, expectedTypes, value) { + let valueType + Object.keys(types).forEach(typeCode => { + if (types[typeCode].check(value)) valueType = types[typeCode].label + }) + return newException('EINVALIDTYPE', 'Argument #' + (num + 1) + ': Expected ' + + englishList(expectedTypes) + ' but got ' + valueType) +} + +function englishList (list) { + return list.join(', ').replace(/, ([^,]+)$/, ' or $1') +} + +function wrongNumberOfArgs (expected, got) { + const english = englishList(expected) + const args = expected.every(ex => ex.length === 1) + ? 'argument' + : 'arguments' + return newException('EWRONGARGCOUNT', 'Expected ' + english + ' ' + args + ' but got ' + got) +} + +function moreThanOneError (schema) { + return newException('ETOOMANYERRORTYPES', + 'Only one error type per argument signature is allowed, more than one found in "' + schema + '"') +} + +function newException (code, msg) { + const err = new Error(msg) + err.code = code + /* istanbul ignore else */ + if (Error.captureStackTrace) Error.captureStackTrace(err, validate) + return err +} diff --git a/backend/node_modules/aproba/package.json b/backend/node_modules/aproba/package.json new file mode 100644 index 000000000..d2212d30d --- /dev/null +++ b/backend/node_modules/aproba/package.json @@ -0,0 +1,35 @@ +{ + "name": "aproba", + "version": "2.0.0", + "description": "A ridiculously light-weight argument validator (now browser friendly)", + "main": "index.js", + "directories": { + "test": "test" + }, + "dependencies": {}, + "devDependencies": { + "standard": "^11.0.1", + "tap": "^12.0.1" + }, + "files": [ + "index.js" + ], + "scripts": { + "pretest": "standard", + "test": "tap --100 -J test/*.js" + }, + "repository": { + "type": "git", + "url": "https://github.com/iarna/aproba" + }, + "keywords": [ + "argument", + "validate" + ], + "author": "Rebecca Turner ", + "license": "ISC", + "bugs": { + "url": "https://github.com/iarna/aproba/issues" + }, + "homepage": "https://github.com/iarna/aproba" +} diff --git a/backend/node_modules/are-we-there-yet/LICENSE.md b/backend/node_modules/are-we-there-yet/LICENSE.md new file mode 100644 index 000000000..845be76f6 --- /dev/null +++ b/backend/node_modules/are-we-there-yet/LICENSE.md @@ -0,0 +1,18 @@ +ISC License + +Copyright npm, Inc. + +Permission to use, copy, modify, and/or distribute this +software for any purpose with or without fee is hereby +granted, provided that the above copyright notice and this +permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND NPM DISCLAIMS ALL +WARRANTIES WITH REGARD TO THIS SOFTWARE INCLUDING ALL +IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS. IN NO +EVENT SHALL NPM BE LIABLE FOR ANY SPECIAL, DIRECT, +INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER +TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE +USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/backend/node_modules/are-we-there-yet/README.md b/backend/node_modules/are-we-there-yet/README.md new file mode 100644 index 000000000..caae19b0a --- /dev/null +++ b/backend/node_modules/are-we-there-yet/README.md @@ -0,0 +1,208 @@ +are-we-there-yet +---------------- + +Track complex hierarchies of asynchronous task completion statuses. This is +intended to give you a way of recording and reporting the progress of the big +recursive fan-out and gather type workflows that are so common in async. + +What you do with this completion data is up to you, but the most common use case is to +feed it to one of the many progress bar modules. + +Most progress bar modules include a rudimentary version of this, but my +needs were more complex. + +Usage +===== + +```javascript +var TrackerGroup = require("are-we-there-yet").TrackerGroup + +var top = new TrackerGroup("program") + +var single = top.newItem("one thing", 100) +single.completeWork(20) + +console.log(top.completed()) // 0.2 + +fs.stat("file", function(er, stat) { + if (er) throw er + var stream = top.newStream("file", stat.size) + console.log(top.completed()) // now 0.1 as single is 50% of the job and is 20% complete + // and 50% * 20% == 10% + fs.createReadStream("file").pipe(stream).on("data", function (chunk) { + // do stuff with chunk + }) + top.on("change", function (name) { + // called each time a chunk is read from "file" + // top.completed() will start at 0.1 and fill up to 0.6 as the file is read + }) +}) +``` + +Shared Methods +============== + +* var completed = tracker.completed() + +Implemented in: `Tracker`, `TrackerGroup`, `TrackerStream` + +Returns the ratio of completed work to work to be done. Range of 0 to 1. + +* tracker.finish() + +Implemented in: `Tracker`, `TrackerGroup` + +Marks the tracker as completed. With a TrackerGroup this marks all of its +components as completed. + +Marks all of the components of this tracker as finished, which in turn means +that `tracker.completed()` for this will now be 1. + +This will result in one or more `change` events being emitted. + +Events +====== + +All tracker objects emit `change` events with the following arguments: + +``` +function (name, completed, tracker) +``` + +`name` is the name of the tracker that originally emitted the event, +or if it didn't have one, the first containing tracker group that had one. + +`completed` is the percent complete (as returned by `tracker.completed()` method). + +`tracker` is the tracker object that you are listening for events on. + +TrackerGroup +============ + +* var tracker = new TrackerGroup(**name**) + + * **name** *(optional)* - The name of this tracker group, used in change + notifications if the component updating didn't have a name. Defaults to undefined. + +Creates a new empty tracker aggregation group. These are trackers whose +completion status is determined by the completion status of other trackers added to this aggregation group. + +Ex. + +```javascript +var tracker = new TrackerGroup("parent") +var foo = tracker.newItem("firstChild", 100) +var bar = tracker.newItem("secondChild", 100) + +foo.finish() +console.log(tracker.completed()) // 0.5 +bar.finish() +console.log(tracker.completed()) // 1 +``` + +* tracker.addUnit(**otherTracker**, **weight**) + + * **otherTracker** - Any of the other are-we-there-yet tracker objects + * **weight** *(optional)* - The weight to give the tracker, defaults to 1. + +Adds the **otherTracker** to this aggregation group. The weight determines +how long you expect this tracker to take to complete in proportion to other +units. So for instance, if you add one tracker with a weight of 1 and +another with a weight of 2, you're saying the second will take twice as long +to complete as the first. As such, the first will account for 33% of the +completion of this tracker and the second will account for the other 67%. + +Returns **otherTracker**. + +* var subGroup = tracker.newGroup(**name**, **weight**) + +The above is exactly equivalent to: + +```javascript + var subGroup = tracker.addUnit(new TrackerGroup(name), weight) +``` + +* var subItem = tracker.newItem(**name**, **todo**, **weight**) + +The above is exactly equivalent to: + +```javascript + var subItem = tracker.addUnit(new Tracker(name, todo), weight) +``` + +* var subStream = tracker.newStream(**name**, **todo**, **weight**) + +The above is exactly equivalent to: + +```javascript + var subStream = tracker.addUnit(new TrackerStream(name, todo), weight) +``` + +* console.log( tracker.debug() ) + +Returns a tree showing the completion of this tracker group and all of its +children, including recursively entering all of the children. + +Tracker +======= + +* var tracker = new Tracker(**name**, **todo**) + + * **name** *(optional)* The name of this counter to report in change + events. Defaults to undefined. + * **todo** *(optional)* The amount of work todo (a number). Defaults to 0. + +Ordinarily these are constructed as a part of a tracker group (via +`newItem`). + +* var completed = tracker.completed() + +Returns the ratio of completed work to work to be done. Range of 0 to 1. If +total work to be done is 0 then it will return 0. + +* tracker.addWork(**todo**) + + * **todo** A number to add to the amount of work to be done. + +Increases the amount of work to be done, thus decreasing the completion +percentage. Triggers a `change` event. + +* tracker.completeWork(**completed**) + + * **completed** A number to add to the work complete + +Increase the amount of work complete, thus increasing the completion percentage. +Will never increase the work completed past the amount of work todo. That is, +percentages > 100% are not allowed. Triggers a `change` event. + +* tracker.finish() + +Marks this tracker as finished, tracker.completed() will now be 1. Triggers +a `change` event. + +TrackerStream +============= + +* var tracker = new TrackerStream(**name**, **size**, **options**) + + * **name** *(optional)* The name of this counter to report in change + events. Defaults to undefined. + * **size** *(optional)* The number of bytes being sent through this stream. + * **options** *(optional)* A hash of stream options + +The tracker stream object is a pass through stream that updates an internal +tracker object each time a block passes through. It's intended to track +downloads, file extraction and other related activities. You use it by piping +your data source into it and then using it as your data source. + +If your data has a length attribute then that's used as the amount of work +completed when the chunk is passed through. If it does not (eg, object +streams) then each chunk counts as completing 1 unit of work, so your size +should be the total number of objects being streamed. + +* tracker.addWork(**todo**) + + * **todo** Increase the expected overall size by **todo** bytes. + +Increases the amount of work to be done, thus decreasing the completion +percentage. Triggers a `change` event. diff --git a/backend/node_modules/are-we-there-yet/lib/index.js b/backend/node_modules/are-we-there-yet/lib/index.js new file mode 100644 index 000000000..57d8743fd --- /dev/null +++ b/backend/node_modules/are-we-there-yet/lib/index.js @@ -0,0 +1,4 @@ +'use strict' +exports.TrackerGroup = require('./tracker-group.js') +exports.Tracker = require('./tracker.js') +exports.TrackerStream = require('./tracker-stream.js') diff --git a/backend/node_modules/are-we-there-yet/lib/tracker-base.js b/backend/node_modules/are-we-there-yet/lib/tracker-base.js new file mode 100644 index 000000000..6f4368755 --- /dev/null +++ b/backend/node_modules/are-we-there-yet/lib/tracker-base.js @@ -0,0 +1,11 @@ +'use strict' +var EventEmitter = require('events').EventEmitter +var util = require('util') + +var trackerId = 0 +var TrackerBase = module.exports = function (name) { + EventEmitter.call(this) + this.id = ++trackerId + this.name = name +} +util.inherits(TrackerBase, EventEmitter) diff --git a/backend/node_modules/are-we-there-yet/lib/tracker-group.js b/backend/node_modules/are-we-there-yet/lib/tracker-group.js new file mode 100644 index 000000000..9da13f8a7 --- /dev/null +++ b/backend/node_modules/are-we-there-yet/lib/tracker-group.js @@ -0,0 +1,116 @@ +'use strict' +var util = require('util') +var TrackerBase = require('./tracker-base.js') +var Tracker = require('./tracker.js') +var TrackerStream = require('./tracker-stream.js') + +var TrackerGroup = module.exports = function (name) { + TrackerBase.call(this, name) + this.parentGroup = null + this.trackers = [] + this.completion = {} + this.weight = {} + this.totalWeight = 0 + this.finished = false + this.bubbleChange = bubbleChange(this) +} +util.inherits(TrackerGroup, TrackerBase) + +function bubbleChange (trackerGroup) { + return function (name, completed, tracker) { + trackerGroup.completion[tracker.id] = completed + if (trackerGroup.finished) { + return + } + trackerGroup.emit('change', name || trackerGroup.name, trackerGroup.completed(), trackerGroup) + } +} + +TrackerGroup.prototype.nameInTree = function () { + var names = [] + var from = this + while (from) { + names.unshift(from.name) + from = from.parentGroup + } + return names.join('/') +} + +TrackerGroup.prototype.addUnit = function (unit, weight) { + if (unit.addUnit) { + var toTest = this + while (toTest) { + if (unit === toTest) { + throw new Error( + 'Attempted to add tracker group ' + + unit.name + ' to tree that already includes it ' + + this.nameInTree(this)) + } + toTest = toTest.parentGroup + } + unit.parentGroup = this + } + this.weight[unit.id] = weight || 1 + this.totalWeight += this.weight[unit.id] + this.trackers.push(unit) + this.completion[unit.id] = unit.completed() + unit.on('change', this.bubbleChange) + if (!this.finished) { + this.emit('change', unit.name, this.completion[unit.id], unit) + } + return unit +} + +TrackerGroup.prototype.completed = function () { + if (this.trackers.length === 0) { + return 0 + } + var valPerWeight = 1 / this.totalWeight + var completed = 0 + for (var ii = 0; ii < this.trackers.length; ii++) { + var trackerId = this.trackers[ii].id + completed += + valPerWeight * this.weight[trackerId] * this.completion[trackerId] + } + return completed +} + +TrackerGroup.prototype.newGroup = function (name, weight) { + return this.addUnit(new TrackerGroup(name), weight) +} + +TrackerGroup.prototype.newItem = function (name, todo, weight) { + return this.addUnit(new Tracker(name, todo), weight) +} + +TrackerGroup.prototype.newStream = function (name, todo, weight) { + return this.addUnit(new TrackerStream(name, todo), weight) +} + +TrackerGroup.prototype.finish = function () { + this.finished = true + if (!this.trackers.length) { + this.addUnit(new Tracker(), 1, true) + } + for (var ii = 0; ii < this.trackers.length; ii++) { + var tracker = this.trackers[ii] + tracker.finish() + tracker.removeListener('change', this.bubbleChange) + } + this.emit('change', this.name, 1, this) +} + +var buffer = ' ' +TrackerGroup.prototype.debug = function (depth) { + depth = depth || 0 + var indent = depth ? buffer.substr(0, depth) : '' + var output = indent + (this.name || 'top') + ': ' + this.completed() + '\n' + this.trackers.forEach(function (tracker) { + if (tracker instanceof TrackerGroup) { + output += tracker.debug(depth + 1) + } else { + output += indent + ' ' + tracker.name + ': ' + tracker.completed() + '\n' + } + }) + return output +} diff --git a/backend/node_modules/are-we-there-yet/lib/tracker-stream.js b/backend/node_modules/are-we-there-yet/lib/tracker-stream.js new file mode 100644 index 000000000..e1cf85055 --- /dev/null +++ b/backend/node_modules/are-we-there-yet/lib/tracker-stream.js @@ -0,0 +1,36 @@ +'use strict' +var util = require('util') +var stream = require('readable-stream') +var delegate = require('delegates') +var Tracker = require('./tracker.js') + +var TrackerStream = module.exports = function (name, size, options) { + stream.Transform.call(this, options) + this.tracker = new Tracker(name, size) + this.name = name + this.id = this.tracker.id + this.tracker.on('change', delegateChange(this)) +} +util.inherits(TrackerStream, stream.Transform) + +function delegateChange (trackerStream) { + return function (name, completion, tracker) { + trackerStream.emit('change', name, completion, trackerStream) + } +} + +TrackerStream.prototype._transform = function (data, encoding, cb) { + this.tracker.completeWork(data.length ? data.length : 1) + this.push(data) + cb() +} + +TrackerStream.prototype._flush = function (cb) { + this.tracker.finish() + cb() +} + +delegate(TrackerStream.prototype, 'tracker') + .method('completed') + .method('addWork') + .method('finish') diff --git a/backend/node_modules/are-we-there-yet/lib/tracker.js b/backend/node_modules/are-we-there-yet/lib/tracker.js new file mode 100644 index 000000000..a8f8b3ba0 --- /dev/null +++ b/backend/node_modules/are-we-there-yet/lib/tracker.js @@ -0,0 +1,32 @@ +'use strict' +var util = require('util') +var TrackerBase = require('./tracker-base.js') + +var Tracker = module.exports = function (name, todo) { + TrackerBase.call(this, name) + this.workDone = 0 + this.workTodo = todo || 0 +} +util.inherits(Tracker, TrackerBase) + +Tracker.prototype.completed = function () { + return this.workTodo === 0 ? 0 : this.workDone / this.workTodo +} + +Tracker.prototype.addWork = function (work) { + this.workTodo += work + this.emit('change', this.name, this.completed(), this) +} + +Tracker.prototype.completeWork = function (work) { + this.workDone += work + if (this.workDone > this.workTodo) { + this.workDone = this.workTodo + } + this.emit('change', this.name, this.completed(), this) +} + +Tracker.prototype.finish = function () { + this.workTodo = this.workDone = 1 + this.emit('change', this.name, 1, this) +} diff --git a/backend/node_modules/are-we-there-yet/package.json b/backend/node_modules/are-we-there-yet/package.json new file mode 100644 index 000000000..5714e09c3 --- /dev/null +++ b/backend/node_modules/are-we-there-yet/package.json @@ -0,0 +1,53 @@ +{ + "name": "are-we-there-yet", + "version": "2.0.0", + "description": "Keep track of the overall completion of many disparate processes", + "main": "lib/index.js", + "scripts": { + "test": "tap", + "npmclilint": "npmcli-lint", + "lint": "eslint '**/*.js'", + "lintfix": "npm run lint -- --fix", + "posttest": "npm run lint", + "postsnap": "npm run lintfix --", + "preversion": "npm test", + "postversion": "npm publish", + "prepublishOnly": "git push origin --follow-tags", + "snap": "tap" + }, + "repository": { + "type": "git", + "url": "https://github.com/npm/are-we-there-yet.git" + }, + "author": "GitHub Inc.", + "license": "ISC", + "bugs": { + "url": "https://github.com/npm/are-we-there-yet/issues" + }, + "homepage": "https://github.com/npm/are-we-there-yet", + "devDependencies": { + "@npmcli/eslint-config": "^1.0.0", + "@npmcli/template-oss": "^1.0.2", + "eslint": "^7.32.0", + "eslint-plugin-node": "^11.1.0", + "tap": "^15.0.9" + }, + "dependencies": { + "delegates": "^1.0.0", + "readable-stream": "^3.6.0" + }, + "files": [ + "bin", + "lib" + ], + "engines": { + "node": ">=10" + }, + "tap": { + "branches": 68, + "statements": 92, + "functions": 86, + "lines": 92 + }, + "templateVersion": "1.0.2" +} diff --git a/backend/node_modules/array-flatten/LICENSE b/backend/node_modules/array-flatten/LICENSE new file mode 100644 index 000000000..983fbe8ae --- /dev/null +++ b/backend/node_modules/array-flatten/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014 Blake Embrey (hello@blakeembrey.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/backend/node_modules/array-flatten/README.md b/backend/node_modules/array-flatten/README.md new file mode 100644 index 000000000..91fa5b637 --- /dev/null +++ b/backend/node_modules/array-flatten/README.md @@ -0,0 +1,43 @@ +# Array Flatten + +[![NPM version][npm-image]][npm-url] +[![NPM downloads][downloads-image]][downloads-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] + +> Flatten an array of nested arrays into a single flat array. Accepts an optional depth. + +## Installation + +``` +npm install array-flatten --save +``` + +## Usage + +```javascript +var flatten = require('array-flatten') + +flatten([1, [2, [3, [4, [5], 6], 7], 8], 9]) +//=> [1, 2, 3, 4, 5, 6, 7, 8, 9] + +flatten([1, [2, [3, [4, [5], 6], 7], 8], 9], 2) +//=> [1, 2, 3, [4, [5], 6], 7, 8, 9] + +(function () { + flatten(arguments) //=> [1, 2, 3] +})(1, [2, 3]) +``` + +## License + +MIT + +[npm-image]: https://img.shields.io/npm/v/array-flatten.svg?style=flat +[npm-url]: https://npmjs.org/package/array-flatten +[downloads-image]: https://img.shields.io/npm/dm/array-flatten.svg?style=flat +[downloads-url]: https://npmjs.org/package/array-flatten +[travis-image]: https://img.shields.io/travis/blakeembrey/array-flatten.svg?style=flat +[travis-url]: https://travis-ci.org/blakeembrey/array-flatten +[coveralls-image]: https://img.shields.io/coveralls/blakeembrey/array-flatten.svg?style=flat +[coveralls-url]: https://coveralls.io/r/blakeembrey/array-flatten?branch=master diff --git a/backend/node_modules/array-flatten/array-flatten.js b/backend/node_modules/array-flatten/array-flatten.js new file mode 100644 index 000000000..089117b32 --- /dev/null +++ b/backend/node_modules/array-flatten/array-flatten.js @@ -0,0 +1,64 @@ +'use strict' + +/** + * Expose `arrayFlatten`. + */ +module.exports = arrayFlatten + +/** + * Recursive flatten function with depth. + * + * @param {Array} array + * @param {Array} result + * @param {Number} depth + * @return {Array} + */ +function flattenWithDepth (array, result, depth) { + for (var i = 0; i < array.length; i++) { + var value = array[i] + + if (depth > 0 && Array.isArray(value)) { + flattenWithDepth(value, result, depth - 1) + } else { + result.push(value) + } + } + + return result +} + +/** + * Recursive flatten function. Omitting depth is slightly faster. + * + * @param {Array} array + * @param {Array} result + * @return {Array} + */ +function flattenForever (array, result) { + for (var i = 0; i < array.length; i++) { + var value = array[i] + + if (Array.isArray(value)) { + flattenForever(value, result) + } else { + result.push(value) + } + } + + return result +} + +/** + * Flatten an array, with the ability to define a depth. + * + * @param {Array} array + * @param {Number} depth + * @return {Array} + */ +function arrayFlatten (array, depth) { + if (depth == null) { + return flattenForever(array, []) + } + + return flattenWithDepth(array, [], depth) +} diff --git a/backend/node_modules/array-flatten/package.json b/backend/node_modules/array-flatten/package.json new file mode 100644 index 000000000..1a24e2a1a --- /dev/null +++ b/backend/node_modules/array-flatten/package.json @@ -0,0 +1,39 @@ +{ + "name": "array-flatten", + "version": "1.1.1", + "description": "Flatten an array of nested arrays into a single flat array", + "main": "array-flatten.js", + "files": [ + "array-flatten.js", + "LICENSE" + ], + "scripts": { + "test": "istanbul cover _mocha -- -R spec" + }, + "repository": { + "type": "git", + "url": "git://github.com/blakeembrey/array-flatten.git" + }, + "keywords": [ + "array", + "flatten", + "arguments", + "depth" + ], + "author": { + "name": "Blake Embrey", + "email": "hello@blakeembrey.com", + "url": "http://blakeembrey.me" + }, + "license": "MIT", + "bugs": { + "url": "https://github.com/blakeembrey/array-flatten/issues" + }, + "homepage": "https://github.com/blakeembrey/array-flatten", + "devDependencies": { + "istanbul": "^0.3.13", + "mocha": "^2.2.4", + "pre-commit": "^1.0.7", + "standard": "^3.7.3" + } +} diff --git a/backend/node_modules/balanced-match/.github/FUNDING.yml b/backend/node_modules/balanced-match/.github/FUNDING.yml new file mode 100644 index 000000000..cea8b16e9 --- /dev/null +++ b/backend/node_modules/balanced-match/.github/FUNDING.yml @@ -0,0 +1,2 @@ +tidelift: "npm/balanced-match" +patreon: juliangruber diff --git a/backend/node_modules/balanced-match/LICENSE.md b/backend/node_modules/balanced-match/LICENSE.md new file mode 100644 index 000000000..2cdc8e414 --- /dev/null +++ b/backend/node_modules/balanced-match/LICENSE.md @@ -0,0 +1,21 @@ +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/backend/node_modules/balanced-match/README.md b/backend/node_modules/balanced-match/README.md new file mode 100644 index 000000000..d2a48b6b4 --- /dev/null +++ b/backend/node_modules/balanced-match/README.md @@ -0,0 +1,97 @@ +# balanced-match + +Match balanced string pairs, like `{` and `}` or `` and ``. Supports regular expressions as well! + +[![build status](https://secure.travis-ci.org/juliangruber/balanced-match.svg)](http://travis-ci.org/juliangruber/balanced-match) +[![downloads](https://img.shields.io/npm/dm/balanced-match.svg)](https://www.npmjs.org/package/balanced-match) + +[![testling badge](https://ci.testling.com/juliangruber/balanced-match.png)](https://ci.testling.com/juliangruber/balanced-match) + +## Example + +Get the first matching pair of braces: + +```js +var balanced = require('balanced-match'); + +console.log(balanced('{', '}', 'pre{in{nested}}post')); +console.log(balanced('{', '}', 'pre{first}between{second}post')); +console.log(balanced(/\s+\{\s+/, /\s+\}\s+/, 'pre { in{nest} } post')); +``` + +The matches are: + +```bash +$ node example.js +{ start: 3, end: 14, pre: 'pre', body: 'in{nested}', post: 'post' } +{ start: 3, + end: 9, + pre: 'pre', + body: 'first', + post: 'between{second}post' } +{ start: 3, end: 17, pre: 'pre', body: 'in{nest}', post: 'post' } +``` + +## API + +### var m = balanced(a, b, str) + +For the first non-nested matching pair of `a` and `b` in `str`, return an +object with those keys: + +* **start** the index of the first match of `a` +* **end** the index of the matching `b` +* **pre** the preamble, `a` and `b` not included +* **body** the match, `a` and `b` not included +* **post** the postscript, `a` and `b` not included + +If there's no match, `undefined` will be returned. + +If the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `['{', 'a', '']` and `{a}}` will match `['', 'a', '}']`. + +### var r = balanced.range(a, b, str) + +For the first non-nested matching pair of `a` and `b` in `str`, return an +array with indexes: `[ , ]`. + +If there's no match, `undefined` will be returned. + +If the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `[ 1, 3 ]` and `{a}}` will match `[0, 2]`. + +## Installation + +With [npm](https://npmjs.org) do: + +```bash +npm install balanced-match +``` + +## Security contact information + +To report a security vulnerability, please use the +[Tidelift security contact](https://tidelift.com/security). +Tidelift will coordinate the fix and disclosure. + +## License + +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/backend/node_modules/balanced-match/index.js b/backend/node_modules/balanced-match/index.js new file mode 100644 index 000000000..c67a64608 --- /dev/null +++ b/backend/node_modules/balanced-match/index.js @@ -0,0 +1,62 @@ +'use strict'; +module.exports = balanced; +function balanced(a, b, str) { + if (a instanceof RegExp) a = maybeMatch(a, str); + if (b instanceof RegExp) b = maybeMatch(b, str); + + var r = range(a, b, str); + + return r && { + start: r[0], + end: r[1], + pre: str.slice(0, r[0]), + body: str.slice(r[0] + a.length, r[1]), + post: str.slice(r[1] + b.length) + }; +} + +function maybeMatch(reg, str) { + var m = str.match(reg); + return m ? m[0] : null; +} + +balanced.range = range; +function range(a, b, str) { + var begs, beg, left, right, result; + var ai = str.indexOf(a); + var bi = str.indexOf(b, ai + 1); + var i = ai; + + if (ai >= 0 && bi > 0) { + if(a===b) { + return [ai, bi]; + } + begs = []; + left = str.length; + + while (i >= 0 && !result) { + if (i == ai) { + begs.push(i); + ai = str.indexOf(a, i + 1); + } else if (begs.length == 1) { + result = [ begs.pop(), bi ]; + } else { + beg = begs.pop(); + if (beg < left) { + left = beg; + right = bi; + } + + bi = str.indexOf(b, i + 1); + } + + i = ai < bi && ai >= 0 ? ai : bi; + } + + if (begs.length) { + result = [ left, right ]; + } + } + + return result; +} diff --git a/backend/node_modules/balanced-match/package.json b/backend/node_modules/balanced-match/package.json new file mode 100644 index 000000000..ce6073e04 --- /dev/null +++ b/backend/node_modules/balanced-match/package.json @@ -0,0 +1,48 @@ +{ + "name": "balanced-match", + "description": "Match balanced character pairs, like \"{\" and \"}\"", + "version": "1.0.2", + "repository": { + "type": "git", + "url": "git://github.com/juliangruber/balanced-match.git" + }, + "homepage": "https://github.com/juliangruber/balanced-match", + "main": "index.js", + "scripts": { + "test": "tape test/test.js", + "bench": "matcha test/bench.js" + }, + "devDependencies": { + "matcha": "^0.7.0", + "tape": "^4.6.0" + }, + "keywords": [ + "match", + "regexp", + "test", + "balanced", + "parse" + ], + "author": { + "name": "Julian Gruber", + "email": "mail@juliangruber.com", + "url": "http://juliangruber.com" + }, + "license": "MIT", + "testling": { + "files": "test/*.js", + "browsers": [ + "ie/8..latest", + "firefox/20..latest", + "firefox/nightly", + "chrome/25..latest", + "chrome/canary", + "opera/12..latest", + "opera/next", + "safari/5.1..latest", + "ipad/6.0..latest", + "iphone/6.0..latest", + "android-browser/4.2..latest" + ] + } +} diff --git a/backend/node_modules/bcrypt/.editorconfig b/backend/node_modules/bcrypt/.editorconfig new file mode 100644 index 000000000..4e12f93be --- /dev/null +++ b/backend/node_modules/bcrypt/.editorconfig @@ -0,0 +1,19 @@ +root = true + +[*] +indent_style = space +indent_size = 4 +end_of_line = lf +charset = utf-8 +trim_trailing_whitespace = true +insert_final_newline = true + +[{package.json,*.yml}] +indent_style = space +indent_size = 2 + +[appveyor.yml] +end_of_line = crlf + +[*.md] +trim_trailing_whitespace = false diff --git a/backend/node_modules/bcrypt/.github/workflows/ci.yaml b/backend/node_modules/bcrypt/.github/workflows/ci.yaml new file mode 100644 index 000000000..dc3f12f47 --- /dev/null +++ b/backend/node_modules/bcrypt/.github/workflows/ci.yaml @@ -0,0 +1,59 @@ +name: ci + +on: + push: + branches: + - master + pull_request: + branches: + - master + +jobs: + build: + strategy: + matrix: + os: [ubuntu-20.04, macos-11.0, windows-2019] + nodeVersion: [14, 16, 18, 20] + runs-on: ${{ matrix.os }} + steps: + - uses: actions/checkout@v3 + - name: Use Node.js ${{ matrix.nodeVersion }} + uses: actions/setup-node@v3 + with: + node-version: ${{ matrix.nodeVersion }} + - name: Test + run: npm test + - name: Package + if: startsWith(github.ref, 'refs/tags/') || startsWith(github.ref, 'refs/heads/master') + run: npx node-pre-gyp package + - name: Upload + uses: actions/upload-artifact@v3 + if: matrix.nodeVersion == '14' && (startsWith(github.ref, 'refs/tags/') || startsWith(github.ref, 'refs/heads/master')) + with: + name: bcrypt-lib-${{ matrix.os }}-${{ matrix.nodeVersion }} + path: build/stage/**/bcrypt_lib*.tar.gz + + build-alpine: + runs-on: ubuntu-latest + strategy: + matrix: + nodeVersion: [14, 16, 18, 20] + container: + image: node:${{ matrix.nodeVersion }}-alpine + steps: + - uses: actions/checkout@v3 + - name: Install dependencies + run: | + apk add make g++ python3 + - name: Test + run: | + npm test --unsafe-perm + - name: Package + if: startsWith(github.ref, 'refs/tags/') || startsWith(github.ref, 'refs/heads/master') + run: npx node-pre-gyp package --unsafe-perm + - name: Upload + if: matrix.nodeVersion == '14' && (startsWith(github.ref, 'refs/tags/') || startsWith(github.ref, 'refs/heads/master')) + uses: actions/upload-artifact@v3 + with: + name: bcrypt-lib-alpine-${{ matrix.nodeVersion }} + path: build/stage/**/bcrypt_lib*.tar.gz diff --git a/backend/node_modules/bcrypt/.travis.yml b/backend/node_modules/bcrypt/.travis.yml new file mode 100644 index 000000000..ed78c2717 --- /dev/null +++ b/backend/node_modules/bcrypt/.travis.yml @@ -0,0 +1,62 @@ +language: node_js + +services: +- docker + +env: +- LINUX_CXX=g++-4.8 + +os: +- linux +- osx + +arch: +- amd64 +- arm64 + +node_js: +- '14' +- '16' +- '17' +- '18' + +addons: + apt: + sources: + - ubuntu-toolchain-r-test + packages: + - g++-4.8 + - bc + +before_install: +- echo Building for Node $TRAVIS_NODE_VERSION +- if [[ "$TRAVIS_OS_NAME" == "linux" ]]; then export CXX=$LINUX_CXX; $CXX --version; + fi; +- if [[ "$TRAVIS_OS_NAME" == "osx" ]]; then c++ --version; fi; +- npm install -g npm@latest + +install: true + +script: +- npm test +- "./node_modules/.bin/node-pre-gyp configure" +- "./node_modules/.bin/node-pre-gyp build" +- "./node_modules/.bin/node-pre-gyp package" +- | + if [[ "$TRAVIS_OS_NAME" == "linux" ]] + then + docker image pull public.ecr.aws/docker/library/node:${TRAVIS_NODE_VERSION}-alpine + docker run -w /src --entrypoint /bin/sh -v`pwd`:/src "node:${TRAVIS_NODE_VERSION}-alpine" test_alpine.sh + fi + +deploy: + provider: releases + skip_cleanup: true + api_key: + secure: j4gQ+m02izaw56EOd0gEStHAjCRfSCkohDWvpABiPzh1YPM9MvfEMSIvzzjV/0oMqi3Sy7eGyFv47EgQHZvouW0I8BIUzxuTCE5wP8z2SjABXCa/rz4WTppTc9d9ABq8JSdz80JxEwjmuwnYeMwWgOd7sT/VDiMxLYaXj0JWO7w= + file_glob: true + file: build/stage/kelektiv/node.bcrypt.js/releases/download/*/* + on: + node_js: '14' + repo: kelektiv/node.bcrypt.js + tags: true diff --git a/backend/node_modules/bcrypt/CHANGELOG.md b/backend/node_modules/bcrypt/CHANGELOG.md new file mode 100644 index 000000000..f2fcb4714 --- /dev/null +++ b/backend/node_modules/bcrypt/CHANGELOG.md @@ -0,0 +1,178 @@ +# 5.1.0 (2022-10-06) + * Update `node-pre-gyp` to 1.0.11 + +# 5.1.0 (2022-10-06) + * Update `node-pre-gyp` to 1.0.10 + * Replace `nodeunit` with `jest` as the testing library + +# 5.0.1 (2021-02-22) + + * Update `node-pre-gyp` to 1.0.0 + +# 5.0.0 (2020-06-02) + + * Fix the bcrypt "wrap-around" bug. It affects passwords with lengths >= 255. + It is uncommon but it's a bug nevertheless. Previous attempts to fix the bug + was unsuccessful. + * Experimental support for z/OS + * Fix a bug related to NUL in password input + * Update `node-pre-gyp` to 0.15.0 + +# 4.0.1 (2020-02-27) + + * Fix compilation errors in Alpine linux + +# 4.0.0 (2020-02-17) + + * Switch to NAPI bcrypt + * Drop support for NodeJS 8 + +# 3.0.8 (2019-12-31) + + * Update `node-pre-gyp` to 0.14 + * Pre-built binaries for NodeJS 13 + +# 3.0.7 (2019-10-18) + + * Update `nan` to 2.14.0 + * Update `node-pre-gyp` to 0.13 + +# 3.0.6 (2019-04-11) + + * Update `nan` to 2.13.2 + +# 3.0.5 (2019-03-19) + + * Update `nan` to 2.13.1 + * NodeJS 12 compatibility + * Remove `node-pre-gyp` from bundled dependencies + +# 3.0.4-napi (2019-03-08) + + * Sync N-API bcrypt with NAN bcrypt + +# 3.0.4 (2019-02-07) + + * Fix GCC, NAN and V8 deprecation warnings + +# 3.0.3 (2018-12-19) + + * Update `nan` to 2.12.1 + +# 3.0.2 (2018-10-18) + + * Update `nan` to 2.11.1 + +# 3.0.1 (2018-09-20) + + * Update `nan` to 2.11.0 + +# 3.0.0 (2018-07-06) + + * Drop support for NodeJS <= 4 + +# 2.0.1 (2018-04-20) + + * Update `node-pre-gyp` to allow downloading prebuilt modules + +# 2.0.0 (2018-04-07) + + * Make `2b` the default bcrypt version + +# 1.1.0-napi (2018-01-21) + + * Initial support for [N-API](https://nodejs.org/api/n-api.html) + +# 1.0.3 (2016-08-23) + + * update to nan v2.6.2 for NodeJS 8 support + * Fix: use npm scripts instead of node-gyp directly. + +# 1.0.2 (2016-12-31) + + * Fix `compare` promise rejection with invalid arguments + +# 1.0.1 (2016-12-07) + + * Fix destructuring imports with promises + +# 1.0.0 (2016-12-04) + + * add Promise support (commit 2488473) + +# 0.8.7 (2016-06-09) + + * update nan to 2.3.5 for improved node v6 support + +# 0.8.6 (2016-04-20) + + * update nan for node v6 support + +# 0.8.5 (2015-08-12) + + * update to nan v2 (adds support for iojs 3) + +# 0.8.4 (2015-07-24) + + * fix deprecation warning for the Encode API + +# 0.8.3 (2015-05-06) + + * update nan to 1.8.4 for iojs 2.x support + +# 0.8.2 (2015-03-28) + + * always use callback for generating random bytes to avoid blocking + +# 0.8.1 (2015-01-18) + * update NaN to 1.5.0 for iojs support + +# 0.8.0 (2014-08-03) + * migrate to NAN for bindings + +# v0.5.0 + * Fix for issue around empty string params throwing Errors. + * Method deprecation. + * Upgrade from libeio/ev to libuv. (shtylman) + ** --- NOTE --- Breaks 0.4.x compatability + * EV_MULTIPLICITY compile flag. + +# v0.4.1 + * Thread safety fix around OpenSSL (GH-32). (bnoordhuis - through node) + * C++ code changes using delete and new instead of malloc and free. (shtylman) + * Compile options for speed, zoom. (shtylman) + * Move much of the type and variable checking to the JS. (shtylman) + +# v0.4.0 + * Added getRounds function that will tell you the number of rounds within a hash/salt + +# v0.3.2 + * Fix api issue with async salt gen first param + +# v0.3.1 + * Compile under node 0.5.x + +# v0.3.0 + * Internal Refactoring + * Remove pthread dependencies and locking + * Fix compiler warnings and a memory bug + +# v0.2.4 + * Use threadsafe functions instead of pthread mutexes + * salt validation to make sure the salt is of the correct size and format + +# v0.2.3 + * cygwin support + +# v0.2.2 + * Remove dependency on libbsd, use libssl instead + +# v0.2.0 + * Added async functionality + * API changes + * hashpw -> encrypt + * all old sync methods now end with _sync + * Removed libbsd(arc4random) dependency...now uses openssl which is more widely spread + +# v0.1.2 + * Security fix. Wasn't reading rounds in properly and was always only using 4 rounds diff --git a/backend/node_modules/bcrypt/ISSUE_TEMPLATE.md b/backend/node_modules/bcrypt/ISSUE_TEMPLATE.md new file mode 100644 index 000000000..b4baa0086 --- /dev/null +++ b/backend/node_modules/bcrypt/ISSUE_TEMPLATE.md @@ -0,0 +1,18 @@ +Thanks for reporting a new issue with the node bcrypt module! + +To help you resolve your issue faster please make sure you have done the following: + +* Searched existing issues (even closed ones) for your same problem +* Make sure you have installed the required dependencies listed on the readme +* Read your npm error log for lines telling you what failed, usually it is a problem with not having the correct dependencies installed to build the native module + +Once you have done the above and are still confident that the issue is with the module, please describe it below. Some things that really help get your issue resolved faster are: + +* What went wrong? +* What did you expect to happen? +* Which version of nodejs and OS? +* If you find a bug, please write a failing test. + +Thanks! + +P.S. If it doesn't look like you read the above then your issue will likely be closed without further explanation. Sorry, but there are just too many issues opened with no useful information or questions which have been previously addressed. diff --git a/backend/node_modules/bcrypt/LICENSE b/backend/node_modules/bcrypt/LICENSE new file mode 100644 index 000000000..94e2ba5f9 --- /dev/null +++ b/backend/node_modules/bcrypt/LICENSE @@ -0,0 +1,19 @@ +Copyright (c) 2010 Nicholas Campbell + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. \ No newline at end of file diff --git a/backend/node_modules/bcrypt/Makefile b/backend/node_modules/bcrypt/Makefile new file mode 100644 index 000000000..0b49b3db7 --- /dev/null +++ b/backend/node_modules/bcrypt/Makefile @@ -0,0 +1,19 @@ +TESTS = test/*.js + +all: test + +build: clean compile + +compile: + npm install . + npm run install + +test: build + @./node_modules/nodeunit/bin/nodeunit \ + $(TESTS) + +clean: + rm -Rf lib/bindings/ + + +.PHONY: clean test build diff --git a/backend/node_modules/bcrypt/README.md b/backend/node_modules/bcrypt/README.md new file mode 100644 index 000000000..059aa3ac7 --- /dev/null +++ b/backend/node_modules/bcrypt/README.md @@ -0,0 +1,388 @@ +# node.bcrypt.js + +[![ci](https://github.com/kelektiv/node.bcrypt.js/actions/workflows/ci.yaml/badge.svg)](https://github.com/kelektiv/node.bcrypt.js/actions/workflows/ci.yaml) + +[![Build Status](https://ci.appveyor.com/api/projects/status/github/kelektiv/node.bcrypt.js)](https://ci.appveyor.com/project/defunctzombie/node-bcrypt-js-pgo26/branch/master) + +A library to help you hash passwords. + +You can read about [bcrypt in Wikipedia][bcryptwiki] as well as in the following article: +[How To Safely Store A Password][codahale] + +## If You Are Submitting Bugs or Issues + +Please verify that the NodeJS version you are using is a _stable_ version; Unstable versions are currently not supported and issues created while using an unstable version will be closed. + +If you are on a stable version of NodeJS, please provide a sufficient code snippet or log files for installation issues. The code snippet does not require you to include confidential information. However, it must provide enough information so the problem can be replicable, or it may be closed without an explanation. + + +## Version Compatibility + +_Please upgrade to atleast v5.0.0 to avoid security issues mentioned below._ + +| Node Version | Bcrypt Version | +| -------------- | ------------------| +| 0.4 | <= 0.4 | +| 0.6, 0.8, 0.10 | >= 0.5 | +| 0.11 | >= 0.8 | +| 4 | <= 2.1.0 | +| 8 | >= 1.0.3 < 4.0.0 | +| 10, 11 | >= 3 | +| 12 onwards | >= 3.0.6 | + +`node-gyp` only works with stable/released versions of node. Since the `bcrypt` module uses `node-gyp` to build and install, you'll need a stable version of node to use bcrypt. If you do not, you'll likely see an error that starts with: + +``` +gyp ERR! stack Error: "pre" versions of node cannot be installed, use the --nodedir flag instead +``` + +## Security Issues And Concerns + +> Per bcrypt implementation, only the first 72 bytes of a string are used. Any extra bytes are ignored when matching passwords. Note that this is not the first 72 *characters*. It is possible for a string to contain less than 72 characters, while taking up more than 72 bytes (e.g. a UTF-8 encoded string containing emojis). + +As should be the case with any security tool, anyone using this library should scrutinise it. If you find or suspect an issue with the code, please bring it to the maintainers' attention. We will spend some time ensuring that this library is as secure as possible. + +Here is a list of BCrypt-related security issues/concerns that have come up over the years. + +* An [issue with passwords][jtr] was found with a version of the Blowfish algorithm developed for John the Ripper. This is not present in the OpenBSD version and is thus not a problem for this module. HT [zooko][zooko]. +* Versions `< 5.0.0` suffer from bcrypt wrap-around bug and _will truncate passwords >= 255 characters leading to severely weakened passwords_. Please upgrade at earliest. See [this wiki page][wrap-around-bug] for more details. +* Versions `< 5.0.0` _do not handle NUL characters inside passwords properly leading to all subsequent characters being dropped and thus resulting in severely weakened passwords_. Please upgrade at earliest. See [this wiki page][improper-nuls] for more details. + +## Compatibility Note + +This library supports `$2a$` and `$2b$` prefix bcrypt hashes. `$2x$` and `$2y$` hashes are specific to bcrypt implementation developed for John the Ripper. In theory, they should be compatible with `$2b$` prefix. + +Compatibility with hashes generated by other languages is not 100% guaranteed due to difference in character encodings. However, it should not be an issue for most cases. + +### Migrating from v1.0.x + +Hashes generated in earlier version of `bcrypt` remain 100% supported in `v2.x.x` and later versions. In most cases, the migration should be a bump in the `package.json`. + +Hashes generated in `v2.x.x` using the defaults parameters will not work in earlier versions. + +## Dependencies + +* NodeJS +* `node-gyp` + * Please check the dependencies for this tool at: https://github.com/nodejs/node-gyp + * Windows users will need the options for c# and c++ installed with their visual studio instance. + * Python 2.x/3.x +* `OpenSSL` - This is only required to build the `bcrypt` project if you are using versions <= 0.7.7. Otherwise, we're using the builtin node crypto bindings for seed data (which use the same OpenSSL code paths we were, but don't have the external dependency). + +## Install via NPM + +``` +npm install bcrypt +``` +***Note:*** OS X users using Xcode 4.3.1 or above may need to run the following command in their terminal prior to installing if errors occur regarding xcodebuild: ```sudo xcode-select -switch /Applications/Xcode.app/Contents/Developer``` + +_Pre-built binaries for various NodeJS versions are made available on a best-effort basis._ + +Only the current stable and supported LTS releases are actively tested against. + +_There may be an interval between the release of the module and the availabilty of the compiled modules._ + +Currently, we have pre-built binaries that support the following platforms: + +1. Windows x32 and x64 +2. Linux x64 (GlibC and musl) +3. macOS + +If you face an error like this: + +``` +node-pre-gyp ERR! Tried to download(404): https://github.com/kelektiv/node.bcrypt.js/releases/download/v1.0.2/bcrypt_lib-v1.0.2-node-v48-linux-x64.tar.gz +``` + +make sure you have the appropriate dependencies installed and configured for your platform. You can find installation instructions for the dependencies for some common platforms [in this page][depsinstall]. + +## Usage + +### async (recommended) + +```javascript +const bcrypt = require('bcrypt'); +const saltRounds = 10; +const myPlaintextPassword = 's0/\/\P4$$w0rD'; +const someOtherPlaintextPassword = 'not_bacon'; +``` + +#### To hash a password: + +Technique 1 (generate a salt and hash on separate function calls): + +```javascript +bcrypt.genSalt(saltRounds, function(err, salt) { + bcrypt.hash(myPlaintextPassword, salt, function(err, hash) { + // Store hash in your password DB. + }); +}); +``` + +Technique 2 (auto-gen a salt and hash): + +```javascript +bcrypt.hash(myPlaintextPassword, saltRounds, function(err, hash) { + // Store hash in your password DB. +}); +``` + +Note that both techniques achieve the same end-result. + +#### To check a password: + +```javascript +// Load hash from your password DB. +bcrypt.compare(myPlaintextPassword, hash, function(err, result) { + // result == true +}); +bcrypt.compare(someOtherPlaintextPassword, hash, function(err, result) { + // result == false +}); +``` + +[A Note on Timing Attacks](#a-note-on-timing-attacks) + +### with promises + +bcrypt uses whatever `Promise` implementation is available in `global.Promise`. NodeJS >= 0.12 has a native `Promise` implementation built in. However, this should work in any Promises/A+ compliant implementation. + +Async methods that accept a callback, return a `Promise` when callback is not specified if Promise support is available. + +```javascript +bcrypt.hash(myPlaintextPassword, saltRounds).then(function(hash) { + // Store hash in your password DB. +}); +``` +```javascript +// Load hash from your password DB. +bcrypt.compare(myPlaintextPassword, hash).then(function(result) { + // result == true +}); +bcrypt.compare(someOtherPlaintextPassword, hash).then(function(result) { + // result == false +}); +``` + +This is also compatible with `async/await` + +```javascript +async function checkUser(username, password) { + //... fetch user from a db etc. + + const match = await bcrypt.compare(password, user.passwordHash); + + if(match) { + //login + } + + //... +} +``` + +### ESM import +```javascript +import bcrypt from "bcrypt"; + +// later +await bcrypt.compare(password, hash); +``` + +### sync + +```javascript +const bcrypt = require('bcrypt'); +const saltRounds = 10; +const myPlaintextPassword = 's0/\/\P4$$w0rD'; +const someOtherPlaintextPassword = 'not_bacon'; +``` + +#### To hash a password: + +Technique 1 (generate a salt and hash on separate function calls): + +```javascript +const salt = bcrypt.genSaltSync(saltRounds); +const hash = bcrypt.hashSync(myPlaintextPassword, salt); +// Store hash in your password DB. +``` + +Technique 2 (auto-gen a salt and hash): + +```javascript +const hash = bcrypt.hashSync(myPlaintextPassword, saltRounds); +// Store hash in your password DB. +``` + +As with async, both techniques achieve the same end-result. + +#### To check a password: + +```javascript +// Load hash from your password DB. +bcrypt.compareSync(myPlaintextPassword, hash); // true +bcrypt.compareSync(someOtherPlaintextPassword, hash); // false +``` + +[A Note on Timing Attacks](#a-note-on-timing-attacks) + +### Why is async mode recommended over sync mode? +We recommend using async API if you use `bcrypt` on a server. Bcrypt hashing is CPU intensive which will cause the sync APIs to block the event loop and prevent your application from servicing any inbound requests or events. The async version uses a thread pool which does not block the main event loop. + +## API + +`BCrypt.` + + * `genSaltSync(rounds, minor)` + * `rounds` - [OPTIONAL] - the cost of processing the data. (default - 10) + * `minor` - [OPTIONAL] - minor version of bcrypt to use. (default - b) + * `genSalt(rounds, minor, cb)` + * `rounds` - [OPTIONAL] - the cost of processing the data. (default - 10) + * `minor` - [OPTIONAL] - minor version of bcrypt to use. (default - b) + * `cb` - [OPTIONAL] - a callback to be fired once the salt has been generated. uses eio making it asynchronous. If `cb` is not specified, a `Promise` is returned if Promise support is available. + * `err` - First parameter to the callback detailing any errors. + * `salt` - Second parameter to the callback providing the generated salt. + * `hashSync(data, salt)` + * `data` - [REQUIRED] - the data to be encrypted. + * `salt` - [REQUIRED] - the salt to be used to hash the password. if specified as a number then a salt will be generated with the specified number of rounds and used (see example under **Usage**). + * `hash(data, salt, cb)` + * `data` - [REQUIRED] - the data to be encrypted. + * `salt` - [REQUIRED] - the salt to be used to hash the password. if specified as a number then a salt will be generated with the specified number of rounds and used (see example under **Usage**). + * `cb` - [OPTIONAL] - a callback to be fired once the data has been encrypted. uses eio making it asynchronous. If `cb` is not specified, a `Promise` is returned if Promise support is available. + * `err` - First parameter to the callback detailing any errors. + * `encrypted` - Second parameter to the callback providing the encrypted form. + * `compareSync(data, encrypted)` + * `data` - [REQUIRED] - data to compare. + * `encrypted` - [REQUIRED] - data to be compared to. + * `compare(data, encrypted, cb)` + * `data` - [REQUIRED] - data to compare. + * `encrypted` - [REQUIRED] - data to be compared to. + * `cb` - [OPTIONAL] - a callback to be fired once the data has been compared. uses eio making it asynchronous. If `cb` is not specified, a `Promise` is returned if Promise support is available. + * `err` - First parameter to the callback detailing any errors. + * `same` - Second parameter to the callback providing whether the data and encrypted forms match [true | false]. + * `getRounds(encrypted)` - return the number of rounds used to encrypt a given hash + * `encrypted` - [REQUIRED] - hash from which the number of rounds used should be extracted. + +## A Note on Rounds + +A note about the cost: when you are hashing your data, the module will go through a series of rounds to give you a secure hash. The value you submit is not just the number of rounds the module will go through to hash your data. The module will use the value you enter and go through `2^rounds` hashing iterations. + +From @garthk, on a 2GHz core you can roughly expect: + + rounds=8 : ~40 hashes/sec + rounds=9 : ~20 hashes/sec + rounds=10: ~10 hashes/sec + rounds=11: ~5 hashes/sec + rounds=12: 2-3 hashes/sec + rounds=13: ~1 sec/hash + rounds=14: ~1.5 sec/hash + rounds=15: ~3 sec/hash + rounds=25: ~1 hour/hash + rounds=31: 2-3 days/hash + + +## A Note on Timing Attacks + +Because it's come up multiple times in this project and other bcrypt projects, it needs to be said. The `bcrypt` library is not susceptible to timing attacks. From codahale/bcrypt-ruby#42: + +> One of the desired properties of a cryptographic hash function is preimage attack resistance, which means there is no shortcut for generating a message which, when hashed, produces a specific digest. + +A great thread on this, in much more detail can be found @ codahale/bcrypt-ruby#43 + +If you're unfamiliar with timing attacks and want to learn more you can find a great writeup @ [A Lesson In Timing Attacks][timingatk] + +However, timing attacks are real. And the comparison function is _not_ time safe. That means that it may exit the function early in the comparison process. Timing attacks happen because of the above. We don't need to be careful that an attacker will learn anything, and our comparison function provides a comparison of hashes. It is a utility to the overall purpose of the library. If you end up using it for something else, we cannot guarantee the security of the comparator. Keep that in mind as you use the library. + +## Hash Info + +The characters that comprise the resultant hash are `./ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789$`. + +Resultant hashes will be 60 characters long and they will include the salt among other parameters, as follows: + +`$[algorithm]$[cost]$[salt][hash]` + +- 2 chars hash algorithm identifier prefix. `"$2a$" or "$2b$"` indicates BCrypt +- Cost-factor (n). Represents the exponent used to determine how many iterations 2^n +- 16-byte (128-bit) salt, base64 encoded to 22 characters +- 24-byte (192-bit) hash, base64 encoded to 31 characters + +Example: +``` +$2b$10$nOUIs5kJ7naTuTFkBy1veuK0kSxUFXfuaOKdOKf9xYT0KKIGSJwFa + | | | | + | | | hash-value = K0kSxUFXfuaOKdOKf9xYT0KKIGSJwFa + | | | + | | salt = nOUIs5kJ7naTuTFkBy1veu + | | + | cost-factor => 10 = 2^10 rounds + | + hash-algorithm identifier => 2b = BCrypt +``` + +## Testing + +If you create a pull request, tests better pass :) + +``` +npm install +npm test +``` + +## Credits + +The code for this comes from a few sources: + +* blowfish.cc - OpenBSD +* bcrypt.cc - OpenBSD +* bcrypt::gen_salt - [gen_salt inclusion to bcrypt][bcryptgs] +* bcrypt_node.cc - me + +## Contributors + +* [Antonio Salazar Cardozo][shadowfiend] - Early MacOS X support (when we used libbsd) +* [Ben Glow][pixelglow] - Fixes for thread safety with async calls +* [Van Nguyen][thegoleffect] - Found a timing attack in the comparator +* [NewITFarmer][newitfarmer] - Initial Cygwin support +* [David Trejo][dtrejo] - packaging fixes +* [Alfred Westerveld][alfredwesterveld] - packaging fixes +* [Vincent Côté-Roy][vincentr] - Testing around concurrency issues +* [Lloyd Hilaiel][lloyd] - Documentation fixes +* [Roman Shtylman][shtylman] - Code refactoring, general rot reduction, compile options, better memory management with delete and new, and an upgrade to libuv over eio/ev. +* [Vadim Graboys][vadimg] - Code changes to support 0.5.5+ +* [Ben Noordhuis][bnoordhuis] - Fixed a thread safety issue in nodejs that was perfectly mappable to this module. +* [Nate Rajlich][tootallnate] - Bindings and build process. +* [Sean McArthur][seanmonstar] - Windows Support +* [Fanie Oosthuysen][weareu] - Windows Support +* [Amitosh Swain Mahapatra][recrsn] - $2b$ hash support, ES6 Promise support +* [Nicola Del Gobbo][NickNaso] - Initial implementation with N-API + +## License +Unless stated elsewhere, file headers or otherwise, the license as stated in the LICENSE file. + +[bcryptwiki]: https://en.wikipedia.org/wiki/Bcrypt +[bcryptgs]: http://mail-index.netbsd.org/tech-crypto/2002/05/24/msg000204.html +[codahale]: http://codahale.com/how-to-safely-store-a-password/ +[gh13]: https://github.com/ncb000gt/node.bcrypt.js/issues/13 +[jtr]: http://www.openwall.com/lists/oss-security/2011/06/20/2 +[depsinstall]: https://github.com/kelektiv/node.bcrypt.js/wiki/Installation-Instructions +[timingatk]: https://codahale.com/a-lesson-in-timing-attacks/ +[wrap-around-bug]: https://github.com/kelektiv/node.bcrypt.js/wiki/Security-Issues-and-Concerns#bcrypt-wrap-around-bug-medium-severity +[improper-nuls]: https://github.com/kelektiv/node.bcrypt.js/wiki/Security-Issues-and-Concerns#improper-nul-handling-medium-severity + +[shadowfiend]:https://github.com/Shadowfiend +[thegoleffect]:https://github.com/thegoleffect +[pixelglow]:https://github.com/pixelglow +[dtrejo]:https://github.com/dtrejo +[alfredwesterveld]:https://github.com/alfredwesterveld +[newitfarmer]:https://github.com/newitfarmer +[zooko]:https://twitter.com/zooko +[vincentr]:https://twitter.com/vincentcr +[lloyd]:https://github.com/lloyd +[shtylman]:https://github.com/shtylman +[vadimg]:https://github.com/vadimg +[bnoordhuis]:https://github.com/bnoordhuis +[tootallnate]:https://github.com/tootallnate +[seanmonstar]:https://github.com/seanmonstar +[weareu]:https://github.com/weareu +[recrsn]:https://github.com/recrsn +[NickNaso]: https://github.com/NickNaso diff --git a/backend/node_modules/bcrypt/SECURITY.md b/backend/node_modules/bcrypt/SECURITY.md new file mode 100644 index 000000000..c132dc869 --- /dev/null +++ b/backend/node_modules/bcrypt/SECURITY.md @@ -0,0 +1,15 @@ +# Security Policy + +As with any software, `bcrypt` is likely to have bugs. Please report any security vulnerabilities responsibly + +## Supported Versions + +| Version | Supported | +| ------- | ------------------ | +| 5.0.x | :white_check_mark: | +| < 5.0 | :x: | + +## Reporting a Vulnerability + +If you are reporting a security vulnerability, please refrain from opening a GitHub issue and instead mail it to +one of the maintainers listed in the README. diff --git a/backend/node_modules/bcrypt/appveyor.yml b/backend/node_modules/bcrypt/appveyor.yml new file mode 100644 index 000000000..d9b4ebb46 --- /dev/null +++ b/backend/node_modules/bcrypt/appveyor.yml @@ -0,0 +1,39 @@ +environment: + matrix: + - nodejs_version: "14" + platform: x64 + - nodejs_version: "14" + platform: x86 + - nodejs_version: "16" + platform: x64 + - nodejs_version: "16" + platform: x86 + - nodejs_version: "18" + platform: x64 + +install: + - where npm + - where node + - ps: Install-Product node $env:nodejs_version $env:platform + +build: off + +artifacts: + - path: 'build/stage/**/bcrypt*.tar.gz' + +test_script: + - node --version + - npm --version + - npm test + +after_test: + - .\node_modules\.bin\node-pre-gyp package + +on_success: + - ps: > + if ($env:NODE_PRE_GYP_GITHUB_TOKEN -ne $null -and $env:APPVEYOR_REPO_TAG_NAME -match '^v(0|[1-9]+)\.(0|[1-9]+)\.(0|[1-9]+)(-\w)?$') { + echo "Publishing $env:APPVEYOR_REPO_TAG_NAME" + npm install node-pre-gyp-github@1.4.3 + ./node_modules/.bin/node-pre-gyp-github publish --release + } + diff --git a/backend/node_modules/bcrypt/bcrypt.js b/backend/node_modules/bcrypt/bcrypt.js new file mode 100644 index 000000000..612f9dcbf --- /dev/null +++ b/backend/node_modules/bcrypt/bcrypt.js @@ -0,0 +1,236 @@ +'use strict'; + +var nodePreGyp = require('@mapbox/node-pre-gyp'); +var path = require('path'); +var binding_path = nodePreGyp.find(path.resolve(path.join(__dirname, './package.json'))); +var bindings = require(binding_path); + +var crypto = require('crypto'); + +var promises = require('./promises'); + +/// generate a salt (sync) +/// @param {Number} [rounds] number of rounds (default 10) +/// @return {String} salt +module.exports.genSaltSync = function genSaltSync(rounds, minor) { + // default 10 rounds + if (!rounds) { + rounds = 10; + } else if (typeof rounds !== 'number') { + throw new Error('rounds must be a number'); + } + + if(!minor) { + minor = 'b'; + } else if(minor !== 'b' && minor !== 'a') { + throw new Error('minor must be either "a" or "b"'); + } + + return bindings.gen_salt_sync(minor, rounds, crypto.randomBytes(16)); +}; + +/// generate a salt +/// @param {Number} [rounds] number of rounds (default 10) +/// @param {Function} cb callback(err, salt) +module.exports.genSalt = function genSalt(rounds, minor, cb) { + var error; + + // if callback is first argument, then use defaults for others + if (typeof arguments[0] === 'function') { + // have to set callback first otherwise arguments are overriden + cb = arguments[0]; + rounds = 10; + minor = 'b'; + // callback is second argument + } else if (typeof arguments[1] === 'function') { + // have to set callback first otherwise arguments are overriden + cb = arguments[1]; + minor = 'b'; + } + + if (!cb) { + return promises.promise(genSalt, this, [rounds, minor]); + } + + // default 10 rounds + if (!rounds) { + rounds = 10; + } else if (typeof rounds !== 'number') { + // callback error asynchronously + error = new Error('rounds must be a number'); + return process.nextTick(function() { + cb(error); + }); + } + + if(!minor) { + minor = 'b' + } else if(minor !== 'b' && minor !== 'a') { + error = new Error('minor must be either "a" or "b"'); + return process.nextTick(function() { + cb(error); + }); + } + + crypto.randomBytes(16, function(error, randomBytes) { + if (error) { + cb(error); + return; + } + + bindings.gen_salt(minor, rounds, randomBytes, cb); + }); +}; + +/// hash data using a salt +/// @param {String|Buffer} data the data to encrypt +/// @param {String} salt the salt to use when hashing +/// @return {String} hash +module.exports.hashSync = function hashSync(data, salt) { + if (data == null || salt == null) { + throw new Error('data and salt arguments required'); + } + + if (!(typeof data === 'string' || data instanceof Buffer) || (typeof salt !== 'string' && typeof salt !== 'number')) { + throw new Error('data must be a string or Buffer and salt must either be a salt string or a number of rounds'); + } + + if (typeof salt === 'number') { + salt = module.exports.genSaltSync(salt); + } + + return bindings.encrypt_sync(data, salt); +}; + +/// hash data using a salt +/// @param {String|Buffer} data the data to encrypt +/// @param {String} salt the salt to use when hashing +/// @param {Function} cb callback(err, hash) +module.exports.hash = function hash(data, salt, cb) { + var error; + + if (typeof data === 'function') { + error = new Error('data must be a string or Buffer and salt must either be a salt string or a number of rounds'); + return process.nextTick(function() { + data(error); + }); + } + + if (typeof salt === 'function') { + error = new Error('data must be a string or Buffer and salt must either be a salt string or a number of rounds'); + return process.nextTick(function() { + salt(error); + }); + } + + // cb exists but is not a function + // return a rejecting promise + if (cb && typeof cb !== 'function') { + return promises.reject(new Error('cb must be a function or null to return a Promise')); + } + + if (!cb) { + return promises.promise(hash, this, [data, salt]); + } + + if (data == null || salt == null) { + error = new Error('data and salt arguments required'); + return process.nextTick(function() { + cb(error); + }); + } + + if (!(typeof data === 'string' || data instanceof Buffer) || (typeof salt !== 'string' && typeof salt !== 'number')) { + error = new Error('data must be a string or Buffer and salt must either be a salt string or a number of rounds'); + return process.nextTick(function() { + cb(error); + }); + } + + + if (typeof salt === 'number') { + return module.exports.genSalt(salt, function(err, salt) { + return bindings.encrypt(data, salt, cb); + }); + } + + return bindings.encrypt(data, salt, cb); +}; + +/// compare raw data to hash +/// @param {String|Buffer} data the data to hash and compare +/// @param {String} hash expected hash +/// @return {bool} true if hashed data matches hash +module.exports.compareSync = function compareSync(data, hash) { + if (data == null || hash == null) { + throw new Error('data and hash arguments required'); + } + + if (!(typeof data === 'string' || data instanceof Buffer) || typeof hash !== 'string') { + throw new Error('data must be a string or Buffer and hash must be a string'); + } + + return bindings.compare_sync(data, hash); +}; + +/// compare raw data to hash +/// @param {String|Buffer} data the data to hash and compare +/// @param {String} hash expected hash +/// @param {Function} cb callback(err, matched) - matched is true if hashed data matches hash +module.exports.compare = function compare(data, hash, cb) { + var error; + + if (typeof data === 'function') { + error = new Error('data and hash arguments required'); + return process.nextTick(function() { + data(error); + }); + } + + if (typeof hash === 'function') { + error = new Error('data and hash arguments required'); + return process.nextTick(function() { + hash(error); + }); + } + + // cb exists but is not a function + // return a rejecting promise + if (cb && typeof cb !== 'function') { + return promises.reject(new Error('cb must be a function or null to return a Promise')); + } + + if (!cb) { + return promises.promise(compare, this, [data, hash]); + } + + if (data == null || hash == null) { + error = new Error('data and hash arguments required'); + return process.nextTick(function() { + cb(error); + }); + } + + if (!(typeof data === 'string' || data instanceof Buffer) || typeof hash !== 'string') { + error = new Error('data and hash must be strings'); + return process.nextTick(function() { + cb(error); + }); + } + + return bindings.compare(data, hash, cb); +}; + +/// @param {String} hash extract rounds from this hash +/// @return {Number} the number of rounds used to encrypt a given hash +module.exports.getRounds = function getRounds(hash) { + if (hash == null) { + throw new Error('hash argument required'); + } + + if (typeof hash !== 'string') { + throw new Error('hash must be a string'); + } + + return bindings.get_rounds(hash); +}; diff --git a/backend/node_modules/bcrypt/binding.gyp b/backend/node_modules/bcrypt/binding.gyp new file mode 100644 index 000000000..181dca0f6 --- /dev/null +++ b/backend/node_modules/bcrypt/binding.gyp @@ -0,0 +1,61 @@ +{ + "variables": { + "NODE_VERSION%":" { + const start = Date.now(); + + // genSalt + const salt = await bcrypt.genSalt(10) + console.log('salt: ' + salt); + console.log('salt cb end: ' + (Date.now() - start) + 'ms'); + + // hash + const crypted = await bcrypt.hash('test', salt) + console.log('crypted: ' + crypted); + console.log('crypted cb end: ' + (Date.now() - start) + 'ms'); + console.log('rounds used from hash:', bcrypt.getRounds(crypted)); + + // compare + const res = await bcrypt.compare('test', crypted) + console.log('compared true: ' + res); + console.log('compared true cb end: ' + (Date.now() - start) + 'ms'); + + // compare + const res = await bcrypt.compare('bacon', crypted) + console.log('compared false: ' + res); + console.log('compared false cb end: ' + (Date.now() - start) + 'ms'); + + console.log('end: ' + (Date.now() - start) + 'ms'); +})(); diff --git a/backend/node_modules/bcrypt/examples/forever_gen_salt.js b/backend/node_modules/bcrypt/examples/forever_gen_salt.js new file mode 100644 index 000000000..761686a84 --- /dev/null +++ b/backend/node_modules/bcrypt/examples/forever_gen_salt.js @@ -0,0 +1,8 @@ +var bcrypt = require('../bcrypt'); + +(function printSalt() { + bcrypt.genSalt(10, function(err, salt) { + console.log('salt: ' + salt); + printSalt(); + }); +})() diff --git a/backend/node_modules/bcrypt/lib/binding/napi-v3/bcrypt_lib.node b/backend/node_modules/bcrypt/lib/binding/napi-v3/bcrypt_lib.node new file mode 100755 index 000000000..2f9c73982 Binary files /dev/null and b/backend/node_modules/bcrypt/lib/binding/napi-v3/bcrypt_lib.node differ diff --git a/backend/node_modules/bcrypt/package.json b/backend/node_modules/bcrypt/package.json new file mode 100644 index 000000000..621fc1be5 --- /dev/null +++ b/backend/node_modules/bcrypt/package.json @@ -0,0 +1,67 @@ +{ + "name": "bcrypt", + "description": "A bcrypt library for NodeJS.", + "keywords": [ + "bcrypt", + "password", + "auth", + "authentication", + "encryption", + "crypt", + "crypto" + ], + "main": "./bcrypt", + "version": "5.1.1", + "author": "Nick Campbell (https://github.com/ncb000gt)", + "engines": { + "node": ">= 10.0.0" + }, + "repository": { + "type": "git", + "url": "https://github.com/kelektiv/node.bcrypt.js.git" + }, + "license": "MIT", + "bugs": { + "url": "https://github.com/kelektiv/node.bcrypt.js/issues" + }, + "scripts": { + "test": "npm ci --build-from-source && jest", + "install": "node-pre-gyp install --fallback-to-build" + }, + "dependencies": { + "@mapbox/node-pre-gyp": "^1.0.11", + "node-addon-api": "^5.0.0" + }, + "devDependencies": { + "jest": "^29.6.2" + }, + "contributors": [ + "Antonio Salazar Cardozo (https://github.com/Shadowfiend)", + "Van Nguyen (https://github.com/thegoleffect)", + "David Trejo (https://github.com/dtrejo)", + "Ben Glow (https://github.com/pixelglow)", + "NewITFarmer.com <> (https://github.com/newitfarmer)", + "Alfred Westerveld (https://github.com/alfredwesterveld)", + "Vincent Côté-Roy (https://github.com/vincentcr)", + "Lloyd Hilaiel (https://github.com/lloyd)", + "Roman Shtylman (https://github.com/shtylman)", + "Vadim Graboys (https://github.com/vadimg)", + "Ben Noorduis <> (https://github.com/bnoordhuis)", + "Nate Rajlich (https://github.com/tootallnate)", + "Sean McArthur (https://github.com/seanmonstar)", + "Fanie Oosthuysen (https://github.com/weareu)", + "Amitosh Swain Mahapatra (https://github.com/Agathver)", + "Corbin Crutchley (https://github.com/crutchcorn)", + "Nicola Del Gobbo (https://github.com/NickNaso)" + ], + "binary": { + "module_name": "bcrypt_lib", + "module_path": "./lib/binding/napi-v{napi_build_version}", + "package_name": "{module_name}-v{version}-napi-v{napi_build_version}-{platform}-{arch}-{libc}.tar.gz", + "host": "https://github.com", + "remote_path": "kelektiv/node.bcrypt.js/releases/download/v{version}", + "napi_versions": [ + 3 + ] + } +} diff --git a/backend/node_modules/bcrypt/promises.js b/backend/node_modules/bcrypt/promises.js new file mode 100644 index 000000000..cd820142a --- /dev/null +++ b/backend/node_modules/bcrypt/promises.js @@ -0,0 +1,42 @@ +'use strict'; + +var Promise = global.Promise; + +/// encapsulate a method with a node-style callback in a Promise +/// @param {object} 'this' of the encapsulated function +/// @param {function} function to be encapsulated +/// @param {Array-like} args to be passed to the called function +/// @return {Promise} a Promise encapsulating the function +module.exports.promise = function (fn, context, args) { + + if (!Array.isArray(args)) { + args = Array.prototype.slice.call(args); + } + + if (typeof fn !== 'function') { + return Promise.reject(new Error('fn must be a function')); + } + + return new Promise(function(resolve, reject) { + args.push(function(err, data) { + if (err) { + reject(err); + } else { + resolve(data); + } + }); + + fn.apply(context, args); + }); +}; + +/// @param {err} the error to be thrown +module.exports.reject = function (err) { + return Promise.reject(err); +}; + +/// changes the promise implementation that bcrypt uses +/// @param {Promise} the implementation to use +module.exports.use = function(promise) { + Promise = promise; +}; diff --git a/backend/node_modules/bcrypt/src/bcrypt.cc b/backend/node_modules/bcrypt/src/bcrypt.cc new file mode 100644 index 000000000..bd8c57355 --- /dev/null +++ b/backend/node_modules/bcrypt/src/bcrypt.cc @@ -0,0 +1,315 @@ +/* $OpenBSD: bcrypt.c,v 1.31 2014/03/22 23:02:03 tedu Exp $ */ + +/* + * Copyright (c) 1997 Niels Provos + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ + +/* This password hashing algorithm was designed by David Mazieres + * and works as follows: + * + * 1. state := InitState () + * 2. state := ExpandKey (state, salt, password) + * 3. REPEAT rounds: + * state := ExpandKey (state, 0, password) + * state := ExpandKey (state, 0, salt) + * 4. ctext := "OrpheanBeholderScryDoubt" + * 5. REPEAT 64: + * ctext := Encrypt_ECB (state, ctext); + * 6. RETURN Concatenate (salt, ctext); + * + */ + +#include +#include +#include +#include + +#include "node_blf.h" + +#ifdef _WIN32 +#define snprintf _snprintf +#endif + +//#if !defined(__APPLE__) && !defined(__MACH__) +//#include "bsd/stdlib.h" +//#endif + +/* This implementation is adaptable to current computing power. + * You can have up to 2^31 rounds which should be enough for some + * time to come. + */ + +static void encode_base64(u_int8_t *, u_int8_t *, u_int16_t); +static void decode_base64(u_int8_t *, u_int16_t, u_int8_t *); + +const static char* error = ":"; + +const static u_int8_t Base64Code[] = +"./ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789"; + +const static u_int8_t index_64[128] = { + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 0, 1, 54, 55, + 56, 57, 58, 59, 60, 61, 62, 63, 255, 255, + 255, 255, 255, 255, 255, 2, 3, 4, 5, 6, + 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, + 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, + 255, 255, 255, 255, 255, 255, 28, 29, 30, + 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, + 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, + 51, 52, 53, 255, 255, 255, 255, 255 +}; +#define CHAR64(c) ( (c) > 127 ? 255 : index_64[(c)]) + +static void +decode_base64(u_int8_t *buffer, u_int16_t len, u_int8_t *data) +{ + u_int8_t *bp = buffer; + u_int8_t *p = data; + u_int8_t c1, c2, c3, c4; + while (bp < buffer + len) { + c1 = CHAR64(*p); + c2 = CHAR64(*(p + 1)); + + /* Invalid data */ + if (c1 == 255 || c2 == 255) + break; + + *bp++ = (c1 << 2) | ((c2 & 0x30) >> 4); + if (bp >= buffer + len) + break; + + c3 = CHAR64(*(p + 2)); + if (c3 == 255) + break; + + *bp++ = ((c2 & 0x0f) << 4) | ((c3 & 0x3c) >> 2); + if (bp >= buffer + len) + break; + + c4 = CHAR64(*(p + 3)); + if (c4 == 255) + break; + *bp++ = ((c3 & 0x03) << 6) | c4; + + p += 4; + } +} + +void +encode_salt(char *salt, u_int8_t *csalt, char minor, u_int16_t clen, u_int8_t logr) +{ + salt[0] = '$'; + salt[1] = BCRYPT_VERSION; + salt[2] = minor; + salt[3] = '$'; + + // Max rounds are 31 + snprintf(salt + 4, 4, "%2.2u$", logr & 0x001F); + + encode_base64((u_int8_t *) salt + 7, csalt, clen); +} + + +/* Generates a salt for this version of crypt. + Since versions may change. Keeping this here + seems sensible. + from: http://mail-index.netbsd.org/tech-crypto/2002/05/24/msg000204.html +*/ +void +bcrypt_gensalt(char minor, u_int8_t log_rounds, u_int8_t *seed, char *gsalt) +{ + if (log_rounds < 4) + log_rounds = 4; + else if (log_rounds > 31) + log_rounds = 31; + + encode_salt(gsalt, seed, minor, BCRYPT_MAXSALT, log_rounds); +} + +/* We handle $Vers$log2(NumRounds)$salt+passwd$ + i.e. $2$04$iwouldntknowwhattosayetKdJ6iFtacBqJdKe6aW7ou */ + +void +bcrypt(const char *key, size_t key_len, const char *salt, char *encrypted) +{ + blf_ctx state; + u_int32_t rounds, i, k; + u_int16_t j; + u_int8_t salt_len, logr, minor; + u_int8_t ciphertext[4 * BCRYPT_BLOCKS+1] = "OrpheanBeholderScryDoubt"; + u_int8_t csalt[BCRYPT_MAXSALT]; + u_int32_t cdata[BCRYPT_BLOCKS]; + int n; + + /* Discard "$" identifier */ + salt++; + + if (*salt > BCRYPT_VERSION) { + /* How do I handle errors ? Return ':' */ + strcpy(encrypted, error); + return; + } + + /* Check for minor versions */ + if (salt[1] != '$') { + switch (salt[1]) { + case 'a': /* 'ab' should not yield the same as 'abab' */ + case 'b': /* cap input length at 72 bytes */ + minor = salt[1]; + salt++; + break; + default: + strcpy(encrypted, error); + return; + } + } else + minor = 0; + + /* Discard version + "$" identifier */ + salt += 2; + + if (salt[2] != '$') { + /* Out of sync with passwd entry */ + strcpy(encrypted, error); + return; + } + + /* Computer power doesn't increase linear, 2^x should be fine */ + n = atoi(salt); + if (n > 31 || n < 0) { + strcpy(encrypted, error); + return; + } + logr = (u_int8_t)n; + if ((rounds = (u_int32_t) 1 << logr) < BCRYPT_MINROUNDS) { + strcpy(encrypted, error); + return; + } + + /* Discard num rounds + "$" identifier */ + salt += 3; + + if (strlen(salt) * 3 / 4 < BCRYPT_MAXSALT) { + strcpy(encrypted, error); + return; + } + + /* We dont want the base64 salt but the raw data */ + decode_base64(csalt, BCRYPT_MAXSALT, (u_int8_t *) salt); + salt_len = BCRYPT_MAXSALT; + if (minor <= 'a') + key_len = (u_int8_t)(key_len + (minor >= 'a' ? 1 : 0)); + else + { + /* cap key_len at the actual maximum supported + * length here to avoid integer wraparound */ + if (key_len > 72) + key_len = 72; + key_len++; /* include the NUL */ + } + + + /* Setting up S-Boxes and Subkeys */ + Blowfish_initstate(&state); + Blowfish_expandstate(&state, csalt, salt_len, + (u_int8_t *) key, key_len); + for (k = 0; k < rounds; k++) { + Blowfish_expand0state(&state, (u_int8_t *) key, key_len); + Blowfish_expand0state(&state, csalt, salt_len); + } + + /* This can be precomputed later */ + j = 0; + for (i = 0; i < BCRYPT_BLOCKS; i++) + cdata[i] = Blowfish_stream2word(ciphertext, 4 * BCRYPT_BLOCKS, &j); + + /* Now do the encryption */ + for (k = 0; k < 64; k++) + blf_enc(&state, cdata, BCRYPT_BLOCKS / 2); + + for (i = 0; i < BCRYPT_BLOCKS; i++) { + ciphertext[4 * i + 3] = cdata[i] & 0xff; + cdata[i] = cdata[i] >> 8; + ciphertext[4 * i + 2] = cdata[i] & 0xff; + cdata[i] = cdata[i] >> 8; + ciphertext[4 * i + 1] = cdata[i] & 0xff; + cdata[i] = cdata[i] >> 8; + ciphertext[4 * i + 0] = cdata[i] & 0xff; + } + + i = 0; + encrypted[i++] = '$'; + encrypted[i++] = BCRYPT_VERSION; + if (minor) + encrypted[i++] = minor; + encrypted[i++] = '$'; + + snprintf(encrypted + i, 4, "%2.2u$", logr & 0x001F); + + encode_base64((u_int8_t *) encrypted + i + 3, csalt, BCRYPT_MAXSALT); + encode_base64((u_int8_t *) encrypted + strlen(encrypted), ciphertext, + 4 * BCRYPT_BLOCKS - 1); + memset(&state, 0, sizeof(state)); + memset(ciphertext, 0, sizeof(ciphertext)); + memset(csalt, 0, sizeof(csalt)); + memset(cdata, 0, sizeof(cdata)); +} + +u_int32_t bcrypt_get_rounds(const char * hash) +{ + /* skip past the leading "$" */ + if (!hash || *(hash++) != '$') return 0; + + /* skip past version */ + if (0 == (*hash++)) return 0; + if (*hash && *hash != '$') hash++; + if (*hash++ != '$') return 0; + + return atoi(hash); +} + +static void +encode_base64(u_int8_t *buffer, u_int8_t *data, u_int16_t len) +{ + u_int8_t *bp = buffer; + u_int8_t *p = data; + u_int8_t c1, c2; + while (p < data + len) { + c1 = *p++; + *bp++ = Base64Code[(c1 >> 2)]; + c1 = (c1 & 0x03) << 4; + if (p >= data + len) { + *bp++ = Base64Code[c1]; + break; + } + c2 = *p++; + c1 |= (c2 >> 4) & 0x0f; + *bp++ = Base64Code[c1]; + c1 = (c2 & 0x0f) << 2; + if (p >= data + len) { + *bp++ = Base64Code[c1]; + break; + } + c2 = *p++; + c1 |= (c2 >> 6) & 0x03; + *bp++ = Base64Code[c1]; + *bp++ = Base64Code[c2 & 0x3f]; + } + *bp = '\0'; +} diff --git a/backend/node_modules/bcrypt/src/bcrypt_node.cc b/backend/node_modules/bcrypt/src/bcrypt_node.cc new file mode 100644 index 000000000..2f072a4f9 --- /dev/null +++ b/backend/node_modules/bcrypt/src/bcrypt_node.cc @@ -0,0 +1,288 @@ +#define NAPI_VERSION 3 + +#include + +#include +#include +#include +#include // atoi + +#include "node_blf.h" + +#define NODE_LESS_THAN (!(NODE_VERSION_AT_LEAST(0, 5, 4))) + +namespace { + + bool ValidateSalt(const char* salt) { + + if (!salt || *salt != '$') { + return false; + } + + // discard $ + salt++; + + if (*salt > BCRYPT_VERSION) { + return false; + } + + if (salt[1] != '$') { + switch (salt[1]) { + case 'a': + case 'b': + salt++; + break; + default: + return false; + } + } + + // discard version + $ + salt += 2; + + if (salt[2] != '$') { + return false; + } + + int n = atoi(salt); + if (n > 31 || n < 0) { + return false; + } + + if (((uint8_t)1 << (uint8_t)n) < BCRYPT_MINROUNDS) { + return false; + } + + salt += 3; + if (strlen(salt) * 3 / 4 < BCRYPT_MAXSALT) { + return false; + } + + return true; + } + + inline char ToCharVersion(const std::string& str) { + return str[0]; + } + + /* SALT GENERATION */ + + class SaltAsyncWorker : public Napi::AsyncWorker { + public: + SaltAsyncWorker(const Napi::Function& callback, const std::string& seed, ssize_t rounds, char minor_ver) + : Napi::AsyncWorker(callback, "bcrypt:SaltAsyncWorker"), seed(seed), rounds(rounds), minor_ver(minor_ver) { + } + + ~SaltAsyncWorker() {} + + void Execute() { + bcrypt_gensalt(minor_ver, rounds, (u_int8_t *)&seed[0], salt); + } + + void OnOK() { + Napi::HandleScope scope(Env()); + Callback().Call({Env().Undefined(), Napi::String::New(Env(), salt)}); + } + + private: + std::string seed; + ssize_t rounds; + char minor_ver; + char salt[_SALT_LEN]; + }; + + Napi::Value GenerateSalt(const Napi::CallbackInfo& info) { + Napi::Env env = info.Env(); + if (info.Length() < 4) { + throw Napi::TypeError::New(env, "4 arguments expected"); + } + if (!info[0].IsString()) { + throw Napi::TypeError::New(env, "First argument must be a string"); + } + if (!info[2].IsBuffer() || (info[2].As>()).Length() != 16) { + throw Napi::TypeError::New(env, "Second argument must be a 16 byte Buffer"); + } + + const char minor_ver = ToCharVersion(info[0].As()); + const int32_t rounds = info[1].As(); + Napi::Buffer seed = info[2].As>(); + Napi::Function callback = info[3].As(); + SaltAsyncWorker* saltWorker = new SaltAsyncWorker(callback, std::string(seed.Data(), 16), rounds, minor_ver); + saltWorker->Queue(); + return env.Undefined(); + } + + Napi::Value GenerateSaltSync(const Napi::CallbackInfo& info) { + Napi::Env env = info.Env(); + if (info.Length() < 3) { + throw Napi::TypeError::New(env, "3 arguments expected"); + } + if (!info[0].IsString()) { + throw Napi::TypeError::New(env, "First argument must be a string"); + } + if (!info[2].IsBuffer() || (info[2].As>()).Length() != 16) { + throw Napi::TypeError::New(env, "Third argument must be a 16 byte Buffer"); + } + const char minor_ver = ToCharVersion(info[0].As()); + const int32_t rounds = info[1].As(); + Napi::Buffer buffer = info[2].As>(); + u_int8_t* seed = (u_int8_t*) buffer.Data(); + char salt[_SALT_LEN]; + bcrypt_gensalt(minor_ver, rounds, seed, salt); + return Napi::String::New(env, salt, strlen(salt)); + } + + inline std::string BufferToString(const Napi::Buffer &buf) { + return std::string(buf.Data(), buf.Length()); + } + + /* ENCRYPT DATA - USED TO BE HASHPW */ + + class EncryptAsyncWorker : public Napi::AsyncWorker { + public: + EncryptAsyncWorker(const Napi::Function& callback, const std::string& input, const std::string& salt) + : Napi::AsyncWorker(callback, "bcrypt:EncryptAsyncWorker"), input(input), salt(salt) { + } + + ~EncryptAsyncWorker() {} + + void Execute() { + if (!(ValidateSalt(salt.c_str()))) { + SetError("Invalid salt. Salt must be in the form of: $Vers$log2(NumRounds)$saltvalue"); + } + bcrypt(input.c_str(), input.length(), salt.c_str(), bcrypted); + } + + void OnOK() { + Napi::HandleScope scope(Env()); + Callback().Call({Env().Undefined(),Napi::String::New(Env(), bcrypted)}); + } + private: + std::string input; + std::string salt; + char bcrypted[_PASSWORD_LEN]; + }; + + Napi::Value Encrypt(const Napi::CallbackInfo& info) { + if (info.Length() < 3) { + throw Napi::TypeError::New(info.Env(), "3 arguments expected"); + } + std::string data = info[0].IsBuffer() + ? BufferToString(info[0].As>()) + : info[0].As(); + std::string salt = info[1].As(); + Napi::Function callback = info[2].As(); + EncryptAsyncWorker* encryptWorker = new EncryptAsyncWorker(callback, data, salt); + encryptWorker->Queue(); + return info.Env().Undefined(); + } + + Napi::Value EncryptSync(const Napi::CallbackInfo& info) { + Napi::Env env = info.Env(); + if (info.Length() < 2) { + throw Napi::TypeError::New(info.Env(), "2 arguments expected"); + } + std::string data = info[0].IsBuffer() + ? BufferToString(info[0].As>()) + : info[0].As(); + std::string salt = info[1].As(); + if (!(ValidateSalt(salt.c_str()))) { + throw Napi::Error::New(env, "Invalid salt. Salt must be in the form of: $Vers$log2(NumRounds)$saltvalue"); + } + char bcrypted[_PASSWORD_LEN]; + bcrypt(data.c_str(), data.length(), salt.c_str(), bcrypted); + return Napi::String::New(env, bcrypted, strlen(bcrypted)); + } + + /* COMPARATOR */ + inline bool CompareStrings(const char* s1, const char* s2) { + return strcmp(s1, s2) == 0; + } + + class CompareAsyncWorker : public Napi::AsyncWorker { + public: + CompareAsyncWorker(const Napi::Function& callback, const std::string& input, const std::string& encrypted) + : Napi::AsyncWorker(callback, "bcrypt:CompareAsyncWorker"), input(input), encrypted(encrypted) { + result = false; + } + + ~CompareAsyncWorker() {} + + void Execute() { + char bcrypted[_PASSWORD_LEN]; + if (ValidateSalt(encrypted.c_str())) { + bcrypt(input.c_str(), input.length(), encrypted.c_str(), bcrypted); + result = CompareStrings(bcrypted, encrypted.c_str()); + } + } + + void OnOK() { + Napi::HandleScope scope(Env()); + Callback().Call({Env().Undefined(), Napi::Boolean::New(Env(), result)}); + } + + private: + std::string input; + std::string encrypted; + bool result; + }; + + Napi::Value Compare(const Napi::CallbackInfo& info) { + if (info.Length() < 3) { + throw Napi::TypeError::New(info.Env(), "3 arguments expected"); + } + std::string input = info[0].IsBuffer() + ? BufferToString(info[0].As>()) + : info[0].As(); + std::string encrypted = info[1].As(); + Napi::Function callback = info[2].As(); + CompareAsyncWorker* compareWorker = new CompareAsyncWorker(callback, input, encrypted); + compareWorker->Queue(); + return info.Env().Undefined(); + } + + Napi::Value CompareSync(const Napi::CallbackInfo& info) { + Napi::Env env = info.Env(); + if (info.Length() < 2) { + throw Napi::TypeError::New(info.Env(), "2 arguments expected"); + } + std::string pw = info[0].IsBuffer() + ? BufferToString(info[0].As>()) + : info[0].As(); + std::string hash = info[1].As(); + char bcrypted[_PASSWORD_LEN]; + if (ValidateSalt(hash.c_str())) { + bcrypt(pw.c_str(), pw.length(), hash.c_str(), bcrypted); + return Napi::Boolean::New(env, CompareStrings(bcrypted, hash.c_str())); + } else { + return Napi::Boolean::New(env, false); + } + } + + Napi::Value GetRounds(const Napi::CallbackInfo& info) { + Napi::Env env = info.Env(); + if (info.Length() < 1) { + throw Napi::TypeError::New(env, "1 argument expected"); + } + std::string hash = info[0].As(); + u_int32_t rounds; + if (!(rounds = bcrypt_get_rounds(hash.c_str()))) { + throw Napi::Error::New(env, "invalid hash provided"); + } + return Napi::Number::New(env, rounds); + } + +} // anonymous namespace + +Napi::Object init(Napi::Env env, Napi::Object exports) { + exports.Set(Napi::String::New(env, "gen_salt_sync"), Napi::Function::New(env, GenerateSaltSync)); + exports.Set(Napi::String::New(env, "encrypt_sync"), Napi::Function::New(env, EncryptSync)); + exports.Set(Napi::String::New(env, "compare_sync"), Napi::Function::New(env, CompareSync)); + exports.Set(Napi::String::New(env, "get_rounds"), Napi::Function::New(env, GetRounds)); + exports.Set(Napi::String::New(env, "gen_salt"), Napi::Function::New(env, GenerateSalt)); + exports.Set(Napi::String::New(env, "encrypt"), Napi::Function::New(env, Encrypt)); + exports.Set(Napi::String::New(env, "compare"), Napi::Function::New(env, Compare)); + return exports; +} + +NODE_API_MODULE(NODE_GYP_MODULE_NAME, init) diff --git a/backend/node_modules/bcrypt/src/blowfish.cc b/backend/node_modules/bcrypt/src/blowfish.cc new file mode 100644 index 000000000..1fc6cf19e --- /dev/null +++ b/backend/node_modules/bcrypt/src/blowfish.cc @@ -0,0 +1,679 @@ +/* $OpenBSD: blowfish.c,v 1.18 2004/11/02 17:23:26 hshoexer Exp $ */ +/* + * Blowfish block cipher for OpenBSD + * Copyright 1997 Niels Provos + * All rights reserved. + * + * Implementation advice by David Mazieres . + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * This product includes software developed by Niels Provos. + * 4. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR + * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES + * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. + * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, + * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +/* + * This code is derived from section 14.3 and the given source + * in section V of Applied Cryptography, second edition. + * Blowfish is an unpatented fast block cipher designed by + * Bruce Schneier. + */ + +#include "node_blf.h" + +#undef inline +#ifdef __GNUC__ +#define inline __inline +#else /* !__GNUC__ */ +#define inline +#endif /* !__GNUC__ */ + +/* Function for Feistel Networks */ + +#define F(s, x) ((((s)[ (((x)>>24)&0xFF)] \ + + (s)[0x100 + (((x)>>16)&0xFF)]) \ + ^ (s)[0x200 + (((x)>> 8)&0xFF)]) \ + + (s)[0x300 + ( (x) &0xFF)]) + +#define BLFRND(s,p,i,j,n) (i ^= F(s,j) ^ (p)[n]) + +void +Blowfish_encipher(blf_ctx *c, u_int32_t *xl, u_int32_t *xr) +{ + u_int32_t Xl; + u_int32_t Xr; + u_int32_t *s = c->S[0]; + u_int32_t *p = c->P; + + Xl = *xl; + Xr = *xr; + + Xl ^= p[0]; + BLFRND(s, p, Xr, Xl, 1); BLFRND(s, p, Xl, Xr, 2); + BLFRND(s, p, Xr, Xl, 3); BLFRND(s, p, Xl, Xr, 4); + BLFRND(s, p, Xr, Xl, 5); BLFRND(s, p, Xl, Xr, 6); + BLFRND(s, p, Xr, Xl, 7); BLFRND(s, p, Xl, Xr, 8); + BLFRND(s, p, Xr, Xl, 9); BLFRND(s, p, Xl, Xr, 10); + BLFRND(s, p, Xr, Xl, 11); BLFRND(s, p, Xl, Xr, 12); + BLFRND(s, p, Xr, Xl, 13); BLFRND(s, p, Xl, Xr, 14); + BLFRND(s, p, Xr, Xl, 15); BLFRND(s, p, Xl, Xr, 16); + + *xl = Xr ^ p[17]; + *xr = Xl; +} + +void +Blowfish_decipher(blf_ctx *c, u_int32_t *xl, u_int32_t *xr) +{ + u_int32_t Xl; + u_int32_t Xr; + u_int32_t *s = c->S[0]; + u_int32_t *p = c->P; + + Xl = *xl; + Xr = *xr; + + Xl ^= p[17]; + BLFRND(s, p, Xr, Xl, 16); BLFRND(s, p, Xl, Xr, 15); + BLFRND(s, p, Xr, Xl, 14); BLFRND(s, p, Xl, Xr, 13); + BLFRND(s, p, Xr, Xl, 12); BLFRND(s, p, Xl, Xr, 11); + BLFRND(s, p, Xr, Xl, 10); BLFRND(s, p, Xl, Xr, 9); + BLFRND(s, p, Xr, Xl, 8); BLFRND(s, p, Xl, Xr, 7); + BLFRND(s, p, Xr, Xl, 6); BLFRND(s, p, Xl, Xr, 5); + BLFRND(s, p, Xr, Xl, 4); BLFRND(s, p, Xl, Xr, 3); + BLFRND(s, p, Xr, Xl, 2); BLFRND(s, p, Xl, Xr, 1); + + *xl = Xr ^ p[0]; + *xr = Xl; +} + +void +Blowfish_initstate(blf_ctx *c) +{ + /* P-box and S-box tables initialized with digits of Pi */ + + static const blf_ctx initstate = + { { + { + 0xd1310ba6, 0x98dfb5ac, 0x2ffd72db, 0xd01adfb7, + 0xb8e1afed, 0x6a267e96, 0xba7c9045, 0xf12c7f99, + 0x24a19947, 0xb3916cf7, 0x0801f2e2, 0x858efc16, + 0x636920d8, 0x71574e69, 0xa458fea3, 0xf4933d7e, + 0x0d95748f, 0x728eb658, 0x718bcd58, 0x82154aee, + 0x7b54a41d, 0xc25a59b5, 0x9c30d539, 0x2af26013, + 0xc5d1b023, 0x286085f0, 0xca417918, 0xb8db38ef, + 0x8e79dcb0, 0x603a180e, 0x6c9e0e8b, 0xb01e8a3e, + 0xd71577c1, 0xbd314b27, 0x78af2fda, 0x55605c60, + 0xe65525f3, 0xaa55ab94, 0x57489862, 0x63e81440, + 0x55ca396a, 0x2aab10b6, 0xb4cc5c34, 0x1141e8ce, + 0xa15486af, 0x7c72e993, 0xb3ee1411, 0x636fbc2a, + 0x2ba9c55d, 0x741831f6, 0xce5c3e16, 0x9b87931e, + 0xafd6ba33, 0x6c24cf5c, 0x7a325381, 0x28958677, + 0x3b8f4898, 0x6b4bb9af, 0xc4bfe81b, 0x66282193, + 0x61d809cc, 0xfb21a991, 0x487cac60, 0x5dec8032, + 0xef845d5d, 0xe98575b1, 0xdc262302, 0xeb651b88, + 0x23893e81, 0xd396acc5, 0x0f6d6ff3, 0x83f44239, + 0x2e0b4482, 0xa4842004, 0x69c8f04a, 0x9e1f9b5e, + 0x21c66842, 0xf6e96c9a, 0x670c9c61, 0xabd388f0, + 0x6a51a0d2, 0xd8542f68, 0x960fa728, 0xab5133a3, + 0x6eef0b6c, 0x137a3be4, 0xba3bf050, 0x7efb2a98, + 0xa1f1651d, 0x39af0176, 0x66ca593e, 0x82430e88, + 0x8cee8619, 0x456f9fb4, 0x7d84a5c3, 0x3b8b5ebe, + 0xe06f75d8, 0x85c12073, 0x401a449f, 0x56c16aa6, + 0x4ed3aa62, 0x363f7706, 0x1bfedf72, 0x429b023d, + 0x37d0d724, 0xd00a1248, 0xdb0fead3, 0x49f1c09b, + 0x075372c9, 0x80991b7b, 0x25d479d8, 0xf6e8def7, + 0xe3fe501a, 0xb6794c3b, 0x976ce0bd, 0x04c006ba, + 0xc1a94fb6, 0x409f60c4, 0x5e5c9ec2, 0x196a2463, + 0x68fb6faf, 0x3e6c53b5, 0x1339b2eb, 0x3b52ec6f, + 0x6dfc511f, 0x9b30952c, 0xcc814544, 0xaf5ebd09, + 0xbee3d004, 0xde334afd, 0x660f2807, 0x192e4bb3, + 0xc0cba857, 0x45c8740f, 0xd20b5f39, 0xb9d3fbdb, + 0x5579c0bd, 0x1a60320a, 0xd6a100c6, 0x402c7279, + 0x679f25fe, 0xfb1fa3cc, 0x8ea5e9f8, 0xdb3222f8, + 0x3c7516df, 0xfd616b15, 0x2f501ec8, 0xad0552ab, + 0x323db5fa, 0xfd238760, 0x53317b48, 0x3e00df82, + 0x9e5c57bb, 0xca6f8ca0, 0x1a87562e, 0xdf1769db, + 0xd542a8f6, 0x287effc3, 0xac6732c6, 0x8c4f5573, + 0x695b27b0, 0xbbca58c8, 0xe1ffa35d, 0xb8f011a0, + 0x10fa3d98, 0xfd2183b8, 0x4afcb56c, 0x2dd1d35b, + 0x9a53e479, 0xb6f84565, 0xd28e49bc, 0x4bfb9790, + 0xe1ddf2da, 0xa4cb7e33, 0x62fb1341, 0xcee4c6e8, + 0xef20cada, 0x36774c01, 0xd07e9efe, 0x2bf11fb4, + 0x95dbda4d, 0xae909198, 0xeaad8e71, 0x6b93d5a0, + 0xd08ed1d0, 0xafc725e0, 0x8e3c5b2f, 0x8e7594b7, + 0x8ff6e2fb, 0xf2122b64, 0x8888b812, 0x900df01c, + 0x4fad5ea0, 0x688fc31c, 0xd1cff191, 0xb3a8c1ad, + 0x2f2f2218, 0xbe0e1777, 0xea752dfe, 0x8b021fa1, + 0xe5a0cc0f, 0xb56f74e8, 0x18acf3d6, 0xce89e299, + 0xb4a84fe0, 0xfd13e0b7, 0x7cc43b81, 0xd2ada8d9, + 0x165fa266, 0x80957705, 0x93cc7314, 0x211a1477, + 0xe6ad2065, 0x77b5fa86, 0xc75442f5, 0xfb9d35cf, + 0xebcdaf0c, 0x7b3e89a0, 0xd6411bd3, 0xae1e7e49, + 0x00250e2d, 0x2071b35e, 0x226800bb, 0x57b8e0af, + 0x2464369b, 0xf009b91e, 0x5563911d, 0x59dfa6aa, + 0x78c14389, 0xd95a537f, 0x207d5ba2, 0x02e5b9c5, + 0x83260376, 0x6295cfa9, 0x11c81968, 0x4e734a41, + 0xb3472dca, 0x7b14a94a, 0x1b510052, 0x9a532915, + 0xd60f573f, 0xbc9bc6e4, 0x2b60a476, 0x81e67400, + 0x08ba6fb5, 0x571be91f, 0xf296ec6b, 0x2a0dd915, + 0xb6636521, 0xe7b9f9b6, 0xff34052e, 0xc5855664, + 0x53b02d5d, 0xa99f8fa1, 0x08ba4799, 0x6e85076a}, + { + 0x4b7a70e9, 0xb5b32944, 0xdb75092e, 0xc4192623, + 0xad6ea6b0, 0x49a7df7d, 0x9cee60b8, 0x8fedb266, + 0xecaa8c71, 0x699a17ff, 0x5664526c, 0xc2b19ee1, + 0x193602a5, 0x75094c29, 0xa0591340, 0xe4183a3e, + 0x3f54989a, 0x5b429d65, 0x6b8fe4d6, 0x99f73fd6, + 0xa1d29c07, 0xefe830f5, 0x4d2d38e6, 0xf0255dc1, + 0x4cdd2086, 0x8470eb26, 0x6382e9c6, 0x021ecc5e, + 0x09686b3f, 0x3ebaefc9, 0x3c971814, 0x6b6a70a1, + 0x687f3584, 0x52a0e286, 0xb79c5305, 0xaa500737, + 0x3e07841c, 0x7fdeae5c, 0x8e7d44ec, 0x5716f2b8, + 0xb03ada37, 0xf0500c0d, 0xf01c1f04, 0x0200b3ff, + 0xae0cf51a, 0x3cb574b2, 0x25837a58, 0xdc0921bd, + 0xd19113f9, 0x7ca92ff6, 0x94324773, 0x22f54701, + 0x3ae5e581, 0x37c2dadc, 0xc8b57634, 0x9af3dda7, + 0xa9446146, 0x0fd0030e, 0xecc8c73e, 0xa4751e41, + 0xe238cd99, 0x3bea0e2f, 0x3280bba1, 0x183eb331, + 0x4e548b38, 0x4f6db908, 0x6f420d03, 0xf60a04bf, + 0x2cb81290, 0x24977c79, 0x5679b072, 0xbcaf89af, + 0xde9a771f, 0xd9930810, 0xb38bae12, 0xdccf3f2e, + 0x5512721f, 0x2e6b7124, 0x501adde6, 0x9f84cd87, + 0x7a584718, 0x7408da17, 0xbc9f9abc, 0xe94b7d8c, + 0xec7aec3a, 0xdb851dfa, 0x63094366, 0xc464c3d2, + 0xef1c1847, 0x3215d908, 0xdd433b37, 0x24c2ba16, + 0x12a14d43, 0x2a65c451, 0x50940002, 0x133ae4dd, + 0x71dff89e, 0x10314e55, 0x81ac77d6, 0x5f11199b, + 0x043556f1, 0xd7a3c76b, 0x3c11183b, 0x5924a509, + 0xf28fe6ed, 0x97f1fbfa, 0x9ebabf2c, 0x1e153c6e, + 0x86e34570, 0xeae96fb1, 0x860e5e0a, 0x5a3e2ab3, + 0x771fe71c, 0x4e3d06fa, 0x2965dcb9, 0x99e71d0f, + 0x803e89d6, 0x5266c825, 0x2e4cc978, 0x9c10b36a, + 0xc6150eba, 0x94e2ea78, 0xa5fc3c53, 0x1e0a2df4, + 0xf2f74ea7, 0x361d2b3d, 0x1939260f, 0x19c27960, + 0x5223a708, 0xf71312b6, 0xebadfe6e, 0xeac31f66, + 0xe3bc4595, 0xa67bc883, 0xb17f37d1, 0x018cff28, + 0xc332ddef, 0xbe6c5aa5, 0x65582185, 0x68ab9802, + 0xeecea50f, 0xdb2f953b, 0x2aef7dad, 0x5b6e2f84, + 0x1521b628, 0x29076170, 0xecdd4775, 0x619f1510, + 0x13cca830, 0xeb61bd96, 0x0334fe1e, 0xaa0363cf, + 0xb5735c90, 0x4c70a239, 0xd59e9e0b, 0xcbaade14, + 0xeecc86bc, 0x60622ca7, 0x9cab5cab, 0xb2f3846e, + 0x648b1eaf, 0x19bdf0ca, 0xa02369b9, 0x655abb50, + 0x40685a32, 0x3c2ab4b3, 0x319ee9d5, 0xc021b8f7, + 0x9b540b19, 0x875fa099, 0x95f7997e, 0x623d7da8, + 0xf837889a, 0x97e32d77, 0x11ed935f, 0x16681281, + 0x0e358829, 0xc7e61fd6, 0x96dedfa1, 0x7858ba99, + 0x57f584a5, 0x1b227263, 0x9b83c3ff, 0x1ac24696, + 0xcdb30aeb, 0x532e3054, 0x8fd948e4, 0x6dbc3128, + 0x58ebf2ef, 0x34c6ffea, 0xfe28ed61, 0xee7c3c73, + 0x5d4a14d9, 0xe864b7e3, 0x42105d14, 0x203e13e0, + 0x45eee2b6, 0xa3aaabea, 0xdb6c4f15, 0xfacb4fd0, + 0xc742f442, 0xef6abbb5, 0x654f3b1d, 0x41cd2105, + 0xd81e799e, 0x86854dc7, 0xe44b476a, 0x3d816250, + 0xcf62a1f2, 0x5b8d2646, 0xfc8883a0, 0xc1c7b6a3, + 0x7f1524c3, 0x69cb7492, 0x47848a0b, 0x5692b285, + 0x095bbf00, 0xad19489d, 0x1462b174, 0x23820e00, + 0x58428d2a, 0x0c55f5ea, 0x1dadf43e, 0x233f7061, + 0x3372f092, 0x8d937e41, 0xd65fecf1, 0x6c223bdb, + 0x7cde3759, 0xcbee7460, 0x4085f2a7, 0xce77326e, + 0xa6078084, 0x19f8509e, 0xe8efd855, 0x61d99735, + 0xa969a7aa, 0xc50c06c2, 0x5a04abfc, 0x800bcadc, + 0x9e447a2e, 0xc3453484, 0xfdd56705, 0x0e1e9ec9, + 0xdb73dbd3, 0x105588cd, 0x675fda79, 0xe3674340, + 0xc5c43465, 0x713e38d8, 0x3d28f89e, 0xf16dff20, + 0x153e21e7, 0x8fb03d4a, 0xe6e39f2b, 0xdb83adf7}, + { + 0xe93d5a68, 0x948140f7, 0xf64c261c, 0x94692934, + 0x411520f7, 0x7602d4f7, 0xbcf46b2e, 0xd4a20068, + 0xd4082471, 0x3320f46a, 0x43b7d4b7, 0x500061af, + 0x1e39f62e, 0x97244546, 0x14214f74, 0xbf8b8840, + 0x4d95fc1d, 0x96b591af, 0x70f4ddd3, 0x66a02f45, + 0xbfbc09ec, 0x03bd9785, 0x7fac6dd0, 0x31cb8504, + 0x96eb27b3, 0x55fd3941, 0xda2547e6, 0xabca0a9a, + 0x28507825, 0x530429f4, 0x0a2c86da, 0xe9b66dfb, + 0x68dc1462, 0xd7486900, 0x680ec0a4, 0x27a18dee, + 0x4f3ffea2, 0xe887ad8c, 0xb58ce006, 0x7af4d6b6, + 0xaace1e7c, 0xd3375fec, 0xce78a399, 0x406b2a42, + 0x20fe9e35, 0xd9f385b9, 0xee39d7ab, 0x3b124e8b, + 0x1dc9faf7, 0x4b6d1856, 0x26a36631, 0xeae397b2, + 0x3a6efa74, 0xdd5b4332, 0x6841e7f7, 0xca7820fb, + 0xfb0af54e, 0xd8feb397, 0x454056ac, 0xba489527, + 0x55533a3a, 0x20838d87, 0xfe6ba9b7, 0xd096954b, + 0x55a867bc, 0xa1159a58, 0xcca92963, 0x99e1db33, + 0xa62a4a56, 0x3f3125f9, 0x5ef47e1c, 0x9029317c, + 0xfdf8e802, 0x04272f70, 0x80bb155c, 0x05282ce3, + 0x95c11548, 0xe4c66d22, 0x48c1133f, 0xc70f86dc, + 0x07f9c9ee, 0x41041f0f, 0x404779a4, 0x5d886e17, + 0x325f51eb, 0xd59bc0d1, 0xf2bcc18f, 0x41113564, + 0x257b7834, 0x602a9c60, 0xdff8e8a3, 0x1f636c1b, + 0x0e12b4c2, 0x02e1329e, 0xaf664fd1, 0xcad18115, + 0x6b2395e0, 0x333e92e1, 0x3b240b62, 0xeebeb922, + 0x85b2a20e, 0xe6ba0d99, 0xde720c8c, 0x2da2f728, + 0xd0127845, 0x95b794fd, 0x647d0862, 0xe7ccf5f0, + 0x5449a36f, 0x877d48fa, 0xc39dfd27, 0xf33e8d1e, + 0x0a476341, 0x992eff74, 0x3a6f6eab, 0xf4f8fd37, + 0xa812dc60, 0xa1ebddf8, 0x991be14c, 0xdb6e6b0d, + 0xc67b5510, 0x6d672c37, 0x2765d43b, 0xdcd0e804, + 0xf1290dc7, 0xcc00ffa3, 0xb5390f92, 0x690fed0b, + 0x667b9ffb, 0xcedb7d9c, 0xa091cf0b, 0xd9155ea3, + 0xbb132f88, 0x515bad24, 0x7b9479bf, 0x763bd6eb, + 0x37392eb3, 0xcc115979, 0x8026e297, 0xf42e312d, + 0x6842ada7, 0xc66a2b3b, 0x12754ccc, 0x782ef11c, + 0x6a124237, 0xb79251e7, 0x06a1bbe6, 0x4bfb6350, + 0x1a6b1018, 0x11caedfa, 0x3d25bdd8, 0xe2e1c3c9, + 0x44421659, 0x0a121386, 0xd90cec6e, 0xd5abea2a, + 0x64af674e, 0xda86a85f, 0xbebfe988, 0x64e4c3fe, + 0x9dbc8057, 0xf0f7c086, 0x60787bf8, 0x6003604d, + 0xd1fd8346, 0xf6381fb0, 0x7745ae04, 0xd736fccc, + 0x83426b33, 0xf01eab71, 0xb0804187, 0x3c005e5f, + 0x77a057be, 0xbde8ae24, 0x55464299, 0xbf582e61, + 0x4e58f48f, 0xf2ddfda2, 0xf474ef38, 0x8789bdc2, + 0x5366f9c3, 0xc8b38e74, 0xb475f255, 0x46fcd9b9, + 0x7aeb2661, 0x8b1ddf84, 0x846a0e79, 0x915f95e2, + 0x466e598e, 0x20b45770, 0x8cd55591, 0xc902de4c, + 0xb90bace1, 0xbb8205d0, 0x11a86248, 0x7574a99e, + 0xb77f19b6, 0xe0a9dc09, 0x662d09a1, 0xc4324633, + 0xe85a1f02, 0x09f0be8c, 0x4a99a025, 0x1d6efe10, + 0x1ab93d1d, 0x0ba5a4df, 0xa186f20f, 0x2868f169, + 0xdcb7da83, 0x573906fe, 0xa1e2ce9b, 0x4fcd7f52, + 0x50115e01, 0xa70683fa, 0xa002b5c4, 0x0de6d027, + 0x9af88c27, 0x773f8641, 0xc3604c06, 0x61a806b5, + 0xf0177a28, 0xc0f586e0, 0x006058aa, 0x30dc7d62, + 0x11e69ed7, 0x2338ea63, 0x53c2dd94, 0xc2c21634, + 0xbbcbee56, 0x90bcb6de, 0xebfc7da1, 0xce591d76, + 0x6f05e409, 0x4b7c0188, 0x39720a3d, 0x7c927c24, + 0x86e3725f, 0x724d9db9, 0x1ac15bb4, 0xd39eb8fc, + 0xed545578, 0x08fca5b5, 0xd83d7cd3, 0x4dad0fc4, + 0x1e50ef5e, 0xb161e6f8, 0xa28514d9, 0x6c51133c, + 0x6fd5c7e7, 0x56e14ec4, 0x362abfce, 0xddc6c837, + 0xd79a3234, 0x92638212, 0x670efa8e, 0x406000e0}, + { + 0x3a39ce37, 0xd3faf5cf, 0xabc27737, 0x5ac52d1b, + 0x5cb0679e, 0x4fa33742, 0xd3822740, 0x99bc9bbe, + 0xd5118e9d, 0xbf0f7315, 0xd62d1c7e, 0xc700c47b, + 0xb78c1b6b, 0x21a19045, 0xb26eb1be, 0x6a366eb4, + 0x5748ab2f, 0xbc946e79, 0xc6a376d2, 0x6549c2c8, + 0x530ff8ee, 0x468dde7d, 0xd5730a1d, 0x4cd04dc6, + 0x2939bbdb, 0xa9ba4650, 0xac9526e8, 0xbe5ee304, + 0xa1fad5f0, 0x6a2d519a, 0x63ef8ce2, 0x9a86ee22, + 0xc089c2b8, 0x43242ef6, 0xa51e03aa, 0x9cf2d0a4, + 0x83c061ba, 0x9be96a4d, 0x8fe51550, 0xba645bd6, + 0x2826a2f9, 0xa73a3ae1, 0x4ba99586, 0xef5562e9, + 0xc72fefd3, 0xf752f7da, 0x3f046f69, 0x77fa0a59, + 0x80e4a915, 0x87b08601, 0x9b09e6ad, 0x3b3ee593, + 0xe990fd5a, 0x9e34d797, 0x2cf0b7d9, 0x022b8b51, + 0x96d5ac3a, 0x017da67d, 0xd1cf3ed6, 0x7c7d2d28, + 0x1f9f25cf, 0xadf2b89b, 0x5ad6b472, 0x5a88f54c, + 0xe029ac71, 0xe019a5e6, 0x47b0acfd, 0xed93fa9b, + 0xe8d3c48d, 0x283b57cc, 0xf8d56629, 0x79132e28, + 0x785f0191, 0xed756055, 0xf7960e44, 0xe3d35e8c, + 0x15056dd4, 0x88f46dba, 0x03a16125, 0x0564f0bd, + 0xc3eb9e15, 0x3c9057a2, 0x97271aec, 0xa93a072a, + 0x1b3f6d9b, 0x1e6321f5, 0xf59c66fb, 0x26dcf319, + 0x7533d928, 0xb155fdf5, 0x03563482, 0x8aba3cbb, + 0x28517711, 0xc20ad9f8, 0xabcc5167, 0xccad925f, + 0x4de81751, 0x3830dc8e, 0x379d5862, 0x9320f991, + 0xea7a90c2, 0xfb3e7bce, 0x5121ce64, 0x774fbe32, + 0xa8b6e37e, 0xc3293d46, 0x48de5369, 0x6413e680, + 0xa2ae0810, 0xdd6db224, 0x69852dfd, 0x09072166, + 0xb39a460a, 0x6445c0dd, 0x586cdecf, 0x1c20c8ae, + 0x5bbef7dd, 0x1b588d40, 0xccd2017f, 0x6bb4e3bb, + 0xdda26a7e, 0x3a59ff45, 0x3e350a44, 0xbcb4cdd5, + 0x72eacea8, 0xfa6484bb, 0x8d6612ae, 0xbf3c6f47, + 0xd29be463, 0x542f5d9e, 0xaec2771b, 0xf64e6370, + 0x740e0d8d, 0xe75b1357, 0xf8721671, 0xaf537d5d, + 0x4040cb08, 0x4eb4e2cc, 0x34d2466a, 0x0115af84, + 0xe1b00428, 0x95983a1d, 0x06b89fb4, 0xce6ea048, + 0x6f3f3b82, 0x3520ab82, 0x011a1d4b, 0x277227f8, + 0x611560b1, 0xe7933fdc, 0xbb3a792b, 0x344525bd, + 0xa08839e1, 0x51ce794b, 0x2f32c9b7, 0xa01fbac9, + 0xe01cc87e, 0xbcc7d1f6, 0xcf0111c3, 0xa1e8aac7, + 0x1a908749, 0xd44fbd9a, 0xd0dadecb, 0xd50ada38, + 0x0339c32a, 0xc6913667, 0x8df9317c, 0xe0b12b4f, + 0xf79e59b7, 0x43f5bb3a, 0xf2d519ff, 0x27d9459c, + 0xbf97222c, 0x15e6fc2a, 0x0f91fc71, 0x9b941525, + 0xfae59361, 0xceb69ceb, 0xc2a86459, 0x12baa8d1, + 0xb6c1075e, 0xe3056a0c, 0x10d25065, 0xcb03a442, + 0xe0ec6e0e, 0x1698db3b, 0x4c98a0be, 0x3278e964, + 0x9f1f9532, 0xe0d392df, 0xd3a0342b, 0x8971f21e, + 0x1b0a7441, 0x4ba3348c, 0xc5be7120, 0xc37632d8, + 0xdf359f8d, 0x9b992f2e, 0xe60b6f47, 0x0fe3f11d, + 0xe54cda54, 0x1edad891, 0xce6279cf, 0xcd3e7e6f, + 0x1618b166, 0xfd2c1d05, 0x848fd2c5, 0xf6fb2299, + 0xf523f357, 0xa6327623, 0x93a83531, 0x56cccd02, + 0xacf08162, 0x5a75ebb5, 0x6e163697, 0x88d273cc, + 0xde966292, 0x81b949d0, 0x4c50901b, 0x71c65614, + 0xe6c6c7bd, 0x327a140a, 0x45e1d006, 0xc3f27b9a, + 0xc9aa53fd, 0x62a80f00, 0xbb25bfe2, 0x35bdd2f6, + 0x71126905, 0xb2040222, 0xb6cbcf7c, 0xcd769c2b, + 0x53113ec0, 0x1640e3d3, 0x38abbd60, 0x2547adf0, + 0xba38209c, 0xf746ce76, 0x77afa1c5, 0x20756060, + 0x85cbfe4e, 0x8ae88dd8, 0x7aaaf9b0, 0x4cf9aa7e, + 0x1948c25c, 0x02fb8a8c, 0x01c36ae4, 0xd6ebe1f9, + 0x90d4f869, 0xa65cdea0, 0x3f09252d, 0xc208e69f, + 0xb74e6132, 0xce77e25b, 0x578fdfe3, 0x3ac372e6} + }, + { + 0x243f6a88, 0x85a308d3, 0x13198a2e, 0x03707344, + 0xa4093822, 0x299f31d0, 0x082efa98, 0xec4e6c89, + 0x452821e6, 0x38d01377, 0xbe5466cf, 0x34e90c6c, + 0xc0ac29b7, 0xc97c50dd, 0x3f84d5b5, 0xb5470917, + 0x9216d5d9, 0x8979fb1b + } }; + + *c = initstate; +} + +u_int32_t +Blowfish_stream2word(const u_int8_t *data, u_int16_t databytes, + u_int16_t *current) +{ + u_int8_t i; + u_int16_t j; + u_int32_t temp; + + temp = 0x00000000; + j = *current; + + for (i = 0; i < 4; i++, j++) { + if (j >= databytes) + j = 0; + temp = (temp << 8) | data[j]; + } + + *current = j; + return temp; +} + +void +Blowfish_expand0state(blf_ctx *c, const u_int8_t *key, u_int16_t keybytes) +{ + u_int16_t i; + u_int16_t j; + u_int16_t k; + u_int32_t temp; + u_int32_t datal; + u_int32_t datar; + + j = 0; + for (i = 0; i < BLF_N + 2; i++) { + /* Extract 4 int8 to 1 int32 from keystream */ + temp = Blowfish_stream2word(key, keybytes, &j); + c->P[i] = c->P[i] ^ temp; + } + + j = 0; + datal = 0x00000000; + datar = 0x00000000; + for (i = 0; i < BLF_N + 2; i += 2) { + Blowfish_encipher(c, &datal, &datar); + + c->P[i] = datal; + c->P[i + 1] = datar; + } + + for (i = 0; i < 4; i++) { + for (k = 0; k < 256; k += 2) { + Blowfish_encipher(c, &datal, &datar); + + c->S[i][k] = datal; + c->S[i][k + 1] = datar; + } + } +} + + +void +Blowfish_expandstate(blf_ctx *c, const u_int8_t *data, u_int16_t databytes, + const u_int8_t *key, u_int16_t keybytes) +{ + u_int16_t i; + u_int16_t j; + u_int16_t k; + u_int32_t temp; + u_int32_t datal; + u_int32_t datar; + + j = 0; + for (i = 0; i < BLF_N + 2; i++) { + /* Extract 4 int8 to 1 int32 from keystream */ + temp = Blowfish_stream2word(key, keybytes, &j); + c->P[i] = c->P[i] ^ temp; + } + + j = 0; + datal = 0x00000000; + datar = 0x00000000; + for (i = 0; i < BLF_N + 2; i += 2) { + datal ^= Blowfish_stream2word(data, databytes, &j); + datar ^= Blowfish_stream2word(data, databytes, &j); + Blowfish_encipher(c, &datal, &datar); + + c->P[i] = datal; + c->P[i + 1] = datar; + } + + for (i = 0; i < 4; i++) { + for (k = 0; k < 256; k += 2) { + datal ^= Blowfish_stream2word(data, databytes, &j); + datar ^= Blowfish_stream2word(data, databytes, &j); + Blowfish_encipher(c, &datal, &datar); + + c->S[i][k] = datal; + c->S[i][k + 1] = datar; + } + } + +} + +void +blf_key(blf_ctx *c, const u_int8_t *k, u_int16_t len) +{ + /* Initialize S-boxes and subkeys with Pi */ + Blowfish_initstate(c); + + /* Transform S-boxes and subkeys with key */ + Blowfish_expand0state(c, k, len); +} + +void +blf_enc(blf_ctx *c, u_int32_t *data, u_int16_t blocks) +{ + u_int32_t *d; + u_int16_t i; + + d = data; + for (i = 0; i < blocks; i++) { + Blowfish_encipher(c, d, d + 1); + d += 2; + } +} + +void +blf_dec(blf_ctx *c, u_int32_t *data, u_int16_t blocks) +{ + u_int32_t *d; + u_int16_t i; + + d = data; + for (i = 0; i < blocks; i++) { + Blowfish_decipher(c, d, d + 1); + d += 2; + } +} + +void +blf_ecb_encrypt(blf_ctx *c, u_int8_t *data, u_int32_t len) +{ + u_int32_t l, r; + u_int32_t i; + + for (i = 0; i < len; i += 8) { + l = data[0] << 24 | data[1] << 16 | data[2] << 8 | data[3]; + r = data[4] << 24 | data[5] << 16 | data[6] << 8 | data[7]; + Blowfish_encipher(c, &l, &r); + data[0] = l >> 24 & 0xff; + data[1] = l >> 16 & 0xff; + data[2] = l >> 8 & 0xff; + data[3] = l & 0xff; + data[4] = r >> 24 & 0xff; + data[5] = r >> 16 & 0xff; + data[6] = r >> 8 & 0xff; + data[7] = r & 0xff; + data += 8; + } +} + +void +blf_ecb_decrypt(blf_ctx *c, u_int8_t *data, u_int32_t len) +{ + u_int32_t l, r; + u_int32_t i; + + for (i = 0; i < len; i += 8) { + l = data[0] << 24 | data[1] << 16 | data[2] << 8 | data[3]; + r = data[4] << 24 | data[5] << 16 | data[6] << 8 | data[7]; + Blowfish_decipher(c, &l, &r); + data[0] = l >> 24 & 0xff; + data[1] = l >> 16 & 0xff; + data[2] = l >> 8 & 0xff; + data[3] = l & 0xff; + data[4] = r >> 24 & 0xff; + data[5] = r >> 16 & 0xff; + data[6] = r >> 8 & 0xff; + data[7] = r & 0xff; + data += 8; + } +} + +void +blf_cbc_encrypt(blf_ctx *c, u_int8_t *iv, u_int8_t *data, u_int32_t len) +{ + u_int32_t l, r; + u_int32_t i, j; + + for (i = 0; i < len; i += 8) { + for (j = 0; j < 8; j++) + data[j] ^= iv[j]; + l = data[0] << 24 | data[1] << 16 | data[2] << 8 | data[3]; + r = data[4] << 24 | data[5] << 16 | data[6] << 8 | data[7]; + Blowfish_encipher(c, &l, &r); + data[0] = l >> 24 & 0xff; + data[1] = l >> 16 & 0xff; + data[2] = l >> 8 & 0xff; + data[3] = l & 0xff; + data[4] = r >> 24 & 0xff; + data[5] = r >> 16 & 0xff; + data[6] = r >> 8 & 0xff; + data[7] = r & 0xff; + iv = data; + data += 8; + } +} + +void +blf_cbc_decrypt(blf_ctx *c, u_int8_t *iva, u_int8_t *data, u_int32_t len) +{ + u_int32_t l, r; + u_int8_t *iv; + u_int32_t i, j; + + iv = data + len - 16; + data = data + len - 8; + for (i = len - 8; i >= 8; i -= 8) { + l = data[0] << 24 | data[1] << 16 | data[2] << 8 | data[3]; + r = data[4] << 24 | data[5] << 16 | data[6] << 8 | data[7]; + Blowfish_decipher(c, &l, &r); + data[0] = l >> 24 & 0xff; + data[1] = l >> 16 & 0xff; + data[2] = l >> 8 & 0xff; + data[3] = l & 0xff; + data[4] = r >> 24 & 0xff; + data[5] = r >> 16 & 0xff; + data[6] = r >> 8 & 0xff; + data[7] = r & 0xff; + for (j = 0; j < 8; j++) + data[j] ^= iv[j]; + iv -= 8; + data -= 8; + } + l = data[0] << 24 | data[1] << 16 | data[2] << 8 | data[3]; + r = data[4] << 24 | data[5] << 16 | data[6] << 8 | data[7]; + Blowfish_decipher(c, &l, &r); + data[0] = l >> 24 & 0xff; + data[1] = l >> 16 & 0xff; + data[2] = l >> 8 & 0xff; + data[3] = l & 0xff; + data[4] = r >> 24 & 0xff; + data[5] = r >> 16 & 0xff; + data[6] = r >> 8 & 0xff; + data[7] = r & 0xff; + for (j = 0; j < 8; j++) + data[j] ^= iva[j]; +} + +#if 0 +void +report(u_int32_t data[], u_int16_t len) +{ + u_int16_t i; + for (i = 0; i < len; i += 2) + printf("Block %0hd: %08lx %08lx.\n", + i / 2, data[i], data[i + 1]); +} +void +main(void) +{ + + blf_ctx c; + char key[] = "AAAAA"; + char key2[] = "abcdefghijklmnopqrstuvwxyz"; + + u_int32_t data[10]; + u_int32_t data2[] = + {0x424c4f57l, 0x46495348l}; + + u_int16_t i; + + /* First test */ + for (i = 0; i < 10; i++) + data[i] = i; + + blf_key(&c, (u_int8_t *) key, 5); + blf_enc(&c, data, 5); + blf_dec(&c, data, 1); + blf_dec(&c, data + 2, 4); + printf("Should read as 0 - 9.\n"); + report(data, 10); + + /* Second test */ + blf_key(&c, (u_int8_t *) key2, strlen(key2)); + blf_enc(&c, data2, 1); + printf("\nShould read as: 0x324ed0fe 0xf413a203.\n"); + report(data2, 2); + blf_dec(&c, data2, 1); + report(data2, 2); +} +#endif diff --git a/backend/node_modules/bcrypt/src/node_blf.h b/backend/node_modules/bcrypt/src/node_blf.h new file mode 100644 index 000000000..2d50a39bf --- /dev/null +++ b/backend/node_modules/bcrypt/src/node_blf.h @@ -0,0 +1,132 @@ +/* $OpenBSD: blf.h,v 1.7 2007/03/14 17:59:41 grunk Exp $ */ +/* + * Blowfish - a fast block cipher designed by Bruce Schneier + * + * Copyright 1997 Niels Provos + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * This product includes software developed by Niels Provos. + * 4. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR + * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES + * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. + * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, + * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _NODE_BLF_H_ +#define _NODE_BLF_H_ + +#include + +/* Solaris compatibility */ +#ifdef __sun +#define u_int8_t uint8_t +#define u_int16_t uint16_t +#define u_int32_t uint32_t +#define u_int64_t uint64_t +#endif + +#ifdef _WIN32 +#define u_int8_t unsigned __int8 +#define u_int16_t unsigned __int16 +#define u_int32_t unsigned __int32 +#define u_int64_t unsigned __int64 +#endif + +/* Windows ssize_t compatibility */ +#if defined(_WIN32) || defined(_WIN64) +# if defined(_WIN64) + typedef __int64 LONG_PTR; +# else + typedef long LONG_PTR; +# endif + typedef LONG_PTR SSIZE_T; + typedef SSIZE_T ssize_t; +#endif + +/* z/OS compatibility */ +#ifdef __MVS__ +typedef unsigned char u_int8_t; +typedef unsigned short u_int16_t; +typedef unsigned int u_int32_t; +typedef unsigned long long u_int64_t; +#endif + +#define BCRYPT_VERSION '2' +#define BCRYPT_MAXSALT 16 /* Precomputation is just so nice */ +#define BCRYPT_BLOCKS 6 /* Ciphertext blocks */ +#define BCRYPT_MINROUNDS 16 /* we have log2(rounds) in salt */ + +/* Schneier specifies a maximum key length of 56 bytes. + * This ensures that every key bit affects every cipher + * bit. However, the subkeys can hold up to 72 bytes. + * Warning: For normal blowfish encryption only 56 bytes + * of the key affect all cipherbits. + */ + +#define BLF_N 16 /* Number of Subkeys */ +#define BLF_MAXKEYLEN ((BLF_N-2)*4) /* 448 bits */ +#define BLF_MAXUTILIZED ((BLF_N+2)*4) /* 576 bits */ + +#define _PASSWORD_LEN 128 /* max length, not counting NUL */ +#define _SALT_LEN 32 /* max length */ + +/* Blowfish context */ +typedef struct BlowfishContext { + u_int32_t S[4][256]; /* S-Boxes */ + u_int32_t P[BLF_N + 2]; /* Subkeys */ +} blf_ctx; + +/* Raw access to customized Blowfish + * blf_key is just: + * Blowfish_initstate( state ) + * Blowfish_expand0state( state, key, keylen ) + */ + +void Blowfish_encipher(blf_ctx *, u_int32_t *, u_int32_t *); +void Blowfish_decipher(blf_ctx *, u_int32_t *, u_int32_t *); +void Blowfish_initstate(blf_ctx *); +void Blowfish_expand0state(blf_ctx *, const u_int8_t *, u_int16_t); +void Blowfish_expandstate +(blf_ctx *, const u_int8_t *, u_int16_t, const u_int8_t *, u_int16_t); + +/* Standard Blowfish */ + +void blf_key(blf_ctx *, const u_int8_t *, u_int16_t); +void blf_enc(blf_ctx *, u_int32_t *, u_int16_t); +void blf_dec(blf_ctx *, u_int32_t *, u_int16_t); + +void blf_ecb_encrypt(blf_ctx *, u_int8_t *, u_int32_t); +void blf_ecb_decrypt(blf_ctx *, u_int8_t *, u_int32_t); + +void blf_cbc_encrypt(blf_ctx *, u_int8_t *, u_int8_t *, u_int32_t); +void blf_cbc_decrypt(blf_ctx *, u_int8_t *, u_int8_t *, u_int32_t); + +/* Converts u_int8_t to u_int32_t */ +u_int32_t Blowfish_stream2word(const u_int8_t *, u_int16_t , u_int16_t *); + +/* bcrypt functions*/ +void bcrypt_gensalt(char, u_int8_t, u_int8_t*, char *); +void bcrypt(const char *, size_t key_len, const char *, char *); +void encode_salt(char *, u_int8_t *, char, u_int16_t, u_int8_t); +u_int32_t bcrypt_get_rounds(const char *); + +#endif diff --git a/backend/node_modules/bcrypt/test-docker.sh b/backend/node_modules/bcrypt/test-docker.sh new file mode 100755 index 000000000..7936cf7de --- /dev/null +++ b/backend/node_modules/bcrypt/test-docker.sh @@ -0,0 +1,15 @@ +#!/bin/sh + +set -xe + +echo "Running on $(node -v)" + +# Cleanup +rm -rf node_modules build-tmp-* lib/binding + +# Install build dependencies +if [ -f /etc/alpine-release ]; then + apk add --no-cache --virtual .build-deps make gcc g++ python3 +fi + +su node -c "npm test; npx node-pre-gyp package" diff --git a/backend/node_modules/bcrypt/test/async.test.js b/backend/node_modules/bcrypt/test/async.test.js new file mode 100644 index 000000000..fb59367a3 --- /dev/null +++ b/backend/node_modules/bcrypt/test/async.test.js @@ -0,0 +1,209 @@ +const bcrypt = require('../bcrypt'); + +test('salt_length', done => { + expect.assertions(1); + bcrypt.genSalt(10, function (err, salt) { + expect(salt).toHaveLength(29); + done(); + }); +}) + +test('salt_only_cb', () => { + expect.assertions(1); + expect(() => { + bcrypt.genSalt((err, salt) => { + }); + }).not.toThrow(); +}) + +test('salt_rounds_is_string_number', done => { + expect.assertions(2); + bcrypt.genSalt('10', void 0, function (err, salt) { + expect(err instanceof Error).toBe(true) + expect(err.message).toBe('rounds must be a number') + done(); + }); +}) + +test('salt_rounds_is_string_non_number', done => { + expect.assertions(2); + bcrypt.genSalt('z', function (err, salt) { + expect(err instanceof Error).toBe(true) + expect(err.message).toBe('rounds must be a number') + done(); + }); +}) + +test('salt_minor', done => { + expect.assertions(3); + bcrypt.genSalt(10, 'a', function (err, value) { + expect(value).toHaveLength(29); + const [_, minor, salt] = value.split('$'); + expect(minor).toEqual('2a'); + expect(salt).toEqual('10'); + done(); + }); +}) + +test('salt_minor_b', done => { + expect.assertions(3); + bcrypt.genSalt(10, 'b', function (err, value) { + expect(value).toHaveLength(29); + const [_, minor, salt] = value.split('$'); + expect(minor).toEqual('2b'); + expect(salt).toEqual('10'); + done(); + }); +}) + +test('hash', done => { + expect.assertions(2); + bcrypt.genSalt(10, function (err, salt) { + bcrypt.hash('password', salt, function (err, res) { + expect(res).toBeDefined(); + expect(err).toBeUndefined(); + done(); + }); + }); +}) + +test('hash_rounds', done => { + expect.assertions(1); + bcrypt.hash('bacon', 8, function (err, hash) { + expect(bcrypt.getRounds(hash)).toEqual(8); + done(); + }); +}) + +test('hash_empty_strings', done => { + expect.assertions(1); + bcrypt.genSalt(10, function (err, salt) { + bcrypt.hash('', salt, function (err, res) { + expect(res).toBeDefined(); + done(); + }); + }); +}) + +test('hash_fails_with_empty_salt', done => { + expect.assertions(1); + bcrypt.hash('', '', function (err, res) { + expect(err.message).toBe('Invalid salt. Salt must be in the form of: $Vers$log2(NumRounds)$saltvalue') + done(); + }); +}) + +test('hash_no_params', done => { + expect.assertions(1); + bcrypt.hash(function (err, hash) { + expect(err.message).toBe('data must be a string or Buffer and salt must either be a salt string or a number of rounds') + done(); + }); +}) + +test('hash_one_param', done => { + expect.assertions(1); + bcrypt.hash('password', function (err, hash) { + expect(err.message).toBe('data must be a string or Buffer and salt must either be a salt string or a number of rounds'); + done(); + }); +}) + +test('hash_salt_validity', done => { + expect.assertions(2); + bcrypt.hash('password', '$2a$10$somesaltyvaluertsetrse', function (err, enc) { + expect(err).toBeUndefined(); + bcrypt.hash('password', 'some$value', function (err, enc) { + expect(err.message).toBe("Invalid salt. Salt must be in the form of: $Vers$log2(NumRounds)$saltvalue"); + done(); + }); + }); +}) + +test('verify_salt', done => { + expect.assertions(2); + bcrypt.genSalt(10, function (err, value) { + const [_, version, rounds] = value.split('$'); + expect(version).toEqual('2b'); + expect(rounds).toEqual('10'); + done(); + }); +}) + +test('verify_salt_min_rounds', done => { + expect.assertions(2); + bcrypt.genSalt(1, function (err, value) { + const [_, version, rounds] = value.split('$'); + expect(version).toEqual('2b'); + expect(rounds).toEqual('04'); + done(); + }); +}) + +test('verify_salt_max_rounds', done => { + expect.assertions(2); + bcrypt.genSalt(100, function (err, value) { + const [_, version, rounds] = value.split('$'); + expect(version).toEqual('2b'); + expect(rounds).toEqual('31'); + done(); + }); +}) + +test('hash_compare', done => { + expect.assertions(2); + bcrypt.genSalt(10, function (err, salt) { + bcrypt.hash("test", salt, function (err, hash) { + bcrypt.compare("test", hash, function (err, res) { + expect(hash).toBeDefined(); + bcrypt.compare("blah", hash, function (err, res) { + expect(res).toBe(false); + done(); + }); + }); + }); + }); +}) + +test('hash_compare_empty_strings', done => { + expect.assertions(2); + const hash = bcrypt.hashSync("test", bcrypt.genSaltSync(10)); + + bcrypt.compare("", hash, function (err, res) { + expect(res).toEqual(false) + bcrypt.compare("", "", function (err, res) { + expect(res).toEqual(false); + done(); + }); + }); +}) + +test('hash_compare_invalid_strings', done => { + expect.assertions(2); + const fullString = 'envy1362987212538'; + const hash = '$2a$10$XOPbrlUPQdwdJUpSrIF6X.LbE14qsMmKGhM1A8W9iqaG3vv1BD7WC'; + const wut = ':'; + bcrypt.compare(fullString, hash, function (err, res) { + expect(res).toBe(true); + bcrypt.compare(fullString, wut, function (err, res) { + expect(res).toBe(false); + done(); + }); + }); +}) + +test('compare_no_params', done => { + expect.assertions(1); + bcrypt.compare(function (err, hash) { + expect(err.message).toBe('data and hash arguments required'); + done(); + }); +}) + +test('hash_compare_one_param', done => { + expect.assertions(1); + bcrypt.compare('password', function (err, hash) { + expect(err.message).toBe('data and hash arguments required'); + done(); + }); +}) diff --git a/backend/node_modules/bcrypt/test/implementation.test.js b/backend/node_modules/bcrypt/test/implementation.test.js new file mode 100644 index 000000000..647f32a92 --- /dev/null +++ b/backend/node_modules/bcrypt/test/implementation.test.js @@ -0,0 +1,48 @@ +const bcrypt = require('../bcrypt'); + +// some tests were adapted from https://github.com/riverrun/bcrypt_elixir/blob/master/test/base_test.exs +// which are under the BSD LICENSE + +test('openwall', () => { + expect(bcrypt.hashSync("U*U", "$2a$05$CCCCCCCCCCCCCCCCCCCCC.")).toStrictEqual("$2a$05$CCCCCCCCCCCCCCCCCCCCC.E5YPO9kmyuRGyh0XouQYb4YMJKvyOeW"); + expect(bcrypt.hashSync("U*U*", "$2a$05$CCCCCCCCCCCCCCCCCCCCC.")).toStrictEqual("$2a$05$CCCCCCCCCCCCCCCCCCCCC.VGOzA784oUp/Z0DY336zx7pLYAy0lwK"); + expect(bcrypt.hashSync("U*U*U", "$2a$05$XXXXXXXXXXXXXXXXXXXXXO")).toStrictEqual("$2a$05$XXXXXXXXXXXXXXXXXXXXXOAcXxm9kjPGEMsLznoKqmqw7tc8WCx4a"); + expect(bcrypt.hashSync("", "$2a$05$CCCCCCCCCCCCCCCCCCCCC.")).toStrictEqual("$2a$05$CCCCCCCCCCCCCCCCCCCCC.7uG0VCzI2bS7j6ymqJi9CdcdxiRTWNy"); + expect(bcrypt.hashSync("0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789", "$2a$05$abcdefghijklmnopqrstuu")).toStrictEqual("$2a$05$abcdefghijklmnopqrstuu5s2v8.iXieOjg/.AySBTTZIIVFJeBui"); +}) + +test('openbsd', () => { + expect(bcrypt.hashSync("000000000000000000000000000000000000000000000000000000000000000000000000", "$2a$05$CCCCCCCCCCCCCCCCCCCCC.")).toStrictEqual("$2a$05$CCCCCCCCCCCCCCCCCCCCC.6.O1dLNbjod2uo0DVcW.jHucKbPDdHS") + expect(bcrypt.hashSync("000000000000000000000000000000000000000000000000000000000000000000000000", "$2b$05$CCCCCCCCCCCCCCCCCCCCC.")).toStrictEqual("$2b$05$CCCCCCCCCCCCCCCCCCCCC.6.O1dLNbjod2uo0DVcW.jHucKbPDdHS") +}) + +test('long_passwords', () => { + // bcrypt wrap-around bug in $2a$ + expect(bcrypt.hashSync("012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234", "$2a$05$CCCCCCCCCCCCCCCCCCCCC.")).toStrictEqual("$2a$05$CCCCCCCCCCCCCCCCCCCCC.6.O1dLNbjod2uo0DVcW.jHucKbPDdHS") + expect(bcrypt.hashSync("01XXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXX", "$2a$05$CCCCCCCCCCCCCCCCCCCCC.")).toStrictEqual("$2a$05$CCCCCCCCCCCCCCCCCCCCC.6.O1dLNbjod2uo0DVcW.jHucKbPDdHS") + + // tests for $2b$ which fixes wrap-around bugs + expect(bcrypt.hashSync("012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234", "$2b$05$CCCCCCCCCCCCCCCCCCCCC.")).toStrictEqual("$2b$05$CCCCCCCCCCCCCCCCCCCCC.XxrQqgBi/5Sxuq9soXzDtjIZ7w5pMfK") + expect(bcrypt.hashSync("0123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345", "$2b$05$CCCCCCCCCCCCCCCCCCCCC.")).toStrictEqual("$2b$05$CCCCCCCCCCCCCCCCCCCCC.XxrQqgBi/5Sxuq9soXzDtjIZ7w5pMfK") +}) + +test('embedded_nulls', () => { + expect(bcrypt.hashSync("Passw\0rd123", "$2b$05$CCCCCCCCCCCCCCCCCCCCC.")).toStrictEqual("$2b$05$CCCCCCCCCCCCCCCCCCCCC.VHy/kzL4sCcX3Ib3wN5rNGiRt.TpfxS") + expect(bcrypt.hashSync("Passw\0 you can literally write anything after the NUL character", "$2b$05$CCCCCCCCCCCCCCCCCCCCC.")).toStrictEqual("$2b$05$CCCCCCCCCCCCCCCCCCCCC.4vJLJQ6nZ/70INTjjSZWQ0iyUek92tu") + expect(bcrypt.hashSync(Buffer.from("Passw\0 you can literally write anything after the NUL character"), "$2b$05$CCCCCCCCCCCCCCCCCCCCC.")).toStrictEqual("$2b$05$CCCCCCCCCCCCCCCCCCCCC.4vJLJQ6nZ/70INTjjSZWQ0iyUek92tu") +}) + +test('shorten_salt_to_128_bits', () => { + expect(bcrypt.hashSync("test", "$2a$10$1234567899123456789012")).toStrictEqual("$2a$10$123456789912345678901u.OtL1A1eGK5wmvBKUDYKvuVKI7h2XBu") + expect(bcrypt.hashSync("U*U*", "$2a$05$CCCCCCCCCCCCCCCCCCCCCh")).toStrictEqual("$2a$05$CCCCCCCCCCCCCCCCCCCCCeUQ7VjYZ2hd4bLYZdhuPpZMUpEUJDw1S") + expect(bcrypt.hashSync("U*U*", "$2a$05$CCCCCCCCCCCCCCCCCCCCCM")).toStrictEqual("$2a$05$CCCCCCCCCCCCCCCCCCCCC.VGOzA784oUp/Z0DY336zx7pLYAy0lwK") + expect(bcrypt.hashSync("U*U*", "$2a$05$CCCCCCCCCCCCCCCCCCCCCA")).toStrictEqual("$2a$05$CCCCCCCCCCCCCCCCCCCCC.VGOzA784oUp/Z0DY336zx7pLYAy0lwK") +}) + +test('consistency', () => { + expect(bcrypt.hashSync("ππππππππ", "$2a$10$.TtQJ4Jr6isd4Hp.mVfZeu")).toStrictEqual("$2a$10$.TtQJ4Jr6isd4Hp.mVfZeuh6Gws4rOQ/vdBczhDx.19NFK0Y84Dle") + expect(bcrypt.hashSync("p@5sw0rd", "$2b$12$zQ4CooEXdGqcwi0PHsgc8e")).toStrictEqual("$2b$12$zQ4CooEXdGqcwi0PHsgc8eAf0DLXE/XHoBE8kCSGQ97rXwuClaPam") + expect(bcrypt.hashSync("C'est bon, la vie!", "$2b$12$cbo7LZ.wxgW4yxAA5Vqlv.")).toStrictEqual("$2b$12$cbo7LZ.wxgW4yxAA5Vqlv.KR6QFPt4qCdc9RYJNXxa/rbUOp.1sw.") + expect(bcrypt.hashSync("ἓν οἶδα ὅτι οὐδὲν οἶδα", "$2b$12$LeHKWR2bmrazi/6P22Jpau")).toStrictEqual("$2b$12$LeHKWR2bmrazi/6P22JpauX5my/eKwwKpWqL7L5iEByBnxNc76FRW") + expect(bcrypt.hashSync(Buffer.from("ἓν οἶδα ὅτι οὐδὲν οἶδα"), "$2b$12$LeHKWR2bmrazi/6P22Jpau")).toStrictEqual("$2b$12$LeHKWR2bmrazi/6P22JpauX5my/eKwwKpWqL7L5iEByBnxNc76FRW") +}) diff --git a/backend/node_modules/bcrypt/test/promise.test.js b/backend/node_modules/bcrypt/test/promise.test.js new file mode 100644 index 000000000..010341825 --- /dev/null +++ b/backend/node_modules/bcrypt/test/promise.test.js @@ -0,0 +1,168 @@ +const bcrypt = require('../bcrypt'); +const promises = require('../promises'); + +test('salt_returns_promise_on_no_args', () => { + // make sure test passes with non-native implementations such as bluebird + // http://stackoverflow.com/questions/27746304/how-do-i-tell-if-an-object-is-a-promise + expect(typeof bcrypt.genSalt().then).toEqual('function') +}) + +test('salt_returns_promise_on_null_callback', () => { + expect(typeof bcrypt.genSalt(13, null, null).then).toEqual('function') +}) + +test('salt_length', () => { + return expect(bcrypt.genSalt(10)).resolves.toHaveLength(29); +}) + +test('salt_rounds_is_string_number', () => { + return expect(bcrypt.genSalt('10')).rejects.toThrow('rounds must be a number'); +}) + +test('salt_rounds_is_string_non_number', () => { + return expect(bcrypt.genSalt('b')).rejects.toThrow('rounds must be a number'); +}) + +test('hash_returns_promise_on_null_callback', () => { + expect(typeof bcrypt.hash('password', 10, null).then).toStrictEqual('function') +}) + +test('hash', () => { + return expect(bcrypt.genSalt(10) + .then(salt => bcrypt.hash('password', salt))).resolves.toBeDefined() +}) + +test('hash_rounds', () => { + return bcrypt.hash('bacon', 8).then(hash => { + expect(bcrypt.getRounds(hash)).toStrictEqual(8) + }); +}) + +test('hash_empty_strings', () => { + expect.assertions(2); + return Promise.all([ + expect(bcrypt.genSalt(10) + .then(salt => bcrypt.hash('', salt))) + .resolves.toBeDefined(), + expect(bcrypt.hash('', '')).rejects.toThrow(''), + ]); +}) + +test('hash_no_params', () => { + expect.assertions(1); + return expect(bcrypt.hash()).rejects.toThrow('data and salt arguments required'); +}) + +test('hash_one_param', () => { + return expect(bcrypt.hash('password')).rejects.toThrow('data and salt arguments required'); +}) + +test('hash_salt_validity', () => { + expect.assertions(2); + return Promise.all( + [ + expect(bcrypt.hash('password', '$2a$10$somesaltyvaluertsetrse')).resolves.toBeDefined(), + expect(bcrypt.hash('password', 'some$value')).rejects.toThrow("Invalid salt. Salt must be in the form of: $Vers$log2(NumRounds)$saltvalue") + ]); +}) + +test('verify_salt', () => { + expect.assertions(2); + return bcrypt.genSalt(10).then(result => { + const [_, version, salt] = result.split('$'); + expect(version).toEqual('2b') + expect(salt).toEqual('10') + }); +}) + +test('verify_salt_min_rounds', () => { + expect.assertions(2); + return bcrypt.genSalt(1).then(value => { + const [_, version, rounds] = value.split('$'); + expect(version).toEqual('2b'); + expect(rounds).toEqual('04'); + }); +}) + +test('verify_salt_max_rounds', () => { + expect.assertions(2); + return bcrypt.genSalt(100).then(value => { + const [_, version, rounds] = value.split('$'); + expect(version).toEqual('2b'); + expect(rounds).toEqual('31'); + }); +}) + +test('hash_compare_returns_promise_on_null_callback', () => { + expect(typeof bcrypt.compare('password', 'something', null).then).toStrictEqual('function') +}) + +test('hash_compare', () => { + expect.assertions(3); + return bcrypt.genSalt(10).then(function (salt) { + expect(salt).toHaveLength(29); + return bcrypt.hash("test", salt); + }).then(hash => Promise.all( + [ + expect(bcrypt.compare("test", hash)).resolves.toEqual(true), + expect(bcrypt.compare("blah", hash)).resolves.toEqual(false) + ])); +}) + +test('hash_compare_empty_strings', () => { + expect.assertions(2); + const hash = bcrypt.hashSync("test", bcrypt.genSaltSync(10)); + return Promise.all([ + expect(bcrypt.compare("", hash)).resolves.toEqual(false), + expect(bcrypt.compare("", "")).resolves.toEqual(false) + ]); +}) + +test('hash_compare_invalid_strings', () => { + const fullString = 'envy1362987212538'; + const hash = '$2a$10$XOPbrlUPQdwdJUpSrIF6X.LbE14qsMmKGhM1A8W9iqaG3vv1BD7WC'; + const wut = ':'; + return Promise.all([ + expect(bcrypt.compare(fullString, hash)).resolves.toEqual(true), + expect(bcrypt.compare(fullString, wut)).resolves.toEqual(false), + ]); +}) + +test('hash_compare_no_params', () => { + expect.assertions(1); + return expect(bcrypt.compare()).rejects.toThrow('data and hash arguments required') +}) + +test('hash_compare_one_param', () => { + expect.assertions(1); + return expect(bcrypt.compare('password')).rejects.toThrow('data and hash arguments required') +}) + +test('change_promise_impl_reject', () => { + + promises.use({ + reject: function () { + return 'mock'; + } + }); + + expect(promises.reject()).toEqual('mock'); + + // need to reset the promise implementation because of require cache + promises.use(global.Promise); +}) + +test('change_promise_impl_promise', () => { + + promises.use({ + reject: function (err) { + expect(err.message).toEqual('fn must be a function'); + return 'mock'; + } + }); + + expect(promises.promise('', '', '')).toEqual('mock'); + + // need to reset the promise implementation because of require cache + promises.use(global.Promise); +}) diff --git a/backend/node_modules/bcrypt/test/repetitions.test.js b/backend/node_modules/bcrypt/test/repetitions.test.js new file mode 100644 index 000000000..66807f3b8 --- /dev/null +++ b/backend/node_modules/bcrypt/test/repetitions.test.js @@ -0,0 +1,46 @@ +const bcrypt = require('../bcrypt'); + +const EXPECTED = 2500; //number of times to iterate these tests.) + +test('salt_length', () => { + expect.assertions(EXPECTED); + + return Promise.all(Array.from({length: EXPECTED}, + () => bcrypt.genSalt(10) + .then(salt => expect(salt).toHaveLength(29)))); +}) + +test('test_hash_length', () => { + expect.assertions(EXPECTED); + const SALT = '$2a$04$TnjywYklQbbZjdjBgBoA4e'; + return Promise.all(Array.from({length: EXPECTED}, + () => bcrypt.hash('test', SALT) + .then(hash => expect(hash).toHaveLength(60)))); +}) + +test('test_compare', () => { + expect.assertions(EXPECTED); + const HASH = '$2a$04$TnjywYklQbbZjdjBgBoA4e9G7RJt9blgMgsCvUvus4Iv4TENB5nHy'; + return Promise.all(Array.from({length: EXPECTED}, + () => bcrypt.compare('test', HASH) + .then(match => expect(match).toEqual(true)))); +}) + +test('test_hash_and_compare', () => { + expect.assertions(EXPECTED * 3); + const salt = bcrypt.genSaltSync(4) + + return Promise.all(Array.from({length: EXPECTED}, + () => { + const password = 'secret' + Math.random(); + return bcrypt.hash(password, salt) + .then(hash => { + expect(hash).toHaveLength(60); + const goodCompare = bcrypt.compare(password, hash).then(res => expect(res).toEqual(true)); + const badCompare = bcrypt.compare('bad' + password, hash).then(res => expect(res).toEqual(false)); + + return Promise.all([goodCompare, badCompare]); + }); + })); +}, 10000); + diff --git a/backend/node_modules/bcrypt/test/sync.test.js b/backend/node_modules/bcrypt/test/sync.test.js new file mode 100644 index 000000000..2e6809af4 --- /dev/null +++ b/backend/node_modules/bcrypt/test/sync.test.js @@ -0,0 +1,125 @@ +const bcrypt = require('../bcrypt') + +test('salt_length', () => { + const salt = bcrypt.genSaltSync(13); + expect(salt).toHaveLength(29); + const [_, version, rounds] = salt.split('$'); + expect(version).toStrictEqual('2b') + expect(rounds).toStrictEqual('13') +}) + +test('salt_no_params', () => { + const salt = bcrypt.genSaltSync(); + const [_, version, rounds] = salt.split('$'); + expect(version).toStrictEqual('2b') + expect(rounds).toStrictEqual('10') +}) + +test('salt_rounds_is_string_number', () => { + expect(() => bcrypt.genSaltSync('10')).toThrowError('rounds must be a number'); +}) + +test('salt_rounds_is_NaN', () => { + expect(() => bcrypt.genSaltSync('b')).toThrowError("rounds must be a number"); +}) + +test('salt_minor_a', () => { + const salt = bcrypt.genSaltSync(10, 'a'); + const [_, version, rounds] = salt.split('$'); + expect(version).toStrictEqual('2a') + expect(rounds).toStrictEqual('10') +}) + +test('salt_minor_b', () => { + const salt = bcrypt.genSaltSync(10, 'b'); + const [_, version, rounds] = salt.split('$'); + expect(version).toStrictEqual('2b') + expect(rounds).toStrictEqual('10') +}) + +test('hash', () => { + expect(() => bcrypt.hashSync('password', bcrypt.genSaltSync(10))).not.toThrow() +}) + +test('hash_rounds', () => { + const hash = bcrypt.hashSync('password', 8); + expect(bcrypt.getRounds(hash)).toStrictEqual(8) +}) + +test('hash_empty_string', () => { + expect(() => bcrypt.hashSync('', bcrypt.genSaltSync(10))).not.toThrow(); + expect(() => bcrypt.hashSync('password', '')).toThrowError('Invalid salt. Salt must be in the form of: $Vers$log2(NumRounds)$saltvalue'); + expect(() => bcrypt.hashSync('', '')).toThrowError('Invalid salt. Salt must be in the form of: $Vers$log2(NumRounds)$saltvalue'); +}) + +test('hash_pw_no_params', () => { + expect(() => bcrypt.hashSync()).toThrow('data and salt arguments required'); +}) + +test('hash_pw_one_param', () => { + expect(() => bcrypt.hashSync('password')).toThrow('data and salt arguments required'); +}) + +test('hash_pw_not_hash_str', () => { + expect(() => bcrypt.hashSync('password', {})).toThrow("data must be a string or Buffer and salt must either be a salt string or a number of rounds") +}) + +test('hash_salt_validity', () => { + expect(2); + expect(bcrypt.hashSync('password', '$2a$10$somesaltyvaluertsetrse')).toBeDefined() + expect(() => bcrypt.hashSync('password', 'some$value')).toThrow('Invalid salt. Salt must be in the form of: $Vers$log2(NumRounds)$saltvalue') +}) + +test('verify_salt', () => { + const salt = bcrypt.genSaltSync(10); + const split_salt = salt.split('$'); + expect(split_salt[1]).toStrictEqual('2b') + expect(split_salt[2]).toStrictEqual('10') +}) + +test('verify_salt_min_rounds', () => { + const salt = bcrypt.genSaltSync(1); + const split_salt = salt.split('$'); + expect(split_salt[1]).toStrictEqual('2b') + expect(split_salt[2]).toStrictEqual('04') +}) + +test('verify_salt_max_rounds', () => { + const salt = bcrypt.genSaltSync(100); + const split_salt = salt.split('$'); + expect(split_salt[1]).toStrictEqual('2b') + expect(split_salt[2]).toStrictEqual('31') +}) + +test('hash_compare', () => { + const salt = bcrypt.genSaltSync(10); + expect(29).toStrictEqual(salt.length) + const hash = bcrypt.hashSync("test", salt); + expect(bcrypt.compareSync("test", hash)).toBeDefined() + expect(!(bcrypt.compareSync("blah", hash))).toBeDefined() +}) + +test('hash_compare_empty_strings', () => { + expect(!(bcrypt.compareSync("", "password"))).toBeDefined() + expect(!(bcrypt.compareSync("", ""))).toBeDefined() + expect(!(bcrypt.compareSync("password", ""))).toBeDefined() +}) + +test('hash_compare_invalid_strings', () => { + const fullString = 'envy1362987212538'; + const hash = '$2a$10$XOPbrlUPQdwdJUpSrIF6X.LbE14qsMmKGhM1A8W9iqaG3vv1BD7WC'; + const wut = ':'; + expect(bcrypt.compareSync(fullString, hash)).toBe(true); + expect(bcrypt.compareSync(fullString, wut)).toBe(false); +}) + +test('getRounds', () => { + const hash = bcrypt.hashSync("test", bcrypt.genSaltSync(9)); + expect(9).toStrictEqual(bcrypt.getRounds(hash)) +}) + +test('getRounds', () => { + const hash = bcrypt.hashSync("test", bcrypt.genSaltSync(9)); + expect(9).toStrictEqual(bcrypt.getRounds(hash)) + expect(() => bcrypt.getRounds('')).toThrow("invalid hash provided"); +}); diff --git a/backend/node_modules/binary-extensions/binary-extensions.json b/backend/node_modules/binary-extensions/binary-extensions.json new file mode 100644 index 000000000..ac08048e4 --- /dev/null +++ b/backend/node_modules/binary-extensions/binary-extensions.json @@ -0,0 +1,263 @@ +[ + "3dm", + "3ds", + "3g2", + "3gp", + "7z", + "a", + "aac", + "adp", + "afdesign", + "afphoto", + "afpub", + "ai", + "aif", + "aiff", + "alz", + "ape", + "apk", + "appimage", + "ar", + "arj", + "asf", + "au", + "avi", + "bak", + "baml", + "bh", + "bin", + "bk", + "bmp", + "btif", + "bz2", + "bzip2", + "cab", + "caf", + "cgm", + "class", + "cmx", + "cpio", + "cr2", + "cur", + "dat", + "dcm", + "deb", + "dex", + "djvu", + "dll", + "dmg", + "dng", + "doc", + "docm", + "docx", + "dot", + "dotm", + "dra", + "DS_Store", + "dsk", + "dts", + "dtshd", + "dvb", + "dwg", + "dxf", + "ecelp4800", + "ecelp7470", + "ecelp9600", + "egg", + "eol", + "eot", + "epub", + "exe", + "f4v", + "fbs", + "fh", + "fla", + "flac", + "flatpak", + "fli", + "flv", + "fpx", + "fst", + "fvt", + "g3", + "gh", + "gif", + "graffle", + "gz", + "gzip", + "h261", + "h263", + "h264", + "icns", + "ico", + "ief", + "img", + "ipa", + "iso", + "jar", + "jpeg", + "jpg", + "jpgv", + "jpm", + "jxr", + "key", + "ktx", + "lha", + "lib", + "lvp", + "lz", + "lzh", + "lzma", + "lzo", + "m3u", + "m4a", + "m4v", + "mar", + "mdi", + "mht", + "mid", + "midi", + "mj2", + "mka", + "mkv", + "mmr", + "mng", + "mobi", + "mov", + "movie", + "mp3", + "mp4", + "mp4a", + "mpeg", + "mpg", + "mpga", + "mxu", + "nef", + "npx", + "numbers", + "nupkg", + "o", + "odp", + "ods", + "odt", + "oga", + "ogg", + "ogv", + "otf", + "ott", + "pages", + "pbm", + "pcx", + "pdb", + "pdf", + "pea", + "pgm", + "pic", + "png", + "pnm", + "pot", + "potm", + "potx", + "ppa", + "ppam", + "ppm", + "pps", + "ppsm", + "ppsx", + "ppt", + "pptm", + "pptx", + "psd", + "pya", + "pyc", + "pyo", + "pyv", + "qt", + "rar", + "ras", + "raw", + "resources", + "rgb", + "rip", + "rlc", + "rmf", + "rmvb", + "rpm", + "rtf", + "rz", + "s3m", + "s7z", + "scpt", + "sgi", + "shar", + "snap", + "sil", + "sketch", + "slk", + "smv", + "snk", + "so", + "stl", + "suo", + "sub", + "swf", + "tar", + "tbz", + "tbz2", + "tga", + "tgz", + "thmx", + "tif", + "tiff", + "tlz", + "ttc", + "ttf", + "txz", + "udf", + "uvh", + "uvi", + "uvm", + "uvp", + "uvs", + "uvu", + "viv", + "vob", + "war", + "wav", + "wax", + "wbmp", + "wdp", + "weba", + "webm", + "webp", + "whl", + "wim", + "wm", + "wma", + "wmv", + "wmx", + "woff", + "woff2", + "wrm", + "wvx", + "xbm", + "xif", + "xla", + "xlam", + "xls", + "xlsb", + "xlsm", + "xlsx", + "xlt", + "xltm", + "xltx", + "xm", + "xmind", + "xpi", + "xpm", + "xwd", + "xz", + "z", + "zip", + "zipx" +] diff --git a/backend/node_modules/binary-extensions/binary-extensions.json.d.ts b/backend/node_modules/binary-extensions/binary-extensions.json.d.ts new file mode 100644 index 000000000..94a248c2b --- /dev/null +++ b/backend/node_modules/binary-extensions/binary-extensions.json.d.ts @@ -0,0 +1,3 @@ +declare const binaryExtensionsJson: readonly string[]; + +export = binaryExtensionsJson; diff --git a/backend/node_modules/binary-extensions/index.d.ts b/backend/node_modules/binary-extensions/index.d.ts new file mode 100644 index 000000000..f469ac5fb --- /dev/null +++ b/backend/node_modules/binary-extensions/index.d.ts @@ -0,0 +1,14 @@ +/** +List of binary file extensions. + +@example +``` +import binaryExtensions = require('binary-extensions'); + +console.log(binaryExtensions); +//=> ['3ds', '3g2', …] +``` +*/ +declare const binaryExtensions: readonly string[]; + +export = binaryExtensions; diff --git a/backend/node_modules/binary-extensions/index.js b/backend/node_modules/binary-extensions/index.js new file mode 100644 index 000000000..d46e46886 --- /dev/null +++ b/backend/node_modules/binary-extensions/index.js @@ -0,0 +1 @@ +module.exports = require('./binary-extensions.json'); diff --git a/backend/node_modules/binary-extensions/license b/backend/node_modules/binary-extensions/license new file mode 100644 index 000000000..5493a1a6e --- /dev/null +++ b/backend/node_modules/binary-extensions/license @@ -0,0 +1,10 @@ +MIT License + +Copyright (c) Sindre Sorhus (https://sindresorhus.com) +Copyright (c) Paul Miller (https://paulmillr.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/backend/node_modules/binary-extensions/package.json b/backend/node_modules/binary-extensions/package.json new file mode 100644 index 000000000..4710c339a --- /dev/null +++ b/backend/node_modules/binary-extensions/package.json @@ -0,0 +1,40 @@ +{ + "name": "binary-extensions", + "version": "2.3.0", + "description": "List of binary file extensions", + "license": "MIT", + "repository": "sindresorhus/binary-extensions", + "funding": "https://github.com/sponsors/sindresorhus", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "https://sindresorhus.com" + }, + "sideEffects": false, + "engines": { + "node": ">=8" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "files": [ + "index.js", + "index.d.ts", + "binary-extensions.json", + "binary-extensions.json.d.ts" + ], + "keywords": [ + "binary", + "extensions", + "extension", + "file", + "json", + "list", + "array" + ], + "devDependencies": { + "ava": "^1.4.1", + "tsd": "^0.7.2", + "xo": "^0.24.0" + } +} diff --git a/backend/node_modules/binary-extensions/readme.md b/backend/node_modules/binary-extensions/readme.md new file mode 100644 index 000000000..88519b3a6 --- /dev/null +++ b/backend/node_modules/binary-extensions/readme.md @@ -0,0 +1,25 @@ +# binary-extensions + +> List of binary file extensions + +The list is just a [JSON file](binary-extensions.json) and can be used anywhere. + +## Install + +```sh +npm install binary-extensions +``` + +## Usage + +```js +const binaryExtensions = require('binary-extensions'); + +console.log(binaryExtensions); +//=> ['3ds', '3g2', …] +``` + +## Related + +- [is-binary-path](https://github.com/sindresorhus/is-binary-path) - Check if a filepath is a binary file +- [text-extensions](https://github.com/sindresorhus/text-extensions) - List of text file extensions diff --git a/backend/node_modules/body-parser/HISTORY.md b/backend/node_modules/body-parser/HISTORY.md new file mode 100644 index 000000000..81d23e064 --- /dev/null +++ b/backend/node_modules/body-parser/HISTORY.md @@ -0,0 +1,672 @@ +1.20.3 / 2024-09-10 +=================== + + * deps: qs@6.13.0 + * add `depth` option to customize the depth level in the parser + * IMPORTANT: The default `depth` level for parsing URL-encoded data is now `32` (previously was `Infinity`) + +1.20.2 / 2023-02-21 +=================== + + * Fix strict json error message on Node.js 19+ + * deps: content-type@~1.0.5 + - perf: skip value escaping when unnecessary + * deps: raw-body@2.5.2 + +1.20.1 / 2022-10-06 +=================== + + * deps: qs@6.11.0 + * perf: remove unnecessary object clone + +1.20.0 / 2022-04-02 +=================== + + * Fix error message for json parse whitespace in `strict` + * Fix internal error when inflated body exceeds limit + * Prevent loss of async hooks context + * Prevent hanging when request already read + * deps: depd@2.0.0 + - Replace internal `eval` usage with `Function` constructor + - Use instance methods on `process` to check for listeners + * deps: http-errors@2.0.0 + - deps: depd@2.0.0 + - deps: statuses@2.0.1 + * deps: on-finished@2.4.1 + * deps: qs@6.10.3 + * deps: raw-body@2.5.1 + - deps: http-errors@2.0.0 + +1.19.2 / 2022-02-15 +=================== + + * deps: bytes@3.1.2 + * deps: qs@6.9.7 + * Fix handling of `__proto__` keys + * deps: raw-body@2.4.3 + - deps: bytes@3.1.2 + +1.19.1 / 2021-12-10 +=================== + + * deps: bytes@3.1.1 + * deps: http-errors@1.8.1 + - deps: inherits@2.0.4 + - deps: toidentifier@1.0.1 + - deps: setprototypeof@1.2.0 + * deps: qs@6.9.6 + * deps: raw-body@2.4.2 + - deps: bytes@3.1.1 + - deps: http-errors@1.8.1 + * deps: safe-buffer@5.2.1 + * deps: type-is@~1.6.18 + +1.19.0 / 2019-04-25 +=================== + + * deps: bytes@3.1.0 + - Add petabyte (`pb`) support + * deps: http-errors@1.7.2 + - Set constructor name when possible + - deps: setprototypeof@1.1.1 + - deps: statuses@'>= 1.5.0 < 2' + * deps: iconv-lite@0.4.24 + - Added encoding MIK + * deps: qs@6.7.0 + - Fix parsing array brackets after index + * deps: raw-body@2.4.0 + - deps: bytes@3.1.0 + - deps: http-errors@1.7.2 + - deps: iconv-lite@0.4.24 + * deps: type-is@~1.6.17 + - deps: mime-types@~2.1.24 + - perf: prevent internal `throw` on invalid type + +1.18.3 / 2018-05-14 +=================== + + * Fix stack trace for strict json parse error + * deps: depd@~1.1.2 + - perf: remove argument reassignment + * deps: http-errors@~1.6.3 + - deps: depd@~1.1.2 + - deps: setprototypeof@1.1.0 + - deps: statuses@'>= 1.3.1 < 2' + * deps: iconv-lite@0.4.23 + - Fix loading encoding with year appended + - Fix deprecation warnings on Node.js 10+ + * deps: qs@6.5.2 + * deps: raw-body@2.3.3 + - deps: http-errors@1.6.3 + - deps: iconv-lite@0.4.23 + * deps: type-is@~1.6.16 + - deps: mime-types@~2.1.18 + +1.18.2 / 2017-09-22 +=================== + + * deps: debug@2.6.9 + * perf: remove argument reassignment + +1.18.1 / 2017-09-12 +=================== + + * deps: content-type@~1.0.4 + - perf: remove argument reassignment + - perf: skip parameter parsing when no parameters + * deps: iconv-lite@0.4.19 + - Fix ISO-8859-1 regression + - Update Windows-1255 + * deps: qs@6.5.1 + - Fix parsing & compacting very deep objects + * deps: raw-body@2.3.2 + - deps: iconv-lite@0.4.19 + +1.18.0 / 2017-09-08 +=================== + + * Fix JSON strict violation error to match native parse error + * Include the `body` property on verify errors + * Include the `type` property on all generated errors + * Use `http-errors` to set status code on errors + * deps: bytes@3.0.0 + * deps: debug@2.6.8 + * deps: depd@~1.1.1 + - Remove unnecessary `Buffer` loading + * deps: http-errors@~1.6.2 + - deps: depd@1.1.1 + * deps: iconv-lite@0.4.18 + - Add support for React Native + - Add a warning if not loaded as utf-8 + - Fix CESU-8 decoding in Node.js 8 + - Improve speed of ISO-8859-1 encoding + * deps: qs@6.5.0 + * deps: raw-body@2.3.1 + - Use `http-errors` for standard emitted errors + - deps: bytes@3.0.0 + - deps: iconv-lite@0.4.18 + - perf: skip buffer decoding on overage chunk + * perf: prevent internal `throw` when missing charset + +1.17.2 / 2017-05-17 +=================== + + * deps: debug@2.6.7 + - Fix `DEBUG_MAX_ARRAY_LENGTH` + - deps: ms@2.0.0 + * deps: type-is@~1.6.15 + - deps: mime-types@~2.1.15 + +1.17.1 / 2017-03-06 +=================== + + * deps: qs@6.4.0 + - Fix regression parsing keys starting with `[` + +1.17.0 / 2017-03-01 +=================== + + * deps: http-errors@~1.6.1 + - Make `message` property enumerable for `HttpError`s + - deps: setprototypeof@1.0.3 + * deps: qs@6.3.1 + - Fix compacting nested arrays + +1.16.1 / 2017-02-10 +=================== + + * deps: debug@2.6.1 + - Fix deprecation messages in WebStorm and other editors + - Undeprecate `DEBUG_FD` set to `1` or `2` + +1.16.0 / 2017-01-17 +=================== + + * deps: debug@2.6.0 + - Allow colors in workers + - Deprecated `DEBUG_FD` environment variable + - Fix error when running under React Native + - Use same color for same namespace + - deps: ms@0.7.2 + * deps: http-errors@~1.5.1 + - deps: inherits@2.0.3 + - deps: setprototypeof@1.0.2 + - deps: statuses@'>= 1.3.1 < 2' + * deps: iconv-lite@0.4.15 + - Added encoding MS-31J + - Added encoding MS-932 + - Added encoding MS-936 + - Added encoding MS-949 + - Added encoding MS-950 + - Fix GBK/GB18030 handling of Euro character + * deps: qs@6.2.1 + - Fix array parsing from skipping empty values + * deps: raw-body@~2.2.0 + - deps: iconv-lite@0.4.15 + * deps: type-is@~1.6.14 + - deps: mime-types@~2.1.13 + +1.15.2 / 2016-06-19 +=================== + + * deps: bytes@2.4.0 + * deps: content-type@~1.0.2 + - perf: enable strict mode + * deps: http-errors@~1.5.0 + - Use `setprototypeof` module to replace `__proto__` setting + - deps: statuses@'>= 1.3.0 < 2' + - perf: enable strict mode + * deps: qs@6.2.0 + * deps: raw-body@~2.1.7 + - deps: bytes@2.4.0 + - perf: remove double-cleanup on happy path + * deps: type-is@~1.6.13 + - deps: mime-types@~2.1.11 + +1.15.1 / 2016-05-05 +=================== + + * deps: bytes@2.3.0 + - Drop partial bytes on all parsed units + - Fix parsing byte string that looks like hex + * deps: raw-body@~2.1.6 + - deps: bytes@2.3.0 + * deps: type-is@~1.6.12 + - deps: mime-types@~2.1.10 + +1.15.0 / 2016-02-10 +=================== + + * deps: http-errors@~1.4.0 + - Add `HttpError` export, for `err instanceof createError.HttpError` + - deps: inherits@2.0.1 + - deps: statuses@'>= 1.2.1 < 2' + * deps: qs@6.1.0 + * deps: type-is@~1.6.11 + - deps: mime-types@~2.1.9 + +1.14.2 / 2015-12-16 +=================== + + * deps: bytes@2.2.0 + * deps: iconv-lite@0.4.13 + * deps: qs@5.2.0 + * deps: raw-body@~2.1.5 + - deps: bytes@2.2.0 + - deps: iconv-lite@0.4.13 + * deps: type-is@~1.6.10 + - deps: mime-types@~2.1.8 + +1.14.1 / 2015-09-27 +=================== + + * Fix issue where invalid charset results in 400 when `verify` used + * deps: iconv-lite@0.4.12 + - Fix CESU-8 decoding in Node.js 4.x + * deps: raw-body@~2.1.4 + - Fix masking critical errors from `iconv-lite` + - deps: iconv-lite@0.4.12 + * deps: type-is@~1.6.9 + - deps: mime-types@~2.1.7 + +1.14.0 / 2015-09-16 +=================== + + * Fix JSON strict parse error to match syntax errors + * Provide static `require` analysis in `urlencoded` parser + * deps: depd@~1.1.0 + - Support web browser loading + * deps: qs@5.1.0 + * deps: raw-body@~2.1.3 + - Fix sync callback when attaching data listener causes sync read + * deps: type-is@~1.6.8 + - Fix type error when given invalid type to match against + - deps: mime-types@~2.1.6 + +1.13.3 / 2015-07-31 +=================== + + * deps: type-is@~1.6.6 + - deps: mime-types@~2.1.4 + +1.13.2 / 2015-07-05 +=================== + + * deps: iconv-lite@0.4.11 + * deps: qs@4.0.0 + - Fix dropping parameters like `hasOwnProperty` + - Fix user-visible incompatibilities from 3.1.0 + - Fix various parsing edge cases + * deps: raw-body@~2.1.2 + - Fix error stack traces to skip `makeError` + - deps: iconv-lite@0.4.11 + * deps: type-is@~1.6.4 + - deps: mime-types@~2.1.2 + - perf: enable strict mode + - perf: remove argument reassignment + +1.13.1 / 2015-06-16 +=================== + + * deps: qs@2.4.2 + - Downgraded from 3.1.0 because of user-visible incompatibilities + +1.13.0 / 2015-06-14 +=================== + + * Add `statusCode` property on `Error`s, in addition to `status` + * Change `type` default to `application/json` for JSON parser + * Change `type` default to `application/x-www-form-urlencoded` for urlencoded parser + * Provide static `require` analysis + * Use the `http-errors` module to generate errors + * deps: bytes@2.1.0 + - Slight optimizations + * deps: iconv-lite@0.4.10 + - The encoding UTF-16 without BOM now defaults to UTF-16LE when detection fails + - Leading BOM is now removed when decoding + * deps: on-finished@~2.3.0 + - Add defined behavior for HTTP `CONNECT` requests + - Add defined behavior for HTTP `Upgrade` requests + - deps: ee-first@1.1.1 + * deps: qs@3.1.0 + - Fix dropping parameters like `hasOwnProperty` + - Fix various parsing edge cases + - Parsed object now has `null` prototype + * deps: raw-body@~2.1.1 + - Use `unpipe` module for unpiping requests + - deps: iconv-lite@0.4.10 + * deps: type-is@~1.6.3 + - deps: mime-types@~2.1.1 + - perf: reduce try block size + - perf: remove bitwise operations + * perf: enable strict mode + * perf: remove argument reassignment + * perf: remove delete call + +1.12.4 / 2015-05-10 +=================== + + * deps: debug@~2.2.0 + * deps: qs@2.4.2 + - Fix allowing parameters like `constructor` + * deps: on-finished@~2.2.1 + * deps: raw-body@~2.0.1 + - Fix a false-positive when unpiping in Node.js 0.8 + - deps: bytes@2.0.1 + * deps: type-is@~1.6.2 + - deps: mime-types@~2.0.11 + +1.12.3 / 2015-04-15 +=================== + + * Slight efficiency improvement when not debugging + * deps: depd@~1.0.1 + * deps: iconv-lite@0.4.8 + - Add encoding alias UNICODE-1-1-UTF-7 + * deps: raw-body@1.3.4 + - Fix hanging callback if request aborts during read + - deps: iconv-lite@0.4.8 + +1.12.2 / 2015-03-16 +=================== + + * deps: qs@2.4.1 + - Fix error when parameter `hasOwnProperty` is present + +1.12.1 / 2015-03-15 +=================== + + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + * deps: type-is@~1.6.1 + - deps: mime-types@~2.0.10 + +1.12.0 / 2015-02-13 +=================== + + * add `debug` messages + * accept a function for the `type` option + * use `content-type` to parse `Content-Type` headers + * deps: iconv-lite@0.4.7 + - Gracefully support enumerables on `Object.prototype` + * deps: raw-body@1.3.3 + - deps: iconv-lite@0.4.7 + * deps: type-is@~1.6.0 + - fix argument reassignment + - fix false-positives in `hasBody` `Transfer-Encoding` check + - support wildcard for both type and subtype (`*/*`) + - deps: mime-types@~2.0.9 + +1.11.0 / 2015-01-30 +=================== + + * make internal `extended: true` depth limit infinity + * deps: type-is@~1.5.6 + - deps: mime-types@~2.0.8 + +1.10.2 / 2015-01-20 +=================== + + * deps: iconv-lite@0.4.6 + - Fix rare aliases of single-byte encodings + * deps: raw-body@1.3.2 + - deps: iconv-lite@0.4.6 + +1.10.1 / 2015-01-01 +=================== + + * deps: on-finished@~2.2.0 + * deps: type-is@~1.5.5 + - deps: mime-types@~2.0.7 + +1.10.0 / 2014-12-02 +=================== + + * make internal `extended: true` array limit dynamic + +1.9.3 / 2014-11-21 +================== + + * deps: iconv-lite@0.4.5 + - Fix Windows-31J and X-SJIS encoding support + * deps: qs@2.3.3 + - Fix `arrayLimit` behavior + * deps: raw-body@1.3.1 + - deps: iconv-lite@0.4.5 + * deps: type-is@~1.5.3 + - deps: mime-types@~2.0.3 + +1.9.2 / 2014-10-27 +================== + + * deps: qs@2.3.2 + - Fix parsing of mixed objects and values + +1.9.1 / 2014-10-22 +================== + + * deps: on-finished@~2.1.1 + - Fix handling of pipelined requests + * deps: qs@2.3.0 + - Fix parsing of mixed implicit and explicit arrays + * deps: type-is@~1.5.2 + - deps: mime-types@~2.0.2 + +1.9.0 / 2014-09-24 +================== + + * include the charset in "unsupported charset" error message + * include the encoding in "unsupported content encoding" error message + * deps: depd@~1.0.0 + +1.8.4 / 2014-09-23 +================== + + * fix content encoding to be case-insensitive + +1.8.3 / 2014-09-19 +================== + + * deps: qs@2.2.4 + - Fix issue with object keys starting with numbers truncated + +1.8.2 / 2014-09-15 +================== + + * deps: depd@0.4.5 + +1.8.1 / 2014-09-07 +================== + + * deps: media-typer@0.3.0 + * deps: type-is@~1.5.1 + +1.8.0 / 2014-09-05 +================== + + * make empty-body-handling consistent between chunked requests + - empty `json` produces `{}` + - empty `raw` produces `new Buffer(0)` + - empty `text` produces `''` + - empty `urlencoded` produces `{}` + * deps: qs@2.2.3 + - Fix issue where first empty value in array is discarded + * deps: type-is@~1.5.0 + - fix `hasbody` to be true for `content-length: 0` + +1.7.0 / 2014-09-01 +================== + + * add `parameterLimit` option to `urlencoded` parser + * change `urlencoded` extended array limit to 100 + * respond with 413 when over `parameterLimit` in `urlencoded` + +1.6.7 / 2014-08-29 +================== + + * deps: qs@2.2.2 + - Remove unnecessary cloning + +1.6.6 / 2014-08-27 +================== + + * deps: qs@2.2.0 + - Array parsing fix + - Performance improvements + +1.6.5 / 2014-08-16 +================== + + * deps: on-finished@2.1.0 + +1.6.4 / 2014-08-14 +================== + + * deps: qs@1.2.2 + +1.6.3 / 2014-08-10 +================== + + * deps: qs@1.2.1 + +1.6.2 / 2014-08-07 +================== + + * deps: qs@1.2.0 + - Fix parsing array of objects + +1.6.1 / 2014-08-06 +================== + + * deps: qs@1.1.0 + - Accept urlencoded square brackets + - Accept empty values in implicit array notation + +1.6.0 / 2014-08-05 +================== + + * deps: qs@1.0.2 + - Complete rewrite + - Limits array length to 20 + - Limits object depth to 5 + - Limits parameters to 1,000 + +1.5.2 / 2014-07-27 +================== + + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + +1.5.1 / 2014-07-26 +================== + + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + +1.5.0 / 2014-07-20 +================== + + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + * deps: iconv-lite@0.4.4 + - Added encoding UTF-7 + * deps: raw-body@1.3.0 + - deps: iconv-lite@0.4.4 + - Added encoding UTF-7 + - Fix `Cannot switch to old mode now` error on Node.js 0.10+ + * deps: type-is@~1.3.2 + +1.4.3 / 2014-06-19 +================== + + * deps: type-is@1.3.1 + - fix global variable leak + +1.4.2 / 2014-06-19 +================== + + * deps: type-is@1.3.0 + - improve type parsing + +1.4.1 / 2014-06-19 +================== + + * fix urlencoded extended deprecation message + +1.4.0 / 2014-06-19 +================== + + * add `text` parser + * add `raw` parser + * check accepted charset in content-type (accepts utf-8) + * check accepted encoding in content-encoding (accepts identity) + * deprecate `bodyParser()` middleware; use `.json()` and `.urlencoded()` as needed + * deprecate `urlencoded()` without provided `extended` option + * lazy-load urlencoded parsers + * parsers split into files for reduced mem usage + * support gzip and deflate bodies + - set `inflate: false` to turn off + * deps: raw-body@1.2.2 + - Support all encodings from `iconv-lite` + +1.3.1 / 2014-06-11 +================== + + * deps: type-is@1.2.1 + - Switch dependency from mime to mime-types@1.0.0 + +1.3.0 / 2014-05-31 +================== + + * add `extended` option to urlencoded parser + +1.2.2 / 2014-05-27 +================== + + * deps: raw-body@1.1.6 + - assert stream encoding on node.js 0.8 + - assert stream encoding on node.js < 0.10.6 + - deps: bytes@1 + +1.2.1 / 2014-05-26 +================== + + * invoke `next(err)` after request fully read + - prevents hung responses and socket hang ups + +1.2.0 / 2014-05-11 +================== + + * add `verify` option + * deps: type-is@1.2.0 + - support suffix matching + +1.1.2 / 2014-05-11 +================== + + * improve json parser speed + +1.1.1 / 2014-05-11 +================== + + * fix repeated limit parsing with every request + +1.1.0 / 2014-05-10 +================== + + * add `type` option + * deps: pin for safety and consistency + +1.0.2 / 2014-04-14 +================== + + * use `type-is` module + +1.0.1 / 2014-03-20 +================== + + * lower default limits to 100kb diff --git a/backend/node_modules/body-parser/LICENSE b/backend/node_modules/body-parser/LICENSE new file mode 100644 index 000000000..386b7b694 --- /dev/null +++ b/backend/node_modules/body-parser/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/backend/node_modules/body-parser/README.md b/backend/node_modules/body-parser/README.md new file mode 100644 index 000000000..f6661b7d3 --- /dev/null +++ b/backend/node_modules/body-parser/README.md @@ -0,0 +1,476 @@ +# body-parser + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Build Status][ci-image]][ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] +[![OpenSSF Scorecard Badge][ossf-scorecard-badge]][ossf-scorecard-visualizer] + +Node.js body parsing middleware. + +Parse incoming request bodies in a middleware before your handlers, available +under the `req.body` property. + +**Note** As `req.body`'s shape is based on user-controlled input, all +properties and values in this object are untrusted and should be validated +before trusting. For example, `req.body.foo.toString()` may fail in multiple +ways, for example the `foo` property may not be there or may not be a string, +and `toString` may not be a function and instead a string or other user input. + +[Learn about the anatomy of an HTTP transaction in Node.js](https://nodejs.org/en/docs/guides/anatomy-of-an-http-transaction/). + +_This does not handle multipart bodies_, due to their complex and typically +large nature. For multipart bodies, you may be interested in the following +modules: + + * [busboy](https://www.npmjs.org/package/busboy#readme) and + [connect-busboy](https://www.npmjs.org/package/connect-busboy#readme) + * [multiparty](https://www.npmjs.org/package/multiparty#readme) and + [connect-multiparty](https://www.npmjs.org/package/connect-multiparty#readme) + * [formidable](https://www.npmjs.org/package/formidable#readme) + * [multer](https://www.npmjs.org/package/multer#readme) + +This module provides the following parsers: + + * [JSON body parser](#bodyparserjsonoptions) + * [Raw body parser](#bodyparserrawoptions) + * [Text body parser](#bodyparsertextoptions) + * [URL-encoded form body parser](#bodyparserurlencodedoptions) + +Other body parsers you might be interested in: + +- [body](https://www.npmjs.org/package/body#readme) +- [co-body](https://www.npmjs.org/package/co-body#readme) + +## Installation + +```sh +$ npm install body-parser +``` + +## API + +```js +var bodyParser = require('body-parser') +``` + +The `bodyParser` object exposes various factories to create middlewares. All +middlewares will populate the `req.body` property with the parsed body when +the `Content-Type` request header matches the `type` option, or an empty +object (`{}`) if there was no body to parse, the `Content-Type` was not matched, +or an error occurred. + +The various errors returned by this module are described in the +[errors section](#errors). + +### bodyParser.json([options]) + +Returns middleware that only parses `json` and only looks at requests where +the `Content-Type` header matches the `type` option. This parser accepts any +Unicode encoding of the body and supports automatic inflation of `gzip` and +`deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). + +#### Options + +The `json` function takes an optional `options` object that may contain any of +the following keys: + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### reviver + +The `reviver` option is passed directly to `JSON.parse` as the second +argument. You can find more information on this argument +[in the MDN documentation about JSON.parse](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/JSON/parse#Example.3A_Using_the_reviver_parameter). + +##### strict + +When set to `true`, will only accept arrays and objects; when `false` will +accept anything `JSON.parse` accepts. Defaults to `true`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not a +function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `json`), a mime type (like `application/json`), or +a mime type with a wildcard (like `*/*` or `*/json`). If a function, the `type` +option is called as `fn(req)` and the request is parsed if it returns a truthy +value. Defaults to `application/json`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.raw([options]) + +Returns middleware that parses all bodies as a `Buffer` and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser supports automatic inflation of `gzip` and `deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This will be a `Buffer` object +of the body. + +#### Options + +The `raw` function takes an optional `options` object that may contain any of +the following keys: + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. +If not a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this +can be an extension name (like `bin`), a mime type (like +`application/octet-stream`), or a mime type with a wildcard (like `*/*` or +`application/*`). If a function, the `type` option is called as `fn(req)` +and the request is parsed if it returns a truthy value. Defaults to +`application/octet-stream`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.text([options]) + +Returns middleware that parses all bodies as a string and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser supports automatic inflation of `gzip` and `deflate` encodings. + +A new `body` string containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This will be a string of the +body. + +#### Options + +The `text` function takes an optional `options` object that may contain any of +the following keys: + +##### defaultCharset + +Specify the default character set for the text content if the charset is not +specified in the `Content-Type` header of the request. Defaults to `utf-8`. + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not +a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `txt`), a mime type (like `text/plain`), or a mime +type with a wildcard (like `*/*` or `text/*`). If a function, the `type` +option is called as `fn(req)` and the request is parsed if it returns a +truthy value. Defaults to `text/plain`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.urlencoded([options]) + +Returns middleware that only parses `urlencoded` bodies and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser accepts only UTF-8 encoding of the body and supports automatic +inflation of `gzip` and `deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This object will contain +key-value pairs, where the value can be a string or array (when `extended` is +`false`), or any type (when `extended` is `true`). + +#### Options + +The `urlencoded` function takes an optional `options` object that may contain +any of the following keys: + +##### extended + +The `extended` option allows to choose between parsing the URL-encoded data +with the `querystring` library (when `false`) or the `qs` library (when +`true`). The "extended" syntax allows for rich objects and arrays to be +encoded into the URL-encoded format, allowing for a JSON-like experience +with URL-encoded. For more information, please +[see the qs library](https://www.npmjs.org/package/qs#readme). + +Defaults to `true`, but using the default has been deprecated. Please +research into the difference between `qs` and `querystring` and choose the +appropriate setting. + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### parameterLimit + +The `parameterLimit` option controls the maximum number of parameters that +are allowed in the URL-encoded data. If a request contains more parameters +than this value, a 413 will be returned to the client. Defaults to `1000`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not +a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `urlencoded`), a mime type (like +`application/x-www-form-urlencoded`), or a mime type with a wildcard (like +`*/x-www-form-urlencoded`). If a function, the `type` option is called as +`fn(req)` and the request is parsed if it returns a truthy value. Defaults +to `application/x-www-form-urlencoded`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +#### depth + +The `depth` option is used to configure the maximum depth of the `qs` library when `extended` is `true`. This allows you to limit the amount of keys that are parsed and can be useful to prevent certain types of abuse. Defaults to `32`. It is recommended to keep this value as low as possible. + +## Errors + +The middlewares provided by this module create errors using the +[`http-errors` module](https://www.npmjs.com/package/http-errors). The errors +will typically have a `status`/`statusCode` property that contains the suggested +HTTP response code, an `expose` property to determine if the `message` property +should be displayed to the client, a `type` property to determine the type of +error without matching against the `message`, and a `body` property containing +the read body, if available. + +The following are the common errors created, though any error can come through +for various reasons. + +### content encoding unsupported + +This error will occur when the request had a `Content-Encoding` header that +contained an encoding but the "inflation" option was set to `false`. The +`status` property is set to `415`, the `type` property is set to +`'encoding.unsupported'`, and the `charset` property will be set to the +encoding that is unsupported. + +### entity parse failed + +This error will occur when the request contained an entity that could not be +parsed by the middleware. The `status` property is set to `400`, the `type` +property is set to `'entity.parse.failed'`, and the `body` property is set to +the entity value that failed parsing. + +### entity verify failed + +This error will occur when the request contained an entity that could not be +failed verification by the defined `verify` option. The `status` property is +set to `403`, the `type` property is set to `'entity.verify.failed'`, and the +`body` property is set to the entity value that failed verification. + +### request aborted + +This error will occur when the request is aborted by the client before reading +the body has finished. The `received` property will be set to the number of +bytes received before the request was aborted and the `expected` property is +set to the number of expected bytes. The `status` property is set to `400` +and `type` property is set to `'request.aborted'`. + +### request entity too large + +This error will occur when the request body's size is larger than the "limit" +option. The `limit` property will be set to the byte limit and the `length` +property will be set to the request body's length. The `status` property is +set to `413` and the `type` property is set to `'entity.too.large'`. + +### request size did not match content length + +This error will occur when the request's length did not match the length from +the `Content-Length` header. This typically occurs when the request is malformed, +typically when the `Content-Length` header was calculated based on characters +instead of bytes. The `status` property is set to `400` and the `type` property +is set to `'request.size.invalid'`. + +### stream encoding should not be set + +This error will occur when something called the `req.setEncoding` method prior +to this middleware. This module operates directly on bytes only and you cannot +call `req.setEncoding` when using this module. The `status` property is set to +`500` and the `type` property is set to `'stream.encoding.set'`. + +### stream is not readable + +This error will occur when the request is no longer readable when this middleware +attempts to read it. This typically means something other than a middleware from +this module read the request body already and the middleware was also configured to +read the same request. The `status` property is set to `500` and the `type` +property is set to `'stream.not.readable'`. + +### too many parameters + +This error will occur when the content of the request exceeds the configured +`parameterLimit` for the `urlencoded` parser. The `status` property is set to +`413` and the `type` property is set to `'parameters.too.many'`. + +### unsupported charset "BOGUS" + +This error will occur when the request had a charset parameter in the +`Content-Type` header, but the `iconv-lite` module does not support it OR the +parser does not support it. The charset is contained in the message as well +as in the `charset` property. The `status` property is set to `415`, the +`type` property is set to `'charset.unsupported'`, and the `charset` property +is set to the charset that is unsupported. + +### unsupported content encoding "bogus" + +This error will occur when the request had a `Content-Encoding` header that +contained an unsupported encoding. The encoding is contained in the message +as well as in the `encoding` property. The `status` property is set to `415`, +the `type` property is set to `'encoding.unsupported'`, and the `encoding` +property is set to the encoding that is unsupported. + +### The input exceeded the depth + +This error occurs when using `bodyParser.urlencoded` with the `extended` property set to `true` and the input exceeds the configured `depth` option. The `status` property is set to `400`. It is recommended to review the `depth` option and evaluate if it requires a higher value. When the `depth` option is set to `32` (default value), the error will not be thrown. + +## Examples + +### Express/Connect top-level generic + +This example demonstrates adding a generic JSON and URL-encoded parser as a +top-level middleware, which will parse the bodies of all incoming requests. +This is the simplest setup. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// parse application/x-www-form-urlencoded +app.use(bodyParser.urlencoded({ extended: false })) + +// parse application/json +app.use(bodyParser.json()) + +app.use(function (req, res) { + res.setHeader('Content-Type', 'text/plain') + res.write('you posted:\n') + res.end(JSON.stringify(req.body, null, 2)) +}) +``` + +### Express route-specific + +This example demonstrates adding body parsers specifically to the routes that +need them. In general, this is the most recommended way to use body-parser with +Express. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// create application/json parser +var jsonParser = bodyParser.json() + +// create application/x-www-form-urlencoded parser +var urlencodedParser = bodyParser.urlencoded({ extended: false }) + +// POST /login gets urlencoded bodies +app.post('/login', urlencodedParser, function (req, res) { + res.send('welcome, ' + req.body.username) +}) + +// POST /api/users gets JSON bodies +app.post('/api/users', jsonParser, function (req, res) { + // create user in req.body +}) +``` + +### Change accepted type for parsers + +All the parsers accept a `type` option which allows you to change the +`Content-Type` that the middleware will parse. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// parse various different custom JSON types as JSON +app.use(bodyParser.json({ type: 'application/*+json' })) + +// parse some custom thing into a Buffer +app.use(bodyParser.raw({ type: 'application/vnd.custom-type' })) + +// parse an HTML body into a string +app.use(bodyParser.text({ type: 'text/html' })) +``` + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/expressjs/body-parser/master?label=ci +[ci-url]: https://github.com/expressjs/body-parser/actions/workflows/ci.yml +[coveralls-image]: https://badgen.net/coveralls/c/github/expressjs/body-parser/master +[coveralls-url]: https://coveralls.io/r/expressjs/body-parser?branch=master +[node-version-image]: https://badgen.net/npm/node/body-parser +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/body-parser +[npm-url]: https://npmjs.org/package/body-parser +[npm-version-image]: https://badgen.net/npm/v/body-parser +[ossf-scorecard-badge]: https://api.scorecard.dev/projects/github.com/expressjs/body-parser/badge +[ossf-scorecard-visualizer]: https://ossf.github.io/scorecard-visualizer/#/projects/github.com/expressjs/body-parser \ No newline at end of file diff --git a/backend/node_modules/body-parser/SECURITY.md b/backend/node_modules/body-parser/SECURITY.md new file mode 100644 index 000000000..9694d4296 --- /dev/null +++ b/backend/node_modules/body-parser/SECURITY.md @@ -0,0 +1,25 @@ +# Security Policies and Procedures + +## Reporting a Bug + +The Express team and community take all security bugs seriously. Thank you +for improving the security of Express. We appreciate your efforts and +responsible disclosure and will make every effort to acknowledge your +contributions. + +Report security bugs by emailing the current owner(s) of `body-parser`. This +information can be found in the npm registry using the command +`npm owner ls body-parser`. +If unsure or unable to get the information from the above, open an issue +in the [project issue tracker](https://github.com/expressjs/body-parser/issues) +asking for the current contact information. + +To ensure the timely response to your report, please ensure that the entirety +of the report is contained within the email body and not solely behind a web +link or an attachment. + +At least one owner will acknowledge your email within 48 hours, and will send a +more detailed response within 48 hours indicating the next steps in handling +your report. After the initial reply to your report, the owners will +endeavor to keep you informed of the progress towards a fix and full +announcement, and may ask for additional information or guidance. diff --git a/backend/node_modules/body-parser/index.js b/backend/node_modules/body-parser/index.js new file mode 100644 index 000000000..bb24d739d --- /dev/null +++ b/backend/node_modules/body-parser/index.js @@ -0,0 +1,156 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var deprecate = require('depd')('body-parser') + +/** + * Cache of loaded parsers. + * @private + */ + +var parsers = Object.create(null) + +/** + * @typedef Parsers + * @type {function} + * @property {function} json + * @property {function} raw + * @property {function} text + * @property {function} urlencoded + */ + +/** + * Module exports. + * @type {Parsers} + */ + +exports = module.exports = deprecate.function(bodyParser, + 'bodyParser: use individual json/urlencoded middlewares') + +/** + * JSON parser. + * @public + */ + +Object.defineProperty(exports, 'json', { + configurable: true, + enumerable: true, + get: createParserGetter('json') +}) + +/** + * Raw parser. + * @public + */ + +Object.defineProperty(exports, 'raw', { + configurable: true, + enumerable: true, + get: createParserGetter('raw') +}) + +/** + * Text parser. + * @public + */ + +Object.defineProperty(exports, 'text', { + configurable: true, + enumerable: true, + get: createParserGetter('text') +}) + +/** + * URL-encoded parser. + * @public + */ + +Object.defineProperty(exports, 'urlencoded', { + configurable: true, + enumerable: true, + get: createParserGetter('urlencoded') +}) + +/** + * Create a middleware to parse json and urlencoded bodies. + * + * @param {object} [options] + * @return {function} + * @deprecated + * @public + */ + +function bodyParser (options) { + // use default type for parsers + var opts = Object.create(options || null, { + type: { + configurable: true, + enumerable: true, + value: undefined, + writable: true + } + }) + + var _urlencoded = exports.urlencoded(opts) + var _json = exports.json(opts) + + return function bodyParser (req, res, next) { + _json(req, res, function (err) { + if (err) return next(err) + _urlencoded(req, res, next) + }) + } +} + +/** + * Create a getter for loading a parser. + * @private + */ + +function createParserGetter (name) { + return function get () { + return loadParser(name) + } +} + +/** + * Load a parser module. + * @private + */ + +function loadParser (parserName) { + var parser = parsers[parserName] + + if (parser !== undefined) { + return parser + } + + // this uses a switch for static require analysis + switch (parserName) { + case 'json': + parser = require('./lib/types/json') + break + case 'raw': + parser = require('./lib/types/raw') + break + case 'text': + parser = require('./lib/types/text') + break + case 'urlencoded': + parser = require('./lib/types/urlencoded') + break + } + + // store to prevent invoking require() + return (parsers[parserName] = parser) +} diff --git a/backend/node_modules/body-parser/lib/read.js b/backend/node_modules/body-parser/lib/read.js new file mode 100644 index 000000000..fce6283f5 --- /dev/null +++ b/backend/node_modules/body-parser/lib/read.js @@ -0,0 +1,205 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var createError = require('http-errors') +var destroy = require('destroy') +var getBody = require('raw-body') +var iconv = require('iconv-lite') +var onFinished = require('on-finished') +var unpipe = require('unpipe') +var zlib = require('zlib') + +/** + * Module exports. + */ + +module.exports = read + +/** + * Read a request into a buffer and parse. + * + * @param {object} req + * @param {object} res + * @param {function} next + * @param {function} parse + * @param {function} debug + * @param {object} options + * @private + */ + +function read (req, res, next, parse, debug, options) { + var length + var opts = options + var stream + + // flag as parsed + req._body = true + + // read options + var encoding = opts.encoding !== null + ? opts.encoding + : null + var verify = opts.verify + + try { + // get the content stream + stream = contentstream(req, debug, opts.inflate) + length = stream.length + stream.length = undefined + } catch (err) { + return next(err) + } + + // set raw-body options + opts.length = length + opts.encoding = verify + ? null + : encoding + + // assert charset is supported + if (opts.encoding === null && encoding !== null && !iconv.encodingExists(encoding)) { + return next(createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', { + charset: encoding.toLowerCase(), + type: 'charset.unsupported' + })) + } + + // read body + debug('read body') + getBody(stream, opts, function (error, body) { + if (error) { + var _error + + if (error.type === 'encoding.unsupported') { + // echo back charset + _error = createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', { + charset: encoding.toLowerCase(), + type: 'charset.unsupported' + }) + } else { + // set status code on error + _error = createError(400, error) + } + + // unpipe from stream and destroy + if (stream !== req) { + unpipe(req) + destroy(stream, true) + } + + // read off entire request + dump(req, function onfinished () { + next(createError(400, _error)) + }) + return + } + + // verify + if (verify) { + try { + debug('verify body') + verify(req, res, body, encoding) + } catch (err) { + next(createError(403, err, { + body: body, + type: err.type || 'entity.verify.failed' + })) + return + } + } + + // parse + var str = body + try { + debug('parse body') + str = typeof body !== 'string' && encoding !== null + ? iconv.decode(body, encoding) + : body + req.body = parse(str) + } catch (err) { + next(createError(400, err, { + body: str, + type: err.type || 'entity.parse.failed' + })) + return + } + + next() + }) +} + +/** + * Get the content stream of the request. + * + * @param {object} req + * @param {function} debug + * @param {boolean} [inflate=true] + * @return {object} + * @api private + */ + +function contentstream (req, debug, inflate) { + var encoding = (req.headers['content-encoding'] || 'identity').toLowerCase() + var length = req.headers['content-length'] + var stream + + debug('content-encoding "%s"', encoding) + + if (inflate === false && encoding !== 'identity') { + throw createError(415, 'content encoding unsupported', { + encoding: encoding, + type: 'encoding.unsupported' + }) + } + + switch (encoding) { + case 'deflate': + stream = zlib.createInflate() + debug('inflate body') + req.pipe(stream) + break + case 'gzip': + stream = zlib.createGunzip() + debug('gunzip body') + req.pipe(stream) + break + case 'identity': + stream = req + stream.length = length + break + default: + throw createError(415, 'unsupported content encoding "' + encoding + '"', { + encoding: encoding, + type: 'encoding.unsupported' + }) + } + + return stream +} + +/** + * Dump the contents of a request. + * + * @param {object} req + * @param {function} callback + * @api private + */ + +function dump (req, callback) { + if (onFinished.isFinished(req)) { + callback(null) + } else { + onFinished(req, callback) + req.resume() + } +} diff --git a/backend/node_modules/body-parser/lib/types/json.js b/backend/node_modules/body-parser/lib/types/json.js new file mode 100644 index 000000000..59f3f7e28 --- /dev/null +++ b/backend/node_modules/body-parser/lib/types/json.js @@ -0,0 +1,247 @@ +/*! + * body-parser + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var createError = require('http-errors') +var debug = require('debug')('body-parser:json') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = json + +/** + * RegExp to match the first non-space in a string. + * + * Allowed whitespace is defined in RFC 7159: + * + * ws = *( + * %x20 / ; Space + * %x09 / ; Horizontal tab + * %x0A / ; Line feed or New line + * %x0D ) ; Carriage return + */ + +var FIRST_CHAR_REGEXP = /^[\x20\x09\x0a\x0d]*([^\x20\x09\x0a\x0d])/ // eslint-disable-line no-control-regex + +var JSON_SYNTAX_CHAR = '#' +var JSON_SYNTAX_REGEXP = /#+/g + +/** + * Create a middleware to parse JSON bodies. + * + * @param {object} [options] + * @return {function} + * @public + */ + +function json (options) { + var opts = options || {} + + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var inflate = opts.inflate !== false + var reviver = opts.reviver + var strict = opts.strict !== false + var type = opts.type || 'application/json' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (body) { + if (body.length === 0) { + // special-case empty json body, as it's a common client-side mistake + // TODO: maybe make this configurable or part of "strict" option + return {} + } + + if (strict) { + var first = firstchar(body) + + if (first !== '{' && first !== '[') { + debug('strict violation') + throw createStrictSyntaxError(body, first) + } + } + + try { + debug('parse json') + return JSON.parse(body, reviver) + } catch (e) { + throw normalizeJsonSyntaxError(e, { + message: e.message, + stack: e.stack + }) + } + } + + return function jsonParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // assert charset per RFC 7159 sec 8.1 + var charset = getCharset(req) || 'utf-8' + if (charset.slice(0, 4) !== 'utf-') { + debug('invalid charset') + next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', { + charset: charset, + type: 'charset.unsupported' + })) + return + } + + // read + read(req, res, next, parse, debug, { + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Create strict violation syntax error matching native error. + * + * @param {string} str + * @param {string} char + * @return {Error} + * @private + */ + +function createStrictSyntaxError (str, char) { + var index = str.indexOf(char) + var partial = '' + + if (index !== -1) { + partial = str.substring(0, index) + JSON_SYNTAX_CHAR + + for (var i = index + 1; i < str.length; i++) { + partial += JSON_SYNTAX_CHAR + } + } + + try { + JSON.parse(partial); /* istanbul ignore next */ throw new SyntaxError('strict violation') + } catch (e) { + return normalizeJsonSyntaxError(e, { + message: e.message.replace(JSON_SYNTAX_REGEXP, function (placeholder) { + return str.substring(index, index + placeholder.length) + }), + stack: e.stack + }) + } +} + +/** + * Get the first non-whitespace character in a string. + * + * @param {string} str + * @return {function} + * @private + */ + +function firstchar (str) { + var match = FIRST_CHAR_REGEXP.exec(str) + + return match + ? match[1] + : undefined +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Normalize a SyntaxError for JSON.parse. + * + * @param {SyntaxError} error + * @param {object} obj + * @return {SyntaxError} + */ + +function normalizeJsonSyntaxError (error, obj) { + var keys = Object.getOwnPropertyNames(error) + + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + if (key !== 'stack' && key !== 'message') { + delete error[key] + } + } + + // replace stack before message for Node.js 0.10 and below + error.stack = obj.stack.replace(error.message, obj.message) + error.message = obj.message + + return error +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/backend/node_modules/body-parser/lib/types/raw.js b/backend/node_modules/body-parser/lib/types/raw.js new file mode 100644 index 000000000..f5d1b6747 --- /dev/null +++ b/backend/node_modules/body-parser/lib/types/raw.js @@ -0,0 +1,101 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + */ + +var bytes = require('bytes') +var debug = require('debug')('body-parser:raw') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = raw + +/** + * Create a middleware to parse raw bodies. + * + * @param {object} [options] + * @return {function} + * @api public + */ + +function raw (options) { + var opts = options || {} + + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'application/octet-stream' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (buf) { + return buf + } + + return function rawParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // read + read(req, res, next, parse, debug, { + encoding: null, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/backend/node_modules/body-parser/lib/types/text.js b/backend/node_modules/body-parser/lib/types/text.js new file mode 100644 index 000000000..083a00908 --- /dev/null +++ b/backend/node_modules/body-parser/lib/types/text.js @@ -0,0 +1,121 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var debug = require('debug')('body-parser:text') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = text + +/** + * Create a middleware to parse text bodies. + * + * @param {object} [options] + * @return {function} + * @api public + */ + +function text (options) { + var opts = options || {} + + var defaultCharset = opts.defaultCharset || 'utf-8' + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'text/plain' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (buf) { + return buf + } + + return function textParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // get charset + var charset = getCharset(req) || defaultCharset + + // read + read(req, res, next, parse, debug, { + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/backend/node_modules/body-parser/lib/types/urlencoded.js b/backend/node_modules/body-parser/lib/types/urlencoded.js new file mode 100644 index 000000000..2bd4485f5 --- /dev/null +++ b/backend/node_modules/body-parser/lib/types/urlencoded.js @@ -0,0 +1,307 @@ +/*! + * body-parser + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var createError = require('http-errors') +var debug = require('debug')('body-parser:urlencoded') +var deprecate = require('depd')('body-parser') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = urlencoded + +/** + * Cache of parser modules. + */ + +var parsers = Object.create(null) + +/** + * Create a middleware to parse urlencoded bodies. + * + * @param {object} [options] + * @return {function} + * @public + */ + +function urlencoded (options) { + var opts = options || {} + + // notice because option default will flip in next major + if (opts.extended === undefined) { + deprecate('undefined extended: provide extended option') + } + + var extended = opts.extended !== false + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'application/x-www-form-urlencoded' + var verify = opts.verify || false + var depth = typeof opts.depth !== 'number' + ? Number(opts.depth || 32) + : opts.depth + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate query parser + var queryparse = extended + ? extendedparser(opts) + : simpleparser(opts) + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (body) { + return body.length + ? queryparse(body) + : {} + } + + return function urlencodedParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // assert charset + var charset = getCharset(req) || 'utf-8' + if (charset !== 'utf-8') { + debug('invalid charset') + next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', { + charset: charset, + type: 'charset.unsupported' + })) + return + } + + // read + read(req, res, next, parse, debug, { + debug: debug, + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify, + depth: depth + }) + } +} + +/** + * Get the extended query parser. + * + * @param {object} options + */ + +function extendedparser (options) { + var parameterLimit = options.parameterLimit !== undefined + ? options.parameterLimit + : 1000 + + var depth = typeof options.depth !== 'number' + ? Number(options.depth || 32) + : options.depth + var parse = parser('qs') + + if (isNaN(parameterLimit) || parameterLimit < 1) { + throw new TypeError('option parameterLimit must be a positive number') + } + + if (isNaN(depth) || depth < 0) { + throw new TypeError('option depth must be a zero or a positive number') + } + + if (isFinite(parameterLimit)) { + parameterLimit = parameterLimit | 0 + } + + return function queryparse (body) { + var paramCount = parameterCount(body, parameterLimit) + + if (paramCount === undefined) { + debug('too many parameters') + throw createError(413, 'too many parameters', { + type: 'parameters.too.many' + }) + } + + var arrayLimit = Math.max(100, paramCount) + + debug('parse extended urlencoding') + try { + return parse(body, { + allowPrototypes: true, + arrayLimit: arrayLimit, + depth: depth, + strictDepth: true, + parameterLimit: parameterLimit + }) + } catch (err) { + if (err instanceof RangeError) { + throw createError(400, 'The input exceeded the depth', { + type: 'querystring.parse.rangeError' + }) + } else { + throw err + } + } + } +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Count the number of parameters, stopping once limit reached + * + * @param {string} body + * @param {number} limit + * @api private + */ + +function parameterCount (body, limit) { + var count = 0 + var index = 0 + + while ((index = body.indexOf('&', index)) !== -1) { + count++ + index++ + + if (count === limit) { + return undefined + } + } + + return count +} + +/** + * Get parser for module name dynamically. + * + * @param {string} name + * @return {function} + * @api private + */ + +function parser (name) { + var mod = parsers[name] + + if (mod !== undefined) { + return mod.parse + } + + // this uses a switch for static require analysis + switch (name) { + case 'qs': + mod = require('qs') + break + case 'querystring': + mod = require('querystring') + break + } + + // store to prevent invoking require() + parsers[name] = mod + + return mod.parse +} + +/** + * Get the simple query parser. + * + * @param {object} options + */ + +function simpleparser (options) { + var parameterLimit = options.parameterLimit !== undefined + ? options.parameterLimit + : 1000 + var parse = parser('querystring') + + if (isNaN(parameterLimit) || parameterLimit < 1) { + throw new TypeError('option parameterLimit must be a positive number') + } + + if (isFinite(parameterLimit)) { + parameterLimit = parameterLimit | 0 + } + + return function queryparse (body) { + var paramCount = parameterCount(body, parameterLimit) + + if (paramCount === undefined) { + debug('too many parameters') + throw createError(413, 'too many parameters', { + type: 'parameters.too.many' + }) + } + + debug('parse urlencoding') + return parse(body, undefined, undefined, { maxKeys: parameterLimit }) + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/backend/node_modules/body-parser/package.json b/backend/node_modules/body-parser/package.json new file mode 100644 index 000000000..3c9926fc5 --- /dev/null +++ b/backend/node_modules/body-parser/package.json @@ -0,0 +1,56 @@ +{ + "name": "body-parser", + "description": "Node.js body parsing middleware", + "version": "1.20.3", + "contributors": [ + "Douglas Christopher Wilson ", + "Jonathan Ong (http://jongleberry.com)" + ], + "license": "MIT", + "repository": "expressjs/body-parser", + "dependencies": { + "bytes": "3.1.2", + "content-type": "~1.0.5", + "debug": "2.6.9", + "depd": "2.0.0", + "destroy": "1.2.0", + "http-errors": "2.0.0", + "iconv-lite": "0.4.24", + "on-finished": "2.4.1", + "qs": "6.13.0", + "raw-body": "2.5.2", + "type-is": "~1.6.18", + "unpipe": "1.0.0" + }, + "devDependencies": { + "eslint": "8.34.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.27.5", + "eslint-plugin-markdown": "3.0.0", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "6.1.1", + "eslint-plugin-standard": "4.1.0", + "methods": "1.1.2", + "mocha": "10.2.0", + "nyc": "15.1.0", + "safe-buffer": "5.2.1", + "supertest": "6.3.3" + }, + "files": [ + "lib/", + "LICENSE", + "HISTORY.md", + "SECURITY.md", + "index.js" + ], + "engines": { + "node": ">= 0.8", + "npm": "1.2.8000 || >= 1.4.16" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --require test/support/env --reporter spec --check-leaks --bail test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + } +} diff --git a/backend/node_modules/brace-expansion/LICENSE b/backend/node_modules/brace-expansion/LICENSE new file mode 100644 index 000000000..de3226673 --- /dev/null +++ b/backend/node_modules/brace-expansion/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2013 Julian Gruber + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/backend/node_modules/brace-expansion/README.md b/backend/node_modules/brace-expansion/README.md new file mode 100644 index 000000000..6b4e0e164 --- /dev/null +++ b/backend/node_modules/brace-expansion/README.md @@ -0,0 +1,129 @@ +# brace-expansion + +[Brace expansion](https://www.gnu.org/software/bash/manual/html_node/Brace-Expansion.html), +as known from sh/bash, in JavaScript. + +[![build status](https://secure.travis-ci.org/juliangruber/brace-expansion.svg)](http://travis-ci.org/juliangruber/brace-expansion) +[![downloads](https://img.shields.io/npm/dm/brace-expansion.svg)](https://www.npmjs.org/package/brace-expansion) +[![Greenkeeper badge](https://badges.greenkeeper.io/juliangruber/brace-expansion.svg)](https://greenkeeper.io/) + +[![testling badge](https://ci.testling.com/juliangruber/brace-expansion.png)](https://ci.testling.com/juliangruber/brace-expansion) + +## Example + +```js +var expand = require('brace-expansion'); + +expand('file-{a,b,c}.jpg') +// => ['file-a.jpg', 'file-b.jpg', 'file-c.jpg'] + +expand('-v{,,}') +// => ['-v', '-v', '-v'] + +expand('file{0..2}.jpg') +// => ['file0.jpg', 'file1.jpg', 'file2.jpg'] + +expand('file-{a..c}.jpg') +// => ['file-a.jpg', 'file-b.jpg', 'file-c.jpg'] + +expand('file{2..0}.jpg') +// => ['file2.jpg', 'file1.jpg', 'file0.jpg'] + +expand('file{0..4..2}.jpg') +// => ['file0.jpg', 'file2.jpg', 'file4.jpg'] + +expand('file-{a..e..2}.jpg') +// => ['file-a.jpg', 'file-c.jpg', 'file-e.jpg'] + +expand('file{00..10..5}.jpg') +// => ['file00.jpg', 'file05.jpg', 'file10.jpg'] + +expand('{{A..C},{a..c}}') +// => ['A', 'B', 'C', 'a', 'b', 'c'] + +expand('ppp{,config,oe{,conf}}') +// => ['ppp', 'pppconfig', 'pppoe', 'pppoeconf'] +``` + +## API + +```js +var expand = require('brace-expansion'); +``` + +### var expanded = expand(str) + +Return an array of all possible and valid expansions of `str`. If none are +found, `[str]` is returned. + +Valid expansions are: + +```js +/^(.*,)+(.+)?$/ +// {a,b,...} +``` + +A comma separated list of options, like `{a,b}` or `{a,{b,c}}` or `{,a,}`. + +```js +/^-?\d+\.\.-?\d+(\.\.-?\d+)?$/ +// {x..y[..incr]} +``` + +A numeric sequence from `x` to `y` inclusive, with optional increment. +If `x` or `y` start with a leading `0`, all the numbers will be padded +to have equal length. Negative numbers and backwards iteration work too. + +```js +/^-?\d+\.\.-?\d+(\.\.-?\d+)?$/ +// {x..y[..incr]} +``` + +An alphabetic sequence from `x` to `y` inclusive, with optional increment. +`x` and `y` must be exactly one character, and if given, `incr` must be a +number. + +For compatibility reasons, the string `${` is not eligible for brace expansion. + +## Installation + +With [npm](https://npmjs.org) do: + +```bash +npm install brace-expansion +``` + +## Contributors + +- [Julian Gruber](https://github.com/juliangruber) +- [Isaac Z. Schlueter](https://github.com/isaacs) + +## Sponsors + +This module is proudly supported by my [Sponsors](https://github.com/juliangruber/sponsors)! + +Do you want to support modules like this to improve their quality, stability and weigh in on new features? Then please consider donating to my [Patreon](https://www.patreon.com/juliangruber). Not sure how much of my modules you're using? Try [feross/thanks](https://github.com/feross/thanks)! + +## License + +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/backend/node_modules/brace-expansion/index.js b/backend/node_modules/brace-expansion/index.js new file mode 100644 index 000000000..0478be81e --- /dev/null +++ b/backend/node_modules/brace-expansion/index.js @@ -0,0 +1,201 @@ +var concatMap = require('concat-map'); +var balanced = require('balanced-match'); + +module.exports = expandTop; + +var escSlash = '\0SLASH'+Math.random()+'\0'; +var escOpen = '\0OPEN'+Math.random()+'\0'; +var escClose = '\0CLOSE'+Math.random()+'\0'; +var escComma = '\0COMMA'+Math.random()+'\0'; +var escPeriod = '\0PERIOD'+Math.random()+'\0'; + +function numeric(str) { + return parseInt(str, 10) == str + ? parseInt(str, 10) + : str.charCodeAt(0); +} + +function escapeBraces(str) { + return str.split('\\\\').join(escSlash) + .split('\\{').join(escOpen) + .split('\\}').join(escClose) + .split('\\,').join(escComma) + .split('\\.').join(escPeriod); +} + +function unescapeBraces(str) { + return str.split(escSlash).join('\\') + .split(escOpen).join('{') + .split(escClose).join('}') + .split(escComma).join(',') + .split(escPeriod).join('.'); +} + + +// Basically just str.split(","), but handling cases +// where we have nested braced sections, which should be +// treated as individual members, like {a,{b,c},d} +function parseCommaParts(str) { + if (!str) + return ['']; + + var parts = []; + var m = balanced('{', '}', str); + + if (!m) + return str.split(','); + + var pre = m.pre; + var body = m.body; + var post = m.post; + var p = pre.split(','); + + p[p.length-1] += '{' + body + '}'; + var postParts = parseCommaParts(post); + if (post.length) { + p[p.length-1] += postParts.shift(); + p.push.apply(p, postParts); + } + + parts.push.apply(parts, p); + + return parts; +} + +function expandTop(str) { + if (!str) + return []; + + // I don't know why Bash 4.3 does this, but it does. + // Anything starting with {} will have the first two bytes preserved + // but *only* at the top level, so {},a}b will not expand to anything, + // but a{},b}c will be expanded to [a}c,abc]. + // One could argue that this is a bug in Bash, but since the goal of + // this module is to match Bash's rules, we escape a leading {} + if (str.substr(0, 2) === '{}') { + str = '\\{\\}' + str.substr(2); + } + + return expand(escapeBraces(str), true).map(unescapeBraces); +} + +function identity(e) { + return e; +} + +function embrace(str) { + return '{' + str + '}'; +} +function isPadded(el) { + return /^-?0\d/.test(el); +} + +function lte(i, y) { + return i <= y; +} +function gte(i, y) { + return i >= y; +} + +function expand(str, isTop) { + var expansions = []; + + var m = balanced('{', '}', str); + if (!m || /\$$/.test(m.pre)) return [str]; + + var isNumericSequence = /^-?\d+\.\.-?\d+(?:\.\.-?\d+)?$/.test(m.body); + var isAlphaSequence = /^[a-zA-Z]\.\.[a-zA-Z](?:\.\.-?\d+)?$/.test(m.body); + var isSequence = isNumericSequence || isAlphaSequence; + var isOptions = m.body.indexOf(',') >= 0; + if (!isSequence && !isOptions) { + // {a},b} + if (m.post.match(/,.*\}/)) { + str = m.pre + '{' + m.body + escClose + m.post; + return expand(str); + } + return [str]; + } + + var n; + if (isSequence) { + n = m.body.split(/\.\./); + } else { + n = parseCommaParts(m.body); + if (n.length === 1) { + // x{{a,b}}y ==> x{a}y x{b}y + n = expand(n[0], false).map(embrace); + if (n.length === 1) { + var post = m.post.length + ? expand(m.post, false) + : ['']; + return post.map(function(p) { + return m.pre + n[0] + p; + }); + } + } + } + + // at this point, n is the parts, and we know it's not a comma set + // with a single entry. + + // no need to expand pre, since it is guaranteed to be free of brace-sets + var pre = m.pre; + var post = m.post.length + ? expand(m.post, false) + : ['']; + + var N; + + if (isSequence) { + var x = numeric(n[0]); + var y = numeric(n[1]); + var width = Math.max(n[0].length, n[1].length) + var incr = n.length == 3 + ? Math.abs(numeric(n[2])) + : 1; + var test = lte; + var reverse = y < x; + if (reverse) { + incr *= -1; + test = gte; + } + var pad = n.some(isPadded); + + N = []; + + for (var i = x; test(i, y); i += incr) { + var c; + if (isAlphaSequence) { + c = String.fromCharCode(i); + if (c === '\\') + c = ''; + } else { + c = String(i); + if (pad) { + var need = width - c.length; + if (need > 0) { + var z = new Array(need + 1).join('0'); + if (i < 0) + c = '-' + z + c.slice(1); + else + c = z + c; + } + } + } + N.push(c); + } + } else { + N = concatMap(n, function(el) { return expand(el, false) }); + } + + for (var j = 0; j < N.length; j++) { + for (var k = 0; k < post.length; k++) { + var expansion = pre + N[j] + post[k]; + if (!isTop || isSequence || expansion) + expansions.push(expansion); + } + } + + return expansions; +} + diff --git a/backend/node_modules/brace-expansion/package.json b/backend/node_modules/brace-expansion/package.json new file mode 100644 index 000000000..a18faa8fd --- /dev/null +++ b/backend/node_modules/brace-expansion/package.json @@ -0,0 +1,47 @@ +{ + "name": "brace-expansion", + "description": "Brace expansion as known from sh/bash", + "version": "1.1.11", + "repository": { + "type": "git", + "url": "git://github.com/juliangruber/brace-expansion.git" + }, + "homepage": "https://github.com/juliangruber/brace-expansion", + "main": "index.js", + "scripts": { + "test": "tape test/*.js", + "gentest": "bash test/generate.sh", + "bench": "matcha test/perf/bench.js" + }, + "dependencies": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + }, + "devDependencies": { + "matcha": "^0.7.0", + "tape": "^4.6.0" + }, + "keywords": [], + "author": { + "name": "Julian Gruber", + "email": "mail@juliangruber.com", + "url": "http://juliangruber.com" + }, + "license": "MIT", + "testling": { + "files": "test/*.js", + "browsers": [ + "ie/8..latest", + "firefox/20..latest", + "firefox/nightly", + "chrome/25..latest", + "chrome/canary", + "opera/12..latest", + "opera/next", + "safari/5.1..latest", + "ipad/6.0..latest", + "iphone/6.0..latest", + "android-browser/4.2..latest" + ] + } +} diff --git a/backend/node_modules/braces/LICENSE b/backend/node_modules/braces/LICENSE new file mode 100644 index 000000000..9af4a67d2 --- /dev/null +++ b/backend/node_modules/braces/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014-present, Jon Schlinkert. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/backend/node_modules/braces/README.md b/backend/node_modules/braces/README.md new file mode 100644 index 000000000..f59dd6045 --- /dev/null +++ b/backend/node_modules/braces/README.md @@ -0,0 +1,586 @@ +# braces [![Donate](https://img.shields.io/badge/Donate-PayPal-green.svg)](https://www.paypal.com/cgi-bin/webscr?cmd=_s-xclick&hosted_button_id=W8YFZ425KND68) [![NPM version](https://img.shields.io/npm/v/braces.svg?style=flat)](https://www.npmjs.com/package/braces) [![NPM monthly downloads](https://img.shields.io/npm/dm/braces.svg?style=flat)](https://npmjs.org/package/braces) [![NPM total downloads](https://img.shields.io/npm/dt/braces.svg?style=flat)](https://npmjs.org/package/braces) [![Linux Build Status](https://img.shields.io/travis/micromatch/braces.svg?style=flat&label=Travis)](https://travis-ci.org/micromatch/braces) + +> Bash-like brace expansion, implemented in JavaScript. Safer than other brace expansion libs, with complete support for the Bash 4.3 braces specification, without sacrificing speed. + +Please consider following this project's author, [Jon Schlinkert](https://github.com/jonschlinkert), and consider starring the project to show your :heart: and support. + +## Install + +Install with [npm](https://www.npmjs.com/): + +```sh +$ npm install --save braces +``` + +## v3.0.0 Released!! + +See the [changelog](CHANGELOG.md) for details. + +## Why use braces? + +Brace patterns make globs more powerful by adding the ability to match specific ranges and sequences of characters. + +- **Accurate** - complete support for the [Bash 4.3 Brace Expansion](www.gnu.org/software/bash/) specification (passes all of the Bash braces tests) +- **[fast and performant](#benchmarks)** - Starts fast, runs fast and [scales well](#performance) as patterns increase in complexity. +- **Organized code base** - The parser and compiler are easy to maintain and update when edge cases crop up. +- **Well-tested** - Thousands of test assertions, and passes all of the Bash, minimatch, and [brace-expansion](https://github.com/juliangruber/brace-expansion) unit tests (as of the date this was written). +- **Safer** - You shouldn't have to worry about users defining aggressive or malicious brace patterns that can break your application. Braces takes measures to prevent malicious regex that can be used for DDoS attacks (see [catastrophic backtracking](https://www.regular-expressions.info/catastrophic.html)). +- [Supports lists](#lists) - (aka "sets") `a/{b,c}/d` => `['a/b/d', 'a/c/d']` +- [Supports sequences](#sequences) - (aka "ranges") `{01..03}` => `['01', '02', '03']` +- [Supports steps](#steps) - (aka "increments") `{2..10..2}` => `['2', '4', '6', '8', '10']` +- [Supports escaping](#escaping) - To prevent evaluation of special characters. + +## Usage + +The main export is a function that takes one or more brace `patterns` and `options`. + +```js +const braces = require('braces'); +// braces(patterns[, options]); + +console.log(braces(['{01..05}', '{a..e}'])); +//=> ['(0[1-5])', '([a-e])'] + +console.log(braces(['{01..05}', '{a..e}'], { expand: true })); +//=> ['01', '02', '03', '04', '05', 'a', 'b', 'c', 'd', 'e'] +``` + +### Brace Expansion vs. Compilation + +By default, brace patterns are compiled into strings that are optimized for creating regular expressions and matching. + +**Compiled** + +```js +console.log(braces('a/{x,y,z}/b')); +//=> ['a/(x|y|z)/b'] +console.log(braces(['a/{01..20}/b', 'a/{1..5}/b'])); +//=> [ 'a/(0[1-9]|1[0-9]|20)/b', 'a/([1-5])/b' ] +``` + +**Expanded** + +Enable brace expansion by setting the `expand` option to true, or by using [braces.expand()](#expand) (returns an array similar to what you'd expect from Bash, or `echo {1..5}`, or [minimatch](https://github.com/isaacs/minimatch)): + +```js +console.log(braces('a/{x,y,z}/b', { expand: true })); +//=> ['a/x/b', 'a/y/b', 'a/z/b'] + +console.log(braces.expand('{01..10}')); +//=> ['01','02','03','04','05','06','07','08','09','10'] +``` + +### Lists + +Expand lists (like Bash "sets"): + +```js +console.log(braces('a/{foo,bar,baz}/*.js')); +//=> ['a/(foo|bar|baz)/*.js'] + +console.log(braces.expand('a/{foo,bar,baz}/*.js')); +//=> ['a/foo/*.js', 'a/bar/*.js', 'a/baz/*.js'] +``` + +### Sequences + +Expand ranges of characters (like Bash "sequences"): + +```js +console.log(braces.expand('{1..3}')); // ['1', '2', '3'] +console.log(braces.expand('a/{1..3}/b')); // ['a/1/b', 'a/2/b', 'a/3/b'] +console.log(braces('{a..c}', { expand: true })); // ['a', 'b', 'c'] +console.log(braces('foo/{a..c}', { expand: true })); // ['foo/a', 'foo/b', 'foo/c'] + +// supports zero-padded ranges +console.log(braces('a/{01..03}/b')); //=> ['a/(0[1-3])/b'] +console.log(braces('a/{001..300}/b')); //=> ['a/(0{2}[1-9]|0[1-9][0-9]|[12][0-9]{2}|300)/b'] +``` + +See [fill-range](https://github.com/jonschlinkert/fill-range) for all available range-expansion options. + +### Steppped ranges + +Steps, or increments, may be used with ranges: + +```js +console.log(braces.expand('{2..10..2}')); +//=> ['2', '4', '6', '8', '10'] + +console.log(braces('{2..10..2}')); +//=> ['(2|4|6|8|10)'] +``` + +When the [.optimize](#optimize) method is used, or [options.optimize](#optionsoptimize) is set to true, sequences are passed to [to-regex-range](https://github.com/jonschlinkert/to-regex-range) for expansion. + +### Nesting + +Brace patterns may be nested. The results of each expanded string are not sorted, and left to right order is preserved. + +**"Expanded" braces** + +```js +console.log(braces.expand('a{b,c,/{x,y}}/e')); +//=> ['ab/e', 'ac/e', 'a/x/e', 'a/y/e'] + +console.log(braces.expand('a/{x,{1..5},y}/c')); +//=> ['a/x/c', 'a/1/c', 'a/2/c', 'a/3/c', 'a/4/c', 'a/5/c', 'a/y/c'] +``` + +**"Optimized" braces** + +```js +console.log(braces('a{b,c,/{x,y}}/e')); +//=> ['a(b|c|/(x|y))/e'] + +console.log(braces('a/{x,{1..5},y}/c')); +//=> ['a/(x|([1-5])|y)/c'] +``` + +### Escaping + +**Escaping braces** + +A brace pattern will not be expanded or evaluted if _either the opening or closing brace is escaped_: + +```js +console.log(braces.expand('a\\{d,c,b}e')); +//=> ['a{d,c,b}e'] + +console.log(braces.expand('a{d,c,b\\}e')); +//=> ['a{d,c,b}e'] +``` + +**Escaping commas** + +Commas inside braces may also be escaped: + +```js +console.log(braces.expand('a{b\\,c}d')); +//=> ['a{b,c}d'] + +console.log(braces.expand('a{d\\,c,b}e')); +//=> ['ad,ce', 'abe'] +``` + +**Single items** + +Following bash conventions, a brace pattern is also not expanded when it contains a single character: + +```js +console.log(braces.expand('a{b}c')); +//=> ['a{b}c'] +``` + +## Options + +### options.maxLength + +**Type**: `Number` + +**Default**: `10,000` + +**Description**: Limit the length of the input string. Useful when the input string is generated or your application allows users to pass a string, et cetera. + +```js +console.log(braces('a/{b,c}/d', { maxLength: 3 })); //=> throws an error +``` + +### options.expand + +**Type**: `Boolean` + +**Default**: `undefined` + +**Description**: Generate an "expanded" brace pattern (alternatively you can use the `braces.expand()` method, which does the same thing). + +```js +console.log(braces('a/{b,c}/d', { expand: true })); +//=> [ 'a/b/d', 'a/c/d' ] +``` + +### options.nodupes + +**Type**: `Boolean` + +**Default**: `undefined` + +**Description**: Remove duplicates from the returned array. + +### options.rangeLimit + +**Type**: `Number` + +**Default**: `1000` + +**Description**: To prevent malicious patterns from being passed by users, an error is thrown when `braces.expand()` is used or `options.expand` is true and the generated range will exceed the `rangeLimit`. + +You can customize `options.rangeLimit` or set it to `Inifinity` to disable this altogether. + +**Examples** + +```js +// pattern exceeds the "rangeLimit", so it's optimized automatically +console.log(braces.expand('{1..1000}')); +//=> ['([1-9]|[1-9][0-9]{1,2}|1000)'] + +// pattern does not exceed "rangeLimit", so it's NOT optimized +console.log(braces.expand('{1..100}')); +//=> ['1', '2', '3', '4', '5', '6', '7', '8', '9', '10', '11', '12', '13', '14', '15', '16', '17', '18', '19', '20', '21', '22', '23', '24', '25', '26', '27', '28', '29', '30', '31', '32', '33', '34', '35', '36', '37', '38', '39', '40', '41', '42', '43', '44', '45', '46', '47', '48', '49', '50', '51', '52', '53', '54', '55', '56', '57', '58', '59', '60', '61', '62', '63', '64', '65', '66', '67', '68', '69', '70', '71', '72', '73', '74', '75', '76', '77', '78', '79', '80', '81', '82', '83', '84', '85', '86', '87', '88', '89', '90', '91', '92', '93', '94', '95', '96', '97', '98', '99', '100'] +``` + +### options.transform + +**Type**: `Function` + +**Default**: `undefined` + +**Description**: Customize range expansion. + +**Example: Transforming non-numeric values** + +```js +const alpha = braces.expand('x/{a..e}/y', { + transform(value, index) { + // When non-numeric values are passed, "value" is a character code. + return 'foo/' + String.fromCharCode(value) + '-' + index; + }, +}); +console.log(alpha); +//=> [ 'x/foo/a-0/y', 'x/foo/b-1/y', 'x/foo/c-2/y', 'x/foo/d-3/y', 'x/foo/e-4/y' ] +``` + +**Example: Transforming numeric values** + +```js +const numeric = braces.expand('{1..5}', { + transform(value) { + // when numeric values are passed, "value" is a number + return 'foo/' + value * 2; + }, +}); +console.log(numeric); +//=> [ 'foo/2', 'foo/4', 'foo/6', 'foo/8', 'foo/10' ] +``` + +### options.quantifiers + +**Type**: `Boolean` + +**Default**: `undefined` + +**Description**: In regular expressions, quanitifiers can be used to specify how many times a token can be repeated. For example, `a{1,3}` will match the letter `a` one to three times. + +Unfortunately, regex quantifiers happen to share the same syntax as [Bash lists](#lists) + +The `quantifiers` option tells braces to detect when [regex quantifiers](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/RegExp#quantifiers) are defined in the given pattern, and not to try to expand them as lists. + +**Examples** + +```js +const braces = require('braces'); +console.log(braces('a/b{1,3}/{x,y,z}')); +//=> [ 'a/b(1|3)/(x|y|z)' ] +console.log(braces('a/b{1,3}/{x,y,z}', { quantifiers: true })); +//=> [ 'a/b{1,3}/(x|y|z)' ] +console.log(braces('a/b{1,3}/{x,y,z}', { quantifiers: true, expand: true })); +//=> [ 'a/b{1,3}/x', 'a/b{1,3}/y', 'a/b{1,3}/z' ] +``` + +### options.keepEscaping + +**Type**: `Boolean` + +**Default**: `undefined` + +**Description**: Do not strip backslashes that were used for escaping from the result. + +## What is "brace expansion"? + +Brace expansion is a type of parameter expansion that was made popular by unix shells for generating lists of strings, as well as regex-like matching when used alongside wildcards (globs). + +In addition to "expansion", braces are also used for matching. In other words: + +- [brace expansion](#brace-expansion) is for generating new lists +- [brace matching](#brace-matching) is for filtering existing lists + +
+More about brace expansion (click to expand) + +There are two main types of brace expansion: + +1. **lists**: which are defined using comma-separated values inside curly braces: `{a,b,c}` +2. **sequences**: which are defined using a starting value and an ending value, separated by two dots: `a{1..3}b`. Optionally, a third argument may be passed to define a "step" or increment to use: `a{1..100..10}b`. These are also sometimes referred to as "ranges". + +Here are some example brace patterns to illustrate how they work: + +**Sets** + +``` +{a,b,c} => a b c +{a,b,c}{1,2} => a1 a2 b1 b2 c1 c2 +``` + +**Sequences** + +``` +{1..9} => 1 2 3 4 5 6 7 8 9 +{4..-4} => 4 3 2 1 0 -1 -2 -3 -4 +{1..20..3} => 1 4 7 10 13 16 19 +{a..j} => a b c d e f g h i j +{j..a} => j i h g f e d c b a +{a..z..3} => a d g j m p s v y +``` + +**Combination** + +Sets and sequences can be mixed together or used along with any other strings. + +``` +{a,b,c}{1..3} => a1 a2 a3 b1 b2 b3 c1 c2 c3 +foo/{a,b,c}/bar => foo/a/bar foo/b/bar foo/c/bar +``` + +The fact that braces can be "expanded" from relatively simple patterns makes them ideal for quickly generating test fixtures, file paths, and similar use cases. + +## Brace matching + +In addition to _expansion_, brace patterns are also useful for performing regular-expression-like matching. + +For example, the pattern `foo/{1..3}/bar` would match any of following strings: + +``` +foo/1/bar +foo/2/bar +foo/3/bar +``` + +But not: + +``` +baz/1/qux +baz/2/qux +baz/3/qux +``` + +Braces can also be combined with [glob patterns](https://github.com/jonschlinkert/micromatch) to perform more advanced wildcard matching. For example, the pattern `*/{1..3}/*` would match any of following strings: + +``` +foo/1/bar +foo/2/bar +foo/3/bar +baz/1/qux +baz/2/qux +baz/3/qux +``` + +## Brace matching pitfalls + +Although brace patterns offer a user-friendly way of matching ranges or sets of strings, there are also some major disadvantages and potential risks you should be aware of. + +### tldr + +**"brace bombs"** + +- brace expansion can eat up a huge amount of processing resources +- as brace patterns increase _linearly in size_, the system resources required to expand the pattern increase exponentially +- users can accidentally (or intentially) exhaust your system's resources resulting in the equivalent of a DoS attack (bonus: no programming knowledge is required!) + +For a more detailed explanation with examples, see the [geometric complexity](#geometric-complexity) section. + +### The solution + +Jump to the [performance section](#performance) to see how Braces solves this problem in comparison to other libraries. + +### Geometric complexity + +At minimum, brace patterns with sets limited to two elements have quadradic or `O(n^2)` complexity. But the complexity of the algorithm increases exponentially as the number of sets, _and elements per set_, increases, which is `O(n^c)`. + +For example, the following sets demonstrate quadratic (`O(n^2)`) complexity: + +``` +{1,2}{3,4} => (2X2) => 13 14 23 24 +{1,2}{3,4}{5,6} => (2X2X2) => 135 136 145 146 235 236 245 246 +``` + +But add an element to a set, and we get a n-fold Cartesian product with `O(n^c)` complexity: + +``` +{1,2,3}{4,5,6}{7,8,9} => (3X3X3) => 147 148 149 157 158 159 167 168 169 247 248 + 249 257 258 259 267 268 269 347 348 349 357 + 358 359 367 368 369 +``` + +Now, imagine how this complexity grows given that each element is a n-tuple: + +``` +{1..100}{1..100} => (100X100) => 10,000 elements (38.4 kB) +{1..100}{1..100}{1..100} => (100X100X100) => 1,000,000 elements (5.76 MB) +``` + +Although these examples are clearly contrived, they demonstrate how brace patterns can quickly grow out of control. + +**More information** + +Interested in learning more about brace expansion? + +- [linuxjournal/bash-brace-expansion](http://www.linuxjournal.com/content/bash-brace-expansion) +- [rosettacode/Brace_expansion](https://rosettacode.org/wiki/Brace_expansion) +- [cartesian product](https://en.wikipedia.org/wiki/Cartesian_product) + +
+ +## Performance + +Braces is not only screaming fast, it's also more accurate the other brace expansion libraries. + +### Better algorithms + +Fortunately there is a solution to the ["brace bomb" problem](#brace-matching-pitfalls): _don't expand brace patterns into an array when they're used for matching_. + +Instead, convert the pattern into an optimized regular expression. This is easier said than done, and braces is the only library that does this currently. + +**The proof is in the numbers** + +Minimatch gets exponentially slower as patterns increase in complexity, braces does not. The following results were generated using `braces()` and `minimatch.braceExpand()`, respectively. + +| **Pattern** | **braces** | **[minimatch][]** | +| --------------------------- | ------------------- | ---------------------------- | +| `{1..9007199254740991}`[^1] | `298 B` (5ms 459μs) | N/A (freezes) | +| `{1..1000000000000000}` | `41 B` (1ms 15μs) | N/A (freezes) | +| `{1..100000000000000}` | `40 B` (890μs) | N/A (freezes) | +| `{1..10000000000000}` | `39 B` (2ms 49μs) | N/A (freezes) | +| `{1..1000000000000}` | `38 B` (608μs) | N/A (freezes) | +| `{1..100000000000}` | `37 B` (397μs) | N/A (freezes) | +| `{1..10000000000}` | `35 B` (983μs) | N/A (freezes) | +| `{1..1000000000}` | `34 B` (798μs) | N/A (freezes) | +| `{1..100000000}` | `33 B` (733μs) | N/A (freezes) | +| `{1..10000000}` | `32 B` (5ms 632μs) | `78.89 MB` (16s 388ms 569μs) | +| `{1..1000000}` | `31 B` (1ms 381μs) | `6.89 MB` (1s 496ms 887μs) | +| `{1..100000}` | `30 B` (950μs) | `588.89 kB` (146ms 921μs) | +| `{1..10000}` | `29 B` (1ms 114μs) | `48.89 kB` (14ms 187μs) | +| `{1..1000}` | `28 B` (760μs) | `3.89 kB` (1ms 453μs) | +| `{1..100}` | `22 B` (345μs) | `291 B` (196μs) | +| `{1..10}` | `10 B` (533μs) | `20 B` (37μs) | +| `{1..3}` | `7 B` (190μs) | `5 B` (27μs) | + +### Faster algorithms + +When you need expansion, braces is still much faster. + +_(the following results were generated using `braces.expand()` and `minimatch.braceExpand()`, respectively)_ + +| **Pattern** | **braces** | **[minimatch][]** | +| --------------- | --------------------------- | ---------------------------- | +| `{1..10000000}` | `78.89 MB` (2s 698ms 642μs) | `78.89 MB` (18s 601ms 974μs) | +| `{1..1000000}` | `6.89 MB` (458ms 576μs) | `6.89 MB` (1s 491ms 621μs) | +| `{1..100000}` | `588.89 kB` (20ms 728μs) | `588.89 kB` (156ms 919μs) | +| `{1..10000}` | `48.89 kB` (2ms 202μs) | `48.89 kB` (13ms 641μs) | +| `{1..1000}` | `3.89 kB` (1ms 796μs) | `3.89 kB` (1ms 958μs) | +| `{1..100}` | `291 B` (424μs) | `291 B` (211μs) | +| `{1..10}` | `20 B` (487μs) | `20 B` (72μs) | +| `{1..3}` | `5 B` (166μs) | `5 B` (27μs) | + +If you'd like to run these comparisons yourself, see [test/support/generate.js](test/support/generate.js). + +## Benchmarks + +### Running benchmarks + +Install dev dependencies: + +```bash +npm i -d && npm benchmark +``` + +### Latest results + +Braces is more accurate, without sacrificing performance. + +```bash +● expand - range (expanded) + braces x 53,167 ops/sec ±0.12% (102 runs sampled) + minimatch x 11,378 ops/sec ±0.10% (102 runs sampled) +● expand - range (optimized for regex) + braces x 373,442 ops/sec ±0.04% (100 runs sampled) + minimatch x 3,262 ops/sec ±0.18% (100 runs sampled) +● expand - nested ranges (expanded) + braces x 33,921 ops/sec ±0.09% (99 runs sampled) + minimatch x 10,855 ops/sec ±0.28% (100 runs sampled) +● expand - nested ranges (optimized for regex) + braces x 287,479 ops/sec ±0.52% (98 runs sampled) + minimatch x 3,219 ops/sec ±0.28% (101 runs sampled) +● expand - set (expanded) + braces x 238,243 ops/sec ±0.19% (97 runs sampled) + minimatch x 538,268 ops/sec ±0.31% (96 runs sampled) +● expand - set (optimized for regex) + braces x 321,844 ops/sec ±0.10% (97 runs sampled) + minimatch x 140,600 ops/sec ±0.15% (100 runs sampled) +● expand - nested sets (expanded) + braces x 165,371 ops/sec ±0.42% (96 runs sampled) + minimatch x 337,720 ops/sec ±0.28% (100 runs sampled) +● expand - nested sets (optimized for regex) + braces x 242,948 ops/sec ±0.12% (99 runs sampled) + minimatch x 87,403 ops/sec ±0.79% (96 runs sampled) +``` + +## About + +
+Contributing + +Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](../../issues/new). + +
+ +
+Running Tests + +Running and reviewing unit tests is a great way to get familiarized with a library and its API. You can install dependencies and run tests with the following command: + +```sh +$ npm install && npm test +``` + +
+ +
+Building docs + +_(This project's readme.md is generated by [verb](https://github.com/verbose/verb-generate-readme), please don't edit the readme directly. Any changes to the readme must be made in the [.verb.md](.verb.md) readme template.)_ + +To generate the readme, run the following command: + +```sh +$ npm install -g verbose/verb#dev verb-generate-readme && verb +``` + +
+ +### Contributors + +| **Commits** | **Contributor** | +| ----------- | ------------------------------------------------------------- | +| 197 | [jonschlinkert](https://github.com/jonschlinkert) | +| 4 | [doowb](https://github.com/doowb) | +| 1 | [es128](https://github.com/es128) | +| 1 | [eush77](https://github.com/eush77) | +| 1 | [hemanth](https://github.com/hemanth) | +| 1 | [wtgtybhertgeghgtwtg](https://github.com/wtgtybhertgeghgtwtg) | + +### Author + +**Jon Schlinkert** + +- [GitHub Profile](https://github.com/jonschlinkert) +- [Twitter Profile](https://twitter.com/jonschlinkert) +- [LinkedIn Profile](https://linkedin.com/in/jonschlinkert) + +### License + +Copyright © 2019, [Jon Schlinkert](https://github.com/jonschlinkert). +Released under the [MIT License](LICENSE). + +--- + +_This file was generated by [verb-generate-readme](https://github.com/verbose/verb-generate-readme), v0.8.0, on April 08, 2019._ diff --git a/backend/node_modules/braces/index.js b/backend/node_modules/braces/index.js new file mode 100644 index 000000000..d222c13b5 --- /dev/null +++ b/backend/node_modules/braces/index.js @@ -0,0 +1,170 @@ +'use strict'; + +const stringify = require('./lib/stringify'); +const compile = require('./lib/compile'); +const expand = require('./lib/expand'); +const parse = require('./lib/parse'); + +/** + * Expand the given pattern or create a regex-compatible string. + * + * ```js + * const braces = require('braces'); + * console.log(braces('{a,b,c}', { compile: true })); //=> ['(a|b|c)'] + * console.log(braces('{a,b,c}')); //=> ['a', 'b', 'c'] + * ``` + * @param {String} `str` + * @param {Object} `options` + * @return {String} + * @api public + */ + +const braces = (input, options = {}) => { + let output = []; + + if (Array.isArray(input)) { + for (const pattern of input) { + const result = braces.create(pattern, options); + if (Array.isArray(result)) { + output.push(...result); + } else { + output.push(result); + } + } + } else { + output = [].concat(braces.create(input, options)); + } + + if (options && options.expand === true && options.nodupes === true) { + output = [...new Set(output)]; + } + return output; +}; + +/** + * Parse the given `str` with the given `options`. + * + * ```js + * // braces.parse(pattern, [, options]); + * const ast = braces.parse('a/{b,c}/d'); + * console.log(ast); + * ``` + * @param {String} pattern Brace pattern to parse + * @param {Object} options + * @return {Object} Returns an AST + * @api public + */ + +braces.parse = (input, options = {}) => parse(input, options); + +/** + * Creates a braces string from an AST, or an AST node. + * + * ```js + * const braces = require('braces'); + * let ast = braces.parse('foo/{a,b}/bar'); + * console.log(stringify(ast.nodes[2])); //=> '{a,b}' + * ``` + * @param {String} `input` Brace pattern or AST. + * @param {Object} `options` + * @return {Array} Returns an array of expanded values. + * @api public + */ + +braces.stringify = (input, options = {}) => { + if (typeof input === 'string') { + return stringify(braces.parse(input, options), options); + } + return stringify(input, options); +}; + +/** + * Compiles a brace pattern into a regex-compatible, optimized string. + * This method is called by the main [braces](#braces) function by default. + * + * ```js + * const braces = require('braces'); + * console.log(braces.compile('a/{b,c}/d')); + * //=> ['a/(b|c)/d'] + * ``` + * @param {String} `input` Brace pattern or AST. + * @param {Object} `options` + * @return {Array} Returns an array of expanded values. + * @api public + */ + +braces.compile = (input, options = {}) => { + if (typeof input === 'string') { + input = braces.parse(input, options); + } + return compile(input, options); +}; + +/** + * Expands a brace pattern into an array. This method is called by the + * main [braces](#braces) function when `options.expand` is true. Before + * using this method it's recommended that you read the [performance notes](#performance)) + * and advantages of using [.compile](#compile) instead. + * + * ```js + * const braces = require('braces'); + * console.log(braces.expand('a/{b,c}/d')); + * //=> ['a/b/d', 'a/c/d']; + * ``` + * @param {String} `pattern` Brace pattern + * @param {Object} `options` + * @return {Array} Returns an array of expanded values. + * @api public + */ + +braces.expand = (input, options = {}) => { + if (typeof input === 'string') { + input = braces.parse(input, options); + } + + let result = expand(input, options); + + // filter out empty strings if specified + if (options.noempty === true) { + result = result.filter(Boolean); + } + + // filter out duplicates if specified + if (options.nodupes === true) { + result = [...new Set(result)]; + } + + return result; +}; + +/** + * Processes a brace pattern and returns either an expanded array + * (if `options.expand` is true), a highly optimized regex-compatible string. + * This method is called by the main [braces](#braces) function. + * + * ```js + * const braces = require('braces'); + * console.log(braces.create('user-{200..300}/project-{a,b,c}-{1..10}')) + * //=> 'user-(20[0-9]|2[1-9][0-9]|300)/project-(a|b|c)-([1-9]|10)' + * ``` + * @param {String} `pattern` Brace pattern + * @param {Object} `options` + * @return {Array} Returns an array of expanded values. + * @api public + */ + +braces.create = (input, options = {}) => { + if (input === '' || input.length < 3) { + return [input]; + } + + return options.expand !== true + ? braces.compile(input, options) + : braces.expand(input, options); +}; + +/** + * Expose "braces" + */ + +module.exports = braces; diff --git a/backend/node_modules/braces/lib/compile.js b/backend/node_modules/braces/lib/compile.js new file mode 100644 index 000000000..dce69beb9 --- /dev/null +++ b/backend/node_modules/braces/lib/compile.js @@ -0,0 +1,60 @@ +'use strict'; + +const fill = require('fill-range'); +const utils = require('./utils'); + +const compile = (ast, options = {}) => { + const walk = (node, parent = {}) => { + const invalidBlock = utils.isInvalidBrace(parent); + const invalidNode = node.invalid === true && options.escapeInvalid === true; + const invalid = invalidBlock === true || invalidNode === true; + const prefix = options.escapeInvalid === true ? '\\' : ''; + let output = ''; + + if (node.isOpen === true) { + return prefix + node.value; + } + + if (node.isClose === true) { + console.log('node.isClose', prefix, node.value); + return prefix + node.value; + } + + if (node.type === 'open') { + return invalid ? prefix + node.value : '('; + } + + if (node.type === 'close') { + return invalid ? prefix + node.value : ')'; + } + + if (node.type === 'comma') { + return node.prev.type === 'comma' ? '' : invalid ? node.value : '|'; + } + + if (node.value) { + return node.value; + } + + if (node.nodes && node.ranges > 0) { + const args = utils.reduce(node.nodes); + const range = fill(...args, { ...options, wrap: false, toRegex: true, strictZeros: true }); + + if (range.length !== 0) { + return args.length > 1 && range.length > 1 ? `(${range})` : range; + } + } + + if (node.nodes) { + for (const child of node.nodes) { + output += walk(child, node); + } + } + + return output; + }; + + return walk(ast); +}; + +module.exports = compile; diff --git a/backend/node_modules/braces/lib/constants.js b/backend/node_modules/braces/lib/constants.js new file mode 100644 index 000000000..2bb3b8840 --- /dev/null +++ b/backend/node_modules/braces/lib/constants.js @@ -0,0 +1,57 @@ +'use strict'; + +module.exports = { + MAX_LENGTH: 10000, + + // Digits + CHAR_0: '0', /* 0 */ + CHAR_9: '9', /* 9 */ + + // Alphabet chars. + CHAR_UPPERCASE_A: 'A', /* A */ + CHAR_LOWERCASE_A: 'a', /* a */ + CHAR_UPPERCASE_Z: 'Z', /* Z */ + CHAR_LOWERCASE_Z: 'z', /* z */ + + CHAR_LEFT_PARENTHESES: '(', /* ( */ + CHAR_RIGHT_PARENTHESES: ')', /* ) */ + + CHAR_ASTERISK: '*', /* * */ + + // Non-alphabetic chars. + CHAR_AMPERSAND: '&', /* & */ + CHAR_AT: '@', /* @ */ + CHAR_BACKSLASH: '\\', /* \ */ + CHAR_BACKTICK: '`', /* ` */ + CHAR_CARRIAGE_RETURN: '\r', /* \r */ + CHAR_CIRCUMFLEX_ACCENT: '^', /* ^ */ + CHAR_COLON: ':', /* : */ + CHAR_COMMA: ',', /* , */ + CHAR_DOLLAR: '$', /* . */ + CHAR_DOT: '.', /* . */ + CHAR_DOUBLE_QUOTE: '"', /* " */ + CHAR_EQUAL: '=', /* = */ + CHAR_EXCLAMATION_MARK: '!', /* ! */ + CHAR_FORM_FEED: '\f', /* \f */ + CHAR_FORWARD_SLASH: '/', /* / */ + CHAR_HASH: '#', /* # */ + CHAR_HYPHEN_MINUS: '-', /* - */ + CHAR_LEFT_ANGLE_BRACKET: '<', /* < */ + CHAR_LEFT_CURLY_BRACE: '{', /* { */ + CHAR_LEFT_SQUARE_BRACKET: '[', /* [ */ + CHAR_LINE_FEED: '\n', /* \n */ + CHAR_NO_BREAK_SPACE: '\u00A0', /* \u00A0 */ + CHAR_PERCENT: '%', /* % */ + CHAR_PLUS: '+', /* + */ + CHAR_QUESTION_MARK: '?', /* ? */ + CHAR_RIGHT_ANGLE_BRACKET: '>', /* > */ + CHAR_RIGHT_CURLY_BRACE: '}', /* } */ + CHAR_RIGHT_SQUARE_BRACKET: ']', /* ] */ + CHAR_SEMICOLON: ';', /* ; */ + CHAR_SINGLE_QUOTE: '\'', /* ' */ + CHAR_SPACE: ' ', /* */ + CHAR_TAB: '\t', /* \t */ + CHAR_UNDERSCORE: '_', /* _ */ + CHAR_VERTICAL_LINE: '|', /* | */ + CHAR_ZERO_WIDTH_NOBREAK_SPACE: '\uFEFF' /* \uFEFF */ +}; diff --git a/backend/node_modules/braces/lib/expand.js b/backend/node_modules/braces/lib/expand.js new file mode 100644 index 000000000..35b2c41d6 --- /dev/null +++ b/backend/node_modules/braces/lib/expand.js @@ -0,0 +1,113 @@ +'use strict'; + +const fill = require('fill-range'); +const stringify = require('./stringify'); +const utils = require('./utils'); + +const append = (queue = '', stash = '', enclose = false) => { + const result = []; + + queue = [].concat(queue); + stash = [].concat(stash); + + if (!stash.length) return queue; + if (!queue.length) { + return enclose ? utils.flatten(stash).map(ele => `{${ele}}`) : stash; + } + + for (const item of queue) { + if (Array.isArray(item)) { + for (const value of item) { + result.push(append(value, stash, enclose)); + } + } else { + for (let ele of stash) { + if (enclose === true && typeof ele === 'string') ele = `{${ele}}`; + result.push(Array.isArray(ele) ? append(item, ele, enclose) : item + ele); + } + } + } + return utils.flatten(result); +}; + +const expand = (ast, options = {}) => { + const rangeLimit = options.rangeLimit === undefined ? 1000 : options.rangeLimit; + + const walk = (node, parent = {}) => { + node.queue = []; + + let p = parent; + let q = parent.queue; + + while (p.type !== 'brace' && p.type !== 'root' && p.parent) { + p = p.parent; + q = p.queue; + } + + if (node.invalid || node.dollar) { + q.push(append(q.pop(), stringify(node, options))); + return; + } + + if (node.type === 'brace' && node.invalid !== true && node.nodes.length === 2) { + q.push(append(q.pop(), ['{}'])); + return; + } + + if (node.nodes && node.ranges > 0) { + const args = utils.reduce(node.nodes); + + if (utils.exceedsLimit(...args, options.step, rangeLimit)) { + throw new RangeError('expanded array length exceeds range limit. Use options.rangeLimit to increase or disable the limit.'); + } + + let range = fill(...args, options); + if (range.length === 0) { + range = stringify(node, options); + } + + q.push(append(q.pop(), range)); + node.nodes = []; + return; + } + + const enclose = utils.encloseBrace(node); + let queue = node.queue; + let block = node; + + while (block.type !== 'brace' && block.type !== 'root' && block.parent) { + block = block.parent; + queue = block.queue; + } + + for (let i = 0; i < node.nodes.length; i++) { + const child = node.nodes[i]; + + if (child.type === 'comma' && node.type === 'brace') { + if (i === 1) queue.push(''); + queue.push(''); + continue; + } + + if (child.type === 'close') { + q.push(append(q.pop(), queue, enclose)); + continue; + } + + if (child.value && child.type !== 'open') { + queue.push(append(queue.pop(), child.value)); + continue; + } + + if (child.nodes) { + walk(child, node); + } + } + + return queue; + }; + + return utils.flatten(walk(ast)); +}; + +module.exports = expand; diff --git a/backend/node_modules/braces/lib/parse.js b/backend/node_modules/braces/lib/parse.js new file mode 100644 index 000000000..3a6988e62 --- /dev/null +++ b/backend/node_modules/braces/lib/parse.js @@ -0,0 +1,331 @@ +'use strict'; + +const stringify = require('./stringify'); + +/** + * Constants + */ + +const { + MAX_LENGTH, + CHAR_BACKSLASH, /* \ */ + CHAR_BACKTICK, /* ` */ + CHAR_COMMA, /* , */ + CHAR_DOT, /* . */ + CHAR_LEFT_PARENTHESES, /* ( */ + CHAR_RIGHT_PARENTHESES, /* ) */ + CHAR_LEFT_CURLY_BRACE, /* { */ + CHAR_RIGHT_CURLY_BRACE, /* } */ + CHAR_LEFT_SQUARE_BRACKET, /* [ */ + CHAR_RIGHT_SQUARE_BRACKET, /* ] */ + CHAR_DOUBLE_QUOTE, /* " */ + CHAR_SINGLE_QUOTE, /* ' */ + CHAR_NO_BREAK_SPACE, + CHAR_ZERO_WIDTH_NOBREAK_SPACE +} = require('./constants'); + +/** + * parse + */ + +const parse = (input, options = {}) => { + if (typeof input !== 'string') { + throw new TypeError('Expected a string'); + } + + const opts = options || {}; + const max = typeof opts.maxLength === 'number' ? Math.min(MAX_LENGTH, opts.maxLength) : MAX_LENGTH; + if (input.length > max) { + throw new SyntaxError(`Input length (${input.length}), exceeds max characters (${max})`); + } + + const ast = { type: 'root', input, nodes: [] }; + const stack = [ast]; + let block = ast; + let prev = ast; + let brackets = 0; + const length = input.length; + let index = 0; + let depth = 0; + let value; + + /** + * Helpers + */ + + const advance = () => input[index++]; + const push = node => { + if (node.type === 'text' && prev.type === 'dot') { + prev.type = 'text'; + } + + if (prev && prev.type === 'text' && node.type === 'text') { + prev.value += node.value; + return; + } + + block.nodes.push(node); + node.parent = block; + node.prev = prev; + prev = node; + return node; + }; + + push({ type: 'bos' }); + + while (index < length) { + block = stack[stack.length - 1]; + value = advance(); + + /** + * Invalid chars + */ + + if (value === CHAR_ZERO_WIDTH_NOBREAK_SPACE || value === CHAR_NO_BREAK_SPACE) { + continue; + } + + /** + * Escaped chars + */ + + if (value === CHAR_BACKSLASH) { + push({ type: 'text', value: (options.keepEscaping ? value : '') + advance() }); + continue; + } + + /** + * Right square bracket (literal): ']' + */ + + if (value === CHAR_RIGHT_SQUARE_BRACKET) { + push({ type: 'text', value: '\\' + value }); + continue; + } + + /** + * Left square bracket: '[' + */ + + if (value === CHAR_LEFT_SQUARE_BRACKET) { + brackets++; + + let next; + + while (index < length && (next = advance())) { + value += next; + + if (next === CHAR_LEFT_SQUARE_BRACKET) { + brackets++; + continue; + } + + if (next === CHAR_BACKSLASH) { + value += advance(); + continue; + } + + if (next === CHAR_RIGHT_SQUARE_BRACKET) { + brackets--; + + if (brackets === 0) { + break; + } + } + } + + push({ type: 'text', value }); + continue; + } + + /** + * Parentheses + */ + + if (value === CHAR_LEFT_PARENTHESES) { + block = push({ type: 'paren', nodes: [] }); + stack.push(block); + push({ type: 'text', value }); + continue; + } + + if (value === CHAR_RIGHT_PARENTHESES) { + if (block.type !== 'paren') { + push({ type: 'text', value }); + continue; + } + block = stack.pop(); + push({ type: 'text', value }); + block = stack[stack.length - 1]; + continue; + } + + /** + * Quotes: '|"|` + */ + + if (value === CHAR_DOUBLE_QUOTE || value === CHAR_SINGLE_QUOTE || value === CHAR_BACKTICK) { + const open = value; + let next; + + if (options.keepQuotes !== true) { + value = ''; + } + + while (index < length && (next = advance())) { + if (next === CHAR_BACKSLASH) { + value += next + advance(); + continue; + } + + if (next === open) { + if (options.keepQuotes === true) value += next; + break; + } + + value += next; + } + + push({ type: 'text', value }); + continue; + } + + /** + * Left curly brace: '{' + */ + + if (value === CHAR_LEFT_CURLY_BRACE) { + depth++; + + const dollar = prev.value && prev.value.slice(-1) === '$' || block.dollar === true; + const brace = { + type: 'brace', + open: true, + close: false, + dollar, + depth, + commas: 0, + ranges: 0, + nodes: [] + }; + + block = push(brace); + stack.push(block); + push({ type: 'open', value }); + continue; + } + + /** + * Right curly brace: '}' + */ + + if (value === CHAR_RIGHT_CURLY_BRACE) { + if (block.type !== 'brace') { + push({ type: 'text', value }); + continue; + } + + const type = 'close'; + block = stack.pop(); + block.close = true; + + push({ type, value }); + depth--; + + block = stack[stack.length - 1]; + continue; + } + + /** + * Comma: ',' + */ + + if (value === CHAR_COMMA && depth > 0) { + if (block.ranges > 0) { + block.ranges = 0; + const open = block.nodes.shift(); + block.nodes = [open, { type: 'text', value: stringify(block) }]; + } + + push({ type: 'comma', value }); + block.commas++; + continue; + } + + /** + * Dot: '.' + */ + + if (value === CHAR_DOT && depth > 0 && block.commas === 0) { + const siblings = block.nodes; + + if (depth === 0 || siblings.length === 0) { + push({ type: 'text', value }); + continue; + } + + if (prev.type === 'dot') { + block.range = []; + prev.value += value; + prev.type = 'range'; + + if (block.nodes.length !== 3 && block.nodes.length !== 5) { + block.invalid = true; + block.ranges = 0; + prev.type = 'text'; + continue; + } + + block.ranges++; + block.args = []; + continue; + } + + if (prev.type === 'range') { + siblings.pop(); + + const before = siblings[siblings.length - 1]; + before.value += prev.value + value; + prev = before; + block.ranges--; + continue; + } + + push({ type: 'dot', value }); + continue; + } + + /** + * Text + */ + + push({ type: 'text', value }); + } + + // Mark imbalanced braces and brackets as invalid + do { + block = stack.pop(); + + if (block.type !== 'root') { + block.nodes.forEach(node => { + if (!node.nodes) { + if (node.type === 'open') node.isOpen = true; + if (node.type === 'close') node.isClose = true; + if (!node.nodes) node.type = 'text'; + node.invalid = true; + } + }); + + // get the location of the block on parent.nodes (block's siblings) + const parent = stack[stack.length - 1]; + const index = parent.nodes.indexOf(block); + // replace the (invalid) block with it's nodes + parent.nodes.splice(index, 1, ...block.nodes); + } + } while (stack.length > 0); + + push({ type: 'eos' }); + return ast; +}; + +module.exports = parse; diff --git a/backend/node_modules/braces/lib/stringify.js b/backend/node_modules/braces/lib/stringify.js new file mode 100644 index 000000000..8bcf872c3 --- /dev/null +++ b/backend/node_modules/braces/lib/stringify.js @@ -0,0 +1,32 @@ +'use strict'; + +const utils = require('./utils'); + +module.exports = (ast, options = {}) => { + const stringify = (node, parent = {}) => { + const invalidBlock = options.escapeInvalid && utils.isInvalidBrace(parent); + const invalidNode = node.invalid === true && options.escapeInvalid === true; + let output = ''; + + if (node.value) { + if ((invalidBlock || invalidNode) && utils.isOpenOrClose(node)) { + return '\\' + node.value; + } + return node.value; + } + + if (node.value) { + return node.value; + } + + if (node.nodes) { + for (const child of node.nodes) { + output += stringify(child); + } + } + return output; + }; + + return stringify(ast); +}; + diff --git a/backend/node_modules/braces/lib/utils.js b/backend/node_modules/braces/lib/utils.js new file mode 100644 index 000000000..d19311fe0 --- /dev/null +++ b/backend/node_modules/braces/lib/utils.js @@ -0,0 +1,122 @@ +'use strict'; + +exports.isInteger = num => { + if (typeof num === 'number') { + return Number.isInteger(num); + } + if (typeof num === 'string' && num.trim() !== '') { + return Number.isInteger(Number(num)); + } + return false; +}; + +/** + * Find a node of the given type + */ + +exports.find = (node, type) => node.nodes.find(node => node.type === type); + +/** + * Find a node of the given type + */ + +exports.exceedsLimit = (min, max, step = 1, limit) => { + if (limit === false) return false; + if (!exports.isInteger(min) || !exports.isInteger(max)) return false; + return ((Number(max) - Number(min)) / Number(step)) >= limit; +}; + +/** + * Escape the given node with '\\' before node.value + */ + +exports.escapeNode = (block, n = 0, type) => { + const node = block.nodes[n]; + if (!node) return; + + if ((type && node.type === type) || node.type === 'open' || node.type === 'close') { + if (node.escaped !== true) { + node.value = '\\' + node.value; + node.escaped = true; + } + } +}; + +/** + * Returns true if the given brace node should be enclosed in literal braces + */ + +exports.encloseBrace = node => { + if (node.type !== 'brace') return false; + if ((node.commas >> 0 + node.ranges >> 0) === 0) { + node.invalid = true; + return true; + } + return false; +}; + +/** + * Returns true if a brace node is invalid. + */ + +exports.isInvalidBrace = block => { + if (block.type !== 'brace') return false; + if (block.invalid === true || block.dollar) return true; + if ((block.commas >> 0 + block.ranges >> 0) === 0) { + block.invalid = true; + return true; + } + if (block.open !== true || block.close !== true) { + block.invalid = true; + return true; + } + return false; +}; + +/** + * Returns true if a node is an open or close node + */ + +exports.isOpenOrClose = node => { + if (node.type === 'open' || node.type === 'close') { + return true; + } + return node.open === true || node.close === true; +}; + +/** + * Reduce an array of text nodes. + */ + +exports.reduce = nodes => nodes.reduce((acc, node) => { + if (node.type === 'text') acc.push(node.value); + if (node.type === 'range') node.type = 'text'; + return acc; +}, []); + +/** + * Flatten an array + */ + +exports.flatten = (...args) => { + const result = []; + + const flat = arr => { + for (let i = 0; i < arr.length; i++) { + const ele = arr[i]; + + if (Array.isArray(ele)) { + flat(ele); + continue; + } + + if (ele !== undefined) { + result.push(ele); + } + } + return result; + }; + + flat(args); + return result; +}; diff --git a/backend/node_modules/braces/package.json b/backend/node_modules/braces/package.json new file mode 100644 index 000000000..c3c056e46 --- /dev/null +++ b/backend/node_modules/braces/package.json @@ -0,0 +1,77 @@ +{ + "name": "braces", + "description": "Bash-like brace expansion, implemented in JavaScript. Safer than other brace expansion libs, with complete support for the Bash 4.3 braces specification, without sacrificing speed.", + "version": "3.0.3", + "homepage": "https://github.com/micromatch/braces", + "author": "Jon Schlinkert (https://github.com/jonschlinkert)", + "contributors": [ + "Brian Woodward (https://twitter.com/doowb)", + "Elan Shanker (https://github.com/es128)", + "Eugene Sharygin (https://github.com/eush77)", + "hemanth.hm (http://h3manth.com)", + "Jon Schlinkert (http://twitter.com/jonschlinkert)" + ], + "repository": "micromatch/braces", + "bugs": { + "url": "https://github.com/micromatch/braces/issues" + }, + "license": "MIT", + "files": [ + "index.js", + "lib" + ], + "main": "index.js", + "engines": { + "node": ">=8" + }, + "scripts": { + "test": "mocha", + "benchmark": "node benchmark" + }, + "dependencies": { + "fill-range": "^7.1.1" + }, + "devDependencies": { + "ansi-colors": "^3.2.4", + "bash-path": "^2.0.1", + "gulp-format-md": "^2.0.0", + "mocha": "^6.1.1" + }, + "keywords": [ + "alpha", + "alphabetical", + "bash", + "brace", + "braces", + "expand", + "expansion", + "filepath", + "fill", + "fs", + "glob", + "globbing", + "letter", + "match", + "matches", + "matching", + "number", + "numerical", + "path", + "range", + "ranges", + "sh" + ], + "verb": { + "toc": false, + "layout": "default", + "tasks": [ + "readme" + ], + "lint": { + "reflinks": true + }, + "plugins": [ + "gulp-format-md" + ] + } +} diff --git a/backend/node_modules/buffer-equal-constant-time/.npmignore b/backend/node_modules/buffer-equal-constant-time/.npmignore new file mode 100644 index 000000000..34e4f5c29 --- /dev/null +++ b/backend/node_modules/buffer-equal-constant-time/.npmignore @@ -0,0 +1,2 @@ +.*.sw[mnop] +node_modules/ diff --git a/backend/node_modules/buffer-equal-constant-time/.travis.yml b/backend/node_modules/buffer-equal-constant-time/.travis.yml new file mode 100644 index 000000000..78e1c0146 --- /dev/null +++ b/backend/node_modules/buffer-equal-constant-time/.travis.yml @@ -0,0 +1,4 @@ +language: node_js +node_js: +- "0.11" +- "0.10" diff --git a/backend/node_modules/buffer-equal-constant-time/LICENSE.txt b/backend/node_modules/buffer-equal-constant-time/LICENSE.txt new file mode 100644 index 000000000..9a064f3f4 --- /dev/null +++ b/backend/node_modules/buffer-equal-constant-time/LICENSE.txt @@ -0,0 +1,12 @@ +Copyright (c) 2013, GoInstant Inc., a salesforce.com company +All rights reserved. + +Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met: + +* Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer. + +* Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution. + +* Neither the name of salesforce.com, nor GoInstant, nor the names of its contributors may be used to endorse or promote products derived from this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/backend/node_modules/buffer-equal-constant-time/README.md b/backend/node_modules/buffer-equal-constant-time/README.md new file mode 100644 index 000000000..4f227f58b --- /dev/null +++ b/backend/node_modules/buffer-equal-constant-time/README.md @@ -0,0 +1,50 @@ +# buffer-equal-constant-time + +Constant-time `Buffer` comparison for node.js. Should work with browserify too. + +[![Build Status](https://travis-ci.org/goinstant/buffer-equal-constant-time.png?branch=master)](https://travis-ci.org/goinstant/buffer-equal-constant-time) + +```sh + npm install buffer-equal-constant-time +``` + +# Usage + +```js + var bufferEq = require('buffer-equal-constant-time'); + + var a = new Buffer('asdf'); + var b = new Buffer('asdf'); + if (bufferEq(a,b)) { + // the same! + } else { + // different in at least one byte! + } +``` + +If you'd like to install an `.equal()` method onto the node.js `Buffer` and +`SlowBuffer` prototypes: + +```js + require('buffer-equal-constant-time').install(); + + var a = new Buffer('asdf'); + var b = new Buffer('asdf'); + if (a.equal(b)) { + // the same! + } else { + // different in at least one byte! + } +``` + +To get rid of the installed `.equal()` method, call `.restore()`: + +```js + require('buffer-equal-constant-time').restore(); +``` + +# Legal + +© 2013 GoInstant Inc., a salesforce.com company + +Licensed under the BSD 3-clause license. diff --git a/backend/node_modules/buffer-equal-constant-time/index.js b/backend/node_modules/buffer-equal-constant-time/index.js new file mode 100644 index 000000000..5462c1f83 --- /dev/null +++ b/backend/node_modules/buffer-equal-constant-time/index.js @@ -0,0 +1,41 @@ +/*jshint node:true */ +'use strict'; +var Buffer = require('buffer').Buffer; // browserify +var SlowBuffer = require('buffer').SlowBuffer; + +module.exports = bufferEq; + +function bufferEq(a, b) { + + // shortcutting on type is necessary for correctness + if (!Buffer.isBuffer(a) || !Buffer.isBuffer(b)) { + return false; + } + + // buffer sizes should be well-known information, so despite this + // shortcutting, it doesn't leak any information about the *contents* of the + // buffers. + if (a.length !== b.length) { + return false; + } + + var c = 0; + for (var i = 0; i < a.length; i++) { + /*jshint bitwise:false */ + c |= a[i] ^ b[i]; // XOR + } + return c === 0; +} + +bufferEq.install = function() { + Buffer.prototype.equal = SlowBuffer.prototype.equal = function equal(that) { + return bufferEq(this, that); + }; +}; + +var origBufEqual = Buffer.prototype.equal; +var origSlowBufEqual = SlowBuffer.prototype.equal; +bufferEq.restore = function() { + Buffer.prototype.equal = origBufEqual; + SlowBuffer.prototype.equal = origSlowBufEqual; +}; diff --git a/backend/node_modules/buffer-equal-constant-time/package.json b/backend/node_modules/buffer-equal-constant-time/package.json new file mode 100644 index 000000000..17c7de22c --- /dev/null +++ b/backend/node_modules/buffer-equal-constant-time/package.json @@ -0,0 +1,21 @@ +{ + "name": "buffer-equal-constant-time", + "version": "1.0.1", + "description": "Constant-time comparison of Buffers", + "main": "index.js", + "scripts": { + "test": "mocha test.js" + }, + "repository": "git@github.com:goinstant/buffer-equal-constant-time.git", + "keywords": [ + "buffer", + "equal", + "constant-time", + "crypto" + ], + "author": "GoInstant Inc., a salesforce.com company", + "license": "BSD-3-Clause", + "devDependencies": { + "mocha": "~1.15.1" + } +} diff --git a/backend/node_modules/buffer-equal-constant-time/test.js b/backend/node_modules/buffer-equal-constant-time/test.js new file mode 100644 index 000000000..0bc972d84 --- /dev/null +++ b/backend/node_modules/buffer-equal-constant-time/test.js @@ -0,0 +1,42 @@ +/*jshint node:true */ +'use strict'; + +var bufferEq = require('./index'); +var assert = require('assert'); + +describe('buffer-equal-constant-time', function() { + var a = new Buffer('asdfasdf123456'); + var b = new Buffer('asdfasdf123456'); + var c = new Buffer('asdfasdf'); + + describe('bufferEq', function() { + it('says a == b', function() { + assert.strictEqual(bufferEq(a, b), true); + }); + + it('says a != c', function() { + assert.strictEqual(bufferEq(a, c), false); + }); + }); + + describe('install/restore', function() { + before(function() { + bufferEq.install(); + }); + after(function() { + bufferEq.restore(); + }); + + it('installed an .equal method', function() { + var SlowBuffer = require('buffer').SlowBuffer; + assert.ok(Buffer.prototype.equal); + assert.ok(SlowBuffer.prototype.equal); + }); + + it('infected existing Buffers', function() { + assert.strictEqual(a.equal(b), true); + assert.strictEqual(a.equal(c), false); + }); + }); + +}); diff --git a/backend/node_modules/bytes/History.md b/backend/node_modules/bytes/History.md new file mode 100644 index 000000000..d60ce0e6d --- /dev/null +++ b/backend/node_modules/bytes/History.md @@ -0,0 +1,97 @@ +3.1.2 / 2022-01-27 +================== + + * Fix return value for un-parsable strings + +3.1.1 / 2021-11-15 +================== + + * Fix "thousandsSeparator" incorrecting formatting fractional part + +3.1.0 / 2019-01-22 +================== + + * Add petabyte (`pb`) support + +3.0.0 / 2017-08-31 +================== + + * Change "kB" to "KB" in format output + * Remove support for Node.js 0.6 + * Remove support for ComponentJS + +2.5.0 / 2017-03-24 +================== + + * Add option "unit" + +2.4.0 / 2016-06-01 +================== + + * Add option "unitSeparator" + +2.3.0 / 2016-02-15 +================== + + * Drop partial bytes on all parsed units + * Fix non-finite numbers to `.format` to return `null` + * Fix parsing byte string that looks like hex + * perf: hoist regular expressions + +2.2.0 / 2015-11-13 +================== + + * add option "decimalPlaces" + * add option "fixedDecimals" + +2.1.0 / 2015-05-21 +================== + + * add `.format` export + * add `.parse` export + +2.0.2 / 2015-05-20 +================== + + * remove map recreation + * remove unnecessary object construction + +2.0.1 / 2015-05-07 +================== + + * fix browserify require + * remove node.extend dependency + +2.0.0 / 2015-04-12 +================== + + * add option "case" + * add option "thousandsSeparator" + * return "null" on invalid parse input + * support proper round-trip: bytes(bytes(num)) === num + * units no longer case sensitive when parsing + +1.0.0 / 2014-05-05 +================== + + * add negative support. fixes #6 + +0.3.0 / 2014-03-19 +================== + + * added terabyte support + +0.2.1 / 2013-04-01 +================== + + * add .component + +0.2.0 / 2012-10-28 +================== + + * bytes(200).should.eql('200b') + +0.1.0 / 2012-07-04 +================== + + * add bytes to string conversion [yields] diff --git a/backend/node_modules/bytes/LICENSE b/backend/node_modules/bytes/LICENSE new file mode 100644 index 000000000..63e95a963 --- /dev/null +++ b/backend/node_modules/bytes/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012-2014 TJ Holowaychuk +Copyright (c) 2015 Jed Watson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/backend/node_modules/bytes/Readme.md b/backend/node_modules/bytes/Readme.md new file mode 100644 index 000000000..5790e23e3 --- /dev/null +++ b/backend/node_modules/bytes/Readme.md @@ -0,0 +1,152 @@ +# Bytes utility + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][ci-image]][ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Utility to parse a string bytes (ex: `1TB`) to bytes (`1099511627776`) and vice-versa. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install bytes +``` + +## Usage + +```js +var bytes = require('bytes'); +``` + +#### bytes(number|string value, [options]): number|string|null + +Default export function. Delegates to either `bytes.format` or `bytes.parse` based on the type of `value`. + +**Arguments** + +| Name | Type | Description | +|---------|----------|--------------------| +| value | `number`|`string` | Number value to format or string value to parse | +| options | `Object` | Conversion options for `format` | + +**Returns** + +| Name | Type | Description | +|---------|------------------|-------------------------------------------------| +| results | `string`|`number`|`null` | Return null upon error. Numeric value in bytes, or string value otherwise. | + +**Example** + +```js +bytes(1024); +// output: '1KB' + +bytes('1KB'); +// output: 1024 +``` + +#### bytes.format(number value, [options]): string|null + +Format the given value in bytes into a string. If the value is negative, it is kept as such. If it is a float, it is + rounded. + +**Arguments** + +| Name | Type | Description | +|---------|----------|--------------------| +| value | `number` | Value in bytes | +| options | `Object` | Conversion options | + +**Options** + +| Property | Type | Description | +|-------------------|--------|-----------------------------------------------------------------------------------------| +| decimalPlaces | `number`|`null` | Maximum number of decimal places to include in output. Default value to `2`. | +| fixedDecimals | `boolean`|`null` | Whether to always display the maximum number of decimal places. Default value to `false` | +| thousandsSeparator | `string`|`null` | Example of values: `' '`, `','` and `'.'`... Default value to `''`. | +| unit | `string`|`null` | The unit in which the result will be returned (B/KB/MB/GB/TB). Default value to `''` (which means auto detect). | +| unitSeparator | `string`|`null` | Separator to use between number and unit. Default value to `''`. | + +**Returns** + +| Name | Type | Description | +|---------|------------------|-------------------------------------------------| +| results | `string`|`null` | Return null upon error. String value otherwise. | + +**Example** + +```js +bytes.format(1024); +// output: '1KB' + +bytes.format(1000); +// output: '1000B' + +bytes.format(1000, {thousandsSeparator: ' '}); +// output: '1 000B' + +bytes.format(1024 * 1.7, {decimalPlaces: 0}); +// output: '2KB' + +bytes.format(1024, {unitSeparator: ' '}); +// output: '1 KB' +``` + +#### bytes.parse(string|number value): number|null + +Parse the string value into an integer in bytes. If no unit is given, or `value` +is a number, it is assumed the value is in bytes. + +Supported units and abbreviations are as follows and are case-insensitive: + + * `b` for bytes + * `kb` for kilobytes + * `mb` for megabytes + * `gb` for gigabytes + * `tb` for terabytes + * `pb` for petabytes + +The units are in powers of two, not ten. This means 1kb = 1024b according to this parser. + +**Arguments** + +| Name | Type | Description | +|---------------|--------|--------------------| +| value | `string`|`number` | String to parse, or number in bytes. | + +**Returns** + +| Name | Type | Description | +|---------|-------------|-------------------------| +| results | `number`|`null` | Return null upon error. Value in bytes otherwise. | + +**Example** + +```js +bytes.parse('1KB'); +// output: 1024 + +bytes.parse('1024'); +// output: 1024 + +bytes.parse(1024); +// output: 1024 +``` + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/visionmedia/bytes.js/master?label=ci +[ci-url]: https://github.com/visionmedia/bytes.js/actions?query=workflow%3Aci +[coveralls-image]: https://badgen.net/coveralls/c/github/visionmedia/bytes.js/master +[coveralls-url]: https://coveralls.io/r/visionmedia/bytes.js?branch=master +[downloads-image]: https://badgen.net/npm/dm/bytes +[downloads-url]: https://npmjs.org/package/bytes +[npm-image]: https://badgen.net/npm/v/bytes +[npm-url]: https://npmjs.org/package/bytes diff --git a/backend/node_modules/bytes/index.js b/backend/node_modules/bytes/index.js new file mode 100644 index 000000000..6f2d0f89e --- /dev/null +++ b/backend/node_modules/bytes/index.js @@ -0,0 +1,170 @@ +/*! + * bytes + * Copyright(c) 2012-2014 TJ Holowaychuk + * Copyright(c) 2015 Jed Watson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = bytes; +module.exports.format = format; +module.exports.parse = parse; + +/** + * Module variables. + * @private + */ + +var formatThousandsRegExp = /\B(?=(\d{3})+(?!\d))/g; + +var formatDecimalsRegExp = /(?:\.0*|(\.[^0]+)0+)$/; + +var map = { + b: 1, + kb: 1 << 10, + mb: 1 << 20, + gb: 1 << 30, + tb: Math.pow(1024, 4), + pb: Math.pow(1024, 5), +}; + +var parseRegExp = /^((-|\+)?(\d+(?:\.\d+)?)) *(kb|mb|gb|tb|pb)$/i; + +/** + * Convert the given value in bytes into a string or parse to string to an integer in bytes. + * + * @param {string|number} value + * @param {{ + * case: [string], + * decimalPlaces: [number] + * fixedDecimals: [boolean] + * thousandsSeparator: [string] + * unitSeparator: [string] + * }} [options] bytes options. + * + * @returns {string|number|null} + */ + +function bytes(value, options) { + if (typeof value === 'string') { + return parse(value); + } + + if (typeof value === 'number') { + return format(value, options); + } + + return null; +} + +/** + * Format the given value in bytes into a string. + * + * If the value is negative, it is kept as such. If it is a float, + * it is rounded. + * + * @param {number} value + * @param {object} [options] + * @param {number} [options.decimalPlaces=2] + * @param {number} [options.fixedDecimals=false] + * @param {string} [options.thousandsSeparator=] + * @param {string} [options.unit=] + * @param {string} [options.unitSeparator=] + * + * @returns {string|null} + * @public + */ + +function format(value, options) { + if (!Number.isFinite(value)) { + return null; + } + + var mag = Math.abs(value); + var thousandsSeparator = (options && options.thousandsSeparator) || ''; + var unitSeparator = (options && options.unitSeparator) || ''; + var decimalPlaces = (options && options.decimalPlaces !== undefined) ? options.decimalPlaces : 2; + var fixedDecimals = Boolean(options && options.fixedDecimals); + var unit = (options && options.unit) || ''; + + if (!unit || !map[unit.toLowerCase()]) { + if (mag >= map.pb) { + unit = 'PB'; + } else if (mag >= map.tb) { + unit = 'TB'; + } else if (mag >= map.gb) { + unit = 'GB'; + } else if (mag >= map.mb) { + unit = 'MB'; + } else if (mag >= map.kb) { + unit = 'KB'; + } else { + unit = 'B'; + } + } + + var val = value / map[unit.toLowerCase()]; + var str = val.toFixed(decimalPlaces); + + if (!fixedDecimals) { + str = str.replace(formatDecimalsRegExp, '$1'); + } + + if (thousandsSeparator) { + str = str.split('.').map(function (s, i) { + return i === 0 + ? s.replace(formatThousandsRegExp, thousandsSeparator) + : s + }).join('.'); + } + + return str + unitSeparator + unit; +} + +/** + * Parse the string value into an integer in bytes. + * + * If no unit is given, it is assumed the value is in bytes. + * + * @param {number|string} val + * + * @returns {number|null} + * @public + */ + +function parse(val) { + if (typeof val === 'number' && !isNaN(val)) { + return val; + } + + if (typeof val !== 'string') { + return null; + } + + // Test if the string passed is valid + var results = parseRegExp.exec(val); + var floatValue; + var unit = 'b'; + + if (!results) { + // Nothing could be extracted from the given string + floatValue = parseInt(val, 10); + unit = 'b' + } else { + // Retrieve the value and the unit + floatValue = parseFloat(results[1]); + unit = results[4].toLowerCase(); + } + + if (isNaN(floatValue)) { + return null; + } + + return Math.floor(map[unit] * floatValue); +} diff --git a/backend/node_modules/bytes/package.json b/backend/node_modules/bytes/package.json new file mode 100644 index 000000000..f2b6a8b0e --- /dev/null +++ b/backend/node_modules/bytes/package.json @@ -0,0 +1,42 @@ +{ + "name": "bytes", + "description": "Utility to parse a string bytes to bytes and vice-versa", + "version": "3.1.2", + "author": "TJ Holowaychuk (http://tjholowaychuk.com)", + "contributors": [ + "Jed Watson ", + "Théo FIDRY " + ], + "license": "MIT", + "keywords": [ + "byte", + "bytes", + "utility", + "parse", + "parser", + "convert", + "converter" + ], + "repository": "visionmedia/bytes.js", + "devDependencies": { + "eslint": "7.32.0", + "eslint-plugin-markdown": "2.2.1", + "mocha": "9.2.0", + "nyc": "15.1.0" + }, + "files": [ + "History.md", + "LICENSE", + "Readme.md", + "index.js" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --check-leaks --reporter spec", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + } +} diff --git a/backend/node_modules/call-bind-apply-helpers/.eslintrc b/backend/node_modules/call-bind-apply-helpers/.eslintrc new file mode 100644 index 000000000..201e859be --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/.eslintrc @@ -0,0 +1,17 @@ +{ + "root": true, + + "extends": "@ljharb", + + "rules": { + "func-name-matching": 0, + "id-length": 0, + "new-cap": [2, { + "capIsNewExceptions": [ + "GetIntrinsic", + ], + }], + "no-extra-parens": 0, + "no-magic-numbers": 0, + }, +} diff --git a/backend/node_modules/call-bind-apply-helpers/.github/FUNDING.yml b/backend/node_modules/call-bind-apply-helpers/.github/FUNDING.yml new file mode 100644 index 000000000..0011e9d65 --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/.github/FUNDING.yml @@ -0,0 +1,12 @@ +# These are supported funding model platforms + +github: [ljharb] +patreon: # Replace with a single Patreon username +open_collective: # Replace with a single Open Collective username +ko_fi: # Replace with a single Ko-fi username +tidelift: npm/call-bind-apply-helpers +community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry +liberapay: # Replace with a single Liberapay username +issuehunt: # Replace with a single IssueHunt username +otechie: # Replace with a single Otechie username +custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2'] diff --git a/backend/node_modules/call-bind-apply-helpers/.nycrc b/backend/node_modules/call-bind-apply-helpers/.nycrc new file mode 100644 index 000000000..bdd626ce9 --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/.nycrc @@ -0,0 +1,9 @@ +{ + "all": true, + "check-coverage": false, + "reporter": ["text-summary", "text", "html", "json"], + "exclude": [ + "coverage", + "test" + ] +} diff --git a/backend/node_modules/call-bind-apply-helpers/CHANGELOG.md b/backend/node_modules/call-bind-apply-helpers/CHANGELOG.md new file mode 100644 index 000000000..24849428b --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/CHANGELOG.md @@ -0,0 +1,30 @@ +# Changelog + +All notable changes to this project will be documented in this file. + +The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/) +and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). + +## [v1.0.2](https://github.com/ljharb/call-bind-apply-helpers/compare/v1.0.1...v1.0.2) - 2025-02-12 + +### Commits + +- [types] improve inferred types [`e6f9586`](https://github.com/ljharb/call-bind-apply-helpers/commit/e6f95860a3c72879cb861a858cdfb8138fbedec1) +- [Dev Deps] update `@arethetypeswrong/cli`, `@ljharb/tsconfig`, `@types/tape`, `es-value-fixtures`, `for-each`, `has-strict-mode`, `object-inspect` [`e43d540`](https://github.com/ljharb/call-bind-apply-helpers/commit/e43d5409f97543bfbb11f345d47d8ce4e066d8c1) + +## [v1.0.1](https://github.com/ljharb/call-bind-apply-helpers/compare/v1.0.0...v1.0.1) - 2024-12-08 + +### Commits + +- [types] `reflectApply`: fix types [`4efc396`](https://github.com/ljharb/call-bind-apply-helpers/commit/4efc3965351a4f02cc55e836fa391d3d11ef2ef8) +- [Fix] `reflectApply`: oops, Reflect is not a function [`83cc739`](https://github.com/ljharb/call-bind-apply-helpers/commit/83cc7395de6b79b7730bdf092f1436f0b1263c75) +- [Dev Deps] update `@arethetypeswrong/cli` [`80bd5d3`](https://github.com/ljharb/call-bind-apply-helpers/commit/80bd5d3ae58b4f6b6995ce439dd5a1bcb178a940) + +## v1.0.0 - 2024-12-05 + +### Commits + +- Initial implementation, tests, readme [`7879629`](https://github.com/ljharb/call-bind-apply-helpers/commit/78796290f9b7430c9934d6f33d94ae9bc89fce04) +- Initial commit [`3f1dc16`](https://github.com/ljharb/call-bind-apply-helpers/commit/3f1dc164afc43285631b114a5f9dd9137b2b952f) +- npm init [`081df04`](https://github.com/ljharb/call-bind-apply-helpers/commit/081df048c312fcee400922026f6e97281200a603) +- Only apps should have lockfiles [`5b9ca0f`](https://github.com/ljharb/call-bind-apply-helpers/commit/5b9ca0fe8101ebfaf309c549caac4e0a017ed930) diff --git a/backend/node_modules/call-bind-apply-helpers/LICENSE b/backend/node_modules/call-bind-apply-helpers/LICENSE new file mode 100644 index 000000000..f82f38963 --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2024 Jordan Harband + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/backend/node_modules/call-bind-apply-helpers/README.md b/backend/node_modules/call-bind-apply-helpers/README.md new file mode 100644 index 000000000..8fc0dae1b --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/README.md @@ -0,0 +1,62 @@ +# call-bind-apply-helpers [![Version Badge][npm-version-svg]][package-url] + +[![github actions][actions-image]][actions-url] +[![coverage][codecov-image]][codecov-url] +[![dependency status][deps-svg]][deps-url] +[![dev dependency status][dev-deps-svg]][dev-deps-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] + +[![npm badge][npm-badge-png]][package-url] + +Helper functions around Function call/apply/bind, for use in `call-bind`. + +The only packages that should likely ever use this package directly are `call-bind` and `get-intrinsic`. +Please use `call-bind` unless you have a very good reason not to. + +## Getting started + +```sh +npm install --save call-bind-apply-helpers +``` + +## Usage/Examples + +```js +const assert = require('assert'); +const callBindBasic = require('call-bind-apply-helpers'); + +function f(a, b) { + assert.equal(this, 1); + assert.equal(a, 2); + assert.equal(b, 3); + assert.equal(arguments.length, 2); +} + +const fBound = callBindBasic([f, 1]); + +delete Function.prototype.call; +delete Function.prototype.bind; + +fBound(2, 3); +``` + +## Tests + +Clone the repo, `npm install`, and run `npm test` + +[package-url]: https://npmjs.org/package/call-bind-apply-helpers +[npm-version-svg]: https://versionbadg.es/ljharb/call-bind-apply-helpers.svg +[deps-svg]: https://david-dm.org/ljharb/call-bind-apply-helpers.svg +[deps-url]: https://david-dm.org/ljharb/call-bind-apply-helpers +[dev-deps-svg]: https://david-dm.org/ljharb/call-bind-apply-helpers/dev-status.svg +[dev-deps-url]: https://david-dm.org/ljharb/call-bind-apply-helpers#info=devDependencies +[npm-badge-png]: https://nodei.co/npm/call-bind-apply-helpers.png?downloads=true&stars=true +[license-image]: https://img.shields.io/npm/l/call-bind-apply-helpers.svg +[license-url]: LICENSE +[downloads-image]: https://img.shields.io/npm/dm/call-bind-apply-helpers.svg +[downloads-url]: https://npm-stat.com/charts.html?package=call-bind-apply-helpers +[codecov-image]: https://codecov.io/gh/ljharb/call-bind-apply-helpers/branch/main/graphs/badge.svg +[codecov-url]: https://app.codecov.io/gh/ljharb/call-bind-apply-helpers/ +[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/call-bind-apply-helpers +[actions-url]: https://github.com/ljharb/call-bind-apply-helpers/actions diff --git a/backend/node_modules/call-bind-apply-helpers/actualApply.d.ts b/backend/node_modules/call-bind-apply-helpers/actualApply.d.ts new file mode 100644 index 000000000..b87286a21 --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/actualApply.d.ts @@ -0,0 +1 @@ +export = Reflect.apply; \ No newline at end of file diff --git a/backend/node_modules/call-bind-apply-helpers/actualApply.js b/backend/node_modules/call-bind-apply-helpers/actualApply.js new file mode 100644 index 000000000..ffa51355d --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/actualApply.js @@ -0,0 +1,10 @@ +'use strict'; + +var bind = require('function-bind'); + +var $apply = require('./functionApply'); +var $call = require('./functionCall'); +var $reflectApply = require('./reflectApply'); + +/** @type {import('./actualApply')} */ +module.exports = $reflectApply || bind.call($call, $apply); diff --git a/backend/node_modules/call-bind-apply-helpers/applyBind.d.ts b/backend/node_modules/call-bind-apply-helpers/applyBind.d.ts new file mode 100644 index 000000000..d176c1ab3 --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/applyBind.d.ts @@ -0,0 +1,19 @@ +import actualApply from './actualApply'; + +type TupleSplitHead = T['length'] extends N + ? T + : T extends [...infer R, any] + ? TupleSplitHead + : never + +type TupleSplitTail = O['length'] extends N + ? T + : T extends [infer F, ...infer R] + ? TupleSplitTail<[...R], N, [...O, F]> + : never + +type TupleSplit = [TupleSplitHead, TupleSplitTail] + +declare function applyBind(...args: TupleSplit, 2>[1]): ReturnType; + +export = applyBind; \ No newline at end of file diff --git a/backend/node_modules/call-bind-apply-helpers/applyBind.js b/backend/node_modules/call-bind-apply-helpers/applyBind.js new file mode 100644 index 000000000..d2b772314 --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/applyBind.js @@ -0,0 +1,10 @@ +'use strict'; + +var bind = require('function-bind'); +var $apply = require('./functionApply'); +var actualApply = require('./actualApply'); + +/** @type {import('./applyBind')} */ +module.exports = function applyBind() { + return actualApply(bind, $apply, arguments); +}; diff --git a/backend/node_modules/call-bind-apply-helpers/functionApply.d.ts b/backend/node_modules/call-bind-apply-helpers/functionApply.d.ts new file mode 100644 index 000000000..1f6e11b3d --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/functionApply.d.ts @@ -0,0 +1 @@ +export = Function.prototype.apply; \ No newline at end of file diff --git a/backend/node_modules/call-bind-apply-helpers/functionApply.js b/backend/node_modules/call-bind-apply-helpers/functionApply.js new file mode 100644 index 000000000..c71df9c2b --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/functionApply.js @@ -0,0 +1,4 @@ +'use strict'; + +/** @type {import('./functionApply')} */ +module.exports = Function.prototype.apply; diff --git a/backend/node_modules/call-bind-apply-helpers/functionCall.d.ts b/backend/node_modules/call-bind-apply-helpers/functionCall.d.ts new file mode 100644 index 000000000..15e93df35 --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/functionCall.d.ts @@ -0,0 +1 @@ +export = Function.prototype.call; \ No newline at end of file diff --git a/backend/node_modules/call-bind-apply-helpers/functionCall.js b/backend/node_modules/call-bind-apply-helpers/functionCall.js new file mode 100644 index 000000000..7a8d87357 --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/functionCall.js @@ -0,0 +1,4 @@ +'use strict'; + +/** @type {import('./functionCall')} */ +module.exports = Function.prototype.call; diff --git a/backend/node_modules/call-bind-apply-helpers/index.d.ts b/backend/node_modules/call-bind-apply-helpers/index.d.ts new file mode 100644 index 000000000..541516bd0 --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/index.d.ts @@ -0,0 +1,64 @@ +type RemoveFromTuple< + Tuple extends readonly unknown[], + RemoveCount extends number, + Index extends 1[] = [] +> = Index["length"] extends RemoveCount + ? Tuple + : Tuple extends [infer First, ...infer Rest] + ? RemoveFromTuple + : Tuple; + +type ConcatTuples< + Prefix extends readonly unknown[], + Suffix extends readonly unknown[] +> = [...Prefix, ...Suffix]; + +type ExtractFunctionParams = T extends (this: infer TThis, ...args: infer P extends readonly unknown[]) => infer R + ? { thisArg: TThis; params: P; returnType: R } + : never; + +type BindFunction< + T extends (this: any, ...args: any[]) => any, + TThis, + TBoundArgs extends readonly unknown[], + ReceiverBound extends boolean +> = ExtractFunctionParams extends { + thisArg: infer OrigThis; + params: infer P extends readonly unknown[]; + returnType: infer R; +} + ? ReceiverBound extends true + ? (...args: RemoveFromTuple>) => R extends [OrigThis, ...infer Rest] + ? [TThis, ...Rest] // Replace `this` with `thisArg` + : R + : >>( + thisArg: U, + ...args: RemainingArgs + ) => R extends [OrigThis, ...infer Rest] + ? [U, ...ConcatTuples] // Preserve bound args in return type + : R + : never; + +declare function callBind< + const T extends (this: any, ...args: any[]) => any, + Extracted extends ExtractFunctionParams, + const TBoundArgs extends Partial & readonly unknown[], + const TThis extends Extracted["thisArg"] +>( + args: [fn: T, thisArg: TThis, ...boundArgs: TBoundArgs] +): BindFunction; + +declare function callBind< + const T extends (this: any, ...args: any[]) => any, + Extracted extends ExtractFunctionParams, + const TBoundArgs extends Partial & readonly unknown[] +>( + args: [fn: T, ...boundArgs: TBoundArgs] +): BindFunction; + +declare function callBind( + args: [fn: Exclude, ...rest: TArgs] +): never; + +// export as namespace callBind; +export = callBind; diff --git a/backend/node_modules/call-bind-apply-helpers/index.js b/backend/node_modules/call-bind-apply-helpers/index.js new file mode 100644 index 000000000..2f6dab4c1 --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/index.js @@ -0,0 +1,15 @@ +'use strict'; + +var bind = require('function-bind'); +var $TypeError = require('es-errors/type'); + +var $call = require('./functionCall'); +var $actualApply = require('./actualApply'); + +/** @type {(args: [Function, thisArg?: unknown, ...args: unknown[]]) => Function} TODO FIXME, find a way to use import('.') */ +module.exports = function callBindBasic(args) { + if (args.length < 1 || typeof args[0] !== 'function') { + throw new $TypeError('a function is required'); + } + return $actualApply(bind, $call, args); +}; diff --git a/backend/node_modules/call-bind-apply-helpers/package.json b/backend/node_modules/call-bind-apply-helpers/package.json new file mode 100644 index 000000000..923b8be2f --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/package.json @@ -0,0 +1,85 @@ +{ + "name": "call-bind-apply-helpers", + "version": "1.0.2", + "description": "Helper functions around Function call/apply/bind, for use in `call-bind`", + "main": "index.js", + "exports": { + ".": "./index.js", + "./actualApply": "./actualApply.js", + "./applyBind": "./applyBind.js", + "./functionApply": "./functionApply.js", + "./functionCall": "./functionCall.js", + "./reflectApply": "./reflectApply.js", + "./package.json": "./package.json" + }, + "scripts": { + "prepack": "npmignore --auto --commentLines=auto", + "prepublish": "not-in-publish || npm run prepublishOnly", + "prepublishOnly": "safe-publish-latest", + "prelint": "evalmd README.md", + "lint": "eslint --ext=.js,.mjs .", + "postlint": "tsc -p . && attw -P", + "pretest": "npm run lint", + "tests-only": "nyc tape 'test/**/*.js'", + "test": "npm run tests-only", + "posttest": "npx npm@'>=10.2' audit --production", + "version": "auto-changelog && git add CHANGELOG.md", + "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\"" + }, + "repository": { + "type": "git", + "url": "git+https://github.com/ljharb/call-bind-apply-helpers.git" + }, + "author": "Jordan Harband ", + "license": "MIT", + "bugs": { + "url": "https://github.com/ljharb/call-bind-apply-helpers/issues" + }, + "homepage": "https://github.com/ljharb/call-bind-apply-helpers#readme", + "dependencies": { + "es-errors": "^1.3.0", + "function-bind": "^1.1.2" + }, + "devDependencies": { + "@arethetypeswrong/cli": "^0.17.3", + "@ljharb/eslint-config": "^21.1.1", + "@ljharb/tsconfig": "^0.2.3", + "@types/for-each": "^0.3.3", + "@types/function-bind": "^1.1.10", + "@types/object-inspect": "^1.13.0", + "@types/tape": "^5.8.1", + "auto-changelog": "^2.5.0", + "encoding": "^0.1.13", + "es-value-fixtures": "^1.7.1", + "eslint": "=8.8.0", + "evalmd": "^0.0.19", + "for-each": "^0.3.5", + "has-strict-mode": "^1.1.0", + "in-publish": "^2.0.1", + "npmignore": "^0.3.1", + "nyc": "^10.3.2", + "object-inspect": "^1.13.4", + "safe-publish-latest": "^2.0.0", + "tape": "^5.9.0", + "typescript": "next" + }, + "testling": { + "files": "test/index.js" + }, + "auto-changelog": { + "output": "CHANGELOG.md", + "template": "keepachangelog", + "unreleased": false, + "commitLimit": false, + "backfillLimit": false, + "hideCredit": true + }, + "publishConfig": { + "ignore": [ + ".github/workflows" + ] + }, + "engines": { + "node": ">= 0.4" + } +} diff --git a/backend/node_modules/call-bind-apply-helpers/reflectApply.d.ts b/backend/node_modules/call-bind-apply-helpers/reflectApply.d.ts new file mode 100644 index 000000000..6b2ae764c --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/reflectApply.d.ts @@ -0,0 +1,3 @@ +declare const reflectApply: false | typeof Reflect.apply; + +export = reflectApply; diff --git a/backend/node_modules/call-bind-apply-helpers/reflectApply.js b/backend/node_modules/call-bind-apply-helpers/reflectApply.js new file mode 100644 index 000000000..3d03caa69 --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/reflectApply.js @@ -0,0 +1,4 @@ +'use strict'; + +/** @type {import('./reflectApply')} */ +module.exports = typeof Reflect !== 'undefined' && Reflect && Reflect.apply; diff --git a/backend/node_modules/call-bind-apply-helpers/test/index.js b/backend/node_modules/call-bind-apply-helpers/test/index.js new file mode 100644 index 000000000..1cdc89ed4 --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/test/index.js @@ -0,0 +1,63 @@ +'use strict'; + +var callBind = require('../'); +var hasStrictMode = require('has-strict-mode')(); +var forEach = require('for-each'); +var inspect = require('object-inspect'); +var v = require('es-value-fixtures'); + +var test = require('tape'); + +test('callBindBasic', function (t) { + forEach(v.nonFunctions, function (nonFunction) { + t['throws']( + // @ts-expect-error + function () { callBind([nonFunction]); }, + TypeError, + inspect(nonFunction) + ' is not a function' + ); + }); + + var sentinel = { sentinel: true }; + /** @type {(this: T, a: A, b: B) => [T | undefined, A, B]} */ + var func = function (a, b) { + // eslint-disable-next-line no-invalid-this + return [!hasStrictMode && this === global ? undefined : this, a, b]; + }; + t.equal(func.length, 2, 'original function length is 2'); + + /** type {(thisArg: unknown, a: number, b: number) => [unknown, number, number]} */ + var bound = callBind([func]); + /** type {((a: number, b: number) => [typeof sentinel, typeof a, typeof b])} */ + var boundR = callBind([func, sentinel]); + /** type {((b: number) => [typeof sentinel, number, typeof b])} */ + var boundArg = callBind([func, sentinel, /** @type {const} */ (1)]); + + // @ts-expect-error + t.deepEqual(bound(), [undefined, undefined, undefined], 'bound func with no args'); + + // @ts-expect-error + t.deepEqual(func(), [undefined, undefined, undefined], 'unbound func with too few args'); + // @ts-expect-error + t.deepEqual(bound(1, 2), [hasStrictMode ? 1 : Object(1), 2, undefined], 'bound func too few args'); + // @ts-expect-error + t.deepEqual(boundR(), [sentinel, undefined, undefined], 'bound func with receiver, with too few args'); + // @ts-expect-error + t.deepEqual(boundArg(), [sentinel, 1, undefined], 'bound func with receiver and arg, with too few args'); + + t.deepEqual(func(1, 2), [undefined, 1, 2], 'unbound func with right args'); + t.deepEqual(bound(1, 2, 3), [hasStrictMode ? 1 : Object(1), 2, 3], 'bound func with right args'); + t.deepEqual(boundR(1, 2), [sentinel, 1, 2], 'bound func with receiver, with right args'); + t.deepEqual(boundArg(2), [sentinel, 1, 2], 'bound func with receiver and arg, with right arg'); + + // @ts-expect-error + t.deepEqual(func(1, 2, 3), [undefined, 1, 2], 'unbound func with too many args'); + // @ts-expect-error + t.deepEqual(bound(1, 2, 3, 4), [hasStrictMode ? 1 : Object(1), 2, 3], 'bound func with too many args'); + // @ts-expect-error + t.deepEqual(boundR(1, 2, 3), [sentinel, 1, 2], 'bound func with receiver, with too many args'); + // @ts-expect-error + t.deepEqual(boundArg(2, 3), [sentinel, 1, 2], 'bound func with receiver and arg, with too many args'); + + t.end(); +}); diff --git a/backend/node_modules/call-bind-apply-helpers/tsconfig.json b/backend/node_modules/call-bind-apply-helpers/tsconfig.json new file mode 100644 index 000000000..aef999308 --- /dev/null +++ b/backend/node_modules/call-bind-apply-helpers/tsconfig.json @@ -0,0 +1,9 @@ +{ + "extends": "@ljharb/tsconfig", + "compilerOptions": { + "target": "es2021", + }, + "exclude": [ + "coverage", + ], +} \ No newline at end of file diff --git a/backend/node_modules/call-bound/.eslintrc b/backend/node_modules/call-bound/.eslintrc new file mode 100644 index 000000000..2612ed8fe --- /dev/null +++ b/backend/node_modules/call-bound/.eslintrc @@ -0,0 +1,13 @@ +{ + "root": true, + + "extends": "@ljharb", + + "rules": { + "new-cap": [2, { + "capIsNewExceptions": [ + "GetIntrinsic", + ], + }], + }, +} diff --git a/backend/node_modules/call-bound/.github/FUNDING.yml b/backend/node_modules/call-bound/.github/FUNDING.yml new file mode 100644 index 000000000..2a2a13571 --- /dev/null +++ b/backend/node_modules/call-bound/.github/FUNDING.yml @@ -0,0 +1,12 @@ +# These are supported funding model platforms + +github: [ljharb] +patreon: # Replace with a single Patreon username +open_collective: # Replace with a single Open Collective username +ko_fi: # Replace with a single Ko-fi username +tidelift: npm/call-bound +community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry +liberapay: # Replace with a single Liberapay username +issuehunt: # Replace with a single IssueHunt username +otechie: # Replace with a single Otechie username +custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2'] diff --git a/backend/node_modules/call-bound/.nycrc b/backend/node_modules/call-bound/.nycrc new file mode 100644 index 000000000..bdd626ce9 --- /dev/null +++ b/backend/node_modules/call-bound/.nycrc @@ -0,0 +1,9 @@ +{ + "all": true, + "check-coverage": false, + "reporter": ["text-summary", "text", "html", "json"], + "exclude": [ + "coverage", + "test" + ] +} diff --git a/backend/node_modules/call-bound/CHANGELOG.md b/backend/node_modules/call-bound/CHANGELOG.md new file mode 100644 index 000000000..25fa7a5e1 --- /dev/null +++ b/backend/node_modules/call-bound/CHANGELOG.md @@ -0,0 +1,34 @@ +# Changelog + +All notable changes to this project will be documented in this file. + +The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/) +and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). + +## [v1.0.3](https://github.com/ljharb/call-bound/compare/v1.0.2...v1.0.3) - 2024-12-15 + +### Commits + +- [Refactor] use `call-bind-apply-helpers` instead of `call-bind` [`5e0b134`](https://github.com/ljharb/call-bound/commit/5e0b13496df14fb7d05dae9412f088da8d3f75be) +- [Deps] update `get-intrinsic` [`41fc967`](https://github.com/ljharb/call-bound/commit/41fc96732a22c7b7e8f381f93ccc54bb6293be2e) +- [readme] fix example [`79a0137`](https://github.com/ljharb/call-bound/commit/79a0137723f7c6d09c9c05452bbf8d5efb5d6e49) +- [meta] add `sideEffects` flag [`08b07be`](https://github.com/ljharb/call-bound/commit/08b07be7f1c03f67dc6f3cdaf0906259771859f7) + +## [v1.0.2](https://github.com/ljharb/call-bound/compare/v1.0.1...v1.0.2) - 2024-12-10 + +### Commits + +- [Dev Deps] update `@arethetypeswrong/cli`, `@ljharb/tsconfig`, `gopd` [`e6a5ffe`](https://github.com/ljharb/call-bound/commit/e6a5ffe849368fe4f74dfd6cdeca1b9baa39e8d5) +- [Deps] update `call-bind`, `get-intrinsic` [`2aeb5b5`](https://github.com/ljharb/call-bound/commit/2aeb5b521dc2b2683d1345c753ea1161de2d1c14) +- [types] improve return type [`1a0c9fe`](https://github.com/ljharb/call-bound/commit/1a0c9fe3114471e7ca1f57d104e2efe713bb4871) + +## v1.0.1 - 2024-12-05 + +### Commits + +- Initial implementation, tests, readme, types [`6d94121`](https://github.com/ljharb/call-bound/commit/6d94121a9243602e506334069f7a03189fe3363d) +- Initial commit [`0eae867`](https://github.com/ljharb/call-bound/commit/0eae867334ea025c33e6e91cdecfc9df96680cf9) +- npm init [`71b2479`](https://github.com/ljharb/call-bound/commit/71b2479c6723e0b7d91a6b663613067e98b7b275) +- Only apps should have lockfiles [`c3754a9`](https://github.com/ljharb/call-bound/commit/c3754a949b7f9132b47e2d18c1729889736741eb) +- [actions] skip `npm ls` in node < 10 [`74275a5`](https://github.com/ljharb/call-bound/commit/74275a5186b8caf6309b6b97472bdcb0df4683a8) +- [Dev Deps] add missing peer dep [`1354de8`](https://github.com/ljharb/call-bound/commit/1354de8679413e4ae9c523d85f76fa7a5e032d97) diff --git a/backend/node_modules/call-bound/LICENSE b/backend/node_modules/call-bound/LICENSE new file mode 100644 index 000000000..f82f38963 --- /dev/null +++ b/backend/node_modules/call-bound/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2024 Jordan Harband + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/backend/node_modules/call-bound/README.md b/backend/node_modules/call-bound/README.md new file mode 100644 index 000000000..a44e43e56 --- /dev/null +++ b/backend/node_modules/call-bound/README.md @@ -0,0 +1,53 @@ +# call-bound [![Version Badge][npm-version-svg]][package-url] + +[![github actions][actions-image]][actions-url] +[![coverage][codecov-image]][codecov-url] +[![dependency status][deps-svg]][deps-url] +[![dev dependency status][dev-deps-svg]][dev-deps-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] + +[![npm badge][npm-badge-png]][package-url] + +Robust call-bound JavaScript intrinsics, using `call-bind` and `get-intrinsic`. + +## Getting started + +```sh +npm install --save call-bound +``` + +## Usage/Examples + +```js +const assert = require('assert'); +const callBound = require('call-bound'); + +const slice = callBound('Array.prototype.slice'); + +delete Function.prototype.call; +delete Function.prototype.bind; +delete Array.prototype.slice; + +assert.deepEqual(slice([1, 2, 3, 4], 1, -1), [2, 3]); +``` + +## Tests + +Clone the repo, `npm install`, and run `npm test` + +[package-url]: https://npmjs.org/package/call-bound +[npm-version-svg]: https://versionbadg.es/ljharb/call-bound.svg +[deps-svg]: https://david-dm.org/ljharb/call-bound.svg +[deps-url]: https://david-dm.org/ljharb/call-bound +[dev-deps-svg]: https://david-dm.org/ljharb/call-bound/dev-status.svg +[dev-deps-url]: https://david-dm.org/ljharb/call-bound#info=devDependencies +[npm-badge-png]: https://nodei.co/npm/call-bound.png?downloads=true&stars=true +[license-image]: https://img.shields.io/npm/l/call-bound.svg +[license-url]: LICENSE +[downloads-image]: https://img.shields.io/npm/dm/call-bound.svg +[downloads-url]: https://npm-stat.com/charts.html?package=call-bound +[codecov-image]: https://codecov.io/gh/ljharb/call-bound/branch/main/graphs/badge.svg +[codecov-url]: https://app.codecov.io/gh/ljharb/call-bound/ +[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/call-bound +[actions-url]: https://github.com/ljharb/call-bound/actions diff --git a/backend/node_modules/call-bound/index.d.ts b/backend/node_modules/call-bound/index.d.ts new file mode 100644 index 000000000..e3d772ce5 --- /dev/null +++ b/backend/node_modules/call-bound/index.d.ts @@ -0,0 +1,13 @@ +import callBind from 'call-bind-apply-helpers'; + +declare function callBoundIntrinsic( + name: string, + allowMissing?: false +): ReturnType; + +declare function callBoundIntrinsic( + name: string, + allowMissing: true +): undefined | ReturnType; + +export = callBoundIntrinsic; \ No newline at end of file diff --git a/backend/node_modules/call-bound/index.js b/backend/node_modules/call-bound/index.js new file mode 100644 index 000000000..3bb40121a --- /dev/null +++ b/backend/node_modules/call-bound/index.js @@ -0,0 +1,18 @@ +'use strict'; + +var GetIntrinsic = require('get-intrinsic'); + +var callBindBasic = require('call-bind-apply-helpers'); + +/** @type {(thisArg: string, searchString: string, position?: number) => number} */ +var $indexOf = callBindBasic([GetIntrinsic('%String.prototype.indexOf%')]); + +/** @type {import('.')} */ +module.exports = function callBoundIntrinsic(name, allowMissing) { + // eslint-disable-next-line no-extra-parens + var intrinsic = /** @type {Parameters[0][0]} */ (GetIntrinsic(name, !!allowMissing)); + if (typeof intrinsic === 'function' && $indexOf(name, '.prototype.') > -1) { + return callBindBasic([intrinsic]); + } + return intrinsic; +}; diff --git a/backend/node_modules/call-bound/package.json b/backend/node_modules/call-bound/package.json new file mode 100644 index 000000000..2893ed11a --- /dev/null +++ b/backend/node_modules/call-bound/package.json @@ -0,0 +1,99 @@ +{ + "name": "call-bound", + "version": "1.0.3", + "description": "Robust call-bound JavaScript intrinsics, using `call-bind` and `get-intrinsic`.", + "main": "index.js", + "exports": { + ".": "./index.js", + "./package.json": "./package.json" + }, + "sideEffects": false, + "scripts": { + "prepack": "npmignore --auto --commentLines=auto", + "prepublish": "not-in-publish || npm run prepublishOnly", + "prepublishOnly": "safe-publish-latest", + "prelint": "evalmd README.md", + "lint": "eslint --ext=.js,.mjs .", + "postlint": "tsc -p . && attw -P", + "pretest": "npm run lint", + "tests-only": "nyc tape 'test/**/*.js'", + "test": "npm run tests-only", + "posttest": "npx npm@'>=10.2' audit --production", + "version": "auto-changelog && git add CHANGELOG.md", + "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\"" + }, + "repository": { + "type": "git", + "url": "git+https://github.com/ljharb/call-bound.git" + }, + "keywords": [ + "javascript", + "ecmascript", + "es", + "js", + "callbind", + "callbound", + "call", + "bind", + "bound", + "call-bind", + "call-bound", + "function", + "es-abstract" + ], + "author": "Jordan Harband ", + "funding": { + "url": "https://github.com/sponsors/ljharb" + }, + "license": "MIT", + "bugs": { + "url": "https://github.com/ljharb/call-bound/issues" + }, + "homepage": "https://github.com/ljharb/call-bound#readme", + "dependencies": { + "call-bind-apply-helpers": "^1.0.1", + "get-intrinsic": "^1.2.6" + }, + "devDependencies": { + "@arethetypeswrong/cli": "^0.17.1", + "@ljharb/eslint-config": "^21.1.1", + "@ljharb/tsconfig": "^0.2.2", + "@types/call-bind": "^1.0.5", + "@types/get-intrinsic": "^1.2.3", + "@types/tape": "^5.6.5", + "auto-changelog": "^2.5.0", + "encoding": "^0.1.13", + "es-value-fixtures": "^1.5.0", + "eslint": "=8.8.0", + "evalmd": "^0.0.19", + "for-each": "^0.3.3", + "gopd": "^1.2.0", + "has-strict-mode": "^1.0.1", + "in-publish": "^2.0.1", + "npmignore": "^0.3.1", + "nyc": "^10.3.2", + "object-inspect": "^1.13.3", + "safe-publish-latest": "^2.0.0", + "tape": "^5.9.0", + "typescript": "next" + }, + "testling": { + "files": "test/index.js" + }, + "auto-changelog": { + "output": "CHANGELOG.md", + "template": "keepachangelog", + "unreleased": false, + "commitLimit": false, + "backfillLimit": false, + "hideCredit": true + }, + "publishConfig": { + "ignore": [ + ".github/workflows" + ] + }, + "engines": { + "node": ">= 0.4" + } +} diff --git a/backend/node_modules/call-bound/test/index.js b/backend/node_modules/call-bound/test/index.js new file mode 100644 index 000000000..36f5f0b97 --- /dev/null +++ b/backend/node_modules/call-bound/test/index.js @@ -0,0 +1,54 @@ +'use strict'; + +var test = require('tape'); + +var callBound = require('../'); + +test('callBound', function (t) { + // static primitive + t.equal(callBound('Array.length'), Array.length, 'Array.length yields itself'); + t.equal(callBound('%Array.length%'), Array.length, '%Array.length% yields itself'); + + // static non-function object + t.equal(callBound('Array.prototype'), Array.prototype, 'Array.prototype yields itself'); + t.equal(callBound('%Array.prototype%'), Array.prototype, '%Array.prototype% yields itself'); + t.equal(callBound('Array.constructor'), Array.constructor, 'Array.constructor yields itself'); + t.equal(callBound('%Array.constructor%'), Array.constructor, '%Array.constructor% yields itself'); + + // static function + t.equal(callBound('Date.parse'), Date.parse, 'Date.parse yields itself'); + t.equal(callBound('%Date.parse%'), Date.parse, '%Date.parse% yields itself'); + + // prototype primitive + t.equal(callBound('Error.prototype.message'), Error.prototype.message, 'Error.prototype.message yields itself'); + t.equal(callBound('%Error.prototype.message%'), Error.prototype.message, '%Error.prototype.message% yields itself'); + + // prototype function + t.notEqual(callBound('Object.prototype.toString'), Object.prototype.toString, 'Object.prototype.toString does not yield itself'); + t.notEqual(callBound('%Object.prototype.toString%'), Object.prototype.toString, '%Object.prototype.toString% does not yield itself'); + t.equal(callBound('Object.prototype.toString')(true), Object.prototype.toString.call(true), 'call-bound Object.prototype.toString calls into the original'); + t.equal(callBound('%Object.prototype.toString%')(true), Object.prototype.toString.call(true), 'call-bound %Object.prototype.toString% calls into the original'); + + t['throws']( + function () { callBound('does not exist'); }, + SyntaxError, + 'nonexistent intrinsic throws' + ); + t['throws']( + function () { callBound('does not exist', true); }, + SyntaxError, + 'allowMissing arg still throws for unknown intrinsic' + ); + + t.test('real but absent intrinsic', { skip: typeof WeakRef !== 'undefined' }, function (st) { + st['throws']( + function () { callBound('WeakRef'); }, + TypeError, + 'real but absent intrinsic throws' + ); + st.equal(callBound('WeakRef', true), undefined, 'allowMissing arg avoids exception'); + st.end(); + }); + + t.end(); +}); diff --git a/backend/node_modules/call-bound/tsconfig.json b/backend/node_modules/call-bound/tsconfig.json new file mode 100644 index 000000000..d9a6668c3 --- /dev/null +++ b/backend/node_modules/call-bound/tsconfig.json @@ -0,0 +1,9 @@ +{ + "extends": "@ljharb/tsconfig", + "compilerOptions": { + "target": "es2021", + }, + "exclude": [ + "coverage", + ], +} diff --git a/backend/node_modules/chokidar/LICENSE b/backend/node_modules/chokidar/LICENSE new file mode 100644 index 000000000..fa9162b51 --- /dev/null +++ b/backend/node_modules/chokidar/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2012-2019 Paul Miller (https://paulmillr.com), Elan Shanker + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the “Software”), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED “AS IS”, WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/backend/node_modules/chokidar/README.md b/backend/node_modules/chokidar/README.md new file mode 100644 index 000000000..8e25decb4 --- /dev/null +++ b/backend/node_modules/chokidar/README.md @@ -0,0 +1,308 @@ +# Chokidar [![Weekly downloads](https://img.shields.io/npm/dw/chokidar.svg)](https://github.com/paulmillr/chokidar) [![Yearly downloads](https://img.shields.io/npm/dy/chokidar.svg)](https://github.com/paulmillr/chokidar) + +> Minimal and efficient cross-platform file watching library + +[![NPM](https://nodei.co/npm/chokidar.png)](https://www.npmjs.com/package/chokidar) + +## Why? + +Node.js `fs.watch`: + +* Doesn't report filenames on MacOS. +* Doesn't report events at all when using editors like Sublime on MacOS. +* Often reports events twice. +* Emits most changes as `rename`. +* Does not provide an easy way to recursively watch file trees. +* Does not support recursive watching on Linux. + +Node.js `fs.watchFile`: + +* Almost as bad at event handling. +* Also does not provide any recursive watching. +* Results in high CPU utilization. + +Chokidar resolves these problems. + +Initially made for **[Brunch](https://brunch.io/)** (an ultra-swift web app build tool), it is now used in +[Microsoft's Visual Studio Code](https://github.com/microsoft/vscode), +[gulp](https://github.com/gulpjs/gulp/), +[karma](https://karma-runner.github.io/), +[PM2](https://github.com/Unitech/PM2), +[browserify](http://browserify.org/), +[webpack](https://webpack.github.io/), +[BrowserSync](https://www.browsersync.io/), +and [many others](https://www.npmjs.com/browse/depended/chokidar). +It has proven itself in production environments. + +Version 3 is out! Check out our blog post about it: [Chokidar 3: How to save 32TB of traffic every week](https://paulmillr.com/posts/chokidar-3-save-32tb-of-traffic/) + +## How? + +Chokidar does still rely on the Node.js core `fs` module, but when using +`fs.watch` and `fs.watchFile` for watching, it normalizes the events it +receives, often checking for truth by getting file stats and/or dir contents. + +On MacOS, chokidar by default uses a native extension exposing the Darwin +`FSEvents` API. This provides very efficient recursive watching compared with +implementations like `kqueue` available on most \*nix platforms. Chokidar still +does have to do some work to normalize the events received that way as well. + +On most other platforms, the `fs.watch`-based implementation is the default, which +avoids polling and keeps CPU usage down. Be advised that chokidar will initiate +watchers recursively for everything within scope of the paths that have been +specified, so be judicious about not wasting system resources by watching much +more than needed. + +## Getting started + +Install with npm: + +```sh +npm install chokidar +``` + +Then `require` and use it in your code: + +```javascript +const chokidar = require('chokidar'); + +// One-liner for current directory +chokidar.watch('.').on('all', (event, path) => { + console.log(event, path); +}); +``` + +## API + +```javascript +// Example of a more typical implementation structure + +// Initialize watcher. +const watcher = chokidar.watch('file, dir, glob, or array', { + ignored: /(^|[\/\\])\../, // ignore dotfiles + persistent: true +}); + +// Something to use when events are received. +const log = console.log.bind(console); +// Add event listeners. +watcher + .on('add', path => log(`File ${path} has been added`)) + .on('change', path => log(`File ${path} has been changed`)) + .on('unlink', path => log(`File ${path} has been removed`)); + +// More possible events. +watcher + .on('addDir', path => log(`Directory ${path} has been added`)) + .on('unlinkDir', path => log(`Directory ${path} has been removed`)) + .on('error', error => log(`Watcher error: ${error}`)) + .on('ready', () => log('Initial scan complete. Ready for changes')) + .on('raw', (event, path, details) => { // internal + log('Raw event info:', event, path, details); + }); + +// 'add', 'addDir' and 'change' events also receive stat() results as second +// argument when available: https://nodejs.org/api/fs.html#fs_class_fs_stats +watcher.on('change', (path, stats) => { + if (stats) console.log(`File ${path} changed size to ${stats.size}`); +}); + +// Watch new files. +watcher.add('new-file'); +watcher.add(['new-file-2', 'new-file-3', '**/other-file*']); + +// Get list of actual paths being watched on the filesystem +var watchedPaths = watcher.getWatched(); + +// Un-watch some files. +await watcher.unwatch('new-file*'); + +// Stop watching. +// The method is async! +watcher.close().then(() => console.log('closed')); + +// Full list of options. See below for descriptions. +// Do not use this example! +chokidar.watch('file', { + persistent: true, + + ignored: '*.txt', + ignoreInitial: false, + followSymlinks: true, + cwd: '.', + disableGlobbing: false, + + usePolling: false, + interval: 100, + binaryInterval: 300, + alwaysStat: false, + depth: 99, + awaitWriteFinish: { + stabilityThreshold: 2000, + pollInterval: 100 + }, + + ignorePermissionErrors: false, + atomic: true // or a custom 'atomicity delay', in milliseconds (default 100) +}); + +``` + +`chokidar.watch(paths, [options])` + +* `paths` (string or array of strings). Paths to files, dirs to be watched +recursively, or glob patterns. + - Note: globs must not contain windows separators (`\`), + because that's how they work by the standard — + you'll need to replace them with forward slashes (`/`). + - Note 2: for additional glob documentation, check out low-level + library: [picomatch](https://github.com/micromatch/picomatch). +* `options` (object) Options object as defined below: + +#### Persistence + +* `persistent` (default: `true`). Indicates whether the process +should continue to run as long as files are being watched. If set to +`false` when using `fsevents` to watch, no more events will be emitted +after `ready`, even if the process continues to run. + +#### Path filtering + +* `ignored` ([anymatch](https://github.com/es128/anymatch)-compatible definition) +Defines files/paths to be ignored. The whole relative or absolute path is +tested, not just filename. If a function with two arguments is provided, it +gets called twice per path - once with a single argument (the path), second +time with two arguments (the path and the +[`fs.Stats`](https://nodejs.org/api/fs.html#fs_class_fs_stats) +object of that path). +* `ignoreInitial` (default: `false`). If set to `false` then `add`/`addDir` events are also emitted for matching paths while +instantiating the watching as chokidar discovers these file paths (before the `ready` event). +* `followSymlinks` (default: `true`). When `false`, only the +symlinks themselves will be watched for changes instead of following +the link references and bubbling events through the link's path. +* `cwd` (no default). The base directory from which watch `paths` are to be +derived. Paths emitted with events will be relative to this. +* `disableGlobbing` (default: `false`). If set to `true` then the strings passed to `.watch()` and `.add()` are treated as +literal path names, even if they look like globs. + +#### Performance + +* `usePolling` (default: `false`). +Whether to use fs.watchFile (backed by polling), or fs.watch. If polling +leads to high CPU utilization, consider setting this to `false`. It is +typically necessary to **set this to `true` to successfully watch files over +a network**, and it may be necessary to successfully watch files in other +non-standard situations. Setting to `true` explicitly on MacOS overrides the +`useFsEvents` default. You may also set the CHOKIDAR_USEPOLLING env variable +to true (1) or false (0) in order to override this option. +* _Polling-specific settings_ (effective when `usePolling: true`) + * `interval` (default: `100`). Interval of file system polling, in milliseconds. You may also + set the CHOKIDAR_INTERVAL env variable to override this option. + * `binaryInterval` (default: `300`). Interval of file system + polling for binary files. + ([see list of binary extensions](https://github.com/sindresorhus/binary-extensions/blob/master/binary-extensions.json)) +* `useFsEvents` (default: `true` on MacOS). Whether to use the +`fsevents` watching interface if available. When set to `true` explicitly +and `fsevents` is available this supercedes the `usePolling` setting. When +set to `false` on MacOS, `usePolling: true` becomes the default. +* `alwaysStat` (default: `false`). If relying upon the +[`fs.Stats`](https://nodejs.org/api/fs.html#fs_class_fs_stats) +object that may get passed with `add`, `addDir`, and `change` events, set +this to `true` to ensure it is provided even in cases where it wasn't +already available from the underlying watch events. +* `depth` (default: `undefined`). If set, limits how many levels of +subdirectories will be traversed. +* `awaitWriteFinish` (default: `false`). +By default, the `add` event will fire when a file first appears on disk, before +the entire file has been written. Furthermore, in some cases some `change` +events will be emitted while the file is being written. In some cases, +especially when watching for large files there will be a need to wait for the +write operation to finish before responding to a file creation or modification. +Setting `awaitWriteFinish` to `true` (or a truthy value) will poll file size, +holding its `add` and `change` events until the size does not change for a +configurable amount of time. The appropriate duration setting is heavily +dependent on the OS and hardware. For accurate detection this parameter should +be relatively high, making file watching much less responsive. +Use with caution. + * *`options.awaitWriteFinish` can be set to an object in order to adjust + timing params:* + * `awaitWriteFinish.stabilityThreshold` (default: 2000). Amount of time in + milliseconds for a file size to remain constant before emitting its event. + * `awaitWriteFinish.pollInterval` (default: 100). File size polling interval, in milliseconds. + +#### Errors + +* `ignorePermissionErrors` (default: `false`). Indicates whether to watch files +that don't have read permissions if possible. If watching fails due to `EPERM` +or `EACCES` with this set to `true`, the errors will be suppressed silently. +* `atomic` (default: `true` if `useFsEvents` and `usePolling` are `false`). +Automatically filters out artifacts that occur when using editors that use +"atomic writes" instead of writing directly to the source file. If a file is +re-added within 100 ms of being deleted, Chokidar emits a `change` event +rather than `unlink` then `add`. If the default of 100 ms does not work well +for you, you can override it by setting `atomic` to a custom value, in +milliseconds. + +### Methods & Events + +`chokidar.watch()` produces an instance of `FSWatcher`. Methods of `FSWatcher`: + +* `.add(path / paths)`: Add files, directories, or glob patterns for tracking. +Takes an array of strings or just one string. +* `.on(event, callback)`: Listen for an FS event. +Available events: `add`, `addDir`, `change`, `unlink`, `unlinkDir`, `ready`, +`raw`, `error`. +Additionally `all` is available which gets emitted with the underlying event +name and path for every event other than `ready`, `raw`, and `error`. `raw` is internal, use it carefully. +* `.unwatch(path / paths)`: Stop watching files, directories, or glob patterns. +Takes an array of strings or just one string. +* `.close()`: **async** Removes all listeners from watched files. Asynchronous, returns Promise. Use with `await` to ensure bugs don't happen. +* `.getWatched()`: Returns an object representing all the paths on the file +system being watched by this `FSWatcher` instance. The object's keys are all the +directories (using absolute paths unless the `cwd` option was used), and the +values are arrays of the names of the items contained in each directory. + +## CLI + +If you need a CLI interface for your file watching, check out +[chokidar-cli](https://github.com/open-cli-tools/chokidar-cli), allowing you to +execute a command on each change, or get a stdio stream of change events. + +## Install Troubleshooting + +* `npm WARN optional dep failed, continuing fsevents@n.n.n` + * This message is normal part of how `npm` handles optional dependencies and is + not indicative of a problem. Even if accompanied by other related error messages, + Chokidar should function properly. + +* `TypeError: fsevents is not a constructor` + * Update chokidar by doing `rm -rf node_modules package-lock.json yarn.lock && npm install`, or update your dependency that uses chokidar. + +* Chokidar is producing `ENOSP` error on Linux, like this: + * `bash: cannot set terminal process group (-1): Inappropriate ioctl for device bash: no job control in this shell` + `Error: watch /home/ ENOSPC` + * This means Chokidar ran out of file handles and you'll need to increase their count by executing the following command in Terminal: + `echo fs.inotify.max_user_watches=524288 | sudo tee -a /etc/sysctl.conf && sudo sysctl -p` + +## Changelog + +For more detailed changelog, see [`full_changelog.md`](.github/full_changelog.md). +- **v3.5 (Jan 6, 2021):** Support for ARM Macs with Apple Silicon. Fixes for deleted symlinks. +- **v3.4 (Apr 26, 2020):** Support for directory-based symlinks. Fixes for macos file replacement. +- **v3.3 (Nov 2, 2019):** `FSWatcher#close()` method became async. That fixes IO race conditions related to close method. +- **v3.2 (Oct 1, 2019):** Improve Linux RAM usage by 50%. Race condition fixes. Windows glob fixes. Improve stability by using tight range of dependency versions. +- **v3.1 (Sep 16, 2019):** dotfiles are no longer filtered out by default. Use `ignored` option if needed. Improve initial Linux scan time by 50%. +- **v3 (Apr 30, 2019):** massive CPU & RAM consumption improvements; reduces deps / package size by a factor of 17x and bumps Node.js requirement to v8.16 and higher. +- **v2 (Dec 29, 2017):** Globs are now posix-style-only; without windows support. Tons of bugfixes. +- **v1 (Apr 7, 2015):** Glob support, symlink support, tons of bugfixes. Node 0.8+ is supported +- **v0.1 (Apr 20, 2012):** Initial release, extracted from [Brunch](https://github.com/brunch/brunch/blob/9847a065aea300da99bd0753f90354cde9de1261/src/helpers.coffee#L66) + +## Also + +Why was chokidar named this way? What's the meaning behind it? + +>Chowkidar is a transliteration of a Hindi word meaning 'watchman, gatekeeper', चौकीदार. This ultimately comes from Sanskrit _ चतुष्क_ (crossway, quadrangle, consisting-of-four). This word is also used in other languages like Urdu as (چوکیدار) which is widely used in Pakistan and India. + +## License + +MIT (c) Paul Miller (), see [LICENSE](LICENSE) file. diff --git a/backend/node_modules/chokidar/index.js b/backend/node_modules/chokidar/index.js new file mode 100644 index 000000000..8752893ca --- /dev/null +++ b/backend/node_modules/chokidar/index.js @@ -0,0 +1,973 @@ +'use strict'; + +const { EventEmitter } = require('events'); +const fs = require('fs'); +const sysPath = require('path'); +const { promisify } = require('util'); +const readdirp = require('readdirp'); +const anymatch = require('anymatch').default; +const globParent = require('glob-parent'); +const isGlob = require('is-glob'); +const braces = require('braces'); +const normalizePath = require('normalize-path'); + +const NodeFsHandler = require('./lib/nodefs-handler'); +const FsEventsHandler = require('./lib/fsevents-handler'); +const { + EV_ALL, + EV_READY, + EV_ADD, + EV_CHANGE, + EV_UNLINK, + EV_ADD_DIR, + EV_UNLINK_DIR, + EV_RAW, + EV_ERROR, + + STR_CLOSE, + STR_END, + + BACK_SLASH_RE, + DOUBLE_SLASH_RE, + SLASH_OR_BACK_SLASH_RE, + DOT_RE, + REPLACER_RE, + + SLASH, + SLASH_SLASH, + BRACE_START, + BANG, + ONE_DOT, + TWO_DOTS, + GLOBSTAR, + SLASH_GLOBSTAR, + ANYMATCH_OPTS, + STRING_TYPE, + FUNCTION_TYPE, + EMPTY_STR, + EMPTY_FN, + + isWindows, + isMacos, + isIBMi +} = require('./lib/constants'); + +const stat = promisify(fs.stat); +const readdir = promisify(fs.readdir); + +/** + * @typedef {String} Path + * @typedef {'all'|'add'|'addDir'|'change'|'unlink'|'unlinkDir'|'raw'|'error'|'ready'} EventName + * @typedef {'readdir'|'watch'|'add'|'remove'|'change'} ThrottleType + */ + +/** + * + * @typedef {Object} WatchHelpers + * @property {Boolean} followSymlinks + * @property {'stat'|'lstat'} statMethod + * @property {Path} path + * @property {Path} watchPath + * @property {Function} entryPath + * @property {Boolean} hasGlob + * @property {Object} globFilter + * @property {Function} filterPath + * @property {Function} filterDir + */ + +const arrify = (value = []) => Array.isArray(value) ? value : [value]; +const flatten = (list, result = []) => { + list.forEach(item => { + if (Array.isArray(item)) { + flatten(item, result); + } else { + result.push(item); + } + }); + return result; +}; + +const unifyPaths = (paths_) => { + /** + * @type {Array} + */ + const paths = flatten(arrify(paths_)); + if (!paths.every(p => typeof p === STRING_TYPE)) { + throw new TypeError(`Non-string provided as watch path: ${paths}`); + } + return paths.map(normalizePathToUnix); +}; + +// If SLASH_SLASH occurs at the beginning of path, it is not replaced +// because "//StoragePC/DrivePool/Movies" is a valid network path +const toUnix = (string) => { + let str = string.replace(BACK_SLASH_RE, SLASH); + let prepend = false; + if (str.startsWith(SLASH_SLASH)) { + prepend = true; + } + while (str.match(DOUBLE_SLASH_RE)) { + str = str.replace(DOUBLE_SLASH_RE, SLASH); + } + if (prepend) { + str = SLASH + str; + } + return str; +}; + +// Our version of upath.normalize +// TODO: this is not equal to path-normalize module - investigate why +const normalizePathToUnix = (path) => toUnix(sysPath.normalize(toUnix(path))); + +const normalizeIgnored = (cwd = EMPTY_STR) => (path) => { + if (typeof path !== STRING_TYPE) return path; + return normalizePathToUnix(sysPath.isAbsolute(path) ? path : sysPath.join(cwd, path)); +}; + +const getAbsolutePath = (path, cwd) => { + if (sysPath.isAbsolute(path)) { + return path; + } + if (path.startsWith(BANG)) { + return BANG + sysPath.join(cwd, path.slice(1)); + } + return sysPath.join(cwd, path); +}; + +const undef = (opts, key) => opts[key] === undefined; + +/** + * Directory entry. + * @property {Path} path + * @property {Set} items + */ +class DirEntry { + /** + * @param {Path} dir + * @param {Function} removeWatcher + */ + constructor(dir, removeWatcher) { + this.path = dir; + this._removeWatcher = removeWatcher; + /** @type {Set} */ + this.items = new Set(); + } + + add(item) { + const {items} = this; + if (!items) return; + if (item !== ONE_DOT && item !== TWO_DOTS) items.add(item); + } + + async remove(item) { + const {items} = this; + if (!items) return; + items.delete(item); + if (items.size > 0) return; + + const dir = this.path; + try { + await readdir(dir); + } catch (err) { + if (this._removeWatcher) { + this._removeWatcher(sysPath.dirname(dir), sysPath.basename(dir)); + } + } + } + + has(item) { + const {items} = this; + if (!items) return; + return items.has(item); + } + + /** + * @returns {Array} + */ + getChildren() { + const {items} = this; + if (!items) return; + return [...items.values()]; + } + + dispose() { + this.items.clear(); + delete this.path; + delete this._removeWatcher; + delete this.items; + Object.freeze(this); + } +} + +const STAT_METHOD_F = 'stat'; +const STAT_METHOD_L = 'lstat'; +class WatchHelper { + constructor(path, watchPath, follow, fsw) { + this.fsw = fsw; + this.path = path = path.replace(REPLACER_RE, EMPTY_STR); + this.watchPath = watchPath; + this.fullWatchPath = sysPath.resolve(watchPath); + this.hasGlob = watchPath !== path; + /** @type {object|boolean} */ + if (path === EMPTY_STR) this.hasGlob = false; + this.globSymlink = this.hasGlob && follow ? undefined : false; + this.globFilter = this.hasGlob ? anymatch(path, undefined, ANYMATCH_OPTS) : false; + this.dirParts = this.getDirParts(path); + this.dirParts.forEach((parts) => { + if (parts.length > 1) parts.pop(); + }); + this.followSymlinks = follow; + this.statMethod = follow ? STAT_METHOD_F : STAT_METHOD_L; + } + + checkGlobSymlink(entry) { + // only need to resolve once + // first entry should always have entry.parentDir === EMPTY_STR + if (this.globSymlink === undefined) { + this.globSymlink = entry.fullParentDir === this.fullWatchPath ? + false : {realPath: entry.fullParentDir, linkPath: this.fullWatchPath}; + } + + if (this.globSymlink) { + return entry.fullPath.replace(this.globSymlink.realPath, this.globSymlink.linkPath); + } + + return entry.fullPath; + } + + entryPath(entry) { + return sysPath.join(this.watchPath, + sysPath.relative(this.watchPath, this.checkGlobSymlink(entry)) + ); + } + + filterPath(entry) { + const {stats} = entry; + if (stats && stats.isSymbolicLink()) return this.filterDir(entry); + const resolvedPath = this.entryPath(entry); + const matchesGlob = this.hasGlob && typeof this.globFilter === FUNCTION_TYPE ? + this.globFilter(resolvedPath) : true; + return matchesGlob && + this.fsw._isntIgnored(resolvedPath, stats) && + this.fsw._hasReadPermissions(stats); + } + + getDirParts(path) { + if (!this.hasGlob) return []; + const parts = []; + const expandedPath = path.includes(BRACE_START) ? braces.expand(path) : [path]; + expandedPath.forEach((path) => { + parts.push(sysPath.relative(this.watchPath, path).split(SLASH_OR_BACK_SLASH_RE)); + }); + return parts; + } + + filterDir(entry) { + if (this.hasGlob) { + const entryParts = this.getDirParts(this.checkGlobSymlink(entry)); + let globstar = false; + this.unmatchedGlob = !this.dirParts.some((parts) => { + return parts.every((part, i) => { + if (part === GLOBSTAR) globstar = true; + return globstar || !entryParts[0][i] || anymatch(part, entryParts[0][i], ANYMATCH_OPTS); + }); + }); + } + return !this.unmatchedGlob && this.fsw._isntIgnored(this.entryPath(entry), entry.stats); + } +} + +/** + * Watches files & directories for changes. Emitted events: + * `add`, `addDir`, `change`, `unlink`, `unlinkDir`, `all`, `error` + * + * new FSWatcher() + * .add(directories) + * .on('add', path => log('File', path, 'was added')) + */ +class FSWatcher extends EventEmitter { +// Not indenting methods for history sake; for now. +constructor(_opts) { + super(); + + const opts = {}; + if (_opts) Object.assign(opts, _opts); // for frozen objects + + /** @type {Map} */ + this._watched = new Map(); + /** @type {Map} */ + this._closers = new Map(); + /** @type {Set} */ + this._ignoredPaths = new Set(); + + /** @type {Map} */ + this._throttled = new Map(); + + /** @type {Map} */ + this._symlinkPaths = new Map(); + + this._streams = new Set(); + this.closed = false; + + // Set up default options. + if (undef(opts, 'persistent')) opts.persistent = true; + if (undef(opts, 'ignoreInitial')) opts.ignoreInitial = false; + if (undef(opts, 'ignorePermissionErrors')) opts.ignorePermissionErrors = false; + if (undef(opts, 'interval')) opts.interval = 100; + if (undef(opts, 'binaryInterval')) opts.binaryInterval = 300; + if (undef(opts, 'disableGlobbing')) opts.disableGlobbing = false; + opts.enableBinaryInterval = opts.binaryInterval !== opts.interval; + + // Enable fsevents on OS X when polling isn't explicitly enabled. + if (undef(opts, 'useFsEvents')) opts.useFsEvents = !opts.usePolling; + + // If we can't use fsevents, ensure the options reflect it's disabled. + const canUseFsEvents = FsEventsHandler.canUse(); + if (!canUseFsEvents) opts.useFsEvents = false; + + // Use polling on Mac if not using fsevents. + // Other platforms use non-polling fs_watch. + if (undef(opts, 'usePolling') && !opts.useFsEvents) { + opts.usePolling = isMacos; + } + + // Always default to polling on IBM i because fs.watch() is not available on IBM i. + if(isIBMi) { + opts.usePolling = true; + } + + // Global override (useful for end-developers that need to force polling for all + // instances of chokidar, regardless of usage/dependency depth) + const envPoll = process.env.CHOKIDAR_USEPOLLING; + if (envPoll !== undefined) { + const envLower = envPoll.toLowerCase(); + + if (envLower === 'false' || envLower === '0') { + opts.usePolling = false; + } else if (envLower === 'true' || envLower === '1') { + opts.usePolling = true; + } else { + opts.usePolling = !!envLower; + } + } + const envInterval = process.env.CHOKIDAR_INTERVAL; + if (envInterval) { + opts.interval = Number.parseInt(envInterval, 10); + } + + // Editor atomic write normalization enabled by default with fs.watch + if (undef(opts, 'atomic')) opts.atomic = !opts.usePolling && !opts.useFsEvents; + if (opts.atomic) this._pendingUnlinks = new Map(); + + if (undef(opts, 'followSymlinks')) opts.followSymlinks = true; + + if (undef(opts, 'awaitWriteFinish')) opts.awaitWriteFinish = false; + if (opts.awaitWriteFinish === true) opts.awaitWriteFinish = {}; + const awf = opts.awaitWriteFinish; + if (awf) { + if (!awf.stabilityThreshold) awf.stabilityThreshold = 2000; + if (!awf.pollInterval) awf.pollInterval = 100; + this._pendingWrites = new Map(); + } + if (opts.ignored) opts.ignored = arrify(opts.ignored); + + let readyCalls = 0; + this._emitReady = () => { + readyCalls++; + if (readyCalls >= this._readyCount) { + this._emitReady = EMPTY_FN; + this._readyEmitted = true; + // use process.nextTick to allow time for listener to be bound + process.nextTick(() => this.emit(EV_READY)); + } + }; + this._emitRaw = (...args) => this.emit(EV_RAW, ...args); + this._readyEmitted = false; + this.options = opts; + + // Initialize with proper watcher. + if (opts.useFsEvents) { + this._fsEventsHandler = new FsEventsHandler(this); + } else { + this._nodeFsHandler = new NodeFsHandler(this); + } + + // You’re frozen when your heart’s not open. + Object.freeze(opts); +} + +// Public methods + +/** + * Adds paths to be watched on an existing FSWatcher instance + * @param {Path|Array} paths_ + * @param {String=} _origAdd private; for handling non-existent paths to be watched + * @param {Boolean=} _internal private; indicates a non-user add + * @returns {FSWatcher} for chaining + */ +add(paths_, _origAdd, _internal) { + const {cwd, disableGlobbing} = this.options; + this.closed = false; + let paths = unifyPaths(paths_); + if (cwd) { + paths = paths.map((path) => { + const absPath = getAbsolutePath(path, cwd); + + // Check `path` instead of `absPath` because the cwd portion can't be a glob + if (disableGlobbing || !isGlob(path)) { + return absPath; + } + return normalizePath(absPath); + }); + } + + // set aside negated glob strings + paths = paths.filter((path) => { + if (path.startsWith(BANG)) { + this._ignoredPaths.add(path.slice(1)); + return false; + } + + // if a path is being added that was previously ignored, stop ignoring it + this._ignoredPaths.delete(path); + this._ignoredPaths.delete(path + SLASH_GLOBSTAR); + + // reset the cached userIgnored anymatch fn + // to make ignoredPaths changes effective + this._userIgnored = undefined; + + return true; + }); + + if (this.options.useFsEvents && this._fsEventsHandler) { + if (!this._readyCount) this._readyCount = paths.length; + if (this.options.persistent) this._readyCount += paths.length; + paths.forEach((path) => this._fsEventsHandler._addToFsEvents(path)); + } else { + if (!this._readyCount) this._readyCount = 0; + this._readyCount += paths.length; + Promise.all( + paths.map(async path => { + const res = await this._nodeFsHandler._addToNodeFs(path, !_internal, 0, 0, _origAdd); + if (res) this._emitReady(); + return res; + }) + ).then(results => { + if (this.closed) return; + results.filter(item => item).forEach(item => { + this.add(sysPath.dirname(item), sysPath.basename(_origAdd || item)); + }); + }); + } + + return this; +} + +/** + * Close watchers or start ignoring events from specified paths. + * @param {Path|Array} paths_ - string or array of strings, file/directory paths and/or globs + * @returns {FSWatcher} for chaining +*/ +unwatch(paths_) { + if (this.closed) return this; + const paths = unifyPaths(paths_); + const {cwd} = this.options; + + paths.forEach((path) => { + // convert to absolute path unless relative path already matches + if (!sysPath.isAbsolute(path) && !this._closers.has(path)) { + if (cwd) path = sysPath.join(cwd, path); + path = sysPath.resolve(path); + } + + this._closePath(path); + + this._ignoredPaths.add(path); + if (this._watched.has(path)) { + this._ignoredPaths.add(path + SLASH_GLOBSTAR); + } + + // reset the cached userIgnored anymatch fn + // to make ignoredPaths changes effective + this._userIgnored = undefined; + }); + + return this; +} + +/** + * Close watchers and remove all listeners from watched paths. + * @returns {Promise}. +*/ +close() { + if (this.closed) return this._closePromise; + this.closed = true; + + // Memory management. + this.removeAllListeners(); + const closers = []; + this._closers.forEach(closerList => closerList.forEach(closer => { + const promise = closer(); + if (promise instanceof Promise) closers.push(promise); + })); + this._streams.forEach(stream => stream.destroy()); + this._userIgnored = undefined; + this._readyCount = 0; + this._readyEmitted = false; + this._watched.forEach(dirent => dirent.dispose()); + ['closers', 'watched', 'streams', 'symlinkPaths', 'throttled'].forEach(key => { + this[`_${key}`].clear(); + }); + + this._closePromise = closers.length ? Promise.all(closers).then(() => undefined) : Promise.resolve(); + return this._closePromise; +} + +/** + * Expose list of watched paths + * @returns {Object} for chaining +*/ +getWatched() { + const watchList = {}; + this._watched.forEach((entry, dir) => { + const key = this.options.cwd ? sysPath.relative(this.options.cwd, dir) : dir; + watchList[key || ONE_DOT] = entry.getChildren().sort(); + }); + return watchList; +} + +emitWithAll(event, args) { + this.emit(...args); + if (event !== EV_ERROR) this.emit(EV_ALL, ...args); +} + +// Common helpers +// -------------- + +/** + * Normalize and emit events. + * Calling _emit DOES NOT MEAN emit() would be called! + * @param {EventName} event Type of event + * @param {Path} path File or directory path + * @param {*=} val1 arguments to be passed with event + * @param {*=} val2 + * @param {*=} val3 + * @returns the error if defined, otherwise the value of the FSWatcher instance's `closed` flag + */ +async _emit(event, path, val1, val2, val3) { + if (this.closed) return; + + const opts = this.options; + if (isWindows) path = sysPath.normalize(path); + if (opts.cwd) path = sysPath.relative(opts.cwd, path); + /** @type Array */ + const args = [event, path]; + if (val3 !== undefined) args.push(val1, val2, val3); + else if (val2 !== undefined) args.push(val1, val2); + else if (val1 !== undefined) args.push(val1); + + const awf = opts.awaitWriteFinish; + let pw; + if (awf && (pw = this._pendingWrites.get(path))) { + pw.lastChange = new Date(); + return this; + } + + if (opts.atomic) { + if (event === EV_UNLINK) { + this._pendingUnlinks.set(path, args); + setTimeout(() => { + this._pendingUnlinks.forEach((entry, path) => { + this.emit(...entry); + this.emit(EV_ALL, ...entry); + this._pendingUnlinks.delete(path); + }); + }, typeof opts.atomic === 'number' ? opts.atomic : 100); + return this; + } + if (event === EV_ADD && this._pendingUnlinks.has(path)) { + event = args[0] = EV_CHANGE; + this._pendingUnlinks.delete(path); + } + } + + if (awf && (event === EV_ADD || event === EV_CHANGE) && this._readyEmitted) { + const awfEmit = (err, stats) => { + if (err) { + event = args[0] = EV_ERROR; + args[1] = err; + this.emitWithAll(event, args); + } else if (stats) { + // if stats doesn't exist the file must have been deleted + if (args.length > 2) { + args[2] = stats; + } else { + args.push(stats); + } + this.emitWithAll(event, args); + } + }; + + this._awaitWriteFinish(path, awf.stabilityThreshold, event, awfEmit); + return this; + } + + if (event === EV_CHANGE) { + const isThrottled = !this._throttle(EV_CHANGE, path, 50); + if (isThrottled) return this; + } + + if (opts.alwaysStat && val1 === undefined && + (event === EV_ADD || event === EV_ADD_DIR || event === EV_CHANGE) + ) { + const fullPath = opts.cwd ? sysPath.join(opts.cwd, path) : path; + let stats; + try { + stats = await stat(fullPath); + } catch (err) {} + // Suppress event when fs_stat fails, to avoid sending undefined 'stat' + if (!stats || this.closed) return; + args.push(stats); + } + this.emitWithAll(event, args); + + return this; +} + +/** + * Common handler for errors + * @param {Error} error + * @returns {Error|Boolean} The error if defined, otherwise the value of the FSWatcher instance's `closed` flag + */ +_handleError(error) { + const code = error && error.code; + if (error && code !== 'ENOENT' && code !== 'ENOTDIR' && + (!this.options.ignorePermissionErrors || (code !== 'EPERM' && code !== 'EACCES')) + ) { + this.emit(EV_ERROR, error); + } + return error || this.closed; +} + +/** + * Helper utility for throttling + * @param {ThrottleType} actionType type being throttled + * @param {Path} path being acted upon + * @param {Number} timeout duration of time to suppress duplicate actions + * @returns {Object|false} tracking object or false if action should be suppressed + */ +_throttle(actionType, path, timeout) { + if (!this._throttled.has(actionType)) { + this._throttled.set(actionType, new Map()); + } + + /** @type {Map} */ + const action = this._throttled.get(actionType); + /** @type {Object} */ + const actionPath = action.get(path); + + if (actionPath) { + actionPath.count++; + return false; + } + + let timeoutObject; + const clear = () => { + const item = action.get(path); + const count = item ? item.count : 0; + action.delete(path); + clearTimeout(timeoutObject); + if (item) clearTimeout(item.timeoutObject); + return count; + }; + timeoutObject = setTimeout(clear, timeout); + const thr = {timeoutObject, clear, count: 0}; + action.set(path, thr); + return thr; +} + +_incrReadyCount() { + return this._readyCount++; +} + +/** + * Awaits write operation to finish. + * Polls a newly created file for size variations. When files size does not change for 'threshold' milliseconds calls callback. + * @param {Path} path being acted upon + * @param {Number} threshold Time in milliseconds a file size must be fixed before acknowledging write OP is finished + * @param {EventName} event + * @param {Function} awfEmit Callback to be called when ready for event to be emitted. + */ +_awaitWriteFinish(path, threshold, event, awfEmit) { + let timeoutHandler; + + let fullPath = path; + if (this.options.cwd && !sysPath.isAbsolute(path)) { + fullPath = sysPath.join(this.options.cwd, path); + } + + const now = new Date(); + + const awaitWriteFinish = (prevStat) => { + fs.stat(fullPath, (err, curStat) => { + if (err || !this._pendingWrites.has(path)) { + if (err && err.code !== 'ENOENT') awfEmit(err); + return; + } + + const now = Number(new Date()); + + if (prevStat && curStat.size !== prevStat.size) { + this._pendingWrites.get(path).lastChange = now; + } + const pw = this._pendingWrites.get(path); + const df = now - pw.lastChange; + + if (df >= threshold) { + this._pendingWrites.delete(path); + awfEmit(undefined, curStat); + } else { + timeoutHandler = setTimeout( + awaitWriteFinish, + this.options.awaitWriteFinish.pollInterval, + curStat + ); + } + }); + }; + + if (!this._pendingWrites.has(path)) { + this._pendingWrites.set(path, { + lastChange: now, + cancelWait: () => { + this._pendingWrites.delete(path); + clearTimeout(timeoutHandler); + return event; + } + }); + timeoutHandler = setTimeout( + awaitWriteFinish, + this.options.awaitWriteFinish.pollInterval + ); + } +} + +_getGlobIgnored() { + return [...this._ignoredPaths.values()]; +} + +/** + * Determines whether user has asked to ignore this path. + * @param {Path} path filepath or dir + * @param {fs.Stats=} stats result of fs.stat + * @returns {Boolean} + */ +_isIgnored(path, stats) { + if (this.options.atomic && DOT_RE.test(path)) return true; + if (!this._userIgnored) { + const {cwd} = this.options; + const ign = this.options.ignored; + + const ignored = ign && ign.map(normalizeIgnored(cwd)); + const paths = arrify(ignored) + .filter((path) => typeof path === STRING_TYPE && !isGlob(path)) + .map((path) => path + SLASH_GLOBSTAR); + const list = this._getGlobIgnored().map(normalizeIgnored(cwd)).concat(ignored, paths); + this._userIgnored = anymatch(list, undefined, ANYMATCH_OPTS); + } + + return this._userIgnored([path, stats]); +} + +_isntIgnored(path, stat) { + return !this._isIgnored(path, stat); +} + +/** + * Provides a set of common helpers and properties relating to symlink and glob handling. + * @param {Path} path file, directory, or glob pattern being watched + * @param {Number=} depth at any depth > 0, this isn't a glob + * @returns {WatchHelper} object containing helpers for this path + */ +_getWatchHelpers(path, depth) { + const watchPath = depth || this.options.disableGlobbing || !isGlob(path) ? path : globParent(path); + const follow = this.options.followSymlinks; + + return new WatchHelper(path, watchPath, follow, this); +} + +// Directory helpers +// ----------------- + +/** + * Provides directory tracking objects + * @param {String} directory path of the directory + * @returns {DirEntry} the directory's tracking object + */ +_getWatchedDir(directory) { + if (!this._boundRemove) this._boundRemove = this._remove.bind(this); + const dir = sysPath.resolve(directory); + if (!this._watched.has(dir)) this._watched.set(dir, new DirEntry(dir, this._boundRemove)); + return this._watched.get(dir); +} + +// File helpers +// ------------ + +/** + * Check for read permissions. + * Based on this answer on SO: https://stackoverflow.com/a/11781404/1358405 + * @param {fs.Stats} stats - object, result of fs_stat + * @returns {Boolean} indicates whether the file can be read +*/ +_hasReadPermissions(stats) { + if (this.options.ignorePermissionErrors) return true; + + // stats.mode may be bigint + const md = stats && Number.parseInt(stats.mode, 10); + const st = md & 0o777; + const it = Number.parseInt(st.toString(8)[0], 10); + return Boolean(4 & it); +} + +/** + * Handles emitting unlink events for + * files and directories, and via recursion, for + * files and directories within directories that are unlinked + * @param {String} directory within which the following item is located + * @param {String} item base path of item/directory + * @returns {void} +*/ +_remove(directory, item, isDirectory) { + // if what is being deleted is a directory, get that directory's paths + // for recursive deleting and cleaning of watched object + // if it is not a directory, nestedDirectoryChildren will be empty array + const path = sysPath.join(directory, item); + const fullPath = sysPath.resolve(path); + isDirectory = isDirectory != null + ? isDirectory + : this._watched.has(path) || this._watched.has(fullPath); + + // prevent duplicate handling in case of arriving here nearly simultaneously + // via multiple paths (such as _handleFile and _handleDir) + if (!this._throttle('remove', path, 100)) return; + + // if the only watched file is removed, watch for its return + if (!isDirectory && !this.options.useFsEvents && this._watched.size === 1) { + this.add(directory, item, true); + } + + // This will create a new entry in the watched object in either case + // so we got to do the directory check beforehand + const wp = this._getWatchedDir(path); + const nestedDirectoryChildren = wp.getChildren(); + + // Recursively remove children directories / files. + nestedDirectoryChildren.forEach(nested => this._remove(path, nested)); + + // Check if item was on the watched list and remove it + const parent = this._getWatchedDir(directory); + const wasTracked = parent.has(item); + parent.remove(item); + + // Fixes issue #1042 -> Relative paths were detected and added as symlinks + // (https://github.com/paulmillr/chokidar/blob/e1753ddbc9571bdc33b4a4af172d52cb6e611c10/lib/nodefs-handler.js#L612), + // but never removed from the map in case the path was deleted. + // This leads to an incorrect state if the path was recreated: + // https://github.com/paulmillr/chokidar/blob/e1753ddbc9571bdc33b4a4af172d52cb6e611c10/lib/nodefs-handler.js#L553 + if (this._symlinkPaths.has(fullPath)) { + this._symlinkPaths.delete(fullPath); + } + + // If we wait for this file to be fully written, cancel the wait. + let relPath = path; + if (this.options.cwd) relPath = sysPath.relative(this.options.cwd, path); + if (this.options.awaitWriteFinish && this._pendingWrites.has(relPath)) { + const event = this._pendingWrites.get(relPath).cancelWait(); + if (event === EV_ADD) return; + } + + // The Entry will either be a directory that just got removed + // or a bogus entry to a file, in either case we have to remove it + this._watched.delete(path); + this._watched.delete(fullPath); + const eventName = isDirectory ? EV_UNLINK_DIR : EV_UNLINK; + if (wasTracked && !this._isIgnored(path)) this._emit(eventName, path); + + // Avoid conflicts if we later create another file with the same name + if (!this.options.useFsEvents) { + this._closePath(path); + } +} + +/** + * Closes all watchers for a path + * @param {Path} path + */ +_closePath(path) { + this._closeFile(path) + const dir = sysPath.dirname(path); + this._getWatchedDir(dir).remove(sysPath.basename(path)); +} + +/** + * Closes only file-specific watchers + * @param {Path} path + */ +_closeFile(path) { + const closers = this._closers.get(path); + if (!closers) return; + closers.forEach(closer => closer()); + this._closers.delete(path); +} + +/** + * + * @param {Path} path + * @param {Function} closer + */ +_addPathCloser(path, closer) { + if (!closer) return; + let list = this._closers.get(path); + if (!list) { + list = []; + this._closers.set(path, list); + } + list.push(closer); +} + +_readdirp(root, opts) { + if (this.closed) return; + const options = {type: EV_ALL, alwaysStat: true, lstat: true, ...opts}; + let stream = readdirp(root, options); + this._streams.add(stream); + stream.once(STR_CLOSE, () => { + stream = undefined; + }); + stream.once(STR_END, () => { + if (stream) { + this._streams.delete(stream); + stream = undefined; + } + }); + return stream; +} + +} + +// Export FSWatcher class +exports.FSWatcher = FSWatcher; + +/** + * Instantiates watcher with paths to be tracked. + * @param {String|Array} paths file/directory paths and/or globs + * @param {Object=} options chokidar opts + * @returns an instance of FSWatcher for chaining. + */ +const watch = (paths, options) => { + const watcher = new FSWatcher(options); + watcher.add(paths); + return watcher; +}; + +exports.watch = watch; diff --git a/backend/node_modules/chokidar/lib/constants.js b/backend/node_modules/chokidar/lib/constants.js new file mode 100644 index 000000000..4743865d6 --- /dev/null +++ b/backend/node_modules/chokidar/lib/constants.js @@ -0,0 +1,66 @@ +'use strict'; + +const {sep} = require('path'); +const {platform} = process; +const os = require('os'); + +exports.EV_ALL = 'all'; +exports.EV_READY = 'ready'; +exports.EV_ADD = 'add'; +exports.EV_CHANGE = 'change'; +exports.EV_ADD_DIR = 'addDir'; +exports.EV_UNLINK = 'unlink'; +exports.EV_UNLINK_DIR = 'unlinkDir'; +exports.EV_RAW = 'raw'; +exports.EV_ERROR = 'error'; + +exports.STR_DATA = 'data'; +exports.STR_END = 'end'; +exports.STR_CLOSE = 'close'; + +exports.FSEVENT_CREATED = 'created'; +exports.FSEVENT_MODIFIED = 'modified'; +exports.FSEVENT_DELETED = 'deleted'; +exports.FSEVENT_MOVED = 'moved'; +exports.FSEVENT_CLONED = 'cloned'; +exports.FSEVENT_UNKNOWN = 'unknown'; +exports.FSEVENT_FLAG_MUST_SCAN_SUBDIRS = 1; +exports.FSEVENT_TYPE_FILE = 'file'; +exports.FSEVENT_TYPE_DIRECTORY = 'directory'; +exports.FSEVENT_TYPE_SYMLINK = 'symlink'; + +exports.KEY_LISTENERS = 'listeners'; +exports.KEY_ERR = 'errHandlers'; +exports.KEY_RAW = 'rawEmitters'; +exports.HANDLER_KEYS = [exports.KEY_LISTENERS, exports.KEY_ERR, exports.KEY_RAW]; + +exports.DOT_SLASH = `.${sep}`; + +exports.BACK_SLASH_RE = /\\/g; +exports.DOUBLE_SLASH_RE = /\/\//; +exports.SLASH_OR_BACK_SLASH_RE = /[/\\]/; +exports.DOT_RE = /\..*\.(sw[px])$|~$|\.subl.*\.tmp/; +exports.REPLACER_RE = /^\.[/\\]/; + +exports.SLASH = '/'; +exports.SLASH_SLASH = '//'; +exports.BRACE_START = '{'; +exports.BANG = '!'; +exports.ONE_DOT = '.'; +exports.TWO_DOTS = '..'; +exports.STAR = '*'; +exports.GLOBSTAR = '**'; +exports.ROOT_GLOBSTAR = '/**/*'; +exports.SLASH_GLOBSTAR = '/**'; +exports.DIR_SUFFIX = 'Dir'; +exports.ANYMATCH_OPTS = {dot: true}; +exports.STRING_TYPE = 'string'; +exports.FUNCTION_TYPE = 'function'; +exports.EMPTY_STR = ''; +exports.EMPTY_FN = () => {}; +exports.IDENTITY_FN = val => val; + +exports.isWindows = platform === 'win32'; +exports.isMacos = platform === 'darwin'; +exports.isLinux = platform === 'linux'; +exports.isIBMi = os.type() === 'OS400'; diff --git a/backend/node_modules/chokidar/lib/fsevents-handler.js b/backend/node_modules/chokidar/lib/fsevents-handler.js new file mode 100644 index 000000000..fe29393c1 --- /dev/null +++ b/backend/node_modules/chokidar/lib/fsevents-handler.js @@ -0,0 +1,526 @@ +'use strict'; + +const fs = require('fs'); +const sysPath = require('path'); +const { promisify } = require('util'); + +let fsevents; +try { + fsevents = require('fsevents'); +} catch (error) { + if (process.env.CHOKIDAR_PRINT_FSEVENTS_REQUIRE_ERROR) console.error(error); +} + +if (fsevents) { + // TODO: real check + const mtch = process.version.match(/v(\d+)\.(\d+)/); + if (mtch && mtch[1] && mtch[2]) { + const maj = Number.parseInt(mtch[1], 10); + const min = Number.parseInt(mtch[2], 10); + if (maj === 8 && min < 16) { + fsevents = undefined; + } + } +} + +const { + EV_ADD, + EV_CHANGE, + EV_ADD_DIR, + EV_UNLINK, + EV_ERROR, + STR_DATA, + STR_END, + FSEVENT_CREATED, + FSEVENT_MODIFIED, + FSEVENT_DELETED, + FSEVENT_MOVED, + // FSEVENT_CLONED, + FSEVENT_UNKNOWN, + FSEVENT_FLAG_MUST_SCAN_SUBDIRS, + FSEVENT_TYPE_FILE, + FSEVENT_TYPE_DIRECTORY, + FSEVENT_TYPE_SYMLINK, + + ROOT_GLOBSTAR, + DIR_SUFFIX, + DOT_SLASH, + FUNCTION_TYPE, + EMPTY_FN, + IDENTITY_FN +} = require('./constants'); + +const Depth = (value) => isNaN(value) ? {} : {depth: value}; + +const stat = promisify(fs.stat); +const lstat = promisify(fs.lstat); +const realpath = promisify(fs.realpath); + +const statMethods = { stat, lstat }; + +/** + * @typedef {String} Path + */ + +/** + * @typedef {Object} FsEventsWatchContainer + * @property {Set} listeners + * @property {Function} rawEmitter + * @property {{stop: Function}} watcher + */ + +// fsevents instance helper functions +/** + * Object to hold per-process fsevents instances (may be shared across chokidar FSWatcher instances) + * @type {Map} + */ +const FSEventsWatchers = new Map(); + +// Threshold of duplicate path prefixes at which to start +// consolidating going forward +const consolidateThreshhold = 10; + +const wrongEventFlags = new Set([ + 69888, 70400, 71424, 72704, 73472, 131328, 131840, 262912 +]); + +/** + * Instantiates the fsevents interface + * @param {Path} path path to be watched + * @param {Function} callback called when fsevents is bound and ready + * @returns {{stop: Function}} new fsevents instance + */ +const createFSEventsInstance = (path, callback) => { + const stop = fsevents.watch(path, callback); + return {stop}; +}; + +/** + * Instantiates the fsevents interface or binds listeners to an existing one covering + * the same file tree. + * @param {Path} path - to be watched + * @param {Path} realPath - real path for symlinks + * @param {Function} listener - called when fsevents emits events + * @param {Function} rawEmitter - passes data to listeners of the 'raw' event + * @returns {Function} closer + */ +function setFSEventsListener(path, realPath, listener, rawEmitter) { + let watchPath = sysPath.extname(realPath) ? sysPath.dirname(realPath) : realPath; + + const parentPath = sysPath.dirname(watchPath); + let cont = FSEventsWatchers.get(watchPath); + + // If we've accumulated a substantial number of paths that + // could have been consolidated by watching one directory + // above the current one, create a watcher on the parent + // path instead, so that we do consolidate going forward. + if (couldConsolidate(parentPath)) { + watchPath = parentPath; + } + + const resolvedPath = sysPath.resolve(path); + const hasSymlink = resolvedPath !== realPath; + + const filteredListener = (fullPath, flags, info) => { + if (hasSymlink) fullPath = fullPath.replace(realPath, resolvedPath); + if ( + fullPath === resolvedPath || + !fullPath.indexOf(resolvedPath + sysPath.sep) + ) listener(fullPath, flags, info); + }; + + // check if there is already a watcher on a parent path + // modifies `watchPath` to the parent path when it finds a match + let watchedParent = false; + for (const watchedPath of FSEventsWatchers.keys()) { + if (realPath.indexOf(sysPath.resolve(watchedPath) + sysPath.sep) === 0) { + watchPath = watchedPath; + cont = FSEventsWatchers.get(watchPath); + watchedParent = true; + break; + } + } + + if (cont || watchedParent) { + cont.listeners.add(filteredListener); + } else { + cont = { + listeners: new Set([filteredListener]), + rawEmitter, + watcher: createFSEventsInstance(watchPath, (fullPath, flags) => { + if (!cont.listeners.size) return; + if (flags & FSEVENT_FLAG_MUST_SCAN_SUBDIRS) return; + const info = fsevents.getInfo(fullPath, flags); + cont.listeners.forEach(list => { + list(fullPath, flags, info); + }); + + cont.rawEmitter(info.event, fullPath, info); + }) + }; + FSEventsWatchers.set(watchPath, cont); + } + + // removes this instance's listeners and closes the underlying fsevents + // instance if there are no more listeners left + return () => { + const lst = cont.listeners; + + lst.delete(filteredListener); + if (!lst.size) { + FSEventsWatchers.delete(watchPath); + if (cont.watcher) return cont.watcher.stop().then(() => { + cont.rawEmitter = cont.watcher = undefined; + Object.freeze(cont); + }); + } + }; +} + +// Decide whether or not we should start a new higher-level +// parent watcher +const couldConsolidate = (path) => { + let count = 0; + for (const watchPath of FSEventsWatchers.keys()) { + if (watchPath.indexOf(path) === 0) { + count++; + if (count >= consolidateThreshhold) { + return true; + } + } + } + + return false; +}; + +// returns boolean indicating whether fsevents can be used +const canUse = () => fsevents && FSEventsWatchers.size < 128; + +// determines subdirectory traversal levels from root to path +const calcDepth = (path, root) => { + let i = 0; + while (!path.indexOf(root) && (path = sysPath.dirname(path)) !== root) i++; + return i; +}; + +// returns boolean indicating whether the fsevents' event info has the same type +// as the one returned by fs.stat +const sameTypes = (info, stats) => ( + info.type === FSEVENT_TYPE_DIRECTORY && stats.isDirectory() || + info.type === FSEVENT_TYPE_SYMLINK && stats.isSymbolicLink() || + info.type === FSEVENT_TYPE_FILE && stats.isFile() +) + +/** + * @mixin + */ +class FsEventsHandler { + +/** + * @param {import('../index').FSWatcher} fsw + */ +constructor(fsw) { + this.fsw = fsw; +} +checkIgnored(path, stats) { + const ipaths = this.fsw._ignoredPaths; + if (this.fsw._isIgnored(path, stats)) { + ipaths.add(path); + if (stats && stats.isDirectory()) { + ipaths.add(path + ROOT_GLOBSTAR); + } + return true; + } + + ipaths.delete(path); + ipaths.delete(path + ROOT_GLOBSTAR); +} + +addOrChange(path, fullPath, realPath, parent, watchedDir, item, info, opts) { + const event = watchedDir.has(item) ? EV_CHANGE : EV_ADD; + this.handleEvent(event, path, fullPath, realPath, parent, watchedDir, item, info, opts); +} + +async checkExists(path, fullPath, realPath, parent, watchedDir, item, info, opts) { + try { + const stats = await stat(path) + if (this.fsw.closed) return; + if (sameTypes(info, stats)) { + this.addOrChange(path, fullPath, realPath, parent, watchedDir, item, info, opts); + } else { + this.handleEvent(EV_UNLINK, path, fullPath, realPath, parent, watchedDir, item, info, opts); + } + } catch (error) { + if (error.code === 'EACCES') { + this.addOrChange(path, fullPath, realPath, parent, watchedDir, item, info, opts); + } else { + this.handleEvent(EV_UNLINK, path, fullPath, realPath, parent, watchedDir, item, info, opts); + } + } +} + +handleEvent(event, path, fullPath, realPath, parent, watchedDir, item, info, opts) { + if (this.fsw.closed || this.checkIgnored(path)) return; + + if (event === EV_UNLINK) { + const isDirectory = info.type === FSEVENT_TYPE_DIRECTORY + // suppress unlink events on never before seen files + if (isDirectory || watchedDir.has(item)) { + this.fsw._remove(parent, item, isDirectory); + } + } else { + if (event === EV_ADD) { + // track new directories + if (info.type === FSEVENT_TYPE_DIRECTORY) this.fsw._getWatchedDir(path); + + if (info.type === FSEVENT_TYPE_SYMLINK && opts.followSymlinks) { + // push symlinks back to the top of the stack to get handled + const curDepth = opts.depth === undefined ? + undefined : calcDepth(fullPath, realPath) + 1; + return this._addToFsEvents(path, false, true, curDepth); + } + + // track new paths + // (other than symlinks being followed, which will be tracked soon) + this.fsw._getWatchedDir(parent).add(item); + } + /** + * @type {'add'|'addDir'|'unlink'|'unlinkDir'} + */ + const eventName = info.type === FSEVENT_TYPE_DIRECTORY ? event + DIR_SUFFIX : event; + this.fsw._emit(eventName, path); + if (eventName === EV_ADD_DIR) this._addToFsEvents(path, false, true); + } +} + +/** + * Handle symlinks encountered during directory scan + * @param {String} watchPath - file/dir path to be watched with fsevents + * @param {String} realPath - real path (in case of symlinks) + * @param {Function} transform - path transformer + * @param {Function} globFilter - path filter in case a glob pattern was provided + * @returns {Function} closer for the watcher instance +*/ +_watchWithFsEvents(watchPath, realPath, transform, globFilter) { + if (this.fsw.closed || this.fsw._isIgnored(watchPath)) return; + const opts = this.fsw.options; + const watchCallback = async (fullPath, flags, info) => { + if (this.fsw.closed) return; + if ( + opts.depth !== undefined && + calcDepth(fullPath, realPath) > opts.depth + ) return; + const path = transform(sysPath.join( + watchPath, sysPath.relative(watchPath, fullPath) + )); + if (globFilter && !globFilter(path)) return; + // ensure directories are tracked + const parent = sysPath.dirname(path); + const item = sysPath.basename(path); + const watchedDir = this.fsw._getWatchedDir( + info.type === FSEVENT_TYPE_DIRECTORY ? path : parent + ); + + // correct for wrong events emitted + if (wrongEventFlags.has(flags) || info.event === FSEVENT_UNKNOWN) { + if (typeof opts.ignored === FUNCTION_TYPE) { + let stats; + try { + stats = await stat(path); + } catch (error) {} + if (this.fsw.closed) return; + if (this.checkIgnored(path, stats)) return; + if (sameTypes(info, stats)) { + this.addOrChange(path, fullPath, realPath, parent, watchedDir, item, info, opts); + } else { + this.handleEvent(EV_UNLINK, path, fullPath, realPath, parent, watchedDir, item, info, opts); + } + } else { + this.checkExists(path, fullPath, realPath, parent, watchedDir, item, info, opts); + } + } else { + switch (info.event) { + case FSEVENT_CREATED: + case FSEVENT_MODIFIED: + return this.addOrChange(path, fullPath, realPath, parent, watchedDir, item, info, opts); + case FSEVENT_DELETED: + case FSEVENT_MOVED: + return this.checkExists(path, fullPath, realPath, parent, watchedDir, item, info, opts); + } + } + }; + + const closer = setFSEventsListener( + watchPath, + realPath, + watchCallback, + this.fsw._emitRaw + ); + + this.fsw._emitReady(); + return closer; +} + +/** + * Handle symlinks encountered during directory scan + * @param {String} linkPath path to symlink + * @param {String} fullPath absolute path to the symlink + * @param {Function} transform pre-existing path transformer + * @param {Number} curDepth level of subdirectories traversed to where symlink is + * @returns {Promise} + */ +async _handleFsEventsSymlink(linkPath, fullPath, transform, curDepth) { + // don't follow the same symlink more than once + if (this.fsw.closed || this.fsw._symlinkPaths.has(fullPath)) return; + + this.fsw._symlinkPaths.set(fullPath, true); + this.fsw._incrReadyCount(); + + try { + const linkTarget = await realpath(linkPath); + if (this.fsw.closed) return; + if (this.fsw._isIgnored(linkTarget)) { + return this.fsw._emitReady(); + } + + this.fsw._incrReadyCount(); + + // add the linkTarget for watching with a wrapper for transform + // that causes emitted paths to incorporate the link's path + this._addToFsEvents(linkTarget || linkPath, (path) => { + let aliasedPath = linkPath; + if (linkTarget && linkTarget !== DOT_SLASH) { + aliasedPath = path.replace(linkTarget, linkPath); + } else if (path !== DOT_SLASH) { + aliasedPath = sysPath.join(linkPath, path); + } + return transform(aliasedPath); + }, false, curDepth); + } catch(error) { + if (this.fsw._handleError(error)) { + return this.fsw._emitReady(); + } + } +} + +/** + * + * @param {Path} newPath + * @param {fs.Stats} stats + */ +emitAdd(newPath, stats, processPath, opts, forceAdd) { + const pp = processPath(newPath); + const isDir = stats.isDirectory(); + const dirObj = this.fsw._getWatchedDir(sysPath.dirname(pp)); + const base = sysPath.basename(pp); + + // ensure empty dirs get tracked + if (isDir) this.fsw._getWatchedDir(pp); + if (dirObj.has(base)) return; + dirObj.add(base); + + if (!opts.ignoreInitial || forceAdd === true) { + this.fsw._emit(isDir ? EV_ADD_DIR : EV_ADD, pp, stats); + } +} + +initWatch(realPath, path, wh, processPath) { + if (this.fsw.closed) return; + const closer = this._watchWithFsEvents( + wh.watchPath, + sysPath.resolve(realPath || wh.watchPath), + processPath, + wh.globFilter + ); + this.fsw._addPathCloser(path, closer); +} + +/** + * Handle added path with fsevents + * @param {String} path file/dir path or glob pattern + * @param {Function|Boolean=} transform converts working path to what the user expects + * @param {Boolean=} forceAdd ensure add is emitted + * @param {Number=} priorDepth Level of subdirectories already traversed. + * @returns {Promise} + */ +async _addToFsEvents(path, transform, forceAdd, priorDepth) { + if (this.fsw.closed) { + return; + } + const opts = this.fsw.options; + const processPath = typeof transform === FUNCTION_TYPE ? transform : IDENTITY_FN; + + const wh = this.fsw._getWatchHelpers(path); + + // evaluate what is at the path we're being asked to watch + try { + const stats = await statMethods[wh.statMethod](wh.watchPath); + if (this.fsw.closed) return; + if (this.fsw._isIgnored(wh.watchPath, stats)) { + throw null; + } + if (stats.isDirectory()) { + // emit addDir unless this is a glob parent + if (!wh.globFilter) this.emitAdd(processPath(path), stats, processPath, opts, forceAdd); + + // don't recurse further if it would exceed depth setting + if (priorDepth && priorDepth > opts.depth) return; + + // scan the contents of the dir + this.fsw._readdirp(wh.watchPath, { + fileFilter: entry => wh.filterPath(entry), + directoryFilter: entry => wh.filterDir(entry), + ...Depth(opts.depth - (priorDepth || 0)) + }).on(STR_DATA, (entry) => { + // need to check filterPath on dirs b/c filterDir is less restrictive + if (this.fsw.closed) { + return; + } + if (entry.stats.isDirectory() && !wh.filterPath(entry)) return; + + const joinedPath = sysPath.join(wh.watchPath, entry.path); + const {fullPath} = entry; + + if (wh.followSymlinks && entry.stats.isSymbolicLink()) { + // preserve the current depth here since it can't be derived from + // real paths past the symlink + const curDepth = opts.depth === undefined ? + undefined : calcDepth(joinedPath, sysPath.resolve(wh.watchPath)) + 1; + + this._handleFsEventsSymlink(joinedPath, fullPath, processPath, curDepth); + } else { + this.emitAdd(joinedPath, entry.stats, processPath, opts, forceAdd); + } + }).on(EV_ERROR, EMPTY_FN).on(STR_END, () => { + this.fsw._emitReady(); + }); + } else { + this.emitAdd(wh.watchPath, stats, processPath, opts, forceAdd); + this.fsw._emitReady(); + } + } catch (error) { + if (!error || this.fsw._handleError(error)) { + // TODO: Strange thing: "should not choke on an ignored watch path" will be failed without 2 ready calls -__- + this.fsw._emitReady(); + this.fsw._emitReady(); + } + } + + if (opts.persistent && forceAdd !== true) { + if (typeof transform === FUNCTION_TYPE) { + // realpath has already been resolved + this.initWatch(undefined, path, wh, processPath); + } else { + let realPath; + try { + realPath = await realpath(wh.watchPath); + } catch (e) {} + this.initWatch(realPath, path, wh, processPath); + } + } +} + +} + +module.exports = FsEventsHandler; +module.exports.canUse = canUse; diff --git a/backend/node_modules/chokidar/lib/nodefs-handler.js b/backend/node_modules/chokidar/lib/nodefs-handler.js new file mode 100644 index 000000000..199cfe9f9 --- /dev/null +++ b/backend/node_modules/chokidar/lib/nodefs-handler.js @@ -0,0 +1,654 @@ +'use strict'; + +const fs = require('fs'); +const sysPath = require('path'); +const { promisify } = require('util'); +const isBinaryPath = require('is-binary-path'); +const { + isWindows, + isLinux, + EMPTY_FN, + EMPTY_STR, + KEY_LISTENERS, + KEY_ERR, + KEY_RAW, + HANDLER_KEYS, + EV_CHANGE, + EV_ADD, + EV_ADD_DIR, + EV_ERROR, + STR_DATA, + STR_END, + BRACE_START, + STAR +} = require('./constants'); + +const THROTTLE_MODE_WATCH = 'watch'; + +const open = promisify(fs.open); +const stat = promisify(fs.stat); +const lstat = promisify(fs.lstat); +const close = promisify(fs.close); +const fsrealpath = promisify(fs.realpath); + +const statMethods = { lstat, stat }; + +// TODO: emit errors properly. Example: EMFILE on Macos. +const foreach = (val, fn) => { + if (val instanceof Set) { + val.forEach(fn); + } else { + fn(val); + } +}; + +const addAndConvert = (main, prop, item) => { + let container = main[prop]; + if (!(container instanceof Set)) { + main[prop] = container = new Set([container]); + } + container.add(item); +}; + +const clearItem = cont => key => { + const set = cont[key]; + if (set instanceof Set) { + set.clear(); + } else { + delete cont[key]; + } +}; + +const delFromSet = (main, prop, item) => { + const container = main[prop]; + if (container instanceof Set) { + container.delete(item); + } else if (container === item) { + delete main[prop]; + } +}; + +const isEmptySet = (val) => val instanceof Set ? val.size === 0 : !val; + +/** + * @typedef {String} Path + */ + +// fs_watch helpers + +// object to hold per-process fs_watch instances +// (may be shared across chokidar FSWatcher instances) + +/** + * @typedef {Object} FsWatchContainer + * @property {Set} listeners + * @property {Set} errHandlers + * @property {Set} rawEmitters + * @property {fs.FSWatcher=} watcher + * @property {Boolean=} watcherUnusable + */ + +/** + * @type {Map} + */ +const FsWatchInstances = new Map(); + +/** + * Instantiates the fs_watch interface + * @param {String} path to be watched + * @param {Object} options to be passed to fs_watch + * @param {Function} listener main event handler + * @param {Function} errHandler emits info about errors + * @param {Function} emitRaw emits raw event data + * @returns {fs.FSWatcher} new fsevents instance + */ +function createFsWatchInstance(path, options, listener, errHandler, emitRaw) { + const handleEvent = (rawEvent, evPath) => { + listener(path); + emitRaw(rawEvent, evPath, {watchedPath: path}); + + // emit based on events occurring for files from a directory's watcher in + // case the file's watcher misses it (and rely on throttling to de-dupe) + if (evPath && path !== evPath) { + fsWatchBroadcast( + sysPath.resolve(path, evPath), KEY_LISTENERS, sysPath.join(path, evPath) + ); + } + }; + try { + return fs.watch(path, options, handleEvent); + } catch (error) { + errHandler(error); + } +} + +/** + * Helper for passing fs_watch event data to a collection of listeners + * @param {Path} fullPath absolute path bound to fs_watch instance + * @param {String} type listener type + * @param {*=} val1 arguments to be passed to listeners + * @param {*=} val2 + * @param {*=} val3 + */ +const fsWatchBroadcast = (fullPath, type, val1, val2, val3) => { + const cont = FsWatchInstances.get(fullPath); + if (!cont) return; + foreach(cont[type], (listener) => { + listener(val1, val2, val3); + }); +}; + +/** + * Instantiates the fs_watch interface or binds listeners + * to an existing one covering the same file system entry + * @param {String} path + * @param {String} fullPath absolute path + * @param {Object} options to be passed to fs_watch + * @param {Object} handlers container for event listener functions + */ +const setFsWatchListener = (path, fullPath, options, handlers) => { + const {listener, errHandler, rawEmitter} = handlers; + let cont = FsWatchInstances.get(fullPath); + + /** @type {fs.FSWatcher=} */ + let watcher; + if (!options.persistent) { + watcher = createFsWatchInstance( + path, options, listener, errHandler, rawEmitter + ); + return watcher.close.bind(watcher); + } + if (cont) { + addAndConvert(cont, KEY_LISTENERS, listener); + addAndConvert(cont, KEY_ERR, errHandler); + addAndConvert(cont, KEY_RAW, rawEmitter); + } else { + watcher = createFsWatchInstance( + path, + options, + fsWatchBroadcast.bind(null, fullPath, KEY_LISTENERS), + errHandler, // no need to use broadcast here + fsWatchBroadcast.bind(null, fullPath, KEY_RAW) + ); + if (!watcher) return; + watcher.on(EV_ERROR, async (error) => { + const broadcastErr = fsWatchBroadcast.bind(null, fullPath, KEY_ERR); + cont.watcherUnusable = true; // documented since Node 10.4.1 + // Workaround for https://github.com/joyent/node/issues/4337 + if (isWindows && error.code === 'EPERM') { + try { + const fd = await open(path, 'r'); + await close(fd); + broadcastErr(error); + } catch (err) {} + } else { + broadcastErr(error); + } + }); + cont = { + listeners: listener, + errHandlers: errHandler, + rawEmitters: rawEmitter, + watcher + }; + FsWatchInstances.set(fullPath, cont); + } + // const index = cont.listeners.indexOf(listener); + + // removes this instance's listeners and closes the underlying fs_watch + // instance if there are no more listeners left + return () => { + delFromSet(cont, KEY_LISTENERS, listener); + delFromSet(cont, KEY_ERR, errHandler); + delFromSet(cont, KEY_RAW, rawEmitter); + if (isEmptySet(cont.listeners)) { + // Check to protect against issue gh-730. + // if (cont.watcherUnusable) { + cont.watcher.close(); + // } + FsWatchInstances.delete(fullPath); + HANDLER_KEYS.forEach(clearItem(cont)); + cont.watcher = undefined; + Object.freeze(cont); + } + }; +}; + +// fs_watchFile helpers + +// object to hold per-process fs_watchFile instances +// (may be shared across chokidar FSWatcher instances) +const FsWatchFileInstances = new Map(); + +/** + * Instantiates the fs_watchFile interface or binds listeners + * to an existing one covering the same file system entry + * @param {String} path to be watched + * @param {String} fullPath absolute path + * @param {Object} options options to be passed to fs_watchFile + * @param {Object} handlers container for event listener functions + * @returns {Function} closer + */ +const setFsWatchFileListener = (path, fullPath, options, handlers) => { + const {listener, rawEmitter} = handlers; + let cont = FsWatchFileInstances.get(fullPath); + + /* eslint-disable no-unused-vars, prefer-destructuring */ + let listeners = new Set(); + let rawEmitters = new Set(); + + const copts = cont && cont.options; + if (copts && (copts.persistent < options.persistent || copts.interval > options.interval)) { + // "Upgrade" the watcher to persistence or a quicker interval. + // This creates some unlikely edge case issues if the user mixes + // settings in a very weird way, but solving for those cases + // doesn't seem worthwhile for the added complexity. + listeners = cont.listeners; + rawEmitters = cont.rawEmitters; + fs.unwatchFile(fullPath); + cont = undefined; + } + + /* eslint-enable no-unused-vars, prefer-destructuring */ + + if (cont) { + addAndConvert(cont, KEY_LISTENERS, listener); + addAndConvert(cont, KEY_RAW, rawEmitter); + } else { + // TODO + // listeners.add(listener); + // rawEmitters.add(rawEmitter); + cont = { + listeners: listener, + rawEmitters: rawEmitter, + options, + watcher: fs.watchFile(fullPath, options, (curr, prev) => { + foreach(cont.rawEmitters, (rawEmitter) => { + rawEmitter(EV_CHANGE, fullPath, {curr, prev}); + }); + const currmtime = curr.mtimeMs; + if (curr.size !== prev.size || currmtime > prev.mtimeMs || currmtime === 0) { + foreach(cont.listeners, (listener) => listener(path, curr)); + } + }) + }; + FsWatchFileInstances.set(fullPath, cont); + } + // const index = cont.listeners.indexOf(listener); + + // Removes this instance's listeners and closes the underlying fs_watchFile + // instance if there are no more listeners left. + return () => { + delFromSet(cont, KEY_LISTENERS, listener); + delFromSet(cont, KEY_RAW, rawEmitter); + if (isEmptySet(cont.listeners)) { + FsWatchFileInstances.delete(fullPath); + fs.unwatchFile(fullPath); + cont.options = cont.watcher = undefined; + Object.freeze(cont); + } + }; +}; + +/** + * @mixin + */ +class NodeFsHandler { + +/** + * @param {import("../index").FSWatcher} fsW + */ +constructor(fsW) { + this.fsw = fsW; + this._boundHandleError = (error) => fsW._handleError(error); +} + +/** + * Watch file for changes with fs_watchFile or fs_watch. + * @param {String} path to file or dir + * @param {Function} listener on fs change + * @returns {Function} closer for the watcher instance + */ +_watchWithNodeFs(path, listener) { + const opts = this.fsw.options; + const directory = sysPath.dirname(path); + const basename = sysPath.basename(path); + const parent = this.fsw._getWatchedDir(directory); + parent.add(basename); + const absolutePath = sysPath.resolve(path); + const options = {persistent: opts.persistent}; + if (!listener) listener = EMPTY_FN; + + let closer; + if (opts.usePolling) { + options.interval = opts.enableBinaryInterval && isBinaryPath(basename) ? + opts.binaryInterval : opts.interval; + closer = setFsWatchFileListener(path, absolutePath, options, { + listener, + rawEmitter: this.fsw._emitRaw + }); + } else { + closer = setFsWatchListener(path, absolutePath, options, { + listener, + errHandler: this._boundHandleError, + rawEmitter: this.fsw._emitRaw + }); + } + return closer; +} + +/** + * Watch a file and emit add event if warranted. + * @param {Path} file Path + * @param {fs.Stats} stats result of fs_stat + * @param {Boolean} initialAdd was the file added at watch instantiation? + * @returns {Function} closer for the watcher instance + */ +_handleFile(file, stats, initialAdd) { + if (this.fsw.closed) { + return; + } + const dirname = sysPath.dirname(file); + const basename = sysPath.basename(file); + const parent = this.fsw._getWatchedDir(dirname); + // stats is always present + let prevStats = stats; + + // if the file is already being watched, do nothing + if (parent.has(basename)) return; + + const listener = async (path, newStats) => { + if (!this.fsw._throttle(THROTTLE_MODE_WATCH, file, 5)) return; + if (!newStats || newStats.mtimeMs === 0) { + try { + const newStats = await stat(file); + if (this.fsw.closed) return; + // Check that change event was not fired because of changed only accessTime. + const at = newStats.atimeMs; + const mt = newStats.mtimeMs; + if (!at || at <= mt || mt !== prevStats.mtimeMs) { + this.fsw._emit(EV_CHANGE, file, newStats); + } + if (isLinux && prevStats.ino !== newStats.ino) { + this.fsw._closeFile(path) + prevStats = newStats; + this.fsw._addPathCloser(path, this._watchWithNodeFs(file, listener)); + } else { + prevStats = newStats; + } + } catch (error) { + // Fix issues where mtime is null but file is still present + this.fsw._remove(dirname, basename); + } + // add is about to be emitted if file not already tracked in parent + } else if (parent.has(basename)) { + // Check that change event was not fired because of changed only accessTime. + const at = newStats.atimeMs; + const mt = newStats.mtimeMs; + if (!at || at <= mt || mt !== prevStats.mtimeMs) { + this.fsw._emit(EV_CHANGE, file, newStats); + } + prevStats = newStats; + } + } + // kick off the watcher + const closer = this._watchWithNodeFs(file, listener); + + // emit an add event if we're supposed to + if (!(initialAdd && this.fsw.options.ignoreInitial) && this.fsw._isntIgnored(file)) { + if (!this.fsw._throttle(EV_ADD, file, 0)) return; + this.fsw._emit(EV_ADD, file, stats); + } + + return closer; +} + +/** + * Handle symlinks encountered while reading a dir. + * @param {Object} entry returned by readdirp + * @param {String} directory path of dir being read + * @param {String} path of this item + * @param {String} item basename of this item + * @returns {Promise} true if no more processing is needed for this entry. + */ +async _handleSymlink(entry, directory, path, item) { + if (this.fsw.closed) { + return; + } + const full = entry.fullPath; + const dir = this.fsw._getWatchedDir(directory); + + if (!this.fsw.options.followSymlinks) { + // watch symlink directly (don't follow) and detect changes + this.fsw._incrReadyCount(); + + let linkPath; + try { + linkPath = await fsrealpath(path); + } catch (e) { + this.fsw._emitReady(); + return true; + } + + if (this.fsw.closed) return; + if (dir.has(item)) { + if (this.fsw._symlinkPaths.get(full) !== linkPath) { + this.fsw._symlinkPaths.set(full, linkPath); + this.fsw._emit(EV_CHANGE, path, entry.stats); + } + } else { + dir.add(item); + this.fsw._symlinkPaths.set(full, linkPath); + this.fsw._emit(EV_ADD, path, entry.stats); + } + this.fsw._emitReady(); + return true; + } + + // don't follow the same symlink more than once + if (this.fsw._symlinkPaths.has(full)) { + return true; + } + + this.fsw._symlinkPaths.set(full, true); +} + +_handleRead(directory, initialAdd, wh, target, dir, depth, throttler) { + // Normalize the directory name on Windows + directory = sysPath.join(directory, EMPTY_STR); + + if (!wh.hasGlob) { + throttler = this.fsw._throttle('readdir', directory, 1000); + if (!throttler) return; + } + + const previous = this.fsw._getWatchedDir(wh.path); + const current = new Set(); + + let stream = this.fsw._readdirp(directory, { + fileFilter: entry => wh.filterPath(entry), + directoryFilter: entry => wh.filterDir(entry), + depth: 0 + }).on(STR_DATA, async (entry) => { + if (this.fsw.closed) { + stream = undefined; + return; + } + const item = entry.path; + let path = sysPath.join(directory, item); + current.add(item); + + if (entry.stats.isSymbolicLink() && await this._handleSymlink(entry, directory, path, item)) { + return; + } + + if (this.fsw.closed) { + stream = undefined; + return; + } + // Files that present in current directory snapshot + // but absent in previous are added to watch list and + // emit `add` event. + if (item === target || !target && !previous.has(item)) { + this.fsw._incrReadyCount(); + + // ensure relativeness of path is preserved in case of watcher reuse + path = sysPath.join(dir, sysPath.relative(dir, path)); + + this._addToNodeFs(path, initialAdd, wh, depth + 1); + } + }).on(EV_ERROR, this._boundHandleError); + + return new Promise(resolve => + stream.once(STR_END, () => { + if (this.fsw.closed) { + stream = undefined; + return; + } + const wasThrottled = throttler ? throttler.clear() : false; + + resolve(); + + // Files that absent in current directory snapshot + // but present in previous emit `remove` event + // and are removed from @watched[directory]. + previous.getChildren().filter((item) => { + return item !== directory && + !current.has(item) && + // in case of intersecting globs; + // a path may have been filtered out of this readdir, but + // shouldn't be removed because it matches a different glob + (!wh.hasGlob || wh.filterPath({ + fullPath: sysPath.resolve(directory, item) + })); + }).forEach((item) => { + this.fsw._remove(directory, item); + }); + + stream = undefined; + + // one more time for any missed in case changes came in extremely quickly + if (wasThrottled) this._handleRead(directory, false, wh, target, dir, depth, throttler); + }) + ); +} + +/** + * Read directory to add / remove files from `@watched` list and re-read it on change. + * @param {String} dir fs path + * @param {fs.Stats} stats + * @param {Boolean} initialAdd + * @param {Number} depth relative to user-supplied path + * @param {String} target child path targeted for watch + * @param {Object} wh Common watch helpers for this path + * @param {String} realpath + * @returns {Promise} closer for the watcher instance. + */ +async _handleDir(dir, stats, initialAdd, depth, target, wh, realpath) { + const parentDir = this.fsw._getWatchedDir(sysPath.dirname(dir)); + const tracked = parentDir.has(sysPath.basename(dir)); + if (!(initialAdd && this.fsw.options.ignoreInitial) && !target && !tracked) { + if (!wh.hasGlob || wh.globFilter(dir)) this.fsw._emit(EV_ADD_DIR, dir, stats); + } + + // ensure dir is tracked (harmless if redundant) + parentDir.add(sysPath.basename(dir)); + this.fsw._getWatchedDir(dir); + let throttler; + let closer; + + const oDepth = this.fsw.options.depth; + if ((oDepth == null || depth <= oDepth) && !this.fsw._symlinkPaths.has(realpath)) { + if (!target) { + await this._handleRead(dir, initialAdd, wh, target, dir, depth, throttler); + if (this.fsw.closed) return; + } + + closer = this._watchWithNodeFs(dir, (dirPath, stats) => { + // if current directory is removed, do nothing + if (stats && stats.mtimeMs === 0) return; + + this._handleRead(dirPath, false, wh, target, dir, depth, throttler); + }); + } + return closer; +} + +/** + * Handle added file, directory, or glob pattern. + * Delegates call to _handleFile / _handleDir after checks. + * @param {String} path to file or ir + * @param {Boolean} initialAdd was the file added at watch instantiation? + * @param {Object} priorWh depth relative to user-supplied path + * @param {Number} depth Child path actually targeted for watch + * @param {String=} target Child path actually targeted for watch + * @returns {Promise} + */ +async _addToNodeFs(path, initialAdd, priorWh, depth, target) { + const ready = this.fsw._emitReady; + if (this.fsw._isIgnored(path) || this.fsw.closed) { + ready(); + return false; + } + + const wh = this.fsw._getWatchHelpers(path, depth); + if (!wh.hasGlob && priorWh) { + wh.hasGlob = priorWh.hasGlob; + wh.globFilter = priorWh.globFilter; + wh.filterPath = entry => priorWh.filterPath(entry); + wh.filterDir = entry => priorWh.filterDir(entry); + } + + // evaluate what is at the path we're being asked to watch + try { + const stats = await statMethods[wh.statMethod](wh.watchPath); + if (this.fsw.closed) return; + if (this.fsw._isIgnored(wh.watchPath, stats)) { + ready(); + return false; + } + + const follow = this.fsw.options.followSymlinks && !path.includes(STAR) && !path.includes(BRACE_START); + let closer; + if (stats.isDirectory()) { + const absPath = sysPath.resolve(path); + const targetPath = follow ? await fsrealpath(path) : path; + if (this.fsw.closed) return; + closer = await this._handleDir(wh.watchPath, stats, initialAdd, depth, target, wh, targetPath); + if (this.fsw.closed) return; + // preserve this symlink's target path + if (absPath !== targetPath && targetPath !== undefined) { + this.fsw._symlinkPaths.set(absPath, targetPath); + } + } else if (stats.isSymbolicLink()) { + const targetPath = follow ? await fsrealpath(path) : path; + if (this.fsw.closed) return; + const parent = sysPath.dirname(wh.watchPath); + this.fsw._getWatchedDir(parent).add(wh.watchPath); + this.fsw._emit(EV_ADD, wh.watchPath, stats); + closer = await this._handleDir(parent, stats, initialAdd, depth, path, wh, targetPath); + if (this.fsw.closed) return; + + // preserve this symlink's target path + if (targetPath !== undefined) { + this.fsw._symlinkPaths.set(sysPath.resolve(path), targetPath); + } + } else { + closer = this._handleFile(wh.watchPath, stats, initialAdd); + } + ready(); + + this.fsw._addPathCloser(path, closer); + return false; + + } catch (error) { + if (this.fsw._handleError(error)) { + ready(); + return path; + } + } +} + +} + +module.exports = NodeFsHandler; diff --git a/backend/node_modules/chokidar/package.json b/backend/node_modules/chokidar/package.json new file mode 100644 index 000000000..e8f8b3d99 --- /dev/null +++ b/backend/node_modules/chokidar/package.json @@ -0,0 +1,70 @@ +{ + "name": "chokidar", + "description": "Minimal and efficient cross-platform file watching library", + "version": "3.6.0", + "homepage": "https://github.com/paulmillr/chokidar", + "author": "Paul Miller (https://paulmillr.com)", + "contributors": [ + "Paul Miller (https://paulmillr.com)", + "Elan Shanker" + ], + "engines": { + "node": ">= 8.10.0" + }, + "main": "index.js", + "types": "./types/index.d.ts", + "dependencies": { + "anymatch": "~3.1.2", + "braces": "~3.0.2", + "glob-parent": "~5.1.2", + "is-binary-path": "~2.1.0", + "is-glob": "~4.0.1", + "normalize-path": "~3.0.0", + "readdirp": "~3.6.0" + }, + "optionalDependencies": { + "fsevents": "~2.3.2" + }, + "devDependencies": { + "@types/node": "^14", + "chai": "^4.3", + "dtslint": "^3.3.0", + "eslint": "^7.0.0", + "mocha": "^7.0.0", + "rimraf": "^3.0.0", + "sinon": "^9.0.1", + "sinon-chai": "^3.3.0", + "typescript": "^4.4.3", + "upath": "^1.2.0" + }, + "files": [ + "index.js", + "lib/*.js", + "types/index.d.ts" + ], + "repository": { + "type": "git", + "url": "git+https://github.com/paulmillr/chokidar.git" + }, + "bugs": { + "url": "https://github.com/paulmillr/chokidar/issues" + }, + "license": "MIT", + "scripts": { + "dtslint": "dtslint types", + "lint": "eslint --report-unused-disable-directives --ignore-path .gitignore .", + "build": "npm ls", + "mocha": "mocha --exit --timeout 90000", + "test": "npm run lint && npm run mocha" + }, + "keywords": [ + "fs", + "watch", + "watchFile", + "watcher", + "watching", + "file", + "fsevents" + ], + "funding": "https://paulmillr.com/funding/" +} diff --git a/backend/node_modules/chokidar/types/index.d.ts b/backend/node_modules/chokidar/types/index.d.ts new file mode 100644 index 000000000..455806638 --- /dev/null +++ b/backend/node_modules/chokidar/types/index.d.ts @@ -0,0 +1,192 @@ +// TypeScript Version: 3.0 + +/// + +import * as fs from "fs"; +import { EventEmitter } from "events"; +import { Matcher } from 'anymatch'; + +export class FSWatcher extends EventEmitter implements fs.FSWatcher { + options: WatchOptions; + + /** + * Constructs a new FSWatcher instance with optional WatchOptions parameter. + */ + constructor(options?: WatchOptions); + + /** + * Add files, directories, or glob patterns for tracking. Takes an array of strings or just one + * string. + */ + add(paths: string | ReadonlyArray): this; + + /** + * Stop watching files, directories, or glob patterns. Takes an array of strings or just one + * string. + */ + unwatch(paths: string | ReadonlyArray): this; + + /** + * Returns an object representing all the paths on the file system being watched by this + * `FSWatcher` instance. The object's keys are all the directories (using absolute paths unless + * the `cwd` option was used), and the values are arrays of the names of the items contained in + * each directory. + */ + getWatched(): { + [directory: string]: string[]; + }; + + /** + * Removes all listeners from watched files. + */ + close(): Promise; + + on(event: 'add'|'addDir'|'change', listener: (path: string, stats?: fs.Stats) => void): this; + + on(event: 'all', listener: (eventName: 'add'|'addDir'|'change'|'unlink'|'unlinkDir', path: string, stats?: fs.Stats) => void): this; + + /** + * Error occurred + */ + on(event: 'error', listener: (error: Error) => void): this; + + /** + * Exposes the native Node `fs.FSWatcher events` + */ + on(event: 'raw', listener: (eventName: string, path: string, details: any) => void): this; + + /** + * Fires when the initial scan is complete + */ + on(event: 'ready', listener: () => void): this; + + on(event: 'unlink'|'unlinkDir', listener: (path: string) => void): this; + + on(event: string, listener: (...args: any[]) => void): this; + + ref(): this; + + unref(): this; +} + +export interface WatchOptions { + /** + * Indicates whether the process should continue to run as long as files are being watched. If + * set to `false` when using `fsevents` to watch, no more events will be emitted after `ready`, + * even if the process continues to run. + */ + persistent?: boolean; + + /** + * ([anymatch](https://github.com/micromatch/anymatch)-compatible definition) Defines files/paths to + * be ignored. The whole relative or absolute path is tested, not just filename. If a function + * with two arguments is provided, it gets called twice per path - once with a single argument + * (the path), second time with two arguments (the path and the + * [`fs.Stats`](https://nodejs.org/api/fs.html#fs_class_fs_stats) object of that path). + */ + ignored?: Matcher; + + /** + * If set to `false` then `add`/`addDir` events are also emitted for matching paths while + * instantiating the watching as chokidar discovers these file paths (before the `ready` event). + */ + ignoreInitial?: boolean; + + /** + * When `false`, only the symlinks themselves will be watched for changes instead of following + * the link references and bubbling events through the link's path. + */ + followSymlinks?: boolean; + + /** + * The base directory from which watch `paths` are to be derived. Paths emitted with events will + * be relative to this. + */ + cwd?: string; + + /** + * If set to true then the strings passed to .watch() and .add() are treated as literal path + * names, even if they look like globs. Default: false. + */ + disableGlobbing?: boolean; + + /** + * Whether to use fs.watchFile (backed by polling), or fs.watch. If polling leads to high CPU + * utilization, consider setting this to `false`. It is typically necessary to **set this to + * `true` to successfully watch files over a network**, and it may be necessary to successfully + * watch files in other non-standard situations. Setting to `true` explicitly on OS X overrides + * the `useFsEvents` default. + */ + usePolling?: boolean; + + /** + * Whether to use the `fsevents` watching interface if available. When set to `true` explicitly + * and `fsevents` is available this supercedes the `usePolling` setting. When set to `false` on + * OS X, `usePolling: true` becomes the default. + */ + useFsEvents?: boolean; + + /** + * If relying upon the [`fs.Stats`](https://nodejs.org/api/fs.html#fs_class_fs_stats) object that + * may get passed with `add`, `addDir`, and `change` events, set this to `true` to ensure it is + * provided even in cases where it wasn't already available from the underlying watch events. + */ + alwaysStat?: boolean; + + /** + * If set, limits how many levels of subdirectories will be traversed. + */ + depth?: number; + + /** + * Interval of file system polling. + */ + interval?: number; + + /** + * Interval of file system polling for binary files. ([see list of binary extensions](https://gi + * thub.com/sindresorhus/binary-extensions/blob/master/binary-extensions.json)) + */ + binaryInterval?: number; + + /** + * Indicates whether to watch files that don't have read permissions if possible. If watching + * fails due to `EPERM` or `EACCES` with this set to `true`, the errors will be suppressed + * silently. + */ + ignorePermissionErrors?: boolean; + + /** + * `true` if `useFsEvents` and `usePolling` are `false`). Automatically filters out artifacts + * that occur when using editors that use "atomic writes" instead of writing directly to the + * source file. If a file is re-added within 100 ms of being deleted, Chokidar emits a `change` + * event rather than `unlink` then `add`. If the default of 100 ms does not work well for you, + * you can override it by setting `atomic` to a custom value, in milliseconds. + */ + atomic?: boolean | number; + + /** + * can be set to an object in order to adjust timing params: + */ + awaitWriteFinish?: AwaitWriteFinishOptions | boolean; +} + +export interface AwaitWriteFinishOptions { + /** + * Amount of time in milliseconds for a file size to remain constant before emitting its event. + */ + stabilityThreshold?: number; + + /** + * File size polling interval. + */ + pollInterval?: number; +} + +/** + * produces an instance of `FSWatcher`. + */ +export function watch( + paths: string | ReadonlyArray, + options?: WatchOptions +): FSWatcher; diff --git a/backend/node_modules/chownr/LICENSE b/backend/node_modules/chownr/LICENSE new file mode 100644 index 000000000..19129e315 --- /dev/null +++ b/backend/node_modules/chownr/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright (c) Isaac Z. Schlueter and Contributors + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/backend/node_modules/chownr/README.md b/backend/node_modules/chownr/README.md new file mode 100644 index 000000000..70e9a54a3 --- /dev/null +++ b/backend/node_modules/chownr/README.md @@ -0,0 +1,3 @@ +Like `chown -R`. + +Takes the same arguments as `fs.chown()` diff --git a/backend/node_modules/chownr/chownr.js b/backend/node_modules/chownr/chownr.js new file mode 100644 index 000000000..0d4093216 --- /dev/null +++ b/backend/node_modules/chownr/chownr.js @@ -0,0 +1,167 @@ +'use strict' +const fs = require('fs') +const path = require('path') + +/* istanbul ignore next */ +const LCHOWN = fs.lchown ? 'lchown' : 'chown' +/* istanbul ignore next */ +const LCHOWNSYNC = fs.lchownSync ? 'lchownSync' : 'chownSync' + +/* istanbul ignore next */ +const needEISDIRHandled = fs.lchown && + !process.version.match(/v1[1-9]+\./) && + !process.version.match(/v10\.[6-9]/) + +const lchownSync = (path, uid, gid) => { + try { + return fs[LCHOWNSYNC](path, uid, gid) + } catch (er) { + if (er.code !== 'ENOENT') + throw er + } +} + +/* istanbul ignore next */ +const chownSync = (path, uid, gid) => { + try { + return fs.chownSync(path, uid, gid) + } catch (er) { + if (er.code !== 'ENOENT') + throw er + } +} + +/* istanbul ignore next */ +const handleEISDIR = + needEISDIRHandled ? (path, uid, gid, cb) => er => { + // Node prior to v10 had a very questionable implementation of + // fs.lchown, which would always try to call fs.open on a directory + // Fall back to fs.chown in those cases. + if (!er || er.code !== 'EISDIR') + cb(er) + else + fs.chown(path, uid, gid, cb) + } + : (_, __, ___, cb) => cb + +/* istanbul ignore next */ +const handleEISDirSync = + needEISDIRHandled ? (path, uid, gid) => { + try { + return lchownSync(path, uid, gid) + } catch (er) { + if (er.code !== 'EISDIR') + throw er + chownSync(path, uid, gid) + } + } + : (path, uid, gid) => lchownSync(path, uid, gid) + +// fs.readdir could only accept an options object as of node v6 +const nodeVersion = process.version +let readdir = (path, options, cb) => fs.readdir(path, options, cb) +let readdirSync = (path, options) => fs.readdirSync(path, options) +/* istanbul ignore next */ +if (/^v4\./.test(nodeVersion)) + readdir = (path, options, cb) => fs.readdir(path, cb) + +const chown = (cpath, uid, gid, cb) => { + fs[LCHOWN](cpath, uid, gid, handleEISDIR(cpath, uid, gid, er => { + // Skip ENOENT error + cb(er && er.code !== 'ENOENT' ? er : null) + })) +} + +const chownrKid = (p, child, uid, gid, cb) => { + if (typeof child === 'string') + return fs.lstat(path.resolve(p, child), (er, stats) => { + // Skip ENOENT error + if (er) + return cb(er.code !== 'ENOENT' ? er : null) + stats.name = child + chownrKid(p, stats, uid, gid, cb) + }) + + if (child.isDirectory()) { + chownr(path.resolve(p, child.name), uid, gid, er => { + if (er) + return cb(er) + const cpath = path.resolve(p, child.name) + chown(cpath, uid, gid, cb) + }) + } else { + const cpath = path.resolve(p, child.name) + chown(cpath, uid, gid, cb) + } +} + + +const chownr = (p, uid, gid, cb) => { + readdir(p, { withFileTypes: true }, (er, children) => { + // any error other than ENOTDIR or ENOTSUP means it's not readable, + // or doesn't exist. give up. + if (er) { + if (er.code === 'ENOENT') + return cb() + else if (er.code !== 'ENOTDIR' && er.code !== 'ENOTSUP') + return cb(er) + } + if (er || !children.length) + return chown(p, uid, gid, cb) + + let len = children.length + let errState = null + const then = er => { + if (errState) + return + if (er) + return cb(errState = er) + if (-- len === 0) + return chown(p, uid, gid, cb) + } + + children.forEach(child => chownrKid(p, child, uid, gid, then)) + }) +} + +const chownrKidSync = (p, child, uid, gid) => { + if (typeof child === 'string') { + try { + const stats = fs.lstatSync(path.resolve(p, child)) + stats.name = child + child = stats + } catch (er) { + if (er.code === 'ENOENT') + return + else + throw er + } + } + + if (child.isDirectory()) + chownrSync(path.resolve(p, child.name), uid, gid) + + handleEISDirSync(path.resolve(p, child.name), uid, gid) +} + +const chownrSync = (p, uid, gid) => { + let children + try { + children = readdirSync(p, { withFileTypes: true }) + } catch (er) { + if (er.code === 'ENOENT') + return + else if (er.code === 'ENOTDIR' || er.code === 'ENOTSUP') + return handleEISDirSync(p, uid, gid) + else + throw er + } + + if (children && children.length) + children.forEach(child => chownrKidSync(p, child, uid, gid)) + + return handleEISDirSync(p, uid, gid) +} + +module.exports = chownr +chownr.sync = chownrSync diff --git a/backend/node_modules/chownr/package.json b/backend/node_modules/chownr/package.json new file mode 100644 index 000000000..5b0214ca1 --- /dev/null +++ b/backend/node_modules/chownr/package.json @@ -0,0 +1,32 @@ +{ + "author": "Isaac Z. Schlueter (http://blog.izs.me/)", + "name": "chownr", + "description": "like `chown -R`", + "version": "2.0.0", + "repository": { + "type": "git", + "url": "git://github.com/isaacs/chownr.git" + }, + "main": "chownr.js", + "files": [ + "chownr.js" + ], + "devDependencies": { + "mkdirp": "0.3", + "rimraf": "^2.7.1", + "tap": "^14.10.6" + }, + "tap": { + "check-coverage": true + }, + "scripts": { + "test": "tap", + "preversion": "npm test", + "postversion": "npm publish", + "prepublishOnly": "git push origin --follow-tags" + }, + "license": "ISC", + "engines": { + "node": ">=10" + } +} diff --git a/backend/node_modules/color-support/LICENSE b/backend/node_modules/color-support/LICENSE new file mode 100644 index 000000000..19129e315 --- /dev/null +++ b/backend/node_modules/color-support/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright (c) Isaac Z. Schlueter and Contributors + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/backend/node_modules/color-support/README.md b/backend/node_modules/color-support/README.md new file mode 100644 index 000000000..f89aa17d3 --- /dev/null +++ b/backend/node_modules/color-support/README.md @@ -0,0 +1,129 @@ +# color-support + +A module which will endeavor to guess your terminal's level of color +support. + +[![Build Status](https://travis-ci.org/isaacs/color-support.svg?branch=master)](https://travis-ci.org/isaacs/color-support) [![Coverage Status](https://coveralls.io/repos/github/isaacs/color-support/badge.svg?branch=master)](https://coveralls.io/github/isaacs/color-support?branch=master) + +This is similar to `supports-color`, but it does not read +`process.argv`. + +1. If not in a node environment, not supported. + +2. If stdout is not a TTY, not supported, unless the `ignoreTTY` + option is set. + +3. If the `TERM` environ is `dumb`, not supported, unless the + `ignoreDumb` option is set. + +4. If on Windows, then support 16 colors. + +5. If using Tmux, then support 256 colors. + +7. Handle continuous-integration servers. If `CI` or + `TEAMCITY_VERSION` are set in the environment, and `TRAVIS` is not + set, then color is not supported, unless `ignoreCI` option is set. + +6. Guess based on the `TERM_PROGRAM` environ. These terminals support + 16m colors: + + - `iTerm.app` version 3.x supports 16m colors, below support 256 + - `MacTerm` supports 16m colors + - `Apple_Terminal` supports 256 colors + - Have more things that belong on this list? Send a PR! + +8. Make a guess based on the `TERM` environment variable. Any + `xterm-256color` will get 256 colors. Any screen, xterm, vt100, + color, ansi, cygwin, or linux `TERM` will get 16 colors. + +9. If `COLORTERM` environment variable is set, then support 16 colors. + +10. At this point, we assume that color is not supported. + +## USAGE + +```javascript +var testColorSupport = require('color-support') +var colorSupport = testColorSupport(/* options object */) + +if (!colorSupport) { + console.log('color is not supported') +} else if (colorSupport.has16m) { + console.log('\x1b[38;2;102;194;255m16m colors\x1b[0m') +} else if (colorSupport.has256) { + console.log('\x1b[38;5;119m256 colors\x1b[0m') +} else if (colorSupport.hasBasic) { + console.log('\x1b[31mbasic colors\x1b[0m') +} else { + console.log('this is impossible, but colors are not supported') +} +``` + +If you don't have any options to set, you can also just look at the +flags which will all be set on the test function itself. (Of course, +this doesn't return a falsey value when colors aren't supported, and +doesn't allow you to set options.) + +```javascript +var colorSupport = require('color-support') + +if (colorSupport.has16m) { + console.log('\x1b[38;2;102;194;255m16m colors\x1b[0m') +} else if (colorSupport.has256) { + console.log('\x1b[38;5;119m256 colors\x1b[0m') +} else if (colorSupport.hasBasic) { + console.log('\x1b[31mbasic colors\x1b[0m') +} else { + console.log('colors are not supported') +} +``` + +## Options + +You can pass in the following options. + +* ignoreTTY - default false. Ignore the `isTTY` check. +* ignoreDumb - default false. Ignore `TERM=dumb` environ check. +* ignoreCI - default false. Ignore `CI` environ check. +* env - Object for environment vars. Defaults to `process.env`. +* stream - Stream for `isTTY` check. Defaults to `process.stdout`. +* term - String for `TERM` checking. Defaults to `env.TERM`. +* alwaysReturn - default false. Return an object when colors aren't + supported (instead of returning `false`). +* level - A number from 0 to 3. This will return a result for the + specified level. This is useful if you want to be able to set the + color support level explicitly as a number in an environment + variable or config, but then use the object flags in your program. + Except for `alwaysReturn` to return an object for level 0, all other + options are ignored, since no checking is done if a level is + explicitly set. + +## Return Value + +If no color support is available, then `false` is returned by default, +unless the `alwaysReturn` flag is set to `true`. This is so that the +simple question of "can I use colors or not" can treat any truthy +return as "yes". + +Otherwise, the return object has the following fields: + +* `level` - A number from 0 to 3 + * `0` - No color support + * `1` - Basic (16) color support + * `2` - 256 color support + * `3` - 16 million (true) color support +* `hasBasic` - Boolean +* `has256` - Boolean +* `has16m` - Boolean + +## CLI + +You can run the `color-support` bin from the command line which will +just dump the values as this module calculates them in whatever env +it's run. It takes no command line arguments. + +## Credits + +This is a spiritual, if not actual, fork of +[supports-color](http://npm.im/supports-color) by the ever prolific +[Sindre Sorhus](http://npm.im/~sindresorhus). diff --git a/backend/node_modules/color-support/bin.js b/backend/node_modules/color-support/bin.js new file mode 100755 index 000000000..3c0a96721 --- /dev/null +++ b/backend/node_modules/color-support/bin.js @@ -0,0 +1,3 @@ +#!/usr/bin/env node +var colorSupport = require('./')({alwaysReturn: true }) +console.log(JSON.stringify(colorSupport, null, 2)) diff --git a/backend/node_modules/color-support/browser.js b/backend/node_modules/color-support/browser.js new file mode 100644 index 000000000..ab5c6631a --- /dev/null +++ b/backend/node_modules/color-support/browser.js @@ -0,0 +1,14 @@ +module.exports = colorSupport({ alwaysReturn: true }, colorSupport) + +function colorSupport(options, obj) { + obj = obj || {} + options = options || {} + obj.level = 0 + obj.hasBasic = false + obj.has256 = false + obj.has16m = false + if (!options.alwaysReturn) { + return false + } + return obj +} diff --git a/backend/node_modules/color-support/index.js b/backend/node_modules/color-support/index.js new file mode 100644 index 000000000..6b6f3b281 --- /dev/null +++ b/backend/node_modules/color-support/index.js @@ -0,0 +1,134 @@ +// call it on itself so we can test the export val for basic stuff +module.exports = colorSupport({ alwaysReturn: true }, colorSupport) + +function hasNone (obj, options) { + obj.level = 0 + obj.hasBasic = false + obj.has256 = false + obj.has16m = false + if (!options.alwaysReturn) { + return false + } + return obj +} + +function hasBasic (obj) { + obj.hasBasic = true + obj.has256 = false + obj.has16m = false + obj.level = 1 + return obj +} + +function has256 (obj) { + obj.hasBasic = true + obj.has256 = true + obj.has16m = false + obj.level = 2 + return obj +} + +function has16m (obj) { + obj.hasBasic = true + obj.has256 = true + obj.has16m = true + obj.level = 3 + return obj +} + +function colorSupport (options, obj) { + options = options || {} + + obj = obj || {} + + // if just requesting a specific level, then return that. + if (typeof options.level === 'number') { + switch (options.level) { + case 0: + return hasNone(obj, options) + case 1: + return hasBasic(obj) + case 2: + return has256(obj) + case 3: + return has16m(obj) + } + } + + obj.level = 0 + obj.hasBasic = false + obj.has256 = false + obj.has16m = false + + if (typeof process === 'undefined' || + !process || + !process.stdout || + !process.env || + !process.platform) { + return hasNone(obj, options) + } + + var env = options.env || process.env + var stream = options.stream || process.stdout + var term = options.term || env.TERM || '' + var platform = options.platform || process.platform + + if (!options.ignoreTTY && !stream.isTTY) { + return hasNone(obj, options) + } + + if (!options.ignoreDumb && term === 'dumb' && !env.COLORTERM) { + return hasNone(obj, options) + } + + if (platform === 'win32') { + return hasBasic(obj) + } + + if (env.TMUX) { + return has256(obj) + } + + if (!options.ignoreCI && (env.CI || env.TEAMCITY_VERSION)) { + if (env.TRAVIS) { + return has256(obj) + } else { + return hasNone(obj, options) + } + } + + // TODO: add more term programs + switch (env.TERM_PROGRAM) { + case 'iTerm.app': + var ver = env.TERM_PROGRAM_VERSION || '0.' + if (/^[0-2]\./.test(ver)) { + return has256(obj) + } else { + return has16m(obj) + } + + case 'HyperTerm': + case 'Hyper': + return has16m(obj) + + case 'MacTerm': + return has16m(obj) + + case 'Apple_Terminal': + return has256(obj) + } + + if (/^xterm-256/.test(term)) { + return has256(obj) + } + + if (/^screen|^xterm|^vt100|color|ansi|cygwin|linux/i.test(term)) { + return hasBasic(obj) + } + + if (env.COLORTERM) { + return hasBasic(obj) + } + + return hasNone(obj, options) +} diff --git a/backend/node_modules/color-support/package.json b/backend/node_modules/color-support/package.json new file mode 100644 index 000000000..f3e3b7714 --- /dev/null +++ b/backend/node_modules/color-support/package.json @@ -0,0 +1,36 @@ +{ + "name": "color-support", + "version": "1.1.3", + "description": "A module which will endeavor to guess your terminal's level of color support.", + "main": "index.js", + "browser": "browser.js", + "bin": "bin.js", + "devDependencies": { + "tap": "^10.3.3" + }, + "scripts": { + "test": "tap test/*.js --100 -J", + "preversion": "npm test", + "postversion": "npm publish", + "postpublish": "git push origin --all; git push origin --tags" + }, + "repository": { + "type": "git", + "url": "git+https://github.com/isaacs/color-support.git" + }, + "keywords": [ + "terminal", + "color", + "support", + "xterm", + "truecolor", + "256" + ], + "author": "Isaac Z. Schlueter (http://blog.izs.me/)", + "license": "ISC", + "files": [ + "browser.js", + "index.js", + "bin.js" + ] +} diff --git a/backend/node_modules/concat-map/.travis.yml b/backend/node_modules/concat-map/.travis.yml new file mode 100644 index 000000000..f1d0f13c8 --- /dev/null +++ b/backend/node_modules/concat-map/.travis.yml @@ -0,0 +1,4 @@ +language: node_js +node_js: + - 0.4 + - 0.6 diff --git a/backend/node_modules/concat-map/LICENSE b/backend/node_modules/concat-map/LICENSE new file mode 100644 index 000000000..ee27ba4b4 --- /dev/null +++ b/backend/node_modules/concat-map/LICENSE @@ -0,0 +1,18 @@ +This software is released under the MIT license: + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/backend/node_modules/concat-map/README.markdown b/backend/node_modules/concat-map/README.markdown new file mode 100644 index 000000000..408f70a1b --- /dev/null +++ b/backend/node_modules/concat-map/README.markdown @@ -0,0 +1,62 @@ +concat-map +========== + +Concatenative mapdashery. + +[![browser support](http://ci.testling.com/substack/node-concat-map.png)](http://ci.testling.com/substack/node-concat-map) + +[![build status](https://secure.travis-ci.org/substack/node-concat-map.png)](http://travis-ci.org/substack/node-concat-map) + +example +======= + +``` js +var concatMap = require('concat-map'); +var xs = [ 1, 2, 3, 4, 5, 6 ]; +var ys = concatMap(xs, function (x) { + return x % 2 ? [ x - 0.1, x, x + 0.1 ] : []; +}); +console.dir(ys); +``` + +*** + +``` +[ 0.9, 1, 1.1, 2.9, 3, 3.1, 4.9, 5, 5.1 ] +``` + +methods +======= + +``` js +var concatMap = require('concat-map') +``` + +concatMap(xs, fn) +----------------- + +Return an array of concatenated elements by calling `fn(x, i)` for each element +`x` and each index `i` in the array `xs`. + +When `fn(x, i)` returns an array, its result will be concatenated with the +result array. If `fn(x, i)` returns anything else, that value will be pushed +onto the end of the result array. + +install +======= + +With [npm](http://npmjs.org) do: + +``` +npm install concat-map +``` + +license +======= + +MIT + +notes +===== + +This module was written while sitting high above the ground in a tree. diff --git a/backend/node_modules/concat-map/example/map.js b/backend/node_modules/concat-map/example/map.js new file mode 100644 index 000000000..33656217b --- /dev/null +++ b/backend/node_modules/concat-map/example/map.js @@ -0,0 +1,6 @@ +var concatMap = require('../'); +var xs = [ 1, 2, 3, 4, 5, 6 ]; +var ys = concatMap(xs, function (x) { + return x % 2 ? [ x - 0.1, x, x + 0.1 ] : []; +}); +console.dir(ys); diff --git a/backend/node_modules/concat-map/index.js b/backend/node_modules/concat-map/index.js new file mode 100644 index 000000000..b29a7812e --- /dev/null +++ b/backend/node_modules/concat-map/index.js @@ -0,0 +1,13 @@ +module.exports = function (xs, fn) { + var res = []; + for (var i = 0; i < xs.length; i++) { + var x = fn(xs[i], i); + if (isArray(x)) res.push.apply(res, x); + else res.push(x); + } + return res; +}; + +var isArray = Array.isArray || function (xs) { + return Object.prototype.toString.call(xs) === '[object Array]'; +}; diff --git a/backend/node_modules/concat-map/package.json b/backend/node_modules/concat-map/package.json new file mode 100644 index 000000000..d3640e6b0 --- /dev/null +++ b/backend/node_modules/concat-map/package.json @@ -0,0 +1,43 @@ +{ + "name" : "concat-map", + "description" : "concatenative mapdashery", + "version" : "0.0.1", + "repository" : { + "type" : "git", + "url" : "git://github.com/substack/node-concat-map.git" + }, + "main" : "index.js", + "keywords" : [ + "concat", + "concatMap", + "map", + "functional", + "higher-order" + ], + "directories" : { + "example" : "example", + "test" : "test" + }, + "scripts" : { + "test" : "tape test/*.js" + }, + "devDependencies" : { + "tape" : "~2.4.0" + }, + "license" : "MIT", + "author" : { + "name" : "James Halliday", + "email" : "mail@substack.net", + "url" : "http://substack.net" + }, + "testling" : { + "files" : "test/*.js", + "browsers" : { + "ie" : [ 6, 7, 8, 9 ], + "ff" : [ 3.5, 10, 15.0 ], + "chrome" : [ 10, 22 ], + "safari" : [ 5.1 ], + "opera" : [ 12 ] + } + } +} diff --git a/backend/node_modules/concat-map/test/map.js b/backend/node_modules/concat-map/test/map.js new file mode 100644 index 000000000..fdbd7022f --- /dev/null +++ b/backend/node_modules/concat-map/test/map.js @@ -0,0 +1,39 @@ +var concatMap = require('../'); +var test = require('tape'); + +test('empty or not', function (t) { + var xs = [ 1, 2, 3, 4, 5, 6 ]; + var ixes = []; + var ys = concatMap(xs, function (x, ix) { + ixes.push(ix); + return x % 2 ? [ x - 0.1, x, x + 0.1 ] : []; + }); + t.same(ys, [ 0.9, 1, 1.1, 2.9, 3, 3.1, 4.9, 5, 5.1 ]); + t.same(ixes, [ 0, 1, 2, 3, 4, 5 ]); + t.end(); +}); + +test('always something', function (t) { + var xs = [ 'a', 'b', 'c', 'd' ]; + var ys = concatMap(xs, function (x) { + return x === 'b' ? [ 'B', 'B', 'B' ] : [ x ]; + }); + t.same(ys, [ 'a', 'B', 'B', 'B', 'c', 'd' ]); + t.end(); +}); + +test('scalars', function (t) { + var xs = [ 'a', 'b', 'c', 'd' ]; + var ys = concatMap(xs, function (x) { + return x === 'b' ? [ 'B', 'B', 'B' ] : x; + }); + t.same(ys, [ 'a', 'B', 'B', 'B', 'c', 'd' ]); + t.end(); +}); + +test('undefs', function (t) { + var xs = [ 'a', 'b', 'c', 'd' ]; + var ys = concatMap(xs, function () {}); + t.same(ys, [ undefined, undefined, undefined, undefined ]); + t.end(); +}); diff --git a/backend/node_modules/console-control-strings/LICENSE b/backend/node_modules/console-control-strings/LICENSE new file mode 100644 index 000000000..e75605296 --- /dev/null +++ b/backend/node_modules/console-control-strings/LICENSE @@ -0,0 +1,13 @@ +Copyright (c) 2014, Rebecca Turner + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/backend/node_modules/console-control-strings/README.md b/backend/node_modules/console-control-strings/README.md new file mode 100644 index 000000000..f58cc8d89 --- /dev/null +++ b/backend/node_modules/console-control-strings/README.md @@ -0,0 +1,145 @@ +# Console Control Strings + +A library of cross-platform tested terminal/console command strings for +doing things like color and cursor positioning. This is a subset of both +ansi and vt100. All control codes included work on both Windows & Unix-like +OSes, except where noted. + +## Usage + +```js +var consoleControl = require('console-control-strings') + +console.log(consoleControl.color('blue','bgRed', 'bold') + 'hi there' + consoleControl.color('reset')) +process.stdout.write(consoleControl.goto(75, 10)) +``` + +## Why Another? + +There are tons of libraries similar to this one. I wanted one that was: + +1. Very clear about compatibility goals. +2. Could emit, for instance, a start color code without an end one. +3. Returned strings w/o writing to streams. +4. Was not weighed down with other unrelated baggage. + +## Functions + +### var code = consoleControl.up(_num = 1_) + +Returns the escape sequence to move _num_ lines up. + +### var code = consoleControl.down(_num = 1_) + +Returns the escape sequence to move _num_ lines down. + +### var code = consoleControl.forward(_num = 1_) + +Returns the escape sequence to move _num_ lines righ. + +### var code = consoleControl.back(_num = 1_) + +Returns the escape sequence to move _num_ lines left. + +### var code = consoleControl.nextLine(_num = 1_) + +Returns the escape sequence to move _num_ lines down and to the beginning of +the line. + +### var code = consoleControl.previousLine(_num = 1_) + +Returns the escape sequence to move _num_ lines up and to the beginning of +the line. + +### var code = consoleControl.eraseData() + +Returns the escape sequence to erase everything from the current cursor +position to the bottom right of the screen. This is line based, so it +erases the remainder of the current line and all following lines. + +### var code = consoleControl.eraseLine() + +Returns the escape sequence to erase to the end of the current line. + +### var code = consoleControl.goto(_x_, _y_) + +Returns the escape sequence to move the cursor to the designated position. +Note that the origin is _1, 1_ not _0, 0_. + +### var code = consoleControl.gotoSOL() + +Returns the escape sequence to move the cursor to the beginning of the +current line. (That is, it returns a carriage return, `\r`.) + +### var code = consoleControl.beep() + +Returns the escape sequence to cause the termianl to beep. (That is, it +returns unicode character `\x0007`, a Control-G.) + +### var code = consoleControl.hideCursor() + +Returns the escape sequence to hide the cursor. + +### var code = consoleControl.showCursor() + +Returns the escape sequence to show the cursor. + +### var code = consoleControl.color(_colors = []_) + +### var code = consoleControl.color(_color1_, _color2_, _…_, _colorn_) + +Returns the escape sequence to set the current terminal display attributes +(mostly colors). Arguments can either be a list of attributes or an array +of attributes. The difference between passing in an array or list of colors +and calling `.color` separately for each one, is that in the former case a +single escape sequence will be produced where as in the latter each change +will have its own distinct escape sequence. Each attribute can be one of: + +* Reset: + * **reset** – Reset all attributes to the terminal default. +* Styles: + * **bold** – Display text as bold. In some terminals this means using a + bold font, in others this means changing the color. In some it means + both. + * **italic** – Display text as italic. This is not available in most Windows terminals. + * **underline** – Underline text. This is not available in most Windows Terminals. + * **inverse** – Invert the foreground and background colors. + * **stopBold** – Do not display text as bold. + * **stopItalic** – Do not display text as italic. + * **stopUnderline** – Do not underline text. + * **stopInverse** – Do not invert foreground and background. +* Colors: + * **white** + * **black** + * **blue** + * **cyan** + * **green** + * **magenta** + * **red** + * **yellow** + * **grey** / **brightBlack** + * **brightRed** + * **brightGreen** + * **brightYellow** + * **brightBlue** + * **brightMagenta** + * **brightCyan** + * **brightWhite** +* Background Colors: + * **bgWhite** + * **bgBlack** + * **bgBlue** + * **bgCyan** + * **bgGreen** + * **bgMagenta** + * **bgRed** + * **bgYellow** + * **bgGrey** / **bgBrightBlack** + * **bgBrightRed** + * **bgBrightGreen** + * **bgBrightYellow** + * **bgBrightBlue** + * **bgBrightMagenta** + * **bgBrightCyan** + * **bgBrightWhite** + diff --git a/backend/node_modules/console-control-strings/README.md~ b/backend/node_modules/console-control-strings/README.md~ new file mode 100644 index 000000000..6eb34e89d --- /dev/null +++ b/backend/node_modules/console-control-strings/README.md~ @@ -0,0 +1,140 @@ +# Console Control Strings + +A library of cross-platform tested terminal/console command strings for +doing things like color and cursor positioning. This is a subset of both +ansi and vt100. All control codes included work on both Windows & Unix-like +OSes, except where noted. + +## Usage + +```js +var consoleControl = require('console-control-strings') + +console.log(consoleControl.color('blue','bgRed', 'bold') + 'hi there' + consoleControl.color('reset')) +process.stdout.write(consoleControl.goto(75, 10)) +``` + +## Why Another? + +There are tons of libraries similar to this one. I wanted one that was: + +1. Very clear about compatibility goals. +2. Could emit, for instance, a start color code without an end one. +3. Returned strings w/o writing to streams. +4. Was not weighed down with other unrelated baggage. + +## Functions + +### var code = consoleControl.up(_num = 1_) + +Returns the escape sequence to move _num_ lines up. + +### var code = consoleControl.down(_num = 1_) + +Returns the escape sequence to move _num_ lines down. + +### var code = consoleControl.forward(_num = 1_) + +Returns the escape sequence to move _num_ lines righ. + +### var code = consoleControl.back(_num = 1_) + +Returns the escape sequence to move _num_ lines left. + +### var code = consoleControl.nextLine(_num = 1_) + +Returns the escape sequence to move _num_ lines down and to the beginning of +the line. + +### var code = consoleControl.previousLine(_num = 1_) + +Returns the escape sequence to move _num_ lines up and to the beginning of +the line. + +### var code = consoleControl.eraseData() + +Returns the escape sequence to erase everything from the current cursor +position to the bottom right of the screen. This is line based, so it +erases the remainder of the current line and all following lines. + +### var code = consoleControl.eraseLine() + +Returns the escape sequence to erase to the end of the current line. + +### var code = consoleControl.goto(_x_, _y_) + +Returns the escape sequence to move the cursor to the designated position. +Note that the origin is _1, 1_ not _0, 0_. + +### var code = consoleControl.gotoSOL() + +Returns the escape sequence to move the cursor to the beginning of the +current line. (That is, it returns a carriage return, `\r`.) + +### var code = consoleControl.hideCursor() + +Returns the escape sequence to hide the cursor. + +### var code = consoleControl.showCursor() + +Returns the escape sequence to show the cursor. + +### var code = consoleControl.color(_colors = []_) + +### var code = consoleControl.color(_color1_, _color2_, _…_, _colorn_) + +Returns the escape sequence to set the current terminal display attributes +(mostly colors). Arguments can either be a list of attributes or an array +of attributes. The difference between passing in an array or list of colors +and calling `.color` separately for each one, is that in the former case a +single escape sequence will be produced where as in the latter each change +will have its own distinct escape sequence. Each attribute can be one of: + +* Reset: + * **reset** – Reset all attributes to the terminal default. +* Styles: + * **bold** – Display text as bold. In some terminals this means using a + bold font, in others this means changing the color. In some it means + both. + * **italic** – Display text as italic. This is not available in most Windows terminals. + * **underline** – Underline text. This is not available in most Windows Terminals. + * **inverse** – Invert the foreground and background colors. + * **stopBold** – Do not display text as bold. + * **stopItalic** – Do not display text as italic. + * **stopUnderline** – Do not underline text. + * **stopInverse** – Do not invert foreground and background. +* Colors: + * **white** + * **black** + * **blue** + * **cyan** + * **green** + * **magenta** + * **red** + * **yellow** + * **grey** / **brightBlack** + * **brightRed** + * **brightGreen** + * **brightYellow** + * **brightBlue** + * **brightMagenta** + * **brightCyan** + * **brightWhite** +* Background Colors: + * **bgWhite** + * **bgBlack** + * **bgBlue** + * **bgCyan** + * **bgGreen** + * **bgMagenta** + * **bgRed** + * **bgYellow** + * **bgGrey** / **bgBrightBlack** + * **bgBrightRed** + * **bgBrightGreen** + * **bgBrightYellow** + * **bgBrightBlue** + * **bgBrightMagenta** + * **bgBrightCyan** + * **bgBrightWhite** + diff --git a/backend/node_modules/console-control-strings/index.js b/backend/node_modules/console-control-strings/index.js new file mode 100644 index 000000000..bf890348e --- /dev/null +++ b/backend/node_modules/console-control-strings/index.js @@ -0,0 +1,125 @@ +'use strict' + +// These tables borrowed from `ansi` + +var prefix = '\x1b[' + +exports.up = function up (num) { + return prefix + (num || '') + 'A' +} + +exports.down = function down (num) { + return prefix + (num || '') + 'B' +} + +exports.forward = function forward (num) { + return prefix + (num || '') + 'C' +} + +exports.back = function back (num) { + return prefix + (num || '') + 'D' +} + +exports.nextLine = function nextLine (num) { + return prefix + (num || '') + 'E' +} + +exports.previousLine = function previousLine (num) { + return prefix + (num || '') + 'F' +} + +exports.horizontalAbsolute = function horizontalAbsolute (num) { + if (num == null) throw new Error('horizontalAboslute requires a column to position to') + return prefix + num + 'G' +} + +exports.eraseData = function eraseData () { + return prefix + 'J' +} + +exports.eraseLine = function eraseLine () { + return prefix + 'K' +} + +exports.goto = function (x, y) { + return prefix + y + ';' + x + 'H' +} + +exports.gotoSOL = function () { + return '\r' +} + +exports.beep = function () { + return '\x07' +} + +exports.hideCursor = function hideCursor () { + return prefix + '?25l' +} + +exports.showCursor = function showCursor () { + return prefix + '?25h' +} + +var colors = { + reset: 0, +// styles + bold: 1, + italic: 3, + underline: 4, + inverse: 7, +// resets + stopBold: 22, + stopItalic: 23, + stopUnderline: 24, + stopInverse: 27, +// colors + white: 37, + black: 30, + blue: 34, + cyan: 36, + green: 32, + magenta: 35, + red: 31, + yellow: 33, + bgWhite: 47, + bgBlack: 40, + bgBlue: 44, + bgCyan: 46, + bgGreen: 42, + bgMagenta: 45, + bgRed: 41, + bgYellow: 43, + + grey: 90, + brightBlack: 90, + brightRed: 91, + brightGreen: 92, + brightYellow: 93, + brightBlue: 94, + brightMagenta: 95, + brightCyan: 96, + brightWhite: 97, + + bgGrey: 100, + bgBrightBlack: 100, + bgBrightRed: 101, + bgBrightGreen: 102, + bgBrightYellow: 103, + bgBrightBlue: 104, + bgBrightMagenta: 105, + bgBrightCyan: 106, + bgBrightWhite: 107 +} + +exports.color = function color (colorWith) { + if (arguments.length !== 1 || !Array.isArray(colorWith)) { + colorWith = Array.prototype.slice.call(arguments) + } + return prefix + colorWith.map(colorNameToCode).join(';') + 'm' +} + +function colorNameToCode (color) { + if (colors[color] != null) return colors[color] + throw new Error('Unknown color or style name: ' + color) +} diff --git a/backend/node_modules/console-control-strings/package.json b/backend/node_modules/console-control-strings/package.json new file mode 100644 index 000000000..eb6c62ae2 --- /dev/null +++ b/backend/node_modules/console-control-strings/package.json @@ -0,0 +1,27 @@ +{ + "name": "console-control-strings", + "version": "1.1.0", + "description": "A library of cross-platform tested terminal/console command strings for doing things like color and cursor positioning. This is a subset of both ansi and vt100. All control codes included work on both Windows & Unix-like OSes, except where noted.", + "main": "index.js", + "directories": { + "test": "test" + }, + "scripts": { + "test": "standard && tap test/*.js" + }, + "repository": { + "type": "git", + "url": "https://github.com/iarna/console-control-strings" + }, + "keywords": [], + "author": "Rebecca Turner (http://re-becca.org/)", + "license": "ISC", + "files": [ + "LICENSE", + "index.js" + ], + "devDependencies": { + "standard": "^7.1.2", + "tap": "^5.7.2" + } +} diff --git a/backend/node_modules/content-disposition/HISTORY.md b/backend/node_modules/content-disposition/HISTORY.md new file mode 100644 index 000000000..488effa0c --- /dev/null +++ b/backend/node_modules/content-disposition/HISTORY.md @@ -0,0 +1,60 @@ +0.5.4 / 2021-12-10 +================== + + * deps: safe-buffer@5.2.1 + +0.5.3 / 2018-12-17 +================== + + * Use `safe-buffer` for improved Buffer API + +0.5.2 / 2016-12-08 +================== + + * Fix `parse` to accept any linear whitespace character + +0.5.1 / 2016-01-17 +================== + + * perf: enable strict mode + +0.5.0 / 2014-10-11 +================== + + * Add `parse` function + +0.4.0 / 2014-09-21 +================== + + * Expand non-Unicode `filename` to the full ISO-8859-1 charset + +0.3.0 / 2014-09-20 +================== + + * Add `fallback` option + * Add `type` option + +0.2.0 / 2014-09-19 +================== + + * Reduce ambiguity of file names with hex escape in buggy browsers + +0.1.2 / 2014-09-19 +================== + + * Fix periodic invalid Unicode filename header + +0.1.1 / 2014-09-19 +================== + + * Fix invalid characters appearing in `filename*` parameter + +0.1.0 / 2014-09-18 +================== + + * Make the `filename` argument optional + +0.0.0 / 2014-09-18 +================== + + * Initial release diff --git a/backend/node_modules/content-disposition/LICENSE b/backend/node_modules/content-disposition/LICENSE new file mode 100644 index 000000000..84441fbb5 --- /dev/null +++ b/backend/node_modules/content-disposition/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2017 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/backend/node_modules/content-disposition/README.md b/backend/node_modules/content-disposition/README.md new file mode 100644 index 000000000..3a0bb0559 --- /dev/null +++ b/backend/node_modules/content-disposition/README.md @@ -0,0 +1,142 @@ +# content-disposition + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][github-actions-ci-image]][github-actions-ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Create and parse HTTP `Content-Disposition` header + +## Installation + +```sh +$ npm install content-disposition +``` + +## API + +```js +var contentDisposition = require('content-disposition') +``` + +### contentDisposition(filename, options) + +Create an attachment `Content-Disposition` header value using the given file name, +if supplied. The `filename` is optional and if no file name is desired, but you +want to specify `options`, set `filename` to `undefined`. + +```js +res.setHeader('Content-Disposition', contentDisposition('∫ maths.pdf')) +``` + +**note** HTTP headers are of the ISO-8859-1 character set. If you are writing this +header through a means different from `setHeader` in Node.js, you'll want to specify +the `'binary'` encoding in Node.js. + +#### Options + +`contentDisposition` accepts these properties in the options object. + +##### fallback + +If the `filename` option is outside ISO-8859-1, then the file name is actually +stored in a supplemental field for clients that support Unicode file names and +a ISO-8859-1 version of the file name is automatically generated. + +This specifies the ISO-8859-1 file name to override the automatic generation or +disables the generation all together, defaults to `true`. + + - A string will specify the ISO-8859-1 file name to use in place of automatic + generation. + - `false` will disable including a ISO-8859-1 file name and only include the + Unicode version (unless the file name is already ISO-8859-1). + - `true` will enable automatic generation if the file name is outside ISO-8859-1. + +If the `filename` option is ISO-8859-1 and this option is specified and has a +different value, then the `filename` option is encoded in the extended field +and this set as the fallback field, even though they are both ISO-8859-1. + +##### type + +Specifies the disposition type, defaults to `"attachment"`. This can also be +`"inline"`, or any other value (all values except inline are treated like +`attachment`, but can convey additional information if both parties agree to +it). The type is normalized to lower-case. + +### contentDisposition.parse(string) + +```js +var disposition = contentDisposition.parse('attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt') +``` + +Parse a `Content-Disposition` header string. This automatically handles extended +("Unicode") parameters by decoding them and providing them under the standard +parameter name. This will return an object with the following properties (examples +are shown for the string `'attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt'`): + + - `type`: The disposition type (always lower case). Example: `'attachment'` + + - `parameters`: An object of the parameters in the disposition (name of parameter + always lower case and extended versions replace non-extended versions). Example: + `{filename: "€ rates.txt"}` + +## Examples + +### Send a file for download + +```js +var contentDisposition = require('content-disposition') +var destroy = require('destroy') +var fs = require('fs') +var http = require('http') +var onFinished = require('on-finished') + +var filePath = '/path/to/public/plans.pdf' + +http.createServer(function onRequest (req, res) { + // set headers + res.setHeader('Content-Type', 'application/pdf') + res.setHeader('Content-Disposition', contentDisposition(filePath)) + + // send file + var stream = fs.createReadStream(filePath) + stream.pipe(res) + onFinished(res, function () { + destroy(stream) + }) +}) +``` + +## Testing + +```sh +$ npm test +``` + +## References + +- [RFC 2616: Hypertext Transfer Protocol -- HTTP/1.1][rfc-2616] +- [RFC 5987: Character Set and Language Encoding for Hypertext Transfer Protocol (HTTP) Header Field Parameters][rfc-5987] +- [RFC 6266: Use of the Content-Disposition Header Field in the Hypertext Transfer Protocol (HTTP)][rfc-6266] +- [Test Cases for HTTP Content-Disposition header field (RFC 6266) and the Encodings defined in RFCs 2047, 2231 and 5987][tc-2231] + +[rfc-2616]: https://tools.ietf.org/html/rfc2616 +[rfc-5987]: https://tools.ietf.org/html/rfc5987 +[rfc-6266]: https://tools.ietf.org/html/rfc6266 +[tc-2231]: http://greenbytes.de/tech/tc2231/ + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/content-disposition.svg +[npm-url]: https://npmjs.org/package/content-disposition +[node-version-image]: https://img.shields.io/node/v/content-disposition.svg +[node-version-url]: https://nodejs.org/en/download +[coveralls-image]: https://img.shields.io/coveralls/jshttp/content-disposition.svg +[coveralls-url]: https://coveralls.io/r/jshttp/content-disposition?branch=master +[downloads-image]: https://img.shields.io/npm/dm/content-disposition.svg +[downloads-url]: https://npmjs.org/package/content-disposition +[github-actions-ci-image]: https://img.shields.io/github/workflow/status/jshttp/content-disposition/ci/master?label=ci +[github-actions-ci-url]: https://github.com/jshttp/content-disposition?query=workflow%3Aci diff --git a/backend/node_modules/content-disposition/index.js b/backend/node_modules/content-disposition/index.js new file mode 100644 index 000000000..ecec899a9 --- /dev/null +++ b/backend/node_modules/content-disposition/index.js @@ -0,0 +1,458 @@ +/*! + * content-disposition + * Copyright(c) 2014-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = contentDisposition +module.exports.parse = parse + +/** + * Module dependencies. + * @private + */ + +var basename = require('path').basename +var Buffer = require('safe-buffer').Buffer + +/** + * RegExp to match non attr-char, *after* encodeURIComponent (i.e. not including "%") + * @private + */ + +var ENCODE_URL_ATTR_CHAR_REGEXP = /[\x00-\x20"'()*,/:;<=>?@[\\\]{}\x7f]/g // eslint-disable-line no-control-regex + +/** + * RegExp to match percent encoding escape. + * @private + */ + +var HEX_ESCAPE_REGEXP = /%[0-9A-Fa-f]{2}/ +var HEX_ESCAPE_REPLACE_REGEXP = /%([0-9A-Fa-f]{2})/g + +/** + * RegExp to match non-latin1 characters. + * @private + */ + +var NON_LATIN1_REGEXP = /[^\x20-\x7e\xa0-\xff]/g + +/** + * RegExp to match quoted-pair in RFC 2616 + * + * quoted-pair = "\" CHAR + * CHAR = + * @private + */ + +var QESC_REGEXP = /\\([\u0000-\u007f])/g // eslint-disable-line no-control-regex + +/** + * RegExp to match chars that must be quoted-pair in RFC 2616 + * @private + */ + +var QUOTE_REGEXP = /([\\"])/g + +/** + * RegExp for various RFC 2616 grammar + * + * parameter = token "=" ( token | quoted-string ) + * token = 1* + * separators = "(" | ")" | "<" | ">" | "@" + * | "," | ";" | ":" | "\" | <"> + * | "/" | "[" | "]" | "?" | "=" + * | "{" | "}" | SP | HT + * quoted-string = ( <"> *(qdtext | quoted-pair ) <"> ) + * qdtext = > + * quoted-pair = "\" CHAR + * CHAR = + * TEXT = + * LWS = [CRLF] 1*( SP | HT ) + * CRLF = CR LF + * CR = + * LF = + * SP = + * HT = + * CTL = + * OCTET = + * @private + */ + +var PARAM_REGEXP = /;[\x09\x20]*([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*=[\x09\x20]*("(?:[\x20!\x23-\x5b\x5d-\x7e\x80-\xff]|\\[\x20-\x7e])*"|[!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*/g // eslint-disable-line no-control-regex +var TEXT_REGEXP = /^[\x20-\x7e\x80-\xff]+$/ +var TOKEN_REGEXP = /^[!#$%&'*+.0-9A-Z^_`a-z|~-]+$/ + +/** + * RegExp for various RFC 5987 grammar + * + * ext-value = charset "'" [ language ] "'" value-chars + * charset = "UTF-8" / "ISO-8859-1" / mime-charset + * mime-charset = 1*mime-charsetc + * mime-charsetc = ALPHA / DIGIT + * / "!" / "#" / "$" / "%" / "&" + * / "+" / "-" / "^" / "_" / "`" + * / "{" / "}" / "~" + * language = ( 2*3ALPHA [ extlang ] ) + * / 4ALPHA + * / 5*8ALPHA + * extlang = *3( "-" 3ALPHA ) + * value-chars = *( pct-encoded / attr-char ) + * pct-encoded = "%" HEXDIG HEXDIG + * attr-char = ALPHA / DIGIT + * / "!" / "#" / "$" / "&" / "+" / "-" / "." + * / "^" / "_" / "`" / "|" / "~" + * @private + */ + +var EXT_VALUE_REGEXP = /^([A-Za-z0-9!#$%&+\-^_`{}~]+)'(?:[A-Za-z]{2,3}(?:-[A-Za-z]{3}){0,3}|[A-Za-z]{4,8}|)'((?:%[0-9A-Fa-f]{2}|[A-Za-z0-9!#$&+.^_`|~-])+)$/ + +/** + * RegExp for various RFC 6266 grammar + * + * disposition-type = "inline" | "attachment" | disp-ext-type + * disp-ext-type = token + * disposition-parm = filename-parm | disp-ext-parm + * filename-parm = "filename" "=" value + * | "filename*" "=" ext-value + * disp-ext-parm = token "=" value + * | ext-token "=" ext-value + * ext-token = + * @private + */ + +var DISPOSITION_TYPE_REGEXP = /^([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*(?:$|;)/ // eslint-disable-line no-control-regex + +/** + * Create an attachment Content-Disposition header. + * + * @param {string} [filename] + * @param {object} [options] + * @param {string} [options.type=attachment] + * @param {string|boolean} [options.fallback=true] + * @return {string} + * @public + */ + +function contentDisposition (filename, options) { + var opts = options || {} + + // get type + var type = opts.type || 'attachment' + + // get parameters + var params = createparams(filename, opts.fallback) + + // format into string + return format(new ContentDisposition(type, params)) +} + +/** + * Create parameters object from filename and fallback. + * + * @param {string} [filename] + * @param {string|boolean} [fallback=true] + * @return {object} + * @private + */ + +function createparams (filename, fallback) { + if (filename === undefined) { + return + } + + var params = {} + + if (typeof filename !== 'string') { + throw new TypeError('filename must be a string') + } + + // fallback defaults to true + if (fallback === undefined) { + fallback = true + } + + if (typeof fallback !== 'string' && typeof fallback !== 'boolean') { + throw new TypeError('fallback must be a string or boolean') + } + + if (typeof fallback === 'string' && NON_LATIN1_REGEXP.test(fallback)) { + throw new TypeError('fallback must be ISO-8859-1 string') + } + + // restrict to file base name + var name = basename(filename) + + // determine if name is suitable for quoted string + var isQuotedString = TEXT_REGEXP.test(name) + + // generate fallback name + var fallbackName = typeof fallback !== 'string' + ? fallback && getlatin1(name) + : basename(fallback) + var hasFallback = typeof fallbackName === 'string' && fallbackName !== name + + // set extended filename parameter + if (hasFallback || !isQuotedString || HEX_ESCAPE_REGEXP.test(name)) { + params['filename*'] = name + } + + // set filename parameter + if (isQuotedString || hasFallback) { + params.filename = hasFallback + ? fallbackName + : name + } + + return params +} + +/** + * Format object to Content-Disposition header. + * + * @param {object} obj + * @param {string} obj.type + * @param {object} [obj.parameters] + * @return {string} + * @private + */ + +function format (obj) { + var parameters = obj.parameters + var type = obj.type + + if (!type || typeof type !== 'string' || !TOKEN_REGEXP.test(type)) { + throw new TypeError('invalid type') + } + + // start with normalized type + var string = String(type).toLowerCase() + + // append parameters + if (parameters && typeof parameters === 'object') { + var param + var params = Object.keys(parameters).sort() + + for (var i = 0; i < params.length; i++) { + param = params[i] + + var val = param.substr(-1) === '*' + ? ustring(parameters[param]) + : qstring(parameters[param]) + + string += '; ' + param + '=' + val + } + } + + return string +} + +/** + * Decode a RFC 5987 field value (gracefully). + * + * @param {string} str + * @return {string} + * @private + */ + +function decodefield (str) { + var match = EXT_VALUE_REGEXP.exec(str) + + if (!match) { + throw new TypeError('invalid extended field value') + } + + var charset = match[1].toLowerCase() + var encoded = match[2] + var value + + // to binary string + var binary = encoded.replace(HEX_ESCAPE_REPLACE_REGEXP, pdecode) + + switch (charset) { + case 'iso-8859-1': + value = getlatin1(binary) + break + case 'utf-8': + value = Buffer.from(binary, 'binary').toString('utf8') + break + default: + throw new TypeError('unsupported charset in extended field') + } + + return value +} + +/** + * Get ISO-8859-1 version of string. + * + * @param {string} val + * @return {string} + * @private + */ + +function getlatin1 (val) { + // simple Unicode -> ISO-8859-1 transformation + return String(val).replace(NON_LATIN1_REGEXP, '?') +} + +/** + * Parse Content-Disposition header string. + * + * @param {string} string + * @return {object} + * @public + */ + +function parse (string) { + if (!string || typeof string !== 'string') { + throw new TypeError('argument string is required') + } + + var match = DISPOSITION_TYPE_REGEXP.exec(string) + + if (!match) { + throw new TypeError('invalid type format') + } + + // normalize type + var index = match[0].length + var type = match[1].toLowerCase() + + var key + var names = [] + var params = {} + var value + + // calculate index to start at + index = PARAM_REGEXP.lastIndex = match[0].substr(-1) === ';' + ? index - 1 + : index + + // match parameters + while ((match = PARAM_REGEXP.exec(string))) { + if (match.index !== index) { + throw new TypeError('invalid parameter format') + } + + index += match[0].length + key = match[1].toLowerCase() + value = match[2] + + if (names.indexOf(key) !== -1) { + throw new TypeError('invalid duplicate parameter') + } + + names.push(key) + + if (key.indexOf('*') + 1 === key.length) { + // decode extended value + key = key.slice(0, -1) + value = decodefield(value) + + // overwrite existing value + params[key] = value + continue + } + + if (typeof params[key] === 'string') { + continue + } + + if (value[0] === '"') { + // remove quotes and escapes + value = value + .substr(1, value.length - 2) + .replace(QESC_REGEXP, '$1') + } + + params[key] = value + } + + if (index !== -1 && index !== string.length) { + throw new TypeError('invalid parameter format') + } + + return new ContentDisposition(type, params) +} + +/** + * Percent decode a single character. + * + * @param {string} str + * @param {string} hex + * @return {string} + * @private + */ + +function pdecode (str, hex) { + return String.fromCharCode(parseInt(hex, 16)) +} + +/** + * Percent encode a single character. + * + * @param {string} char + * @return {string} + * @private + */ + +function pencode (char) { + return '%' + String(char) + .charCodeAt(0) + .toString(16) + .toUpperCase() +} + +/** + * Quote a string for HTTP. + * + * @param {string} val + * @return {string} + * @private + */ + +function qstring (val) { + var str = String(val) + + return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"' +} + +/** + * Encode a Unicode string for HTTP (RFC 5987). + * + * @param {string} val + * @return {string} + * @private + */ + +function ustring (val) { + var str = String(val) + + // percent encode as UTF-8 + var encoded = encodeURIComponent(str) + .replace(ENCODE_URL_ATTR_CHAR_REGEXP, pencode) + + return 'UTF-8\'\'' + encoded +} + +/** + * Class for parsed Content-Disposition header for v8 optimization + * + * @public + * @param {string} type + * @param {object} parameters + * @constructor + */ + +function ContentDisposition (type, parameters) { + this.type = type + this.parameters = parameters +} diff --git a/backend/node_modules/content-disposition/package.json b/backend/node_modules/content-disposition/package.json new file mode 100644 index 000000000..43c70ce24 --- /dev/null +++ b/backend/node_modules/content-disposition/package.json @@ -0,0 +1,44 @@ +{ + "name": "content-disposition", + "description": "Create and parse Content-Disposition header", + "version": "0.5.4", + "author": "Douglas Christopher Wilson ", + "license": "MIT", + "keywords": [ + "content-disposition", + "http", + "rfc6266", + "res" + ], + "repository": "jshttp/content-disposition", + "dependencies": { + "safe-buffer": "5.2.1" + }, + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "7.32.0", + "eslint-config-standard": "13.0.1", + "eslint-plugin-import": "2.25.3", + "eslint-plugin-markdown": "2.2.1", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "5.2.0", + "eslint-plugin-standard": "4.1.0", + "istanbul": "0.4.5", + "mocha": "9.1.3" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/" + } +} diff --git a/backend/node_modules/content-type/HISTORY.md b/backend/node_modules/content-type/HISTORY.md new file mode 100644 index 000000000..458367139 --- /dev/null +++ b/backend/node_modules/content-type/HISTORY.md @@ -0,0 +1,29 @@ +1.0.5 / 2023-01-29 +================== + + * perf: skip value escaping when unnecessary + +1.0.4 / 2017-09-11 +================== + + * perf: skip parameter parsing when no parameters + +1.0.3 / 2017-09-10 +================== + + * perf: remove argument reassignment + +1.0.2 / 2016-05-09 +================== + + * perf: enable strict mode + +1.0.1 / 2015-02-13 +================== + + * Improve missing `Content-Type` header error message + +1.0.0 / 2015-02-01 +================== + + * Initial implementation, derived from `media-typer@0.3.0` diff --git a/backend/node_modules/content-type/LICENSE b/backend/node_modules/content-type/LICENSE new file mode 100644 index 000000000..34b1a2de3 --- /dev/null +++ b/backend/node_modules/content-type/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/backend/node_modules/content-type/README.md b/backend/node_modules/content-type/README.md new file mode 100644 index 000000000..c1a922a9a --- /dev/null +++ b/backend/node_modules/content-type/README.md @@ -0,0 +1,94 @@ +# content-type + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][ci-image]][ci-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +Create and parse HTTP Content-Type header according to RFC 7231 + +## Installation + +```sh +$ npm install content-type +``` + +## API + +```js +var contentType = require('content-type') +``` + +### contentType.parse(string) + +```js +var obj = contentType.parse('image/svg+xml; charset=utf-8') +``` + +Parse a `Content-Type` header. This will return an object with the following +properties (examples are shown for the string `'image/svg+xml; charset=utf-8'`): + + - `type`: The media type (the type and subtype, always lower case). + Example: `'image/svg+xml'` + + - `parameters`: An object of the parameters in the media type (name of parameter + always lower case). Example: `{charset: 'utf-8'}` + +Throws a `TypeError` if the string is missing or invalid. + +### contentType.parse(req) + +```js +var obj = contentType.parse(req) +``` + +Parse the `Content-Type` header from the given `req`. Short-cut for +`contentType.parse(req.headers['content-type'])`. + +Throws a `TypeError` if the `Content-Type` header is missing or invalid. + +### contentType.parse(res) + +```js +var obj = contentType.parse(res) +``` + +Parse the `Content-Type` header set on the given `res`. Short-cut for +`contentType.parse(res.getHeader('content-type'))`. + +Throws a `TypeError` if the `Content-Type` header is missing or invalid. + +### contentType.format(obj) + +```js +var str = contentType.format({ + type: 'image/svg+xml', + parameters: { charset: 'utf-8' } +}) +``` + +Format an object into a `Content-Type` header. This will return a string of the +content type for the given object with the following properties (examples are +shown that produce the string `'image/svg+xml; charset=utf-8'`): + + - `type`: The media type (will be lower-cased). Example: `'image/svg+xml'` + + - `parameters`: An object of the parameters in the media type (name of the + parameter will be lower-cased). Example: `{charset: 'utf-8'}` + +Throws a `TypeError` if the object contains an invalid type or parameter names. + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/jshttp/content-type/master?label=ci +[ci-url]: https://github.com/jshttp/content-type/actions/workflows/ci.yml +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/content-type/master +[coveralls-url]: https://coveralls.io/r/jshttp/content-type?branch=master +[node-image]: https://badgen.net/npm/node/content-type +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/content-type +[npm-url]: https://npmjs.org/package/content-type +[npm-version-image]: https://badgen.net/npm/v/content-type diff --git a/backend/node_modules/content-type/index.js b/backend/node_modules/content-type/index.js new file mode 100644 index 000000000..41840e7bc --- /dev/null +++ b/backend/node_modules/content-type/index.js @@ -0,0 +1,225 @@ +/*! + * content-type + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * RegExp to match *( ";" parameter ) in RFC 7231 sec 3.1.1.1 + * + * parameter = token "=" ( token / quoted-string ) + * token = 1*tchar + * tchar = "!" / "#" / "$" / "%" / "&" / "'" / "*" + * / "+" / "-" / "." / "^" / "_" / "`" / "|" / "~" + * / DIGIT / ALPHA + * ; any VCHAR, except delimiters + * quoted-string = DQUOTE *( qdtext / quoted-pair ) DQUOTE + * qdtext = HTAB / SP / %x21 / %x23-5B / %x5D-7E / obs-text + * obs-text = %x80-FF + * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text ) + */ +var PARAM_REGEXP = /; *([!#$%&'*+.^_`|~0-9A-Za-z-]+) *= *("(?:[\u000b\u0020\u0021\u0023-\u005b\u005d-\u007e\u0080-\u00ff]|\\[\u000b\u0020-\u00ff])*"|[!#$%&'*+.^_`|~0-9A-Za-z-]+) */g // eslint-disable-line no-control-regex +var TEXT_REGEXP = /^[\u000b\u0020-\u007e\u0080-\u00ff]+$/ // eslint-disable-line no-control-regex +var TOKEN_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+$/ + +/** + * RegExp to match quoted-pair in RFC 7230 sec 3.2.6 + * + * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text ) + * obs-text = %x80-FF + */ +var QESC_REGEXP = /\\([\u000b\u0020-\u00ff])/g // eslint-disable-line no-control-regex + +/** + * RegExp to match chars that must be quoted-pair in RFC 7230 sec 3.2.6 + */ +var QUOTE_REGEXP = /([\\"])/g + +/** + * RegExp to match type in RFC 7231 sec 3.1.1.1 + * + * media-type = type "/" subtype + * type = token + * subtype = token + */ +var TYPE_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+\/[!#$%&'*+.^_`|~0-9A-Za-z-]+$/ + +/** + * Module exports. + * @public + */ + +exports.format = format +exports.parse = parse + +/** + * Format object to media type. + * + * @param {object} obj + * @return {string} + * @public + */ + +function format (obj) { + if (!obj || typeof obj !== 'object') { + throw new TypeError('argument obj is required') + } + + var parameters = obj.parameters + var type = obj.type + + if (!type || !TYPE_REGEXP.test(type)) { + throw new TypeError('invalid type') + } + + var string = type + + // append parameters + if (parameters && typeof parameters === 'object') { + var param + var params = Object.keys(parameters).sort() + + for (var i = 0; i < params.length; i++) { + param = params[i] + + if (!TOKEN_REGEXP.test(param)) { + throw new TypeError('invalid parameter name') + } + + string += '; ' + param + '=' + qstring(parameters[param]) + } + } + + return string +} + +/** + * Parse media type to object. + * + * @param {string|object} string + * @return {Object} + * @public + */ + +function parse (string) { + if (!string) { + throw new TypeError('argument string is required') + } + + // support req/res-like objects as argument + var header = typeof string === 'object' + ? getcontenttype(string) + : string + + if (typeof header !== 'string') { + throw new TypeError('argument string is required to be a string') + } + + var index = header.indexOf(';') + var type = index !== -1 + ? header.slice(0, index).trim() + : header.trim() + + if (!TYPE_REGEXP.test(type)) { + throw new TypeError('invalid media type') + } + + var obj = new ContentType(type.toLowerCase()) + + // parse parameters + if (index !== -1) { + var key + var match + var value + + PARAM_REGEXP.lastIndex = index + + while ((match = PARAM_REGEXP.exec(header))) { + if (match.index !== index) { + throw new TypeError('invalid parameter format') + } + + index += match[0].length + key = match[1].toLowerCase() + value = match[2] + + if (value.charCodeAt(0) === 0x22 /* " */) { + // remove quotes + value = value.slice(1, -1) + + // remove escapes + if (value.indexOf('\\') !== -1) { + value = value.replace(QESC_REGEXP, '$1') + } + } + + obj.parameters[key] = value + } + + if (index !== header.length) { + throw new TypeError('invalid parameter format') + } + } + + return obj +} + +/** + * Get content-type from req/res objects. + * + * @param {object} + * @return {Object} + * @private + */ + +function getcontenttype (obj) { + var header + + if (typeof obj.getHeader === 'function') { + // res-like + header = obj.getHeader('content-type') + } else if (typeof obj.headers === 'object') { + // req-like + header = obj.headers && obj.headers['content-type'] + } + + if (typeof header !== 'string') { + throw new TypeError('content-type header is missing from object') + } + + return header +} + +/** + * Quote a string if necessary. + * + * @param {string} val + * @return {string} + * @private + */ + +function qstring (val) { + var str = String(val) + + // no need to quote tokens + if (TOKEN_REGEXP.test(str)) { + return str + } + + if (str.length > 0 && !TEXT_REGEXP.test(str)) { + throw new TypeError('invalid parameter value') + } + + return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"' +} + +/** + * Class to represent a content type. + * @private + */ +function ContentType (type) { + this.parameters = Object.create(null) + this.type = type +} diff --git a/backend/node_modules/content-type/package.json b/backend/node_modules/content-type/package.json new file mode 100644 index 000000000..9db19f63f --- /dev/null +++ b/backend/node_modules/content-type/package.json @@ -0,0 +1,42 @@ +{ + "name": "content-type", + "description": "Create and parse HTTP Content-Type header", + "version": "1.0.5", + "author": "Douglas Christopher Wilson ", + "license": "MIT", + "keywords": [ + "content-type", + "http", + "req", + "res", + "rfc7231" + ], + "repository": "jshttp/content-type", + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "8.32.0", + "eslint-config-standard": "15.0.1", + "eslint-plugin-import": "2.27.5", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "6.1.1", + "eslint-plugin-standard": "4.1.0", + "mocha": "10.2.0", + "nyc": "15.1.0" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "nyc --reporter=lcovonly --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "version": "node scripts/version-history.js && git add HISTORY.md" + } +} diff --git a/backend/node_modules/cookie-signature/.npmignore b/backend/node_modules/cookie-signature/.npmignore new file mode 100644 index 000000000..f1250e584 --- /dev/null +++ b/backend/node_modules/cookie-signature/.npmignore @@ -0,0 +1,4 @@ +support +test +examples +*.sock diff --git a/backend/node_modules/cookie-signature/History.md b/backend/node_modules/cookie-signature/History.md new file mode 100644 index 000000000..78513cc3d --- /dev/null +++ b/backend/node_modules/cookie-signature/History.md @@ -0,0 +1,38 @@ +1.0.6 / 2015-02-03 +================== + +* use `npm test` instead of `make test` to run tests +* clearer assertion messages when checking input + + +1.0.5 / 2014-09-05 +================== + +* add license to package.json + +1.0.4 / 2014-06-25 +================== + + * corrected avoidance of timing attacks (thanks @tenbits!) + +1.0.3 / 2014-01-28 +================== + + * [incorrect] fix for timing attacks + +1.0.2 / 2014-01-28 +================== + + * fix missing repository warning + * fix typo in test + +1.0.1 / 2013-04-15 +================== + + * Revert "Changed underlying HMAC algo. to sha512." + * Revert "Fix for timing attacks on MAC verification." + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/backend/node_modules/cookie-signature/Readme.md b/backend/node_modules/cookie-signature/Readme.md new file mode 100644 index 000000000..2559e841b --- /dev/null +++ b/backend/node_modules/cookie-signature/Readme.md @@ -0,0 +1,42 @@ + +# cookie-signature + + Sign and unsign cookies. + +## Example + +```js +var cookie = require('cookie-signature'); + +var val = cookie.sign('hello', 'tobiiscool'); +val.should.equal('hello.DGDUkGlIkCzPz+C0B064FNgHdEjox7ch8tOBGslZ5QI'); + +var val = cookie.sign('hello', 'tobiiscool'); +cookie.unsign(val, 'tobiiscool').should.equal('hello'); +cookie.unsign(val, 'luna').should.be.false; +``` + +## License + +(The MIT License) + +Copyright (c) 2012 LearnBoost <tj@learnboost.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/backend/node_modules/cookie-signature/index.js b/backend/node_modules/cookie-signature/index.js new file mode 100644 index 000000000..b8c9463a2 --- /dev/null +++ b/backend/node_modules/cookie-signature/index.js @@ -0,0 +1,51 @@ +/** + * Module dependencies. + */ + +var crypto = require('crypto'); + +/** + * Sign the given `val` with `secret`. + * + * @param {String} val + * @param {String} secret + * @return {String} + * @api private + */ + +exports.sign = function(val, secret){ + if ('string' != typeof val) throw new TypeError("Cookie value must be provided as a string."); + if ('string' != typeof secret) throw new TypeError("Secret string must be provided."); + return val + '.' + crypto + .createHmac('sha256', secret) + .update(val) + .digest('base64') + .replace(/\=+$/, ''); +}; + +/** + * Unsign and decode the given `val` with `secret`, + * returning `false` if the signature is invalid. + * + * @param {String} val + * @param {String} secret + * @return {String|Boolean} + * @api private + */ + +exports.unsign = function(val, secret){ + if ('string' != typeof val) throw new TypeError("Signed cookie string must be provided."); + if ('string' != typeof secret) throw new TypeError("Secret string must be provided."); + var str = val.slice(0, val.lastIndexOf('.')) + , mac = exports.sign(str, secret); + + return sha1(mac) == sha1(val) ? str : false; +}; + +/** + * Private + */ + +function sha1(str){ + return crypto.createHash('sha1').update(str).digest('hex'); +} diff --git a/backend/node_modules/cookie-signature/package.json b/backend/node_modules/cookie-signature/package.json new file mode 100644 index 000000000..29c4498e0 --- /dev/null +++ b/backend/node_modules/cookie-signature/package.json @@ -0,0 +1,18 @@ +{ + "name": "cookie-signature", + "version": "1.0.6", + "description": "Sign and unsign cookies", + "keywords": ["cookie", "sign", "unsign"], + "author": "TJ Holowaychuk ", + "license": "MIT", + "repository": { "type": "git", "url": "https://github.com/visionmedia/node-cookie-signature.git"}, + "dependencies": {}, + "devDependencies": { + "mocha": "*", + "should": "*" + }, + "scripts": { + "test": "mocha --require should --reporter spec" + }, + "main": "index" +} diff --git a/backend/node_modules/cookie/LICENSE b/backend/node_modules/cookie/LICENSE new file mode 100644 index 000000000..058b6b4ef --- /dev/null +++ b/backend/node_modules/cookie/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012-2014 Roman Shtylman +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/backend/node_modules/cookie/README.md b/backend/node_modules/cookie/README.md new file mode 100644 index 000000000..71fdac111 --- /dev/null +++ b/backend/node_modules/cookie/README.md @@ -0,0 +1,317 @@ +# cookie + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][ci-image]][ci-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +Basic HTTP cookie parser and serializer for HTTP servers. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install cookie +``` + +## API + +```js +var cookie = require('cookie'); +``` + +### cookie.parse(str, options) + +Parse an HTTP `Cookie` header string and returning an object of all cookie name-value pairs. +The `str` argument is the string representing a `Cookie` header value and `options` is an +optional object containing additional parsing options. + +```js +var cookies = cookie.parse('foo=bar; equation=E%3Dmc%5E2'); +// { foo: 'bar', equation: 'E=mc^2' } +``` + +#### Options + +`cookie.parse` accepts these properties in the options object. + +##### decode + +Specifies a function that will be used to decode a cookie's value. Since the value of a cookie +has a limited character set (and must be a simple string), this function can be used to decode +a previously-encoded cookie value into a JavaScript string or other object. + +The default function is the global `decodeURIComponent`, which will decode any URL-encoded +sequences into their byte representations. + +**note** if an error is thrown from this function, the original, non-decoded cookie value will +be returned as the cookie's value. + +### cookie.serialize(name, value, options) + +Serialize a cookie name-value pair into a `Set-Cookie` header string. The `name` argument is the +name for the cookie, the `value` argument is the value to set the cookie to, and the `options` +argument is an optional object containing additional serialization options. + +```js +var setCookie = cookie.serialize('foo', 'bar'); +// foo=bar +``` + +#### Options + +`cookie.serialize` accepts these properties in the options object. + +##### domain + +Specifies the value for the [`Domain` `Set-Cookie` attribute][rfc-6265-5.2.3]. By default, no +domain is set, and most clients will consider the cookie to apply to only the current domain. + +##### encode + +Specifies a function that will be used to encode a cookie's value. Since value of a cookie +has a limited character set (and must be a simple string), this function can be used to encode +a value into a string suited for a cookie's value. + +The default function is the global `encodeURIComponent`, which will encode a JavaScript string +into UTF-8 byte sequences and then URL-encode any that fall outside of the cookie range. + +##### expires + +Specifies the `Date` object to be the value for the [`Expires` `Set-Cookie` attribute][rfc-6265-5.2.1]. +By default, no expiration is set, and most clients will consider this a "non-persistent cookie" and +will delete it on a condition like exiting a web browser application. + +**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and +`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### httpOnly + +Specifies the `boolean` value for the [`HttpOnly` `Set-Cookie` attribute][rfc-6265-5.2.6]. When truthy, +the `HttpOnly` attribute is set, otherwise it is not. By default, the `HttpOnly` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not allow client-side +JavaScript to see the cookie in `document.cookie`. + +##### maxAge + +Specifies the `number` (in seconds) to be the value for the [`Max-Age` `Set-Cookie` attribute][rfc-6265-5.2.2]. +The given number will be converted to an integer by rounding down. By default, no maximum age is set. + +**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and +`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### partitioned + +Specifies the `boolean` value for the [`Partitioned` `Set-Cookie`](rfc-cutler-httpbis-partitioned-cookies) +attribute. When truthy, the `Partitioned` attribute is set, otherwise it is not. By default, the +`Partitioned` attribute is not set. + +**note** This is an attribute that has not yet been fully standardized, and may change in the future. +This also means many clients may ignore this attribute until they understand it. + +More information about can be found in [the proposal](https://github.com/privacycg/CHIPS). + +##### path + +Specifies the value for the [`Path` `Set-Cookie` attribute][rfc-6265-5.2.4]. By default, the path +is considered the ["default path"][rfc-6265-5.1.4]. + +##### priority + +Specifies the `string` to be the value for the [`Priority` `Set-Cookie` attribute][rfc-west-cookie-priority-00-4.1]. + + - `'low'` will set the `Priority` attribute to `Low`. + - `'medium'` will set the `Priority` attribute to `Medium`, the default priority when not set. + - `'high'` will set the `Priority` attribute to `High`. + +More information about the different priority levels can be found in +[the specification][rfc-west-cookie-priority-00-4.1]. + +**note** This is an attribute that has not yet been fully standardized, and may change in the future. +This also means many clients may ignore this attribute until they understand it. + +##### sameSite + +Specifies the `boolean` or `string` to be the value for the [`SameSite` `Set-Cookie` attribute][rfc-6265bis-09-5.4.7]. + + - `true` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + - `false` will not set the `SameSite` attribute. + - `'lax'` will set the `SameSite` attribute to `Lax` for lax same site enforcement. + - `'none'` will set the `SameSite` attribute to `None` for an explicit cross-site cookie. + - `'strict'` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + +More information about the different enforcement levels can be found in +[the specification][rfc-6265bis-09-5.4.7]. + +**note** This is an attribute that has not yet been fully standardized, and may change in the future. +This also means many clients may ignore this attribute until they understand it. + +##### secure + +Specifies the `boolean` value for the [`Secure` `Set-Cookie` attribute][rfc-6265-5.2.5]. When truthy, +the `Secure` attribute is set, otherwise it is not. By default, the `Secure` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not send the cookie back to +the server in the future if the browser does not have an HTTPS connection. + +## Example + +The following example uses this module in conjunction with the Node.js core HTTP server +to prompt a user for their name and display it back on future visits. + +```js +var cookie = require('cookie'); +var escapeHtml = require('escape-html'); +var http = require('http'); +var url = require('url'); + +function onRequest(req, res) { + // Parse the query string + var query = url.parse(req.url, true, true).query; + + if (query && query.name) { + // Set a new cookie with the name + res.setHeader('Set-Cookie', cookie.serialize('name', String(query.name), { + httpOnly: true, + maxAge: 60 * 60 * 24 * 7 // 1 week + })); + + // Redirect back after setting cookie + res.statusCode = 302; + res.setHeader('Location', req.headers.referer || '/'); + res.end(); + return; + } + + // Parse the cookies on the request + var cookies = cookie.parse(req.headers.cookie || ''); + + // Get the visitor name set in the cookie + var name = cookies.name; + + res.setHeader('Content-Type', 'text/html; charset=UTF-8'); + + if (name) { + res.write('

Welcome back, ' + escapeHtml(name) + '!

'); + } else { + res.write('

Hello, new visitor!

'); + } + + res.write('
'); + res.write(' '); + res.end('
'); +} + +http.createServer(onRequest).listen(3000); +``` + +## Testing + +```sh +$ npm test +``` + +## Benchmark + +``` +$ npm run bench + +> cookie@0.5.0 bench +> node benchmark/index.js + + node@18.18.2 + acorn@8.10.0 + ada@2.6.0 + ares@1.19.1 + brotli@1.0.9 + cldr@43.1 + icu@73.2 + llhttp@6.0.11 + modules@108 + napi@9 + nghttp2@1.57.0 + nghttp3@0.7.0 + ngtcp2@0.8.1 + openssl@3.0.10+quic + simdutf@3.2.14 + tz@2023c + undici@5.26.3 + unicode@15.0 + uv@1.44.2 + uvwasi@0.0.18 + v8@10.2.154.26-node.26 + zlib@1.2.13.1-motley + +> node benchmark/parse-top.js + + cookie.parse - top sites + + 14 tests completed. + + parse accounts.google.com x 2,588,913 ops/sec ±0.74% (186 runs sampled) + parse apple.com x 2,370,002 ops/sec ±0.69% (186 runs sampled) + parse cloudflare.com x 2,213,102 ops/sec ±0.88% (188 runs sampled) + parse docs.google.com x 2,194,157 ops/sec ±1.03% (184 runs sampled) + parse drive.google.com x 2,265,084 ops/sec ±0.79% (187 runs sampled) + parse en.wikipedia.org x 457,099 ops/sec ±0.81% (186 runs sampled) + parse linkedin.com x 504,407 ops/sec ±0.89% (186 runs sampled) + parse maps.google.com x 1,230,959 ops/sec ±0.98% (186 runs sampled) + parse microsoft.com x 926,294 ops/sec ±0.88% (184 runs sampled) + parse play.google.com x 2,311,338 ops/sec ±0.83% (185 runs sampled) + parse support.google.com x 1,508,850 ops/sec ±0.86% (186 runs sampled) + parse www.google.com x 1,022,582 ops/sec ±1.32% (182 runs sampled) + parse youtu.be x 332,136 ops/sec ±1.02% (185 runs sampled) + parse youtube.com x 323,833 ops/sec ±0.77% (183 runs sampled) + +> node benchmark/parse.js + + cookie.parse - generic + + 6 tests completed. + + simple x 3,214,032 ops/sec ±1.61% (183 runs sampled) + decode x 587,237 ops/sec ±1.16% (187 runs sampled) + unquote x 2,954,618 ops/sec ±1.35% (183 runs sampled) + duplicates x 857,008 ops/sec ±0.89% (187 runs sampled) + 10 cookies x 292,133 ops/sec ±0.89% (187 runs sampled) + 100 cookies x 22,610 ops/sec ±0.68% (187 runs sampled) +``` + +## References + +- [RFC 6265: HTTP State Management Mechanism][rfc-6265] +- [Same-site Cookies][rfc-6265bis-09-5.4.7] + +[rfc-cutler-httpbis-partitioned-cookies]: https://tools.ietf.org/html/draft-cutler-httpbis-partitioned-cookies/ +[rfc-west-cookie-priority-00-4.1]: https://tools.ietf.org/html/draft-west-cookie-priority-00#section-4.1 +[rfc-6265bis-09-5.4.7]: https://tools.ietf.org/html/draft-ietf-httpbis-rfc6265bis-09#section-5.4.7 +[rfc-6265]: https://tools.ietf.org/html/rfc6265 +[rfc-6265-5.1.4]: https://tools.ietf.org/html/rfc6265#section-5.1.4 +[rfc-6265-5.2.1]: https://tools.ietf.org/html/rfc6265#section-5.2.1 +[rfc-6265-5.2.2]: https://tools.ietf.org/html/rfc6265#section-5.2.2 +[rfc-6265-5.2.3]: https://tools.ietf.org/html/rfc6265#section-5.2.3 +[rfc-6265-5.2.4]: https://tools.ietf.org/html/rfc6265#section-5.2.4 +[rfc-6265-5.2.5]: https://tools.ietf.org/html/rfc6265#section-5.2.5 +[rfc-6265-5.2.6]: https://tools.ietf.org/html/rfc6265#section-5.2.6 +[rfc-6265-5.3]: https://tools.ietf.org/html/rfc6265#section-5.3 + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/jshttp/cookie/master?label=ci +[ci-url]: https://github.com/jshttp/cookie/actions/workflows/ci.yml +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/cookie/master +[coveralls-url]: https://coveralls.io/r/jshttp/cookie?branch=master +[node-image]: https://badgen.net/npm/node/cookie +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/cookie +[npm-url]: https://npmjs.org/package/cookie +[npm-version-image]: https://badgen.net/npm/v/cookie diff --git a/backend/node_modules/cookie/SECURITY.md b/backend/node_modules/cookie/SECURITY.md new file mode 100644 index 000000000..fd4a6c53a --- /dev/null +++ b/backend/node_modules/cookie/SECURITY.md @@ -0,0 +1,25 @@ +# Security Policies and Procedures + +## Reporting a Bug + +The `cookie` team and community take all security bugs seriously. Thank +you for improving the security of the project. We appreciate your efforts and +responsible disclosure and will make every effort to acknowledge your +contributions. + +Report security bugs by emailing the current owner(s) of `cookie`. This +information can be found in the npm registry using the command +`npm owner ls cookie`. +If unsure or unable to get the information from the above, open an issue +in the [project issue tracker](https://github.com/jshttp/cookie/issues) +asking for the current contact information. + +To ensure the timely response to your report, please ensure that the entirety +of the report is contained within the email body and not solely behind a web +link or an attachment. + +At least one owner will acknowledge your email within 48 hours, and will send a +more detailed response within 48 hours indicating the next steps in handling +your report. After the initial reply to your report, the owners will +endeavor to keep you informed of the progress towards a fix and full +announcement, and may ask for additional information or guidance. diff --git a/backend/node_modules/cookie/index.js b/backend/node_modules/cookie/index.js new file mode 100644 index 000000000..51a58cbe9 --- /dev/null +++ b/backend/node_modules/cookie/index.js @@ -0,0 +1,334 @@ +/*! + * cookie + * Copyright(c) 2012-2014 Roman Shtylman + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +exports.parse = parse; +exports.serialize = serialize; + +/** + * Module variables. + * @private + */ + +var __toString = Object.prototype.toString + +/** + * RegExp to match cookie-name in RFC 6265 sec 4.1.1 + * This refers out to the obsoleted definition of token in RFC 2616 sec 2.2 + * which has been replaced by the token definition in RFC 7230 appendix B. + * + * cookie-name = token + * token = 1*tchar + * tchar = "!" / "#" / "$" / "%" / "&" / "'" / + * "*" / "+" / "-" / "." / "^" / "_" / + * "`" / "|" / "~" / DIGIT / ALPHA + */ + +var cookieNameRegExp = /^[!#$%&'*+\-.^_`|~0-9A-Za-z]+$/; + +/** + * RegExp to match cookie-value in RFC 6265 sec 4.1.1 + * + * cookie-value = *cookie-octet / ( DQUOTE *cookie-octet DQUOTE ) + * cookie-octet = %x21 / %x23-2B / %x2D-3A / %x3C-5B / %x5D-7E + * ; US-ASCII characters excluding CTLs, + * ; whitespace DQUOTE, comma, semicolon, + * ; and backslash + */ + +var cookieValueRegExp = /^("?)[\u0021\u0023-\u002B\u002D-\u003A\u003C-\u005B\u005D-\u007E]*\1$/; + +/** + * RegExp to match domain-value in RFC 6265 sec 4.1.1 + * + * domain-value = + * ; defined in [RFC1034], Section 3.5, as + * ; enhanced by [RFC1123], Section 2.1 + * =
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## License + +(The MIT License) + +Copyright (c) 2014-2016 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/backend/node_modules/debug/component.json b/backend/node_modules/debug/component.json new file mode 100644 index 000000000..9de26410f --- /dev/null +++ b/backend/node_modules/debug/component.json @@ -0,0 +1,19 @@ +{ + "name": "debug", + "repo": "visionmedia/debug", + "description": "small debugging utility", + "version": "2.6.9", + "keywords": [ + "debug", + "log", + "debugger" + ], + "main": "src/browser.js", + "scripts": [ + "src/browser.js", + "src/debug.js" + ], + "dependencies": { + "rauchg/ms.js": "0.7.1" + } +} diff --git a/backend/node_modules/debug/karma.conf.js b/backend/node_modules/debug/karma.conf.js new file mode 100644 index 000000000..103a82d15 --- /dev/null +++ b/backend/node_modules/debug/karma.conf.js @@ -0,0 +1,70 @@ +// Karma configuration +// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC) + +module.exports = function(config) { + config.set({ + + // base path that will be used to resolve all patterns (eg. files, exclude) + basePath: '', + + + // frameworks to use + // available frameworks: https://npmjs.org/browse/keyword/karma-adapter + frameworks: ['mocha', 'chai', 'sinon'], + + + // list of files / patterns to load in the browser + files: [ + 'dist/debug.js', + 'test/*spec.js' + ], + + + // list of files to exclude + exclude: [ + 'src/node.js' + ], + + + // preprocess matching files before serving them to the browser + // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor + preprocessors: { + }, + + // test results reporter to use + // possible values: 'dots', 'progress' + // available reporters: https://npmjs.org/browse/keyword/karma-reporter + reporters: ['progress'], + + + // web server port + port: 9876, + + + // enable / disable colors in the output (reporters and logs) + colors: true, + + + // level of logging + // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG + logLevel: config.LOG_INFO, + + + // enable / disable watching file and executing tests whenever any file changes + autoWatch: true, + + + // start these browsers + // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher + browsers: ['PhantomJS'], + + + // Continuous Integration mode + // if true, Karma captures browsers, runs the tests and exits + singleRun: false, + + // Concurrency level + // how many browser should be started simultaneous + concurrency: Infinity + }) +} diff --git a/backend/node_modules/debug/node.js b/backend/node_modules/debug/node.js new file mode 100644 index 000000000..7fc36fe6d --- /dev/null +++ b/backend/node_modules/debug/node.js @@ -0,0 +1 @@ +module.exports = require('./src/node'); diff --git a/backend/node_modules/debug/package.json b/backend/node_modules/debug/package.json new file mode 100644 index 000000000..dc787ba76 --- /dev/null +++ b/backend/node_modules/debug/package.json @@ -0,0 +1,49 @@ +{ + "name": "debug", + "version": "2.6.9", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "description": "small debugging utility", + "keywords": [ + "debug", + "log", + "debugger" + ], + "author": "TJ Holowaychuk ", + "contributors": [ + "Nathan Rajlich (http://n8.io)", + "Andrew Rhyne " + ], + "license": "MIT", + "dependencies": { + "ms": "2.0.0" + }, + "devDependencies": { + "browserify": "9.0.3", + "chai": "^3.5.0", + "concurrently": "^3.1.0", + "coveralls": "^2.11.15", + "eslint": "^3.12.1", + "istanbul": "^0.4.5", + "karma": "^1.3.0", + "karma-chai": "^0.1.0", + "karma-mocha": "^1.3.0", + "karma-phantomjs-launcher": "^1.0.2", + "karma-sinon": "^1.0.5", + "mocha": "^3.2.0", + "mocha-lcov-reporter": "^1.2.0", + "rimraf": "^2.5.4", + "sinon": "^1.17.6", + "sinon-chai": "^2.8.0" + }, + "main": "./src/index.js", + "browser": "./src/browser.js", + "component": { + "scripts": { + "debug/index.js": "browser.js", + "debug/debug.js": "debug.js" + } + } +} diff --git a/backend/node_modules/debug/src/browser.js b/backend/node_modules/debug/src/browser.js new file mode 100644 index 000000000..710692493 --- /dev/null +++ b/backend/node_modules/debug/src/browser.js @@ -0,0 +1,185 @@ +/** + * This is the web browser implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = 'undefined' != typeof chrome + && 'undefined' != typeof chrome.storage + ? chrome.storage.local + : localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + 'lightseagreen', + 'forestgreen', + 'goldenrod', + 'dodgerblue', + 'darkorchid', + 'crimson' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') { + return true; + } + + // is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +exports.formatters.j = function(v) { + try { + return JSON.stringify(v); + } catch (err) { + return '[UnexpectedJSONParseError]: ' + err.message; + } +}; + + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + var useColors = this.useColors; + + args[0] = (useColors ? '%c' : '') + + this.namespace + + (useColors ? ' %c' : ' ') + + args[0] + + (useColors ? '%c ' : ' ') + + '+' + exports.humanize(this.diff); + + if (!useColors) return; + + var c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit') + + // the final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + var index = 0; + var lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, function(match) { + if ('%%' === match) return; + index++; + if ('%c' === match) { + // we only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + +function log() { + // this hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return 'object' === typeof console + && console.log + && Function.prototype.apply.call(console.log, console, arguments); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + try { + if (null == namespaces) { + exports.storage.removeItem('debug'); + } else { + exports.storage.debug = namespaces; + } + } catch(e) {} +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + var r; + try { + r = exports.storage.debug; + } catch(e) {} + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Enable namespaces listed in `localStorage.debug` initially. + */ + +exports.enable(load()); + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + return window.localStorage; + } catch (e) {} +} diff --git a/backend/node_modules/debug/src/debug.js b/backend/node_modules/debug/src/debug.js new file mode 100644 index 000000000..6a5e3fc94 --- /dev/null +++ b/backend/node_modules/debug/src/debug.js @@ -0,0 +1,202 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = createDebug.debug = createDebug['default'] = createDebug; +exports.coerce = coerce; +exports.disable = disable; +exports.enable = enable; +exports.enabled = enabled; +exports.humanize = require('ms'); + +/** + * The currently active debug mode names, and names to skip. + */ + +exports.names = []; +exports.skips = []; + +/** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + +exports.formatters = {}; + +/** + * Previous log timestamp. + */ + +var prevTime; + +/** + * Select a color. + * @param {String} namespace + * @return {Number} + * @api private + */ + +function selectColor(namespace) { + var hash = 0, i; + + for (i in namespace) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return exports.colors[Math.abs(hash) % exports.colors.length]; +} + +/** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + +function createDebug(namespace) { + + function debug() { + // disabled? + if (!debug.enabled) return; + + var self = debug; + + // set `diff` timestamp + var curr = +new Date(); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + // turn the `arguments` into a proper Array + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + + args[0] = exports.coerce(args[0]); + + if ('string' !== typeof args[0]) { + // anything else let's inspect with %O + args.unshift('%O'); + } + + // apply any `formatters` transformations + var index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) { + // if we encounter an escaped % then don't increase the array index + if (match === '%%') return match; + index++; + var formatter = exports.formatters[format]; + if ('function' === typeof formatter) { + var val = args[index]; + match = formatter.call(self, val); + + // now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // apply env-specific formatting (colors, etc.) + exports.formatArgs.call(self, args); + + var logFn = debug.log || exports.log || console.log.bind(console); + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = exports.enabled(namespace); + debug.useColors = exports.useColors(); + debug.color = selectColor(namespace); + + // env-specific initialization logic for debug instances + if ('function' === typeof exports.init) { + exports.init(debug); + } + + return debug; +} + +/** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + +function enable(namespaces) { + exports.save(namespaces); + + exports.names = []; + exports.skips = []; + + var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + var len = split.length; + + for (var i = 0; i < len; i++) { + if (!split[i]) continue; // ignore empty strings + namespaces = split[i].replace(/\*/g, '.*?'); + if (namespaces[0] === '-') { + exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + exports.names.push(new RegExp('^' + namespaces + '$')); + } + } +} + +/** + * Disable debug output. + * + * @api public + */ + +function disable() { + exports.enable(''); +} + +/** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + +function enabled(name) { + var i, len; + for (i = 0, len = exports.skips.length; i < len; i++) { + if (exports.skips[i].test(name)) { + return false; + } + } + for (i = 0, len = exports.names.length; i < len; i++) { + if (exports.names[i].test(name)) { + return true; + } + } + return false; +} + +/** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function coerce(val) { + if (val instanceof Error) return val.stack || val.message; + return val; +} diff --git a/backend/node_modules/debug/src/index.js b/backend/node_modules/debug/src/index.js new file mode 100644 index 000000000..e12cf4d58 --- /dev/null +++ b/backend/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer process, which is node, but we should + * treat as a browser. + */ + +if (typeof process !== 'undefined' && process.type === 'renderer') { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/backend/node_modules/debug/src/inspector-log.js b/backend/node_modules/debug/src/inspector-log.js new file mode 100644 index 000000000..60ea6c04a --- /dev/null +++ b/backend/node_modules/debug/src/inspector-log.js @@ -0,0 +1,15 @@ +module.exports = inspectorLog; + +// black hole +const nullStream = new (require('stream').Writable)(); +nullStream._write = () => {}; + +/** + * Outputs a `console.log()` to the Node.js Inspector console *only*. + */ +function inspectorLog() { + const stdout = console._stdout; + console._stdout = nullStream; + console.log.apply(console, arguments); + console._stdout = stdout; +} diff --git a/backend/node_modules/debug/src/node.js b/backend/node_modules/debug/src/node.js new file mode 100644 index 000000000..b15109c90 --- /dev/null +++ b/backend/node_modules/debug/src/node.js @@ -0,0 +1,248 @@ +/** + * Module dependencies. + */ + +var tty = require('tty'); +var util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(function (key) { + return /^debug_/i.test(key); +}).reduce(function (obj, key) { + // camel-case + var prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() }); + + // coerce string value into JS value + var val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) val = true; + else if (/^(no|off|false|disabled)$/i.test(val)) val = false; + else if (val === 'null') val = null; + else val = Number(val); + + obj[prop] = val; + return obj; +}, {}); + +/** + * The file descriptor to write the `debug()` calls to. + * Set the `DEBUG_FD` env variable to override with another value. i.e.: + * + * $ DEBUG_FD=3 node script.js 3>debug.log + */ + +var fd = parseInt(process.env.DEBUG_FD, 10) || 2; + +if (1 !== fd && 2 !== fd) { + util.deprecate(function(){}, 'except for stderr(2) and stdout(1), any other usage of DEBUG_FD is deprecated. Override debug.log if you want to use a different log function (https://git.io/debug_fd)')() +} + +var stream = 1 === fd ? process.stdout : + 2 === fd ? process.stderr : + createWritableStdioStream(fd); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts + ? Boolean(exports.inspectOpts.colors) + : tty.isatty(fd); +} + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +exports.formatters.o = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .split('\n').map(function(str) { + return str.trim() + }).join(' '); +}; + +/** + * Map %o to `util.inspect()`, allowing multiple lines if needed. + */ + +exports.formatters.O = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + var name = this.namespace; + var useColors = this.useColors; + + if (useColors) { + var c = this.color; + var prefix = ' \u001b[3' + c + ';1m' + name + ' ' + '\u001b[0m'; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push('\u001b[3' + c + 'm+' + exports.humanize(this.diff) + '\u001b[0m'); + } else { + args[0] = new Date().toUTCString() + + ' ' + name + ' ' + args[0]; + } +} + +/** + * Invokes `util.format()` with the specified arguments and writes to `stream`. + */ + +function log() { + return stream.write(util.format.apply(util, arguments) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + if (null == namespaces) { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } else { + process.env.DEBUG = namespaces; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Copied from `node/src/node.js`. + * + * XXX: It's lame that node doesn't expose this API out-of-the-box. It also + * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame. + */ + +function createWritableStdioStream (fd) { + var stream; + var tty_wrap = process.binding('tty_wrap'); + + // Note stream._type is used for test-module-load-list.js + + switch (tty_wrap.guessHandleType(fd)) { + case 'TTY': + stream = new tty.WriteStream(fd); + stream._type = 'tty'; + + // Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + case 'FILE': + var fs = require('fs'); + stream = new fs.SyncWriteStream(fd, { autoClose: false }); + stream._type = 'fs'; + break; + + case 'PIPE': + case 'TCP': + var net = require('net'); + stream = new net.Socket({ + fd: fd, + readable: false, + writable: true + }); + + // FIXME Should probably have an option in net.Socket to create a + // stream from an existing fd which is writable only. But for now + // we'll just add this hack and set the `readable` member to false. + // Test: ./node test/fixtures/echo.js < /etc/passwd + stream.readable = false; + stream.read = null; + stream._type = 'pipe'; + + // FIXME Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + default: + // Probably an error on in uv_guess_handle() + throw new Error('Implement me. Unknown stream file type!'); + } + + // For supporting legacy API we put the FD here. + stream.fd = fd; + + stream._isStdio = true; + + return stream; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init (debug) { + debug.inspectOpts = {}; + + var keys = Object.keys(exports.inspectOpts); + for (var i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +/** + * Enable namespaces listed in `process.env.DEBUG` initially. + */ + +exports.enable(load()); diff --git a/backend/node_modules/delegates/.npmignore b/backend/node_modules/delegates/.npmignore new file mode 100644 index 000000000..c2658d7d1 --- /dev/null +++ b/backend/node_modules/delegates/.npmignore @@ -0,0 +1 @@ +node_modules/ diff --git a/backend/node_modules/delegates/History.md b/backend/node_modules/delegates/History.md new file mode 100644 index 000000000..25959eab6 --- /dev/null +++ b/backend/node_modules/delegates/History.md @@ -0,0 +1,22 @@ + +1.0.0 / 2015-12-14 +================== + + * Merge pull request #12 from kasicka/master + * Add license text + +0.1.0 / 2014-10-17 +================== + + * adds `.fluent()` to api + +0.0.3 / 2014-01-13 +================== + + * fix receiver for .method() + +0.0.2 / 2014-01-13 +================== + + * Object.defineProperty() sucks + * Initial commit diff --git a/backend/node_modules/delegates/License b/backend/node_modules/delegates/License new file mode 100644 index 000000000..60de60add --- /dev/null +++ b/backend/node_modules/delegates/License @@ -0,0 +1,20 @@ +Copyright (c) 2015 TJ Holowaychuk + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/backend/node_modules/delegates/Makefile b/backend/node_modules/delegates/Makefile new file mode 100644 index 000000000..a9dcfd50d --- /dev/null +++ b/backend/node_modules/delegates/Makefile @@ -0,0 +1,8 @@ + +test: + @./node_modules/.bin/mocha \ + --require should \ + --reporter spec \ + --bail + +.PHONY: test \ No newline at end of file diff --git a/backend/node_modules/delegates/Readme.md b/backend/node_modules/delegates/Readme.md new file mode 100644 index 000000000..ab8cf4ace --- /dev/null +++ b/backend/node_modules/delegates/Readme.md @@ -0,0 +1,94 @@ + +# delegates + + Node method and accessor delegation utilty. + +## Installation + +``` +$ npm install delegates +``` + +## Example + +```js +var delegate = require('delegates'); + +... + +delegate(proto, 'request') + .method('acceptsLanguages') + .method('acceptsEncodings') + .method('acceptsCharsets') + .method('accepts') + .method('is') + .access('querystring') + .access('idempotent') + .access('socket') + .access('length') + .access('query') + .access('search') + .access('status') + .access('method') + .access('path') + .access('body') + .access('host') + .access('url') + .getter('subdomains') + .getter('protocol') + .getter('header') + .getter('stale') + .getter('fresh') + .getter('secure') + .getter('ips') + .getter('ip') +``` + +# API + +## Delegate(proto, prop) + +Creates a delegator instance used to configure using the `prop` on the given +`proto` object. (which is usually a prototype) + +## Delegate#method(name) + +Allows the given method `name` to be accessed on the host. + +## Delegate#getter(name) + +Creates a "getter" for the property with the given `name` on the delegated +object. + +## Delegate#setter(name) + +Creates a "setter" for the property with the given `name` on the delegated +object. + +## Delegate#access(name) + +Creates an "accessor" (ie: both getter *and* setter) for the property with the +given `name` on the delegated object. + +## Delegate#fluent(name) + +A unique type of "accessor" that works for a "fluent" API. When called as a +getter, the method returns the expected value. However, if the method is called +with a value, it will return itself so it can be chained. For example: + +```js +delegate(proto, 'request') + .fluent('query') + +// getter +var q = request.query(); + +// setter (chainable) +request + .query({ a: 1 }) + .query({ b: 2 }); +``` + +# License + + MIT diff --git a/backend/node_modules/delegates/index.js b/backend/node_modules/delegates/index.js new file mode 100644 index 000000000..17c222d52 --- /dev/null +++ b/backend/node_modules/delegates/index.js @@ -0,0 +1,121 @@ + +/** + * Expose `Delegator`. + */ + +module.exports = Delegator; + +/** + * Initialize a delegator. + * + * @param {Object} proto + * @param {String} target + * @api public + */ + +function Delegator(proto, target) { + if (!(this instanceof Delegator)) return new Delegator(proto, target); + this.proto = proto; + this.target = target; + this.methods = []; + this.getters = []; + this.setters = []; + this.fluents = []; +} + +/** + * Delegate method `name`. + * + * @param {String} name + * @return {Delegator} self + * @api public + */ + +Delegator.prototype.method = function(name){ + var proto = this.proto; + var target = this.target; + this.methods.push(name); + + proto[name] = function(){ + return this[target][name].apply(this[target], arguments); + }; + + return this; +}; + +/** + * Delegator accessor `name`. + * + * @param {String} name + * @return {Delegator} self + * @api public + */ + +Delegator.prototype.access = function(name){ + return this.getter(name).setter(name); +}; + +/** + * Delegator getter `name`. + * + * @param {String} name + * @return {Delegator} self + * @api public + */ + +Delegator.prototype.getter = function(name){ + var proto = this.proto; + var target = this.target; + this.getters.push(name); + + proto.__defineGetter__(name, function(){ + return this[target][name]; + }); + + return this; +}; + +/** + * Delegator setter `name`. + * + * @param {String} name + * @return {Delegator} self + * @api public + */ + +Delegator.prototype.setter = function(name){ + var proto = this.proto; + var target = this.target; + this.setters.push(name); + + proto.__defineSetter__(name, function(val){ + return this[target][name] = val; + }); + + return this; +}; + +/** + * Delegator fluent accessor + * + * @param {String} name + * @return {Delegator} self + * @api public + */ + +Delegator.prototype.fluent = function (name) { + var proto = this.proto; + var target = this.target; + this.fluents.push(name); + + proto[name] = function(val){ + if ('undefined' != typeof val) { + this[target][name] = val; + return this; + } else { + return this[target][name]; + } + }; + + return this; +}; diff --git a/backend/node_modules/delegates/package.json b/backend/node_modules/delegates/package.json new file mode 100644 index 000000000..17240384f --- /dev/null +++ b/backend/node_modules/delegates/package.json @@ -0,0 +1,13 @@ +{ + "name": "delegates", + "version": "1.0.0", + "repository": "visionmedia/node-delegates", + "description": "delegate methods and accessors to another property", + "keywords": ["delegate", "delegation"], + "dependencies": {}, + "devDependencies": { + "mocha": "*", + "should": "*" + }, + "license": "MIT" +} diff --git a/backend/node_modules/delegates/test/index.js b/backend/node_modules/delegates/test/index.js new file mode 100644 index 000000000..7b6e3d4df --- /dev/null +++ b/backend/node_modules/delegates/test/index.js @@ -0,0 +1,94 @@ + +var assert = require('assert'); +var delegate = require('..'); + +describe('.method(name)', function(){ + it('should delegate methods', function(){ + var obj = {}; + + obj.request = { + foo: function(bar){ + assert(this == obj.request); + return bar; + } + }; + + delegate(obj, 'request').method('foo'); + + obj.foo('something').should.equal('something'); + }) +}) + +describe('.getter(name)', function(){ + it('should delegate getters', function(){ + var obj = {}; + + obj.request = { + get type() { + return 'text/html'; + } + } + + delegate(obj, 'request').getter('type'); + + obj.type.should.equal('text/html'); + }) +}) + +describe('.setter(name)', function(){ + it('should delegate setters', function(){ + var obj = {}; + + obj.request = { + get type() { + return this._type.toUpperCase(); + }, + + set type(val) { + this._type = val; + } + } + + delegate(obj, 'request').setter('type'); + + obj.type = 'hey'; + obj.request.type.should.equal('HEY'); + }) +}) + +describe('.access(name)', function(){ + it('should delegate getters and setters', function(){ + var obj = {}; + + obj.request = { + get type() { + return this._type.toUpperCase(); + }, + + set type(val) { + this._type = val; + } + } + + delegate(obj, 'request').access('type'); + + obj.type = 'hey'; + obj.type.should.equal('HEY'); + }) +}) + +describe('.fluent(name)', function () { + it('should delegate in a fluent fashion', function () { + var obj = { + settings: { + env: 'development' + } + }; + + delegate(obj, 'settings').fluent('env'); + + obj.env().should.equal('development'); + obj.env('production').should.equal(obj); + obj.settings.env.should.equal('production'); + }) +}) diff --git a/backend/node_modules/depd/History.md b/backend/node_modules/depd/History.md new file mode 100644 index 000000000..cd9ebaaa9 --- /dev/null +++ b/backend/node_modules/depd/History.md @@ -0,0 +1,103 @@ +2.0.0 / 2018-10-26 +================== + + * Drop support for Node.js 0.6 + * Replace internal `eval` usage with `Function` constructor + * Use instance methods on `process` to check for listeners + +1.1.2 / 2018-01-11 +================== + + * perf: remove argument reassignment + * Support Node.js 0.6 to 9.x + +1.1.1 / 2017-07-27 +================== + + * Remove unnecessary `Buffer` loading + * Support Node.js 0.6 to 8.x + +1.1.0 / 2015-09-14 +================== + + * Enable strict mode in more places + * Support io.js 3.x + * Support io.js 2.x + * Support web browser loading + - Requires bundler like Browserify or webpack + +1.0.1 / 2015-04-07 +================== + + * Fix `TypeError`s when under `'use strict'` code + * Fix useless type name on auto-generated messages + * Support io.js 1.x + * Support Node.js 0.12 + +1.0.0 / 2014-09-17 +================== + + * No changes + +0.4.5 / 2014-09-09 +================== + + * Improve call speed to functions using the function wrapper + * Support Node.js 0.6 + +0.4.4 / 2014-07-27 +================== + + * Work-around v8 generating empty stack traces + +0.4.3 / 2014-07-26 +================== + + * Fix exception when global `Error.stackTraceLimit` is too low + +0.4.2 / 2014-07-19 +================== + + * Correct call site for wrapped functions and properties + +0.4.1 / 2014-07-19 +================== + + * Improve automatic message generation for function properties + +0.4.0 / 2014-07-19 +================== + + * Add `TRACE_DEPRECATION` environment variable + * Remove non-standard grey color from color output + * Support `--no-deprecation` argument + * Support `--trace-deprecation` argument + * Support `deprecate.property(fn, prop, message)` + +0.3.0 / 2014-06-16 +================== + + * Add `NO_DEPRECATION` environment variable + +0.2.0 / 2014-06-15 +================== + + * Add `deprecate.property(obj, prop, message)` + * Remove `supports-color` dependency for node.js 0.8 + +0.1.0 / 2014-06-15 +================== + + * Add `deprecate.function(fn, message)` + * Add `process.on('deprecation', fn)` emitter + * Automatically generate message when omitted from `deprecate()` + +0.0.1 / 2014-06-15 +================== + + * Fix warning for dynamic calls at singe call site + +0.0.0 / 2014-06-15 +================== + + * Initial implementation diff --git a/backend/node_modules/depd/LICENSE b/backend/node_modules/depd/LICENSE new file mode 100644 index 000000000..248de7af2 --- /dev/null +++ b/backend/node_modules/depd/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2018 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/backend/node_modules/depd/Readme.md b/backend/node_modules/depd/Readme.md new file mode 100644 index 000000000..043d1ca28 --- /dev/null +++ b/backend/node_modules/depd/Readme.md @@ -0,0 +1,280 @@ +# depd + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Linux Build][travis-image]][travis-url] +[![Windows Build][appveyor-image]][appveyor-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +Deprecate all the things + +> With great modules comes great responsibility; mark things deprecated! + +## Install + +This module is installed directly using `npm`: + +```sh +$ npm install depd +``` + +This module can also be bundled with systems like +[Browserify](http://browserify.org/) or [webpack](https://webpack.github.io/), +though by default this module will alter it's API to no longer display or +track deprecations. + +## API + + + +```js +var deprecate = require('depd')('my-module') +``` + +This library allows you to display deprecation messages to your users. +This library goes above and beyond with deprecation warnings by +introspection of the call stack (but only the bits that it is interested +in). + +Instead of just warning on the first invocation of a deprecated +function and never again, this module will warn on the first invocation +of a deprecated function per unique call site, making it ideal to alert +users of all deprecated uses across the code base, rather than just +whatever happens to execute first. + +The deprecation warnings from this module also include the file and line +information for the call into the module that the deprecated function was +in. + +**NOTE** this library has a similar interface to the `debug` module, and +this module uses the calling file to get the boundary for the call stacks, +so you should always create a new `deprecate` object in each file and not +within some central file. + +### depd(namespace) + +Create a new deprecate function that uses the given namespace name in the +messages and will display the call site prior to the stack entering the +file this function was called from. It is highly suggested you use the +name of your module as the namespace. + +### deprecate(message) + +Call this function from deprecated code to display a deprecation message. +This message will appear once per unique caller site. Caller site is the +first call site in the stack in a different file from the caller of this +function. + +If the message is omitted, a message is generated for you based on the site +of the `deprecate()` call and will display the name of the function called, +similar to the name displayed in a stack trace. + +### deprecate.function(fn, message) + +Call this function to wrap a given function in a deprecation message on any +call to the function. An optional message can be supplied to provide a custom +message. + +### deprecate.property(obj, prop, message) + +Call this function to wrap a given property on object in a deprecation message +on any accessing or setting of the property. An optional message can be supplied +to provide a custom message. + +The method must be called on the object where the property belongs (not +inherited from the prototype). + +If the property is a data descriptor, it will be converted to an accessor +descriptor in order to display the deprecation message. + +### process.on('deprecation', fn) + +This module will allow easy capturing of deprecation errors by emitting the +errors as the type "deprecation" on the global `process`. If there are no +listeners for this type, the errors are written to STDERR as normal, but if +there are any listeners, nothing will be written to STDERR and instead only +emitted. From there, you can write the errors in a different format or to a +logging source. + +The error represents the deprecation and is emitted only once with the same +rules as writing to STDERR. The error has the following properties: + + - `message` - This is the message given by the library + - `name` - This is always `'DeprecationError'` + - `namespace` - This is the namespace the deprecation came from + - `stack` - This is the stack of the call to the deprecated thing + +Example `error.stack` output: + +``` +DeprecationError: my-cool-module deprecated oldfunction + at Object. ([eval]-wrapper:6:22) + at Module._compile (module.js:456:26) + at evalScript (node.js:532:25) + at startup (node.js:80:7) + at node.js:902:3 +``` + +### process.env.NO_DEPRECATION + +As a user of modules that are deprecated, the environment variable `NO_DEPRECATION` +is provided as a quick solution to silencing deprecation warnings from being +output. The format of this is similar to that of `DEBUG`: + +```sh +$ NO_DEPRECATION=my-module,othermod node app.js +``` + +This will suppress deprecations from being output for "my-module" and "othermod". +The value is a list of comma-separated namespaces. To suppress every warning +across all namespaces, use the value `*` for a namespace. + +Providing the argument `--no-deprecation` to the `node` executable will suppress +all deprecations (only available in Node.js 0.8 or higher). + +**NOTE** This will not suppress the deperecations given to any "deprecation" +event listeners, just the output to STDERR. + +### process.env.TRACE_DEPRECATION + +As a user of modules that are deprecated, the environment variable `TRACE_DEPRECATION` +is provided as a solution to getting more detailed location information in deprecation +warnings by including the entire stack trace. The format of this is the same as +`NO_DEPRECATION`: + +```sh +$ TRACE_DEPRECATION=my-module,othermod node app.js +``` + +This will include stack traces for deprecations being output for "my-module" and +"othermod". The value is a list of comma-separated namespaces. To trace every +warning across all namespaces, use the value `*` for a namespace. + +Providing the argument `--trace-deprecation` to the `node` executable will trace +all deprecations (only available in Node.js 0.8 or higher). + +**NOTE** This will not trace the deperecations silenced by `NO_DEPRECATION`. + +## Display + +![message](files/message.png) + +When a user calls a function in your library that you mark deprecated, they +will see the following written to STDERR (in the given colors, similar colors +and layout to the `debug` module): + +``` +bright cyan bright yellow +| | reset cyan +| | | | +▼ ▼ ▼ ▼ +my-cool-module deprecated oldfunction [eval]-wrapper:6:22 +▲ ▲ ▲ ▲ +| | | | +namespace | | location of mycoolmod.oldfunction() call + | deprecation message + the word "deprecated" +``` + +If the user redirects their STDERR to a file or somewhere that does not support +colors, they see (similar layout to the `debug` module): + +``` +Sun, 15 Jun 2014 05:21:37 GMT my-cool-module deprecated oldfunction at [eval]-wrapper:6:22 +▲ ▲ ▲ ▲ ▲ +| | | | | +timestamp of message namespace | | location of mycoolmod.oldfunction() call + | deprecation message + the word "deprecated" +``` + +## Examples + +### Deprecating all calls to a function + +This will display a deprecated message about "oldfunction" being deprecated +from "my-module" on STDERR. + +```js +var deprecate = require('depd')('my-cool-module') + +// message automatically derived from function name +// Object.oldfunction +exports.oldfunction = deprecate.function(function oldfunction () { + // all calls to function are deprecated +}) + +// specific message +exports.oldfunction = deprecate.function(function () { + // all calls to function are deprecated +}, 'oldfunction') +``` + +### Conditionally deprecating a function call + +This will display a deprecated message about "weirdfunction" being deprecated +from "my-module" on STDERR when called with less than 2 arguments. + +```js +var deprecate = require('depd')('my-cool-module') + +exports.weirdfunction = function () { + if (arguments.length < 2) { + // calls with 0 or 1 args are deprecated + deprecate('weirdfunction args < 2') + } +} +``` + +When calling `deprecate` as a function, the warning is counted per call site +within your own module, so you can display different deprecations depending +on different situations and the users will still get all the warnings: + +```js +var deprecate = require('depd')('my-cool-module') + +exports.weirdfunction = function () { + if (arguments.length < 2) { + // calls with 0 or 1 args are deprecated + deprecate('weirdfunction args < 2') + } else if (typeof arguments[0] !== 'string') { + // calls with non-string first argument are deprecated + deprecate('weirdfunction non-string first arg') + } +} +``` + +### Deprecating property access + +This will display a deprecated message about "oldprop" being deprecated +from "my-module" on STDERR when accessed. A deprecation will be displayed +when setting the value and when getting the value. + +```js +var deprecate = require('depd')('my-cool-module') + +exports.oldprop = 'something' + +// message automatically derives from property name +deprecate.property(exports, 'oldprop') + +// explicit message +deprecate.property(exports, 'oldprop', 'oldprop >= 0.10') +``` + +## License + +[MIT](LICENSE) + +[appveyor-image]: https://badgen.net/appveyor/ci/dougwilson/nodejs-depd/master?label=windows +[appveyor-url]: https://ci.appveyor.com/project/dougwilson/nodejs-depd +[coveralls-image]: https://badgen.net/coveralls/c/github/dougwilson/nodejs-depd/master +[coveralls-url]: https://coveralls.io/r/dougwilson/nodejs-depd?branch=master +[node-image]: https://badgen.net/npm/node/depd +[node-url]: https://nodejs.org/en/download/ +[npm-downloads-image]: https://badgen.net/npm/dm/depd +[npm-url]: https://npmjs.org/package/depd +[npm-version-image]: https://badgen.net/npm/v/depd +[travis-image]: https://badgen.net/travis/dougwilson/nodejs-depd/master?label=linux +[travis-url]: https://travis-ci.org/dougwilson/nodejs-depd diff --git a/backend/node_modules/depd/index.js b/backend/node_modules/depd/index.js new file mode 100644 index 000000000..1bf2fcfde --- /dev/null +++ b/backend/node_modules/depd/index.js @@ -0,0 +1,538 @@ +/*! + * depd + * Copyright(c) 2014-2018 Douglas Christopher Wilson + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var relative = require('path').relative + +/** + * Module exports. + */ + +module.exports = depd + +/** + * Get the path to base files on. + */ + +var basePath = process.cwd() + +/** + * Determine if namespace is contained in the string. + */ + +function containsNamespace (str, namespace) { + var vals = str.split(/[ ,]+/) + var ns = String(namespace).toLowerCase() + + for (var i = 0; i < vals.length; i++) { + var val = vals[i] + + // namespace contained + if (val && (val === '*' || val.toLowerCase() === ns)) { + return true + } + } + + return false +} + +/** + * Convert a data descriptor to accessor descriptor. + */ + +function convertDataDescriptorToAccessor (obj, prop, message) { + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + var value = descriptor.value + + descriptor.get = function getter () { return value } + + if (descriptor.writable) { + descriptor.set = function setter (val) { return (value = val) } + } + + delete descriptor.value + delete descriptor.writable + + Object.defineProperty(obj, prop, descriptor) + + return descriptor +} + +/** + * Create arguments string to keep arity. + */ + +function createArgumentsString (arity) { + var str = '' + + for (var i = 0; i < arity; i++) { + str += ', arg' + i + } + + return str.substr(2) +} + +/** + * Create stack string from stack. + */ + +function createStackString (stack) { + var str = this.name + ': ' + this.namespace + + if (this.message) { + str += ' deprecated ' + this.message + } + + for (var i = 0; i < stack.length; i++) { + str += '\n at ' + stack[i].toString() + } + + return str +} + +/** + * Create deprecate for namespace in caller. + */ + +function depd (namespace) { + if (!namespace) { + throw new TypeError('argument namespace is required') + } + + var stack = getStack() + var site = callSiteLocation(stack[1]) + var file = site[0] + + function deprecate (message) { + // call to self as log + log.call(deprecate, message) + } + + deprecate._file = file + deprecate._ignored = isignored(namespace) + deprecate._namespace = namespace + deprecate._traced = istraced(namespace) + deprecate._warned = Object.create(null) + + deprecate.function = wrapfunction + deprecate.property = wrapproperty + + return deprecate +} + +/** + * Determine if event emitter has listeners of a given type. + * + * The way to do this check is done three different ways in Node.js >= 0.8 + * so this consolidates them into a minimal set using instance methods. + * + * @param {EventEmitter} emitter + * @param {string} type + * @returns {boolean} + * @private + */ + +function eehaslisteners (emitter, type) { + var count = typeof emitter.listenerCount !== 'function' + ? emitter.listeners(type).length + : emitter.listenerCount(type) + + return count > 0 +} + +/** + * Determine if namespace is ignored. + */ + +function isignored (namespace) { + if (process.noDeprecation) { + // --no-deprecation support + return true + } + + var str = process.env.NO_DEPRECATION || '' + + // namespace ignored + return containsNamespace(str, namespace) +} + +/** + * Determine if namespace is traced. + */ + +function istraced (namespace) { + if (process.traceDeprecation) { + // --trace-deprecation support + return true + } + + var str = process.env.TRACE_DEPRECATION || '' + + // namespace traced + return containsNamespace(str, namespace) +} + +/** + * Display deprecation message. + */ + +function log (message, site) { + var haslisteners = eehaslisteners(process, 'deprecation') + + // abort early if no destination + if (!haslisteners && this._ignored) { + return + } + + var caller + var callFile + var callSite + var depSite + var i = 0 + var seen = false + var stack = getStack() + var file = this._file + + if (site) { + // provided site + depSite = site + callSite = callSiteLocation(stack[1]) + callSite.name = depSite.name + file = callSite[0] + } else { + // get call site + i = 2 + depSite = callSiteLocation(stack[i]) + callSite = depSite + } + + // get caller of deprecated thing in relation to file + for (; i < stack.length; i++) { + caller = callSiteLocation(stack[i]) + callFile = caller[0] + + if (callFile === file) { + seen = true + } else if (callFile === this._file) { + file = this._file + } else if (seen) { + break + } + } + + var key = caller + ? depSite.join(':') + '__' + caller.join(':') + : undefined + + if (key !== undefined && key in this._warned) { + // already warned + return + } + + this._warned[key] = true + + // generate automatic message from call site + var msg = message + if (!msg) { + msg = callSite === depSite || !callSite.name + ? defaultMessage(depSite) + : defaultMessage(callSite) + } + + // emit deprecation if listeners exist + if (haslisteners) { + var err = DeprecationError(this._namespace, msg, stack.slice(i)) + process.emit('deprecation', err) + return + } + + // format and write message + var format = process.stderr.isTTY + ? formatColor + : formatPlain + var output = format.call(this, msg, caller, stack.slice(i)) + process.stderr.write(output + '\n', 'utf8') +} + +/** + * Get call site location as array. + */ + +function callSiteLocation (callSite) { + var file = callSite.getFileName() || '' + var line = callSite.getLineNumber() + var colm = callSite.getColumnNumber() + + if (callSite.isEval()) { + file = callSite.getEvalOrigin() + ', ' + file + } + + var site = [file, line, colm] + + site.callSite = callSite + site.name = callSite.getFunctionName() + + return site +} + +/** + * Generate a default message from the site. + */ + +function defaultMessage (site) { + var callSite = site.callSite + var funcName = site.name + + // make useful anonymous name + if (!funcName) { + funcName = '' + } + + var context = callSite.getThis() + var typeName = context && callSite.getTypeName() + + // ignore useless type name + if (typeName === 'Object') { + typeName = undefined + } + + // make useful type name + if (typeName === 'Function') { + typeName = context.name || typeName + } + + return typeName && callSite.getMethodName() + ? typeName + '.' + funcName + : funcName +} + +/** + * Format deprecation message without color. + */ + +function formatPlain (msg, caller, stack) { + var timestamp = new Date().toUTCString() + + var formatted = timestamp + + ' ' + this._namespace + + ' deprecated ' + msg + + // add stack trace + if (this._traced) { + for (var i = 0; i < stack.length; i++) { + formatted += '\n at ' + stack[i].toString() + } + + return formatted + } + + if (caller) { + formatted += ' at ' + formatLocation(caller) + } + + return formatted +} + +/** + * Format deprecation message with color. + */ + +function formatColor (msg, caller, stack) { + var formatted = '\x1b[36;1m' + this._namespace + '\x1b[22;39m' + // bold cyan + ' \x1b[33;1mdeprecated\x1b[22;39m' + // bold yellow + ' \x1b[0m' + msg + '\x1b[39m' // reset + + // add stack trace + if (this._traced) { + for (var i = 0; i < stack.length; i++) { + formatted += '\n \x1b[36mat ' + stack[i].toString() + '\x1b[39m' // cyan + } + + return formatted + } + + if (caller) { + formatted += ' \x1b[36m' + formatLocation(caller) + '\x1b[39m' // cyan + } + + return formatted +} + +/** + * Format call site location. + */ + +function formatLocation (callSite) { + return relative(basePath, callSite[0]) + + ':' + callSite[1] + + ':' + callSite[2] +} + +/** + * Get the stack as array of call sites. + */ + +function getStack () { + var limit = Error.stackTraceLimit + var obj = {} + var prep = Error.prepareStackTrace + + Error.prepareStackTrace = prepareObjectStackTrace + Error.stackTraceLimit = Math.max(10, limit) + + // capture the stack + Error.captureStackTrace(obj) + + // slice this function off the top + var stack = obj.stack.slice(1) + + Error.prepareStackTrace = prep + Error.stackTraceLimit = limit + + return stack +} + +/** + * Capture call site stack from v8. + */ + +function prepareObjectStackTrace (obj, stack) { + return stack +} + +/** + * Return a wrapped function in a deprecation message. + */ + +function wrapfunction (fn, message) { + if (typeof fn !== 'function') { + throw new TypeError('argument fn must be a function') + } + + var args = createArgumentsString(fn.length) + var stack = getStack() + var site = callSiteLocation(stack[1]) + + site.name = fn.name + + // eslint-disable-next-line no-new-func + var deprecatedfn = new Function('fn', 'log', 'deprecate', 'message', 'site', + '"use strict"\n' + + 'return function (' + args + ') {' + + 'log.call(deprecate, message, site)\n' + + 'return fn.apply(this, arguments)\n' + + '}')(fn, log, this, message, site) + + return deprecatedfn +} + +/** + * Wrap property in a deprecation message. + */ + +function wrapproperty (obj, prop, message) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new TypeError('argument obj must be object') + } + + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + + if (!descriptor) { + throw new TypeError('must call property on owner object') + } + + if (!descriptor.configurable) { + throw new TypeError('property must be configurable') + } + + var deprecate = this + var stack = getStack() + var site = callSiteLocation(stack[1]) + + // set site name + site.name = prop + + // convert data descriptor + if ('value' in descriptor) { + descriptor = convertDataDescriptorToAccessor(obj, prop, message) + } + + var get = descriptor.get + var set = descriptor.set + + // wrap getter + if (typeof get === 'function') { + descriptor.get = function getter () { + log.call(deprecate, message, site) + return get.apply(this, arguments) + } + } + + // wrap setter + if (typeof set === 'function') { + descriptor.set = function setter () { + log.call(deprecate, message, site) + return set.apply(this, arguments) + } + } + + Object.defineProperty(obj, prop, descriptor) +} + +/** + * Create DeprecationError for deprecation + */ + +function DeprecationError (namespace, message, stack) { + var error = new Error() + var stackString + + Object.defineProperty(error, 'constructor', { + value: DeprecationError + }) + + Object.defineProperty(error, 'message', { + configurable: true, + enumerable: false, + value: message, + writable: true + }) + + Object.defineProperty(error, 'name', { + enumerable: false, + configurable: true, + value: 'DeprecationError', + writable: true + }) + + Object.defineProperty(error, 'namespace', { + configurable: true, + enumerable: false, + value: namespace, + writable: true + }) + + Object.defineProperty(error, 'stack', { + configurable: true, + enumerable: false, + get: function () { + if (stackString !== undefined) { + return stackString + } + + // prepare stack trace + return (stackString = createStackString.call(this, stack)) + }, + set: function setter (val) { + stackString = val + } + }) + + return error +} diff --git a/backend/node_modules/depd/lib/browser/index.js b/backend/node_modules/depd/lib/browser/index.js new file mode 100644 index 000000000..6be45cc20 --- /dev/null +++ b/backend/node_modules/depd/lib/browser/index.js @@ -0,0 +1,77 @@ +/*! + * depd + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = depd + +/** + * Create deprecate for namespace in caller. + */ + +function depd (namespace) { + if (!namespace) { + throw new TypeError('argument namespace is required') + } + + function deprecate (message) { + // no-op in browser + } + + deprecate._file = undefined + deprecate._ignored = true + deprecate._namespace = namespace + deprecate._traced = false + deprecate._warned = Object.create(null) + + deprecate.function = wrapfunction + deprecate.property = wrapproperty + + return deprecate +} + +/** + * Return a wrapped function in a deprecation message. + * + * This is a no-op version of the wrapper, which does nothing but call + * validation. + */ + +function wrapfunction (fn, message) { + if (typeof fn !== 'function') { + throw new TypeError('argument fn must be a function') + } + + return fn +} + +/** + * Wrap property in a deprecation message. + * + * This is a no-op version of the wrapper, which does nothing but call + * validation. + */ + +function wrapproperty (obj, prop, message) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new TypeError('argument obj must be object') + } + + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + + if (!descriptor) { + throw new TypeError('must call property on owner object') + } + + if (!descriptor.configurable) { + throw new TypeError('property must be configurable') + } +} diff --git a/backend/node_modules/depd/package.json b/backend/node_modules/depd/package.json new file mode 100644 index 000000000..3857e1991 --- /dev/null +++ b/backend/node_modules/depd/package.json @@ -0,0 +1,45 @@ +{ + "name": "depd", + "description": "Deprecate all the things", + "version": "2.0.0", + "author": "Douglas Christopher Wilson ", + "license": "MIT", + "keywords": [ + "deprecate", + "deprecated" + ], + "repository": "dougwilson/nodejs-depd", + "browser": "lib/browser/index.js", + "devDependencies": { + "benchmark": "2.1.4", + "beautify-benchmark": "0.2.4", + "eslint": "5.7.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.14.0", + "eslint-plugin-markdown": "1.0.0-beta.7", + "eslint-plugin-node": "7.0.1", + "eslint-plugin-promise": "4.0.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "mocha": "5.2.0", + "safe-buffer": "5.1.2", + "uid-safe": "2.1.5" + }, + "files": [ + "lib/", + "History.md", + "LICENSE", + "index.js", + "Readme.md" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail test/", + "test-ci": "istanbul cover --print=none node_modules/mocha/bin/_mocha -- --reporter spec test/ && istanbul report lcovonly text-summary", + "test-cov": "istanbul cover --print=none node_modules/mocha/bin/_mocha -- --reporter dot test/ && istanbul report lcov text-summary" + } +} diff --git a/backend/node_modules/destroy/LICENSE b/backend/node_modules/destroy/LICENSE new file mode 100644 index 000000000..0e2c35f0e --- /dev/null +++ b/backend/node_modules/destroy/LICENSE @@ -0,0 +1,23 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com +Copyright (c) 2015-2022 Douglas Christopher Wilson doug@somethingdoug.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/backend/node_modules/destroy/README.md b/backend/node_modules/destroy/README.md new file mode 100644 index 000000000..e7701aee7 --- /dev/null +++ b/backend/node_modules/destroy/README.md @@ -0,0 +1,63 @@ +# destroy + +[![NPM version][npm-image]][npm-url] +[![Build Status][github-actions-ci-image]][github-actions-ci-url] +[![Test coverage][coveralls-image]][coveralls-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] + +Destroy a stream. + +This module is meant to ensure a stream gets destroyed, handling different APIs +and Node.js bugs. + +## API + +```js +var destroy = require('destroy') +``` + +### destroy(stream [, suppress]) + +Destroy the given stream, and optionally suppress any future `error` events. + +In most cases, this is identical to a simple `stream.destroy()` call. The rules +are as follows for a given stream: + + 1. If the `stream` is an instance of `ReadStream`, then call `stream.destroy()` + and add a listener to the `open` event to call `stream.close()` if it is + fired. This is for a Node.js bug that will leak a file descriptor if + `.destroy()` is called before `open`. + 2. If the `stream` is an instance of a zlib stream, then call `stream.destroy()` + and close the underlying zlib handle if open, otherwise call `stream.close()`. + This is for consistency across Node.js versions and a Node.js bug that will + leak a native zlib handle. + 3. If the `stream` is not an instance of `Stream`, then nothing happens. + 4. If the `stream` has a `.destroy()` method, then call it. + +The function returns the `stream` passed in as the argument. + +## Example + +```js +var destroy = require('destroy') + +var fs = require('fs') +var stream = fs.createReadStream('package.json') + +// ... and later +destroy(stream) +``` + +[npm-image]: https://img.shields.io/npm/v/destroy.svg?style=flat-square +[npm-url]: https://npmjs.org/package/destroy +[github-tag]: http://img.shields.io/github/tag/stream-utils/destroy.svg?style=flat-square +[github-url]: https://github.com/stream-utils/destroy/tags +[coveralls-image]: https://img.shields.io/coveralls/stream-utils/destroy.svg?style=flat-square +[coveralls-url]: https://coveralls.io/r/stream-utils/destroy?branch=master +[license-image]: http://img.shields.io/npm/l/destroy.svg?style=flat-square +[license-url]: LICENSE.md +[downloads-image]: http://img.shields.io/npm/dm/destroy.svg?style=flat-square +[downloads-url]: https://npmjs.org/package/destroy +[github-actions-ci-image]: https://img.shields.io/github/workflow/status/stream-utils/destroy/ci/master?label=ci&style=flat-square +[github-actions-ci-url]: https://github.com/stream-utils/destroy/actions/workflows/ci.yml diff --git a/backend/node_modules/destroy/index.js b/backend/node_modules/destroy/index.js new file mode 100644 index 000000000..7fd5c0936 --- /dev/null +++ b/backend/node_modules/destroy/index.js @@ -0,0 +1,209 @@ +/*! + * destroy + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015-2022 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var EventEmitter = require('events').EventEmitter +var ReadStream = require('fs').ReadStream +var Stream = require('stream') +var Zlib = require('zlib') + +/** + * Module exports. + * @public + */ + +module.exports = destroy + +/** + * Destroy the given stream, and optionally suppress any future `error` events. + * + * @param {object} stream + * @param {boolean} suppress + * @public + */ + +function destroy (stream, suppress) { + if (isFsReadStream(stream)) { + destroyReadStream(stream) + } else if (isZlibStream(stream)) { + destroyZlibStream(stream) + } else if (hasDestroy(stream)) { + stream.destroy() + } + + if (isEventEmitter(stream) && suppress) { + stream.removeAllListeners('error') + stream.addListener('error', noop) + } + + return stream +} + +/** + * Destroy a ReadStream. + * + * @param {object} stream + * @private + */ + +function destroyReadStream (stream) { + stream.destroy() + + if (typeof stream.close === 'function') { + // node.js core bug work-around + stream.on('open', onOpenClose) + } +} + +/** + * Close a Zlib stream. + * + * Zlib streams below Node.js 4.5.5 have a buggy implementation + * of .close() when zlib encountered an error. + * + * @param {object} stream + * @private + */ + +function closeZlibStream (stream) { + if (stream._hadError === true) { + var prop = stream._binding === null + ? '_binding' + : '_handle' + + stream[prop] = { + close: function () { this[prop] = null } + } + } + + stream.close() +} + +/** + * Destroy a Zlib stream. + * + * Zlib streams don't have a destroy function in Node.js 6. On top of that + * simply calling destroy on a zlib stream in Node.js 8+ will result in a + * memory leak. So until that is fixed, we need to call both close AND destroy. + * + * PR to fix memory leak: https://github.com/nodejs/node/pull/23734 + * + * In Node.js 6+8, it's important that destroy is called before close as the + * stream would otherwise emit the error 'zlib binding closed'. + * + * @param {object} stream + * @private + */ + +function destroyZlibStream (stream) { + if (typeof stream.destroy === 'function') { + // node.js core bug work-around + // istanbul ignore if: node.js 0.8 + if (stream._binding) { + // node.js < 0.10.0 + stream.destroy() + if (stream._processing) { + stream._needDrain = true + stream.once('drain', onDrainClearBinding) + } else { + stream._binding.clear() + } + } else if (stream._destroy && stream._destroy !== Stream.Transform.prototype._destroy) { + // node.js >= 12, ^11.1.0, ^10.15.1 + stream.destroy() + } else if (stream._destroy && typeof stream.close === 'function') { + // node.js 7, 8 + stream.destroyed = true + stream.close() + } else { + // fallback + // istanbul ignore next + stream.destroy() + } + } else if (typeof stream.close === 'function') { + // node.js < 8 fallback + closeZlibStream(stream) + } +} + +/** + * Determine if stream has destroy. + * @private + */ + +function hasDestroy (stream) { + return stream instanceof Stream && + typeof stream.destroy === 'function' +} + +/** + * Determine if val is EventEmitter. + * @private + */ + +function isEventEmitter (val) { + return val instanceof EventEmitter +} + +/** + * Determine if stream is fs.ReadStream stream. + * @private + */ + +function isFsReadStream (stream) { + return stream instanceof ReadStream +} + +/** + * Determine if stream is Zlib stream. + * @private + */ + +function isZlibStream (stream) { + return stream instanceof Zlib.Gzip || + stream instanceof Zlib.Gunzip || + stream instanceof Zlib.Deflate || + stream instanceof Zlib.DeflateRaw || + stream instanceof Zlib.Inflate || + stream instanceof Zlib.InflateRaw || + stream instanceof Zlib.Unzip +} + +/** + * No-op function. + * @private + */ + +function noop () {} + +/** + * On drain handler to clear binding. + * @private + */ + +// istanbul ignore next: node.js 0.8 +function onDrainClearBinding () { + this._binding.clear() +} + +/** + * On open handler to close stream. + * @private + */ + +function onOpenClose () { + if (typeof this.fd === 'number') { + // actually close down the fd + this.close() + } +} diff --git a/backend/node_modules/destroy/package.json b/backend/node_modules/destroy/package.json new file mode 100644 index 000000000..c85e43837 --- /dev/null +++ b/backend/node_modules/destroy/package.json @@ -0,0 +1,48 @@ +{ + "name": "destroy", + "description": "destroy a stream if possible", + "version": "1.2.0", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com", + "twitter": "https://twitter.com/jongleberry" + }, + "contributors": [ + "Douglas Christopher Wilson " + ], + "license": "MIT", + "repository": "stream-utils/destroy", + "devDependencies": { + "eslint": "7.32.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.25.4", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "5.2.0", + "eslint-plugin-standard": "4.1.0", + "mocha": "9.2.2", + "nyc": "15.1.0" + }, + "engines": { + "node": ">= 0.8", + "npm": "1.2.8000 || >= 1.4.16" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec", + "test-ci": "nyc --reporter=lcovonly --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + }, + "files": [ + "index.js", + "LICENSE" + ], + "keywords": [ + "stream", + "streams", + "destroy", + "cleanup", + "leak", + "fd" + ] +} diff --git a/backend/node_modules/detect-libc/LICENSE b/backend/node_modules/detect-libc/LICENSE new file mode 100644 index 000000000..8dada3eda --- /dev/null +++ b/backend/node_modules/detect-libc/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "{}" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright {yyyy} {name of copyright owner} + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/backend/node_modules/detect-libc/README.md b/backend/node_modules/detect-libc/README.md new file mode 100644 index 000000000..23212fdd7 --- /dev/null +++ b/backend/node_modules/detect-libc/README.md @@ -0,0 +1,163 @@ +# detect-libc + +Node.js module to detect details of the C standard library (libc) +implementation provided by a given Linux system. + +Currently supports detection of GNU glibc and MUSL libc. + +Provides asychronous and synchronous functions for the +family (e.g. `glibc`, `musl`) and version (e.g. `1.23`, `1.2.3`). + +The version numbers of libc implementations +are not guaranteed to be semver-compliant. + +For previous v1.x releases, please see the +[v1](https://github.com/lovell/detect-libc/tree/v1) branch. + +## Install + +```sh +npm install detect-libc +``` + +## API + +### GLIBC + +```ts +const GLIBC: string = 'glibc'; +``` + +A String constant containing the value `glibc`. + +### MUSL + +```ts +const MUSL: string = 'musl'; +``` + +A String constant containing the value `musl`. + +### family + +```ts +function family(): Promise; +``` + +Resolves asychronously with: + +* `glibc` or `musl` when the libc family can be determined +* `null` when the libc family cannot be determined +* `null` when run on a non-Linux platform + +```js +const { family, GLIBC, MUSL } = require('detect-libc'); + +switch (await family()) { + case GLIBC: ... + case MUSL: ... + case null: ... +} +``` + +### familySync + +```ts +function familySync(): string | null; +``` + +Synchronous version of `family()`. + +```js +const { familySync, GLIBC, MUSL } = require('detect-libc'); + +switch (familySync()) { + case GLIBC: ... + case MUSL: ... + case null: ... +} +``` + +### version + +```ts +function version(): Promise; +``` + +Resolves asychronously with: + +* The version when it can be determined +* `null` when the libc family cannot be determined +* `null` when run on a non-Linux platform + +```js +const { version } = require('detect-libc'); + +const v = await version(); +if (v) { + const [major, minor, patch] = v.split('.'); +} +``` + +### versionSync + +```ts +function versionSync(): string | null; +``` + +Synchronous version of `version()`. + +```js +const { versionSync } = require('detect-libc'); + +const v = versionSync(); +if (v) { + const [major, minor, patch] = v.split('.'); +} +``` + +### isNonGlibcLinux + +```ts +function isNonGlibcLinux(): Promise; +``` + +Resolves asychronously with: + +* `false` when the libc family is `glibc` +* `true` when the libc family is not `glibc` +* `false` when run on a non-Linux platform + +```js +const { isNonGlibcLinux } = require('detect-libc'); + +if (await isNonGlibcLinux()) { ... } +``` + +### isNonGlibcLinuxSync + +```ts +function isNonGlibcLinuxSync(): boolean; +``` + +Synchronous version of `isNonGlibcLinux()`. + +```js +const { isNonGlibcLinuxSync } = require('detect-libc'); + +if (isNonGlibcLinuxSync()) { ... } +``` + +## Licensing + +Copyright 2017 Lovell Fuller and others. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at [http://www.apache.org/licenses/LICENSE-2.0](http://www.apache.org/licenses/LICENSE-2.0.html) + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. diff --git a/backend/node_modules/detect-libc/index.d.ts b/backend/node_modules/detect-libc/index.d.ts new file mode 100644 index 000000000..4c0fb2b0a --- /dev/null +++ b/backend/node_modules/detect-libc/index.d.ts @@ -0,0 +1,14 @@ +// Copyright 2017 Lovell Fuller and others. +// SPDX-License-Identifier: Apache-2.0 + +export const GLIBC: 'glibc'; +export const MUSL: 'musl'; + +export function family(): Promise; +export function familySync(): string | null; + +export function isNonGlibcLinux(): Promise; +export function isNonGlibcLinuxSync(): boolean; + +export function version(): Promise; +export function versionSync(): string | null; diff --git a/backend/node_modules/detect-libc/lib/detect-libc.js b/backend/node_modules/detect-libc/lib/detect-libc.js new file mode 100644 index 000000000..fe4998704 --- /dev/null +++ b/backend/node_modules/detect-libc/lib/detect-libc.js @@ -0,0 +1,267 @@ +// Copyright 2017 Lovell Fuller and others. +// SPDX-License-Identifier: Apache-2.0 + +'use strict'; + +const childProcess = require('child_process'); +const { isLinux, getReport } = require('./process'); +const { LDD_PATH, readFile, readFileSync } = require('./filesystem'); + +let cachedFamilyFilesystem; +let cachedVersionFilesystem; + +const command = 'getconf GNU_LIBC_VERSION 2>&1 || true; ldd --version 2>&1 || true'; +let commandOut = ''; + +const safeCommand = () => { + if (!commandOut) { + return new Promise((resolve) => { + childProcess.exec(command, (err, out) => { + commandOut = err ? ' ' : out; + resolve(commandOut); + }); + }); + } + return commandOut; +}; + +const safeCommandSync = () => { + if (!commandOut) { + try { + commandOut = childProcess.execSync(command, { encoding: 'utf8' }); + } catch (_err) { + commandOut = ' '; + } + } + return commandOut; +}; + +/** + * A String constant containing the value `glibc`. + * @type {string} + * @public + */ +const GLIBC = 'glibc'; + +/** + * A Regexp constant to get the GLIBC Version. + * @type {string} + */ +const RE_GLIBC_VERSION = /LIBC[a-z0-9 \-).]*?(\d+\.\d+)/i; + +/** + * A String constant containing the value `musl`. + * @type {string} + * @public + */ +const MUSL = 'musl'; + +const isFileMusl = (f) => f.includes('libc.musl-') || f.includes('ld-musl-'); + +const familyFromReport = () => { + const report = getReport(); + if (report.header && report.header.glibcVersionRuntime) { + return GLIBC; + } + if (Array.isArray(report.sharedObjects)) { + if (report.sharedObjects.some(isFileMusl)) { + return MUSL; + } + } + return null; +}; + +const familyFromCommand = (out) => { + const [getconf, ldd1] = out.split(/[\r\n]+/); + if (getconf && getconf.includes(GLIBC)) { + return GLIBC; + } + if (ldd1 && ldd1.includes(MUSL)) { + return MUSL; + } + return null; +}; + +const getFamilyFromLddContent = (content) => { + if (content.includes('musl')) { + return MUSL; + } + if (content.includes('GNU C Library')) { + return GLIBC; + } + return null; +}; + +const familyFromFilesystem = async () => { + if (cachedFamilyFilesystem !== undefined) { + return cachedFamilyFilesystem; + } + cachedFamilyFilesystem = null; + try { + const lddContent = await readFile(LDD_PATH); + cachedFamilyFilesystem = getFamilyFromLddContent(lddContent); + } catch (e) {} + return cachedFamilyFilesystem; +}; + +const familyFromFilesystemSync = () => { + if (cachedFamilyFilesystem !== undefined) { + return cachedFamilyFilesystem; + } + cachedFamilyFilesystem = null; + try { + const lddContent = readFileSync(LDD_PATH); + cachedFamilyFilesystem = getFamilyFromLddContent(lddContent); + } catch (e) {} + return cachedFamilyFilesystem; +}; + +/** + * Resolves with the libc family when it can be determined, `null` otherwise. + * @returns {Promise} + */ +const family = async () => { + let family = null; + if (isLinux()) { + family = await familyFromFilesystem(); + if (!family) { + family = familyFromReport(); + } + if (!family) { + const out = await safeCommand(); + family = familyFromCommand(out); + } + } + return family; +}; + +/** + * Returns the libc family when it can be determined, `null` otherwise. + * @returns {?string} + */ +const familySync = () => { + let family = null; + if (isLinux()) { + family = familyFromFilesystemSync(); + if (!family) { + family = familyFromReport(); + } + if (!family) { + const out = safeCommandSync(); + family = familyFromCommand(out); + } + } + return family; +}; + +/** + * Resolves `true` only when the platform is Linux and the libc family is not `glibc`. + * @returns {Promise} + */ +const isNonGlibcLinux = async () => isLinux() && await family() !== GLIBC; + +/** + * Returns `true` only when the platform is Linux and the libc family is not `glibc`. + * @returns {boolean} + */ +const isNonGlibcLinuxSync = () => isLinux() && familySync() !== GLIBC; + +const versionFromFilesystem = async () => { + if (cachedVersionFilesystem !== undefined) { + return cachedVersionFilesystem; + } + cachedVersionFilesystem = null; + try { + const lddContent = await readFile(LDD_PATH); + const versionMatch = lddContent.match(RE_GLIBC_VERSION); + if (versionMatch) { + cachedVersionFilesystem = versionMatch[1]; + } + } catch (e) {} + return cachedVersionFilesystem; +}; + +const versionFromFilesystemSync = () => { + if (cachedVersionFilesystem !== undefined) { + return cachedVersionFilesystem; + } + cachedVersionFilesystem = null; + try { + const lddContent = readFileSync(LDD_PATH); + const versionMatch = lddContent.match(RE_GLIBC_VERSION); + if (versionMatch) { + cachedVersionFilesystem = versionMatch[1]; + } + } catch (e) {} + return cachedVersionFilesystem; +}; + +const versionFromReport = () => { + const report = getReport(); + if (report.header && report.header.glibcVersionRuntime) { + return report.header.glibcVersionRuntime; + } + return null; +}; + +const versionSuffix = (s) => s.trim().split(/\s+/)[1]; + +const versionFromCommand = (out) => { + const [getconf, ldd1, ldd2] = out.split(/[\r\n]+/); + if (getconf && getconf.includes(GLIBC)) { + return versionSuffix(getconf); + } + if (ldd1 && ldd2 && ldd1.includes(MUSL)) { + return versionSuffix(ldd2); + } + return null; +}; + +/** + * Resolves with the libc version when it can be determined, `null` otherwise. + * @returns {Promise} + */ +const version = async () => { + let version = null; + if (isLinux()) { + version = await versionFromFilesystem(); + if (!version) { + version = versionFromReport(); + } + if (!version) { + const out = await safeCommand(); + version = versionFromCommand(out); + } + } + return version; +}; + +/** + * Returns the libc version when it can be determined, `null` otherwise. + * @returns {?string} + */ +const versionSync = () => { + let version = null; + if (isLinux()) { + version = versionFromFilesystemSync(); + if (!version) { + version = versionFromReport(); + } + if (!version) { + const out = safeCommandSync(); + version = versionFromCommand(out); + } + } + return version; +}; + +module.exports = { + GLIBC, + MUSL, + family, + familySync, + isNonGlibcLinux, + isNonGlibcLinuxSync, + version, + versionSync +}; diff --git a/backend/node_modules/detect-libc/lib/filesystem.js b/backend/node_modules/detect-libc/lib/filesystem.js new file mode 100644 index 000000000..de7e007e3 --- /dev/null +++ b/backend/node_modules/detect-libc/lib/filesystem.js @@ -0,0 +1,41 @@ +// Copyright 2017 Lovell Fuller and others. +// SPDX-License-Identifier: Apache-2.0 + +'use strict'; + +const fs = require('fs'); + +/** + * The path where we can find the ldd + */ +const LDD_PATH = '/usr/bin/ldd'; + +/** + * Read the content of a file synchronous + * + * @param {string} path + * @returns {string} + */ +const readFileSync = (path) => fs.readFileSync(path, 'utf-8'); + +/** + * Read the content of a file + * + * @param {string} path + * @returns {Promise} + */ +const readFile = (path) => new Promise((resolve, reject) => { + fs.readFile(path, 'utf-8', (err, data) => { + if (err) { + reject(err); + } else { + resolve(data); + } + }); +}); + +module.exports = { + LDD_PATH, + readFileSync, + readFile +}; diff --git a/backend/node_modules/detect-libc/lib/process.js b/backend/node_modules/detect-libc/lib/process.js new file mode 100644 index 000000000..ee78ad261 --- /dev/null +++ b/backend/node_modules/detect-libc/lib/process.js @@ -0,0 +1,24 @@ +// Copyright 2017 Lovell Fuller and others. +// SPDX-License-Identifier: Apache-2.0 + +'use strict'; + +const isLinux = () => process.platform === 'linux'; + +let report = null; +const getReport = () => { + if (!report) { + /* istanbul ignore next */ + if (isLinux() && process.report) { + const orig = process.report.excludeNetwork; + process.report.excludeNetwork = true; + report = process.report.getReport(); + process.report.excludeNetwork = orig; + } else { + report = {}; + } + } + return report; +}; + +module.exports = { isLinux, getReport }; diff --git a/backend/node_modules/detect-libc/package.json b/backend/node_modules/detect-libc/package.json new file mode 100644 index 000000000..d5adec310 --- /dev/null +++ b/backend/node_modules/detect-libc/package.json @@ -0,0 +1,40 @@ +{ + "name": "detect-libc", + "version": "2.0.3", + "description": "Node.js module to detect the C standard library (libc) implementation family and version", + "main": "lib/detect-libc.js", + "files": [ + "lib/", + "index.d.ts" + ], + "scripts": { + "test": "semistandard && nyc --reporter=text --check-coverage --branches=100 ava test/unit.js", + "bench": "node benchmark/detect-libc", + "bench:calls": "node benchmark/call-familySync.js && sleep 1 && node benchmark/call-isNonGlibcLinuxSync.js && sleep 1 && node benchmark/call-versionSync.js" + }, + "repository": { + "type": "git", + "url": "git://github.com/lovell/detect-libc" + }, + "keywords": [ + "libc", + "glibc", + "musl" + ], + "author": "Lovell Fuller ", + "contributors": [ + "Niklas Salmoukas ", + "Vinícius Lourenço " + ], + "license": "Apache-2.0", + "devDependencies": { + "ava": "^2.4.0", + "benchmark": "^2.1.4", + "nyc": "^15.1.0", + "proxyquire": "^2.1.3", + "semistandard": "^14.2.3" + }, + "engines": { + "node": ">=8" + } +} diff --git a/backend/node_modules/dotenv/CHANGELOG.md b/backend/node_modules/dotenv/CHANGELOG.md new file mode 100644 index 000000000..e3e40d6e9 --- /dev/null +++ b/backend/node_modules/dotenv/CHANGELOG.md @@ -0,0 +1,488 @@ +# Changelog + +All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines. + +## [Unreleased](https://github.com/motdotla/dotenv/compare/v16.4.7...master) + +## [16.4.7](https://github.com/motdotla/dotenv/compare/v16.4.6...v16.4.7 (2024-12-03) + +### Changed + +- Ignore `.tap` folder when publishing. (oops, sorry about that everyone. - @motdotla) [#848](https://github.com/motdotla/dotenv/pull/848) + +## [16.4.6](https://github.com/motdotla/dotenv/compare/v16.4.5...v16.4.6) (2024-12-02) + +### Changed + +- Clean up stale dev dependencies [#847](https://github.com/motdotla/dotenv/pull/847) +- Various README updates clarifying usage and alternative solutions using [dotenvx](https://github.com/dotenvx/dotenvx) + +## [16.4.5](https://github.com/motdotla/dotenv/compare/v16.4.4...v16.4.5) (2024-02-19) + +### Changed + +- 🐞 Fix recent regression when using `path` option. return to historical behavior: do not attempt to auto find `.env` if `path` set. (regression was introduced in `16.4.3`) [#814](https://github.com/motdotla/dotenv/pull/814) + +## [16.4.4](https://github.com/motdotla/dotenv/compare/v16.4.3...v16.4.4) (2024-02-13) + +### Changed + +- 🐞 Replaced chaining operator `?.` with old school `&&` (fixing node 12 failures) [#812](https://github.com/motdotla/dotenv/pull/812) + +## [16.4.3](https://github.com/motdotla/dotenv/compare/v16.4.2...v16.4.3) (2024-02-12) + +### Changed + +- Fixed processing of multiple files in `options.path` [#805](https://github.com/motdotla/dotenv/pull/805) + +## [16.4.2](https://github.com/motdotla/dotenv/compare/v16.4.1...v16.4.2) (2024-02-10) + +### Changed + +- Changed funding link in package.json to [`dotenvx.com`](https://dotenvx.com) + +## [16.4.1](https://github.com/motdotla/dotenv/compare/v16.4.0...v16.4.1) (2024-01-24) + +- Patch support for array as `path` option [#797](https://github.com/motdotla/dotenv/pull/797) + +## [16.4.0](https://github.com/motdotla/dotenv/compare/v16.3.2...v16.4.0) (2024-01-23) + +- Add `error.code` to error messages around `.env.vault` decryption handling [#795](https://github.com/motdotla/dotenv/pull/795) +- Add ability to find `.env.vault` file when filename(s) passed as an array [#784](https://github.com/motdotla/dotenv/pull/784) + +## [16.3.2](https://github.com/motdotla/dotenv/compare/v16.3.1...v16.3.2) (2024-01-18) + +### Added + +- Add debug message when no encoding set [#735](https://github.com/motdotla/dotenv/pull/735) + +### Changed + +- Fix output typing for `populate` [#792](https://github.com/motdotla/dotenv/pull/792) +- Use subarray instead of slice [#793](https://github.com/motdotla/dotenv/pull/793) + +## [16.3.1](https://github.com/motdotla/dotenv/compare/v16.3.0...v16.3.1) (2023-06-17) + +### Added + +- Add missing type definitions for `processEnv` and `DOTENV_KEY` options. [#756](https://github.com/motdotla/dotenv/pull/756) + +## [16.3.0](https://github.com/motdotla/dotenv/compare/v16.2.0...v16.3.0) (2023-06-16) + +### Added + +- Optionally pass `DOTENV_KEY` to options rather than relying on `process.env.DOTENV_KEY`. Defaults to `process.env.DOTENV_KEY` [#754](https://github.com/motdotla/dotenv/pull/754) + +## [16.2.0](https://github.com/motdotla/dotenv/compare/v16.1.4...v16.2.0) (2023-06-15) + +### Added + +- Optionally write to your own target object rather than `process.env`. Defaults to `process.env`. [#753](https://github.com/motdotla/dotenv/pull/753) +- Add import type URL to types file [#751](https://github.com/motdotla/dotenv/pull/751) + +## [16.1.4](https://github.com/motdotla/dotenv/compare/v16.1.3...v16.1.4) (2023-06-04) + +### Added + +- Added `.github/` to `.npmignore` [#747](https://github.com/motdotla/dotenv/pull/747) + +## [16.1.3](https://github.com/motdotla/dotenv/compare/v16.1.2...v16.1.3) (2023-05-31) + +### Removed + +- Removed `browser` keys for `path`, `os`, and `crypto` in package.json. These were set to false incorrectly as of 16.1. Instead, if using dotenv on the front-end make sure to include polyfills for `path`, `os`, and `crypto`. [node-polyfill-webpack-plugin](https://github.com/Richienb/node-polyfill-webpack-plugin) provides these. + +## [16.1.2](https://github.com/motdotla/dotenv/compare/v16.1.1...v16.1.2) (2023-05-31) + +### Changed + +- Exposed private function `_configDotenv` as `configDotenv`. [#744](https://github.com/motdotla/dotenv/pull/744) + +## [16.1.1](https://github.com/motdotla/dotenv/compare/v16.1.0...v16.1.1) (2023-05-30) + +### Added + +- Added type definition for `decrypt` function + +### Changed + +- Fixed `{crypto: false}` in `packageJson.browser` + +## [16.1.0](https://github.com/motdotla/dotenv/compare/v16.0.3...v16.1.0) (2023-05-30) + +### Added + +- Add `populate` convenience method [#733](https://github.com/motdotla/dotenv/pull/733) +- Accept URL as path option [#720](https://github.com/motdotla/dotenv/pull/720) +- Add dotenv to `npm fund` command +- Spanish language README [#698](https://github.com/motdotla/dotenv/pull/698) +- Add `.env.vault` support. 🎉 ([#730](https://github.com/motdotla/dotenv/pull/730)) + +ℹ️ `.env.vault` extends the `.env` file format standard with a localized encrypted vault file. Package it securely with your production code deploys. It's cloud agnostic so that you can deploy your secrets anywhere – without [risky third-party integrations](https://techcrunch.com/2023/01/05/circleci-breach/). [read more](https://github.com/motdotla/dotenv#-deploying) + +### Changed + +- Fixed "cannot resolve 'fs'" error on tools like Replit [#693](https://github.com/motdotla/dotenv/pull/693) + +## [16.0.3](https://github.com/motdotla/dotenv/compare/v16.0.2...v16.0.3) (2022-09-29) + +### Changed + +- Added library version to debug logs ([#682](https://github.com/motdotla/dotenv/pull/682)) + +## [16.0.2](https://github.com/motdotla/dotenv/compare/v16.0.1...v16.0.2) (2022-08-30) + +### Added + +- Export `env-options.js` and `cli-options.js` in package.json for use with downstream [dotenv-expand](https://github.com/motdotla/dotenv-expand) module + +## [16.0.1](https://github.com/motdotla/dotenv/compare/v16.0.0...v16.0.1) (2022-05-10) + +### Changed + +- Minor README clarifications +- Development ONLY: updated devDependencies as recommended for development only security risks ([#658](https://github.com/motdotla/dotenv/pull/658)) + +## [16.0.0](https://github.com/motdotla/dotenv/compare/v15.0.1...v16.0.0) (2022-02-02) + +### Added + +- _Breaking:_ Backtick support 🎉 ([#615](https://github.com/motdotla/dotenv/pull/615)) + +If you had values containing the backtick character, please quote those values with either single or double quotes. + +## [15.0.1](https://github.com/motdotla/dotenv/compare/v15.0.0...v15.0.1) (2022-02-02) + +### Changed + +- Properly parse empty single or double quoted values 🐞 ([#614](https://github.com/motdotla/dotenv/pull/614)) + +## [15.0.0](https://github.com/motdotla/dotenv/compare/v14.3.2...v15.0.0) (2022-01-31) + +`v15.0.0` is a major new release with some important breaking changes. + +### Added + +- _Breaking:_ Multiline parsing support (just works. no need for the flag.) + +### Changed + +- _Breaking:_ `#` marks the beginning of a comment (UNLESS the value is wrapped in quotes. Please update your `.env` files to wrap in quotes any values containing `#`. For example: `SECRET_HASH="something-with-a-#-hash"`). + +..Understandably, (as some teams have noted) this is tedious to do across the entire team. To make it less tedious, we recommend using [dotenv cli](https://github.com/dotenv-org/cli) going forward. It's an optional plugin that will keep your `.env` files in sync between machines, environments, or team members. + +### Removed + +- _Breaking:_ Remove multiline option (just works out of the box now. no need for the flag.) + +## [14.3.2](https://github.com/motdotla/dotenv/compare/v14.3.1...v14.3.2) (2022-01-25) + +### Changed + +- Preserve backwards compatibility on values containing `#` 🐞 ([#603](https://github.com/motdotla/dotenv/pull/603)) + +## [14.3.1](https://github.com/motdotla/dotenv/compare/v14.3.0...v14.3.1) (2022-01-25) + +### Changed + +- Preserve backwards compatibility on exports by re-introducing the prior in-place exports 🐞 ([#606](https://github.com/motdotla/dotenv/pull/606)) + +## [14.3.0](https://github.com/motdotla/dotenv/compare/v14.2.0...v14.3.0) (2022-01-24) + +### Added + +- Add `multiline` option 🎉 ([#486](https://github.com/motdotla/dotenv/pull/486)) + +## [14.2.0](https://github.com/motdotla/dotenv/compare/v14.1.1...v14.2.0) (2022-01-17) + +### Added + +- Add `dotenv_config_override` cli option +- Add `DOTENV_CONFIG_OVERRIDE` command line env option + +## [14.1.1](https://github.com/motdotla/dotenv/compare/v14.1.0...v14.1.1) (2022-01-17) + +### Added + +- Add React gotcha to FAQ on README + +## [14.1.0](https://github.com/motdotla/dotenv/compare/v14.0.1...v14.1.0) (2022-01-17) + +### Added + +- Add `override` option 🎉 ([#595](https://github.com/motdotla/dotenv/pull/595)) + +## [14.0.1](https://github.com/motdotla/dotenv/compare/v14.0.0...v14.0.1) (2022-01-16) + +### Added + +- Log error on failure to load `.env` file ([#594](https://github.com/motdotla/dotenv/pull/594)) + +## [14.0.0](https://github.com/motdotla/dotenv/compare/v13.0.1...v14.0.0) (2022-01-16) + +### Added + +- _Breaking:_ Support inline comments for the parser 🎉 ([#568](https://github.com/motdotla/dotenv/pull/568)) + +## [13.0.1](https://github.com/motdotla/dotenv/compare/v13.0.0...v13.0.1) (2022-01-16) + +### Changed + +* Hide comments and newlines from debug output ([#404](https://github.com/motdotla/dotenv/pull/404)) + +## [13.0.0](https://github.com/motdotla/dotenv/compare/v12.0.4...v13.0.0) (2022-01-16) + +### Added + +* _Breaking:_ Add type file for `config.js` ([#539](https://github.com/motdotla/dotenv/pull/539)) + +## [12.0.4](https://github.com/motdotla/dotenv/compare/v12.0.3...v12.0.4) (2022-01-16) + +### Changed + +* README updates +* Minor order adjustment to package json format + +## [12.0.3](https://github.com/motdotla/dotenv/compare/v12.0.2...v12.0.3) (2022-01-15) + +### Changed + +* Simplified jsdoc for consistency across editors + +## [12.0.2](https://github.com/motdotla/dotenv/compare/v12.0.1...v12.0.2) (2022-01-15) + +### Changed + +* Improve embedded jsdoc type documentation + +## [12.0.1](https://github.com/motdotla/dotenv/compare/v12.0.0...v12.0.1) (2022-01-15) + +### Changed + +* README updates and clarifications + +## [12.0.0](https://github.com/motdotla/dotenv/compare/v11.0.0...v12.0.0) (2022-01-15) + +### Removed + +- _Breaking:_ drop support for Flow static type checker ([#584](https://github.com/motdotla/dotenv/pull/584)) + +### Changed + +- Move types/index.d.ts to lib/main.d.ts ([#585](https://github.com/motdotla/dotenv/pull/585)) +- Typescript cleanup ([#587](https://github.com/motdotla/dotenv/pull/587)) +- Explicit typescript inclusion in package.json ([#566](https://github.com/motdotla/dotenv/pull/566)) + +## [11.0.0](https://github.com/motdotla/dotenv/compare/v10.0.0...v11.0.0) (2022-01-11) + +### Changed + +- _Breaking:_ drop support for Node v10 ([#558](https://github.com/motdotla/dotenv/pull/558)) +- Patch debug option ([#550](https://github.com/motdotla/dotenv/pull/550)) + +## [10.0.0](https://github.com/motdotla/dotenv/compare/v9.0.2...v10.0.0) (2021-05-20) + +### Added + +- Add generic support to parse function +- Allow for import "dotenv/config.js" +- Add support to resolve home directory in path via ~ + +## [9.0.2](https://github.com/motdotla/dotenv/compare/v9.0.1...v9.0.2) (2021-05-10) + +### Changed + +- Support windows newlines with debug mode + +## [9.0.1](https://github.com/motdotla/dotenv/compare/v9.0.0...v9.0.1) (2021-05-08) + +### Changed + +- Updates to README + +## [9.0.0](https://github.com/motdotla/dotenv/compare/v8.6.0...v9.0.0) (2021-05-05) + +### Changed + +- _Breaking:_ drop support for Node v8 + +## [8.6.0](https://github.com/motdotla/dotenv/compare/v8.5.1...v8.6.0) (2021-05-05) + +### Added + +- define package.json in exports + +## [8.5.1](https://github.com/motdotla/dotenv/compare/v8.5.0...v8.5.1) (2021-05-05) + +### Changed + +- updated dev dependencies via npm audit + +## [8.5.0](https://github.com/motdotla/dotenv/compare/v8.4.0...v8.5.0) (2021-05-05) + +### Added + +- allow for `import "dotenv/config"` + +## [8.4.0](https://github.com/motdotla/dotenv/compare/v8.3.0...v8.4.0) (2021-05-05) + +### Changed + +- point to exact types file to work with VS Code + +## [8.3.0](https://github.com/motdotla/dotenv/compare/v8.2.0...v8.3.0) (2021-05-05) + +### Changed + +- _Breaking:_ drop support for Node v8 (mistake to be released as minor bump. later bumped to 9.0.0. see above.) + +## [8.2.0](https://github.com/motdotla/dotenv/compare/v8.1.0...v8.2.0) (2019-10-16) + +### Added + +- TypeScript types + +## [8.1.0](https://github.com/motdotla/dotenv/compare/v8.0.0...v8.1.0) (2019-08-18) + +### Changed + +- _Breaking:_ drop support for Node v6 ([#392](https://github.com/motdotla/dotenv/issues/392)) + +# [8.0.0](https://github.com/motdotla/dotenv/compare/v7.0.0...v8.0.0) (2019-05-02) + +### Changed + +- _Breaking:_ drop support for Node v6 ([#302](https://github.com/motdotla/dotenv/issues/392)) + +## [7.0.0] - 2019-03-12 + +### Fixed + +- Fix removing unbalanced quotes ([#376](https://github.com/motdotla/dotenv/pull/376)) + +### Removed + +- Removed `load` alias for `config` for consistency throughout code and documentation. + +## [6.2.0] - 2018-12-03 + +### Added + +- Support preload configuration via environment variables ([#351](https://github.com/motdotla/dotenv/issues/351)) + +## [6.1.0] - 2018-10-08 + +### Added + +- `debug` option for `config` and `parse` methods will turn on logging + +## [6.0.0] - 2018-06-02 + +### Changed + +- _Breaking:_ drop support for Node v4 ([#304](https://github.com/motdotla/dotenv/pull/304)) + +## [5.0.0] - 2018-01-29 + +### Added + +- Testing against Node v8 and v9 +- Documentation on trim behavior of values +- Documentation on how to use with `import` + +### Changed + +- _Breaking_: default `path` is now `path.resolve(process.cwd(), '.env')` +- _Breaking_: does not write over keys already in `process.env` if the key has a falsy value +- using `const` and `let` instead of `var` + +### Removed + +- Testing against Node v7 + +## [4.0.0] - 2016-12-23 + +### Changed + +- Return Object with parsed content or error instead of false ([#165](https://github.com/motdotla/dotenv/pull/165)). + +### Removed + +- `verbose` option removed in favor of returning result. + +## [3.0.0] - 2016-12-20 + +### Added + +- `verbose` option will log any error messages. Off by default. +- parses email addresses correctly +- allow importing config method directly in ES6 + +### Changed + +- Suppress error messages by default ([#154](https://github.com/motdotla/dotenv/pull/154)) +- Ignoring more files for NPM to make package download smaller + +### Fixed + +- False positive test due to case-sensitive variable ([#124](https://github.com/motdotla/dotenv/pull/124)) + +### Removed + +- `silent` option removed in favor of `verbose` + +## [2.0.0] - 2016-01-20 + +### Added + +- CHANGELOG to ["make it easier for users and contributors to see precisely what notable changes have been made between each release"](http://keepachangelog.com/). Linked to from README +- LICENSE to be more explicit about what was defined in `package.json`. Linked to from README +- Testing nodejs v4 on travis-ci +- added examples of how to use dotenv in different ways +- return parsed object on success rather than boolean true + +### Changed + +- README has shorter description not referencing ruby gem since we don't have or want feature parity + +### Removed + +- Variable expansion and escaping so environment variables are encouraged to be fully orthogonal + +## [1.2.0] - 2015-06-20 + +### Added + +- Preload hook to require dotenv without including it in your code + +### Changed + +- clarified license to be "BSD-2-Clause" in `package.json` + +### Fixed + +- retain spaces in string vars + +## [1.1.0] - 2015-03-31 + +### Added + +- Silent option to silence `console.log` when `.env` missing + +## [1.0.0] - 2015-03-13 + +### Removed + +- support for multiple `.env` files. should always use one `.env` file for the current environment + +[7.0.0]: https://github.com/motdotla/dotenv/compare/v6.2.0...v7.0.0 +[6.2.0]: https://github.com/motdotla/dotenv/compare/v6.1.0...v6.2.0 +[6.1.0]: https://github.com/motdotla/dotenv/compare/v6.0.0...v6.1.0 +[6.0.0]: https://github.com/motdotla/dotenv/compare/v5.0.0...v6.0.0 +[5.0.0]: https://github.com/motdotla/dotenv/compare/v4.0.0...v5.0.0 +[4.0.0]: https://github.com/motdotla/dotenv/compare/v3.0.0...v4.0.0 +[3.0.0]: https://github.com/motdotla/dotenv/compare/v2.0.0...v3.0.0 +[2.0.0]: https://github.com/motdotla/dotenv/compare/v1.2.0...v2.0.0 +[1.2.0]: https://github.com/motdotla/dotenv/compare/v1.1.0...v1.2.0 +[1.1.0]: https://github.com/motdotla/dotenv/compare/v1.0.0...v1.1.0 +[1.0.0]: https://github.com/motdotla/dotenv/compare/v0.4.0...v1.0.0 diff --git a/backend/node_modules/dotenv/LICENSE b/backend/node_modules/dotenv/LICENSE new file mode 100644 index 000000000..c430ad8bd --- /dev/null +++ b/backend/node_modules/dotenv/LICENSE @@ -0,0 +1,23 @@ +Copyright (c) 2015, Scott Motte +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are met: + +* Redistributions of source code must retain the above copyright notice, this + list of conditions and the following disclaimer. + +* Redistributions in binary form must reproduce the above copyright notice, + this list of conditions and the following disclaimer in the documentation + and/or other materials provided with the distribution. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE +FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL +DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR +SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER +CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, +OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/backend/node_modules/dotenv/README-es.md b/backend/node_modules/dotenv/README-es.md new file mode 100644 index 000000000..154c13909 --- /dev/null +++ b/backend/node_modules/dotenv/README-es.md @@ -0,0 +1,448 @@ +
+🎉 announcing dotenvx. run anywhere, multi-environment, encrypted envs. +
+ +  + +
+ +

+ + Dotenv es apoyado por la comunidad. + +

+Gracias espaciales a: +
+
+ +
+ Warp +
+ Warp es una rápida e impresionante terminal basada en Rust, reinventado para funcionar como una aplicación moderna. +
+ Haga más en la CLI con edición de texto real, resultado básado en bloques, y busqueda de comandos de IA. +
+
+
+ +
+ Retool +
+ Retool ayuda a los desarrolladores a crear software interno personalizado, como aplicaciones CRUD y paneles de administración, realmente rápido. +
+ Construya Interfaces de Usuario de forma visual con componentes flexibles, conéctese a cualquier fuente de datos, y escriba lógica de negocio en JavaScript. +
+
+
+ +
+ WorkOS +
+ Su Apliación, Lista para la Empresa. +
+ Agrega Inicio de Sesión Único, Autenticación Multi-Factor, y mucho más, en minutos en lugar de meses. +
+
+
+
+
+
+
+ +
+ +# dotenv [![NPM version](https://img.shields.io/npm/v/dotenv.svg?style=flat-square)](https://www.npmjs.com/package/dotenv) + +dotenv + +Dotenv es un módulo de dependencia cero que carga las variables de entorno desde un archivo `.env` en [`process.env`](https://nodejs.org/docs/latest/api/process.html#process_process_env). El almacenamiento de la configuración del entorno separado del código está basado en la metodología [The Twelve-Factor App](http://12factor.net/config). + +[![js-standard-style](https://img.shields.io/badge/code%20style-standard-brightgreen.svg?style=flat-square)](https://github.com/feross/standard) +[![LICENSE](https://img.shields.io/github/license/motdotla/dotenv.svg)](LICENSE) + +## Instalación + +```bash +# instalación local (recomendado) +npm install dotenv --save +``` + +O installación con yarn? `yarn add dotenv` + +## Uso + +Cree un archivo `.env` en la raíz de su proyecto: + +```dosini +S3_BUCKET="YOURS3BUCKET" +SECRET_KEY="YOURSECRETKEYGOESHERE" +``` + +Tan prónto como sea posible en su aplicación, importe y configure dotenv: + +```javascript +require('dotenv').config() +console.log(process.env) // elimine esto después que haya confirmado que esta funcionando +``` + +.. o usa ES6? + +```javascript +import * as dotenv from 'dotenv' // vea en https://github.com/motdotla/dotenv#como-uso-dotenv-con-import +// REVISAR LINK DE REFERENCIA DE IMPORTACIÓN +dotenv.config() +import express from 'express' +``` + +Eso es todo. `process.env` ahora tiene las claves y los valores que definiste en tu archivo `.env`: + +```javascript +require('dotenv').config() + +... + +s3.getBucketCors({Bucket: process.env.S3_BUCKET}, function(err, data) {}) +``` + +### Valores multilínea + +Si necesita variables de varias líneas, por ejemplo, claves privadas, ahora se admiten en la versión (`>= v15.0.0`) con saltos de línea: + +```dosini +PRIVATE_KEY="-----BEGIN RSA PRIVATE KEY----- +... +Kh9NV... +... +-----END RSA PRIVATE KEY-----" +``` + +Alternativamente, puede usar comillas dobles y usar el carácter `\n`: + +```dosini +PRIVATE_KEY="-----BEGIN RSA PRIVATE KEY-----\nKh9NV...\n-----END RSA PRIVATE KEY-----\n" +``` + +### Comentarios + +Los comentarios pueden ser agregados en tu archivo o en la misma línea: + +```dosini +# This is a comment +SECRET_KEY=YOURSECRETKEYGOESHERE # comment +SECRET_HASH="something-with-a-#-hash" +``` + +Los comentarios comienzan donde existe un `#`, entonces, si su valor contiene un `#`, enciérrelo entre comillas. Este es un cambio importante desde la versión `>= v15.0.0` en adelante. + +### Análisis + +El motor que analiza el contenido de su archivo que contiene variables de entorno está disponible para su uso. Este Acepta una Cadena o un Búfer y devolverá un Objeto con las claves y los valores analizados. + +```javascript +const dotenv = require('dotenv') +const buf = Buffer.from('BASICO=basico') +const config = dotenv.parse(buf) // devolverá un objeto +console.log(typeof config, config) // objeto { BASICO : 'basico' } +``` + +### Precarga + +Puede usar el `--require` (`-r`) [opción de línea de comando](https://nodejs.org/api/cli.html#-r---require-module) para precargar dotenv. Al hacer esto, no necesita requerir ni cargar dotnev en el código de su aplicación. + +```bash +$ node -r dotenv/config tu_script.js +``` + +Las opciones de configuración a continuación se admiten como argumentos de línea de comandos en el formato `dotenv_config_